mirror of https://github.com/vector-im/riot-web
Merge branch 'develop' into rte-fixes2
Conflicts: package.json src/autocomplete/CommandProvider.js src/autocomplete/UserProvider.js src/components/structures/RoomView.js src/components/structures/UserSettings.js src/components/views/rooms/MessageComposerInput.jspull/21833/head
commit
87609582c6
|
@ -0,0 +1,184 @@
|
||||||
|
# autogenerated file: run scripts/generate-eslint-error-ignore-file to update.
|
||||||
|
|
||||||
|
src/AddThreepid.js
|
||||||
|
src/async-components/views/dialogs/EncryptedEventDialog.js
|
||||||
|
src/autocomplete/AutocompleteProvider.js
|
||||||
|
src/autocomplete/Autocompleter.js
|
||||||
|
src/autocomplete/Components.js
|
||||||
|
src/autocomplete/DuckDuckGoProvider.js
|
||||||
|
src/autocomplete/EmojiProvider.js
|
||||||
|
src/autocomplete/RoomProvider.js
|
||||||
|
src/autocomplete/UserProvider.js
|
||||||
|
src/Avatar.js
|
||||||
|
src/BasePlatform.js
|
||||||
|
src/CallHandler.js
|
||||||
|
src/component-index.js
|
||||||
|
src/components/structures/ContextualMenu.js
|
||||||
|
src/components/structures/CreateRoom.js
|
||||||
|
src/components/structures/FilePanel.js
|
||||||
|
src/components/structures/InteractiveAuth.js
|
||||||
|
src/components/structures/LoggedInView.js
|
||||||
|
src/components/structures/login/ForgotPassword.js
|
||||||
|
src/components/structures/login/Login.js
|
||||||
|
src/components/structures/login/PostRegistration.js
|
||||||
|
src/components/structures/login/Registration.js
|
||||||
|
src/components/structures/MessagePanel.js
|
||||||
|
src/components/structures/NotificationPanel.js
|
||||||
|
src/components/structures/RoomStatusBar.js
|
||||||
|
src/components/structures/RoomView.js
|
||||||
|
src/components/structures/ScrollPanel.js
|
||||||
|
src/components/structures/TimelinePanel.js
|
||||||
|
src/components/structures/UploadBar.js
|
||||||
|
src/components/views/avatars/BaseAvatar.js
|
||||||
|
src/components/views/avatars/MemberAvatar.js
|
||||||
|
src/components/views/avatars/RoomAvatar.js
|
||||||
|
src/components/views/create_room/CreateRoomButton.js
|
||||||
|
src/components/views/create_room/Presets.js
|
||||||
|
src/components/views/create_room/RoomAlias.js
|
||||||
|
src/components/views/dialogs/ChatCreateOrReuseDialog.js
|
||||||
|
src/components/views/dialogs/ChatInviteDialog.js
|
||||||
|
src/components/views/dialogs/DeactivateAccountDialog.js
|
||||||
|
src/components/views/dialogs/InteractiveAuthDialog.js
|
||||||
|
src/components/views/dialogs/SetMxIdDialog.js
|
||||||
|
src/components/views/dialogs/UnknownDeviceDialog.js
|
||||||
|
src/components/views/elements/AccessibleButton.js
|
||||||
|
src/components/views/elements/ActionButton.js
|
||||||
|
src/components/views/elements/AddressSelector.js
|
||||||
|
src/components/views/elements/AddressTile.js
|
||||||
|
src/components/views/elements/CreateRoomButton.js
|
||||||
|
src/components/views/elements/DeviceVerifyButtons.js
|
||||||
|
src/components/views/elements/DirectorySearchBox.js
|
||||||
|
src/components/views/elements/Dropdown.js
|
||||||
|
src/components/views/elements/EditableText.js
|
||||||
|
src/components/views/elements/EditableTextContainer.js
|
||||||
|
src/components/views/elements/HomeButton.js
|
||||||
|
src/components/views/elements/LanguageDropdown.js
|
||||||
|
src/components/views/elements/MemberEventListSummary.js
|
||||||
|
src/components/views/elements/PowerSelector.js
|
||||||
|
src/components/views/elements/ProgressBar.js
|
||||||
|
src/components/views/elements/RoomDirectoryButton.js
|
||||||
|
src/components/views/elements/SettingsButton.js
|
||||||
|
src/components/views/elements/StartChatButton.js
|
||||||
|
src/components/views/elements/TintableSvg.js
|
||||||
|
src/components/views/elements/TruncatedList.js
|
||||||
|
src/components/views/elements/UserSelector.js
|
||||||
|
src/components/views/login/CaptchaForm.js
|
||||||
|
src/components/views/login/CasLogin.js
|
||||||
|
src/components/views/login/CountryDropdown.js
|
||||||
|
src/components/views/login/CustomServerDialog.js
|
||||||
|
src/components/views/login/InteractiveAuthEntryComponents.js
|
||||||
|
src/components/views/login/LoginHeader.js
|
||||||
|
src/components/views/login/PasswordLogin.js
|
||||||
|
src/components/views/login/RegistrationForm.js
|
||||||
|
src/components/views/login/ServerConfig.js
|
||||||
|
src/components/views/messages/MAudioBody.js
|
||||||
|
src/components/views/messages/MessageEvent.js
|
||||||
|
src/components/views/messages/MFileBody.js
|
||||||
|
src/components/views/messages/MImageBody.js
|
||||||
|
src/components/views/messages/MVideoBody.js
|
||||||
|
src/components/views/messages/RoomAvatarEvent.js
|
||||||
|
src/components/views/messages/TextualBody.js
|
||||||
|
src/components/views/messages/TextualEvent.js
|
||||||
|
src/components/views/room_settings/AliasSettings.js
|
||||||
|
src/components/views/room_settings/ColorSettings.js
|
||||||
|
src/components/views/room_settings/UrlPreviewSettings.js
|
||||||
|
src/components/views/rooms/Autocomplete.js
|
||||||
|
src/components/views/rooms/AuxPanel.js
|
||||||
|
src/components/views/rooms/EntityTile.js
|
||||||
|
src/components/views/rooms/EventTile.js
|
||||||
|
src/components/views/rooms/LinkPreviewWidget.js
|
||||||
|
src/components/views/rooms/MemberDeviceInfo.js
|
||||||
|
src/components/views/rooms/MemberInfo.js
|
||||||
|
src/components/views/rooms/MemberList.js
|
||||||
|
src/components/views/rooms/MemberTile.js
|
||||||
|
src/components/views/rooms/MessageComposer.js
|
||||||
|
src/components/views/rooms/MessageComposerInput.js
|
||||||
|
src/components/views/rooms/MessageComposerInputOld.js
|
||||||
|
src/components/views/rooms/PresenceLabel.js
|
||||||
|
src/components/views/rooms/ReadReceiptMarker.js
|
||||||
|
src/components/views/rooms/RoomHeader.js
|
||||||
|
src/components/views/rooms/RoomList.js
|
||||||
|
src/components/views/rooms/RoomNameEditor.js
|
||||||
|
src/components/views/rooms/RoomPreviewBar.js
|
||||||
|
src/components/views/rooms/RoomSettings.js
|
||||||
|
src/components/views/rooms/RoomTile.js
|
||||||
|
src/components/views/rooms/RoomTopicEditor.js
|
||||||
|
src/components/views/rooms/SearchableEntityList.js
|
||||||
|
src/components/views/rooms/SearchResultTile.js
|
||||||
|
src/components/views/rooms/TabCompleteBar.js
|
||||||
|
src/components/views/rooms/TopUnreadMessagesBar.js
|
||||||
|
src/components/views/rooms/UserTile.js
|
||||||
|
src/components/views/settings/AddPhoneNumber.js
|
||||||
|
src/components/views/settings/ChangeAvatar.js
|
||||||
|
src/components/views/settings/ChangeDisplayName.js
|
||||||
|
src/components/views/settings/ChangePassword.js
|
||||||
|
src/components/views/settings/DevicesPanel.js
|
||||||
|
src/components/views/settings/DevicesPanelEntry.js
|
||||||
|
src/components/views/settings/EnableNotificationsButton.js
|
||||||
|
src/components/views/voip/CallView.js
|
||||||
|
src/components/views/voip/IncomingCallBox.js
|
||||||
|
src/components/views/voip/VideoFeed.js
|
||||||
|
src/components/views/voip/VideoView.js
|
||||||
|
src/ContentMessages.js
|
||||||
|
src/createRoom.js
|
||||||
|
src/DateUtils.js
|
||||||
|
src/email.js
|
||||||
|
src/Entities.js
|
||||||
|
src/extend.js
|
||||||
|
src/HtmlUtils.js
|
||||||
|
src/ImageUtils.js
|
||||||
|
src/Invite.js
|
||||||
|
src/languageHandler.js
|
||||||
|
src/linkify-matrix.js
|
||||||
|
src/Login.js
|
||||||
|
src/Markdown.js
|
||||||
|
src/MatrixClientPeg.js
|
||||||
|
src/Modal.js
|
||||||
|
src/Notifier.js
|
||||||
|
src/ObjectUtils.js
|
||||||
|
src/PasswordReset.js
|
||||||
|
src/PlatformPeg.js
|
||||||
|
src/Presence.js
|
||||||
|
src/ratelimitedfunc.js
|
||||||
|
src/Resend.js
|
||||||
|
src/RichText.js
|
||||||
|
src/Roles.js
|
||||||
|
src/RoomListSorter.js
|
||||||
|
src/RoomNotifs.js
|
||||||
|
src/Rooms.js
|
||||||
|
src/ScalarAuthClient.js
|
||||||
|
src/ScalarMessaging.js
|
||||||
|
src/SdkConfig.js
|
||||||
|
src/Skinner.js
|
||||||
|
src/SlashCommands.js
|
||||||
|
src/stores/LifecycleStore.js
|
||||||
|
src/TabComplete.js
|
||||||
|
src/TabCompleteEntries.js
|
||||||
|
src/TextForEvent.js
|
||||||
|
src/Tinter.js
|
||||||
|
src/UiEffects.js
|
||||||
|
src/Unread.js
|
||||||
|
src/UserActivity.js
|
||||||
|
src/utils/DecryptFile.js
|
||||||
|
src/utils/DMRoomMap.js
|
||||||
|
src/utils/FormattingUtils.js
|
||||||
|
src/utils/MultiInviter.js
|
||||||
|
src/utils/Receipt.js
|
||||||
|
src/Velociraptor.js
|
||||||
|
src/VelocityBounce.js
|
||||||
|
src/WhoIsTyping.js
|
||||||
|
src/wrappers/WithMatrixClient.js
|
||||||
|
test/all-tests.js
|
||||||
|
test/components/structures/login/Registration-test.js
|
||||||
|
test/components/structures/MessagePanel-test.js
|
||||||
|
test/components/structures/ScrollPanel-test.js
|
||||||
|
test/components/structures/TimelinePanel-test.js
|
||||||
|
test/components/stub-component.js
|
||||||
|
test/components/views/dialogs/InteractiveAuthDialog-test.js
|
||||||
|
test/components/views/elements/MemberEventListSummary-test.js
|
||||||
|
test/components/views/login/RegistrationForm-test.js
|
||||||
|
test/components/views/rooms/MessageComposerInput-test.js
|
||||||
|
test/mock-clock.js
|
||||||
|
test/skinned-sdk.js
|
||||||
|
test/stores/RoomViewStore-test.js
|
||||||
|
test/test-utils.js
|
|
@ -9,3 +9,8 @@ npm-debug.log
|
||||||
|
|
||||||
# test reports created by karma
|
# test reports created by karma
|
||||||
/karma-reports
|
/karma-reports
|
||||||
|
|
||||||
|
/.idea
|
||||||
|
/src/component-index.js
|
||||||
|
|
||||||
|
.DS_Store
|
||||||
|
|
|
@ -9,11 +9,16 @@ set -ev
|
||||||
RIOT_WEB_DIR=riot-web
|
RIOT_WEB_DIR=riot-web
|
||||||
REACT_SDK_DIR=`pwd`
|
REACT_SDK_DIR=`pwd`
|
||||||
|
|
||||||
git clone --depth=1 --branch develop https://github.com/vector-im/riot-web.git \
|
curbranch="${TRAVIS_PULL_REQUEST_BRANCH:-$TRAVIS_BRANCH}"
|
||||||
|
echo "Determined branch to be $curbranch"
|
||||||
|
|
||||||
|
git clone https://github.com/vector-im/riot-web.git \
|
||||||
"$RIOT_WEB_DIR"
|
"$RIOT_WEB_DIR"
|
||||||
|
|
||||||
cd "$RIOT_WEB_DIR"
|
cd "$RIOT_WEB_DIR"
|
||||||
|
|
||||||
|
git checkout "$curbranch" || git checkout develop
|
||||||
|
|
||||||
mkdir node_modules
|
mkdir node_modules
|
||||||
npm install
|
npm install
|
||||||
|
|
||||||
|
|
|
@ -5,5 +5,4 @@ install:
|
||||||
- npm install
|
- npm install
|
||||||
- (cd node_modules/matrix-js-sdk && npm install)
|
- (cd node_modules/matrix-js-sdk && npm install)
|
||||||
script:
|
script:
|
||||||
- npm run test
|
./scripts/travis.sh
|
||||||
- ./.travis-test-riot.sh
|
|
||||||
|
|
621
CHANGELOG.md
621
CHANGELOG.md
|
@ -1,3 +1,624 @@
|
||||||
|
Changes in [0.9.7](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.7) (2017-06-22)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.6...v0.9.7)
|
||||||
|
|
||||||
|
* Fix ability to invite users with caps in their user IDs
|
||||||
|
[\#1128](https://github.com/matrix-org/matrix-react-sdk/pull/1128)
|
||||||
|
* Fix another race with first-sync
|
||||||
|
[\#1131](https://github.com/matrix-org/matrix-react-sdk/pull/1131)
|
||||||
|
* Make the indexeddb worker script work again
|
||||||
|
[\#1132](https://github.com/matrix-org/matrix-react-sdk/pull/1132)
|
||||||
|
* Use the web worker when clearing js-sdk stores
|
||||||
|
[\#1133](https://github.com/matrix-org/matrix-react-sdk/pull/1133)
|
||||||
|
|
||||||
|
Changes in [0.9.6](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.6) (2017-06-20)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.5...v0.9.6)
|
||||||
|
|
||||||
|
* Fix infinite spinner on email registration
|
||||||
|
[\#1120](https://github.com/matrix-org/matrix-react-sdk/pull/1120)
|
||||||
|
* Translate help promots in room list
|
||||||
|
[\#1121](https://github.com/matrix-org/matrix-react-sdk/pull/1121)
|
||||||
|
* Internationalise the drop targets
|
||||||
|
[\#1122](https://github.com/matrix-org/matrix-react-sdk/pull/1122)
|
||||||
|
* Fix another infinite spin on register
|
||||||
|
[\#1124](https://github.com/matrix-org/matrix-react-sdk/pull/1124)
|
||||||
|
|
||||||
|
|
||||||
|
Changes in [0.9.5](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.5) (2017-06-19)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.5-rc.2...v0.9.5)
|
||||||
|
|
||||||
|
* Don't peek when creating a room
|
||||||
|
[\#1113](https://github.com/matrix-org/matrix-react-sdk/pull/1113)
|
||||||
|
* More translations & translation fixes
|
||||||
|
|
||||||
|
|
||||||
|
Changes in [0.9.5-rc.2](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.5-rc.2) (2017-06-16)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.5-rc.1...v0.9.5-rc.2)
|
||||||
|
|
||||||
|
* Avoid getting stuck in a loop in CAS login
|
||||||
|
[\#1109](https://github.com/matrix-org/matrix-react-sdk/pull/1109)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1101](https://github.com/matrix-org/matrix-react-sdk/pull/1101)
|
||||||
|
* Correctly inspect state when rejecting invite
|
||||||
|
[\#1108](https://github.com/matrix-org/matrix-react-sdk/pull/1108)
|
||||||
|
* Make sure to pass the roomAlias to the preview header if we have it
|
||||||
|
[\#1107](https://github.com/matrix-org/matrix-react-sdk/pull/1107)
|
||||||
|
* Make sure captcha disappears when container does
|
||||||
|
[\#1106](https://github.com/matrix-org/matrix-react-sdk/pull/1106)
|
||||||
|
* Fix URL previews
|
||||||
|
[\#1105](https://github.com/matrix-org/matrix-react-sdk/pull/1105)
|
||||||
|
|
||||||
|
Changes in [0.9.5-rc.1](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.5-rc.1) (2017-06-15)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.4...v0.9.5-rc.1)
|
||||||
|
|
||||||
|
* Groundwork for tests including a teamserver login
|
||||||
|
[\#1098](https://github.com/matrix-org/matrix-react-sdk/pull/1098)
|
||||||
|
* Show a spinner when accepting an invite and waitingForRoom
|
||||||
|
[\#1100](https://github.com/matrix-org/matrix-react-sdk/pull/1100)
|
||||||
|
* Display a spinner until new room object after join success
|
||||||
|
[\#1099](https://github.com/matrix-org/matrix-react-sdk/pull/1099)
|
||||||
|
* Luke/attempt fix peeking regression
|
||||||
|
[\#1097](https://github.com/matrix-org/matrix-react-sdk/pull/1097)
|
||||||
|
* Show correct text in set email password dialog (2)
|
||||||
|
[\#1096](https://github.com/matrix-org/matrix-react-sdk/pull/1096)
|
||||||
|
* Don't create a guest login if user went to /login
|
||||||
|
[\#1092](https://github.com/matrix-org/matrix-react-sdk/pull/1092)
|
||||||
|
* Give password confirmation correct title, description
|
||||||
|
[\#1095](https://github.com/matrix-org/matrix-react-sdk/pull/1095)
|
||||||
|
* Make enter submit change password form
|
||||||
|
[\#1094](https://github.com/matrix-org/matrix-react-sdk/pull/1094)
|
||||||
|
* When not specified, remove roomAlias state in RoomViewStore
|
||||||
|
[\#1093](https://github.com/matrix-org/matrix-react-sdk/pull/1093)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1091](https://github.com/matrix-org/matrix-react-sdk/pull/1091)
|
||||||
|
* Fixed pagination infinite loop caused by long messages
|
||||||
|
[\#1045](https://github.com/matrix-org/matrix-react-sdk/pull/1045)
|
||||||
|
* Clear persistent storage on login and logout
|
||||||
|
[\#1085](https://github.com/matrix-org/matrix-react-sdk/pull/1085)
|
||||||
|
* DM guessing: prefer oldest joined member
|
||||||
|
[\#1087](https://github.com/matrix-org/matrix-react-sdk/pull/1087)
|
||||||
|
* Ask for email address after setting password for the first time
|
||||||
|
[\#1090](https://github.com/matrix-org/matrix-react-sdk/pull/1090)
|
||||||
|
* i18n for setting password flow
|
||||||
|
[\#1089](https://github.com/matrix-org/matrix-react-sdk/pull/1089)
|
||||||
|
* remove mx_filterFlipColor from verified e2e icon so its not purple :/
|
||||||
|
[\#1088](https://github.com/matrix-org/matrix-react-sdk/pull/1088)
|
||||||
|
* width and height must be int otherwise synapse cries
|
||||||
|
[\#1083](https://github.com/matrix-org/matrix-react-sdk/pull/1083)
|
||||||
|
* remove RoomViewStore listener from MatrixChat on unmount
|
||||||
|
[\#1084](https://github.com/matrix-org/matrix-react-sdk/pull/1084)
|
||||||
|
* Add script to copy translations between files
|
||||||
|
[\#1082](https://github.com/matrix-org/matrix-react-sdk/pull/1082)
|
||||||
|
* Only process user_directory response if it's for the current query
|
||||||
|
[\#1081](https://github.com/matrix-org/matrix-react-sdk/pull/1081)
|
||||||
|
* Fix regressions with starting a 1-1.
|
||||||
|
[\#1080](https://github.com/matrix-org/matrix-react-sdk/pull/1080)
|
||||||
|
* allow forcing of TURN
|
||||||
|
[\#1079](https://github.com/matrix-org/matrix-react-sdk/pull/1079)
|
||||||
|
* Remove a bunch of dead code from react-sdk
|
||||||
|
[\#1077](https://github.com/matrix-org/matrix-react-sdk/pull/1077)
|
||||||
|
* Improve error logging/reporting in megolm import/export
|
||||||
|
[\#1061](https://github.com/matrix-org/matrix-react-sdk/pull/1061)
|
||||||
|
* Delinting
|
||||||
|
[\#1064](https://github.com/matrix-org/matrix-react-sdk/pull/1064)
|
||||||
|
* Show reason for a call hanging up unexpectedly.
|
||||||
|
[\#1071](https://github.com/matrix-org/matrix-react-sdk/pull/1071)
|
||||||
|
* Add reason for ban in room settings
|
||||||
|
[\#1072](https://github.com/matrix-org/matrix-react-sdk/pull/1072)
|
||||||
|
* adds mx_filterFlipColor so that the dark theme will invert this image
|
||||||
|
[\#1070](https://github.com/matrix-org/matrix-react-sdk/pull/1070)
|
||||||
|
|
||||||
|
Changes in [0.9.4](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.4) (2017-06-14)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.3...v0.9.4)
|
||||||
|
|
||||||
|
* Ask for email address after setting password for the first time
|
||||||
|
[\#1090](https://github.com/matrix-org/matrix-react-sdk/pull/1090)
|
||||||
|
* DM guessing: prefer oldest joined member
|
||||||
|
[\#1087](https://github.com/matrix-org/matrix-react-sdk/pull/1087)
|
||||||
|
* More translations
|
||||||
|
|
||||||
|
Changes in [0.9.3](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.3) (2017-06-12)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.3-rc.2...v0.9.3)
|
||||||
|
|
||||||
|
* Add more translations & fix some existing ones
|
||||||
|
|
||||||
|
Changes in [0.9.3-rc.2](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.3-rc.2) (2017-06-09)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.3-rc.1...v0.9.3-rc.2)
|
||||||
|
|
||||||
|
* Fix flux dependency
|
||||||
|
* Fix translations on conference call bar
|
||||||
|
|
||||||
|
Changes in [0.9.3-rc.1](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.3-rc.1) (2017-06-09)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.2...v0.9.3-rc.1)
|
||||||
|
|
||||||
|
* When ChatCreateOrReuseDialog is cancelled by a guest, go home
|
||||||
|
[\#1069](https://github.com/matrix-org/matrix-react-sdk/pull/1069)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1065](https://github.com/matrix-org/matrix-react-sdk/pull/1065)
|
||||||
|
* Goto /home when forgetting the last room
|
||||||
|
[\#1067](https://github.com/matrix-org/matrix-react-sdk/pull/1067)
|
||||||
|
* Default to home page when settings is closed
|
||||||
|
[\#1066](https://github.com/matrix-org/matrix-react-sdk/pull/1066)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1063](https://github.com/matrix-org/matrix-react-sdk/pull/1063)
|
||||||
|
* When joining, use a roomAlias if we have it
|
||||||
|
[\#1062](https://github.com/matrix-org/matrix-react-sdk/pull/1062)
|
||||||
|
* Control currently viewed event via RoomViewStore
|
||||||
|
[\#1058](https://github.com/matrix-org/matrix-react-sdk/pull/1058)
|
||||||
|
* Better error messages for login
|
||||||
|
[\#1060](https://github.com/matrix-org/matrix-react-sdk/pull/1060)
|
||||||
|
* Add remaining translations
|
||||||
|
[\#1056](https://github.com/matrix-org/matrix-react-sdk/pull/1056)
|
||||||
|
* Added button that copies code to clipboard
|
||||||
|
[\#1040](https://github.com/matrix-org/matrix-react-sdk/pull/1040)
|
||||||
|
* de-lint MegolmExportEncryption + test
|
||||||
|
[\#1059](https://github.com/matrix-org/matrix-react-sdk/pull/1059)
|
||||||
|
* Better RTL support
|
||||||
|
[\#1021](https://github.com/matrix-org/matrix-react-sdk/pull/1021)
|
||||||
|
* make mels emoji capable
|
||||||
|
[\#1057](https://github.com/matrix-org/matrix-react-sdk/pull/1057)
|
||||||
|
* Make travis check for lint on files which are clean to start with
|
||||||
|
[\#1055](https://github.com/matrix-org/matrix-react-sdk/pull/1055)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1053](https://github.com/matrix-org/matrix-react-sdk/pull/1053)
|
||||||
|
* Add some logging around switching rooms
|
||||||
|
[\#1054](https://github.com/matrix-org/matrix-react-sdk/pull/1054)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1052](https://github.com/matrix-org/matrix-react-sdk/pull/1052)
|
||||||
|
* Use user_directory endpoint to populate ChatInviteDialog
|
||||||
|
[\#1050](https://github.com/matrix-org/matrix-react-sdk/pull/1050)
|
||||||
|
* Various Analytics changes/fixes/improvements
|
||||||
|
[\#1046](https://github.com/matrix-org/matrix-react-sdk/pull/1046)
|
||||||
|
* Use an arrow function to allow `this`
|
||||||
|
[\#1051](https://github.com/matrix-org/matrix-react-sdk/pull/1051)
|
||||||
|
* New guest access
|
||||||
|
[\#937](https://github.com/matrix-org/matrix-react-sdk/pull/937)
|
||||||
|
* Translate src/components/structures
|
||||||
|
[\#1048](https://github.com/matrix-org/matrix-react-sdk/pull/1048)
|
||||||
|
* Cancel 'join room' action if 'log in' is clicked
|
||||||
|
[\#1049](https://github.com/matrix-org/matrix-react-sdk/pull/1049)
|
||||||
|
* fix copy and paste derp and rip out unused imports
|
||||||
|
[\#1015](https://github.com/matrix-org/matrix-react-sdk/pull/1015)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1042](https://github.com/matrix-org/matrix-react-sdk/pull/1042)
|
||||||
|
* Reset 'first sync' flag / promise on log in
|
||||||
|
[\#1041](https://github.com/matrix-org/matrix-react-sdk/pull/1041)
|
||||||
|
* Remove DM-guessing code (again)
|
||||||
|
[\#1036](https://github.com/matrix-org/matrix-react-sdk/pull/1036)
|
||||||
|
* Cancel deferred actions
|
||||||
|
[\#1039](https://github.com/matrix-org/matrix-react-sdk/pull/1039)
|
||||||
|
* Merge develop, add i18n for SetMxIdDialog
|
||||||
|
[\#1034](https://github.com/matrix-org/matrix-react-sdk/pull/1034)
|
||||||
|
* Defer an intention for creating a room
|
||||||
|
[\#1038](https://github.com/matrix-org/matrix-react-sdk/pull/1038)
|
||||||
|
* Fix 'create room' button
|
||||||
|
[\#1037](https://github.com/matrix-org/matrix-react-sdk/pull/1037)
|
||||||
|
* Always show the spinner during the first sync
|
||||||
|
[\#1033](https://github.com/matrix-org/matrix-react-sdk/pull/1033)
|
||||||
|
* Only view welcome user if we are not looking at a room
|
||||||
|
[\#1032](https://github.com/matrix-org/matrix-react-sdk/pull/1032)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1030](https://github.com/matrix-org/matrix-react-sdk/pull/1030)
|
||||||
|
* Keep deferred actions for view_user_settings and view_create_chat
|
||||||
|
[\#1031](https://github.com/matrix-org/matrix-react-sdk/pull/1031)
|
||||||
|
* Don't do a deferred start chat if user is welcome user
|
||||||
|
[\#1029](https://github.com/matrix-org/matrix-react-sdk/pull/1029)
|
||||||
|
* Introduce state `peekLoading` to avoid collision with `roomLoading`
|
||||||
|
[\#1028](https://github.com/matrix-org/matrix-react-sdk/pull/1028)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1016](https://github.com/matrix-org/matrix-react-sdk/pull/1016)
|
||||||
|
* Fix accepting a 3pid invite
|
||||||
|
[\#1013](https://github.com/matrix-org/matrix-react-sdk/pull/1013)
|
||||||
|
* Propagate room join errors to the UI
|
||||||
|
[\#1007](https://github.com/matrix-org/matrix-react-sdk/pull/1007)
|
||||||
|
* Implement /user/@userid:domain?action=chat
|
||||||
|
[\#1006](https://github.com/matrix-org/matrix-react-sdk/pull/1006)
|
||||||
|
* Show People/Rooms emptySubListTip even when total rooms !== 0
|
||||||
|
[\#967](https://github.com/matrix-org/matrix-react-sdk/pull/967)
|
||||||
|
* Fix to show the correct room
|
||||||
|
[\#995](https://github.com/matrix-org/matrix-react-sdk/pull/995)
|
||||||
|
* Remove cachedPassword from localStorage on_logged_out
|
||||||
|
[\#977](https://github.com/matrix-org/matrix-react-sdk/pull/977)
|
||||||
|
* Add /start to show the setMxId above HomePage
|
||||||
|
[\#964](https://github.com/matrix-org/matrix-react-sdk/pull/964)
|
||||||
|
* Allow pressing Enter to submit setMxId
|
||||||
|
[\#961](https://github.com/matrix-org/matrix-react-sdk/pull/961)
|
||||||
|
* add login link to SetMxIdDialog
|
||||||
|
[\#954](https://github.com/matrix-org/matrix-react-sdk/pull/954)
|
||||||
|
* Block user settings with view_set_mxid
|
||||||
|
[\#936](https://github.com/matrix-org/matrix-react-sdk/pull/936)
|
||||||
|
* Show "Something went wrong!" when errcode undefined
|
||||||
|
[\#935](https://github.com/matrix-org/matrix-react-sdk/pull/935)
|
||||||
|
* Reset store state when logging out
|
||||||
|
[\#930](https://github.com/matrix-org/matrix-react-sdk/pull/930)
|
||||||
|
* Set the displayname to the mxid once PWLU
|
||||||
|
[\#933](https://github.com/matrix-org/matrix-react-sdk/pull/933)
|
||||||
|
* Fix view_next_room, view_previous_room and view_indexed_room
|
||||||
|
[\#929](https://github.com/matrix-org/matrix-react-sdk/pull/929)
|
||||||
|
* Use RVS to indicate "joining" when setting a mxid
|
||||||
|
[\#928](https://github.com/matrix-org/matrix-react-sdk/pull/928)
|
||||||
|
* Don't show notif nag bar if guest
|
||||||
|
[\#932](https://github.com/matrix-org/matrix-react-sdk/pull/932)
|
||||||
|
* Show "Password" instead of "New Password"
|
||||||
|
[\#927](https://github.com/matrix-org/matrix-react-sdk/pull/927)
|
||||||
|
* Remove warm-fuzzy after setting mxid
|
||||||
|
[\#926](https://github.com/matrix-org/matrix-react-sdk/pull/926)
|
||||||
|
* Allow teamServerConfig to be missing
|
||||||
|
[\#925](https://github.com/matrix-org/matrix-react-sdk/pull/925)
|
||||||
|
* Remove GuestWarningBar
|
||||||
|
[\#923](https://github.com/matrix-org/matrix-react-sdk/pull/923)
|
||||||
|
* Make left panel better for new users (mk III)
|
||||||
|
[\#924](https://github.com/matrix-org/matrix-react-sdk/pull/924)
|
||||||
|
* Implement default welcome page and allow custom URL /w config
|
||||||
|
[\#922](https://github.com/matrix-org/matrix-react-sdk/pull/922)
|
||||||
|
* Implement a store for RoomView
|
||||||
|
[\#921](https://github.com/matrix-org/matrix-react-sdk/pull/921)
|
||||||
|
* Add prop to toggle whether new password input is autoFocused
|
||||||
|
[\#915](https://github.com/matrix-org/matrix-react-sdk/pull/915)
|
||||||
|
* Implement warm-fuzzy success dialog for SetMxIdDialog
|
||||||
|
[\#905](https://github.com/matrix-org/matrix-react-sdk/pull/905)
|
||||||
|
* Write some tests for the RTS UI
|
||||||
|
[\#893](https://github.com/matrix-org/matrix-react-sdk/pull/893)
|
||||||
|
* Make confirmation optional on ChangePassword
|
||||||
|
[\#890](https://github.com/matrix-org/matrix-react-sdk/pull/890)
|
||||||
|
* Remove "Current Password" input if mx_pass exists
|
||||||
|
[\#881](https://github.com/matrix-org/matrix-react-sdk/pull/881)
|
||||||
|
* Replace NeedToRegisterDialog /w SetMxIdDialog
|
||||||
|
[\#889](https://github.com/matrix-org/matrix-react-sdk/pull/889)
|
||||||
|
* Invite the welcome user after registration if configured
|
||||||
|
[\#882](https://github.com/matrix-org/matrix-react-sdk/pull/882)
|
||||||
|
* Prevent ROUs from creating new chats/new rooms
|
||||||
|
[\#879](https://github.com/matrix-org/matrix-react-sdk/pull/879)
|
||||||
|
* Redesign mxID chooser, add availability checking
|
||||||
|
[\#877](https://github.com/matrix-org/matrix-react-sdk/pull/877)
|
||||||
|
* Show password nag bar when user is PWLU
|
||||||
|
[\#864](https://github.com/matrix-org/matrix-react-sdk/pull/864)
|
||||||
|
* fix typo
|
||||||
|
[\#858](https://github.com/matrix-org/matrix-react-sdk/pull/858)
|
||||||
|
* Initial implementation: SetDisplayName -> SetMxIdDialog
|
||||||
|
[\#849](https://github.com/matrix-org/matrix-react-sdk/pull/849)
|
||||||
|
|
||||||
|
Changes in [0.9.2](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.2) (2017-06-06)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.1...v0.9.2)
|
||||||
|
|
||||||
|
* Hotfix: Allow password reset when logged in
|
||||||
|
[\#1044](https://github.com/matrix-org/matrix-react-sdk/pull/1044)
|
||||||
|
|
||||||
|
Changes in [0.9.1](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.1) (2017-06-02)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.0...v0.9.1)
|
||||||
|
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1012](https://github.com/matrix-org/matrix-react-sdk/pull/1012)
|
||||||
|
* typo, missing import and mis-casing
|
||||||
|
[\#1014](https://github.com/matrix-org/matrix-react-sdk/pull/1014)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1010](https://github.com/matrix-org/matrix-react-sdk/pull/1010)
|
||||||
|
|
||||||
|
Changes in [0.9.0](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.0) (2017-06-02)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.0-rc.2...v0.9.0)
|
||||||
|
|
||||||
|
* sync pt with pt_BR
|
||||||
|
[\#1009](https://github.com/matrix-org/matrix-react-sdk/pull/1009)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1008](https://github.com/matrix-org/matrix-react-sdk/pull/1008)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1003](https://github.com/matrix-org/matrix-react-sdk/pull/1003)
|
||||||
|
* allow hiding redactions, restoring old behaviour
|
||||||
|
[\#1004](https://github.com/matrix-org/matrix-react-sdk/pull/1004)
|
||||||
|
* Add missing translations
|
||||||
|
[\#1005](https://github.com/matrix-org/matrix-react-sdk/pull/1005)
|
||||||
|
|
||||||
|
Changes in [0.9.0-rc.2](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.0-rc.2) (2017-06-02)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.9.0-rc.1...v0.9.0-rc.2)
|
||||||
|
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#1002](https://github.com/matrix-org/matrix-react-sdk/pull/1002)
|
||||||
|
* webrtc config electron
|
||||||
|
[\#850](https://github.com/matrix-org/matrix-react-sdk/pull/850)
|
||||||
|
* enable useCompactLayout user setting an add a class when it's enabled
|
||||||
|
[\#986](https://github.com/matrix-org/matrix-react-sdk/pull/986)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#987](https://github.com/matrix-org/matrix-react-sdk/pull/987)
|
||||||
|
* Translation fixes for everything but src/components
|
||||||
|
[\#990](https://github.com/matrix-org/matrix-react-sdk/pull/990)
|
||||||
|
* Fix tests
|
||||||
|
[\#1001](https://github.com/matrix-org/matrix-react-sdk/pull/1001)
|
||||||
|
* Fix tests for PR #989
|
||||||
|
[\#999](https://github.com/matrix-org/matrix-react-sdk/pull/999)
|
||||||
|
* Revert "Revert "add labels to language picker""
|
||||||
|
[\#1000](https://github.com/matrix-org/matrix-react-sdk/pull/1000)
|
||||||
|
* maybe fixxy [Electron] external thing?
|
||||||
|
[\#997](https://github.com/matrix-org/matrix-react-sdk/pull/997)
|
||||||
|
* travisci: Don't run the riot-web tests if the react-sdk tests fail
|
||||||
|
[\#992](https://github.com/matrix-org/matrix-react-sdk/pull/992)
|
||||||
|
* Support 12hr time on DateSeparator
|
||||||
|
[\#991](https://github.com/matrix-org/matrix-react-sdk/pull/991)
|
||||||
|
* Revert "add labels to language picker"
|
||||||
|
[\#994](https://github.com/matrix-org/matrix-react-sdk/pull/994)
|
||||||
|
* Call MatrixClient.clearStores on logout
|
||||||
|
[\#983](https://github.com/matrix-org/matrix-react-sdk/pull/983)
|
||||||
|
* Matthew/room avatar event
|
||||||
|
[\#988](https://github.com/matrix-org/matrix-react-sdk/pull/988)
|
||||||
|
* add labels to language picker
|
||||||
|
[\#989](https://github.com/matrix-org/matrix-react-sdk/pull/989)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#981](https://github.com/matrix-org/matrix-react-sdk/pull/981)
|
||||||
|
|
||||||
|
Changes in [0.9.0-rc.1](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.9.0-rc.1) (2017-06-01)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.9...v0.9.0-rc.1)
|
||||||
|
|
||||||
|
* Fix rare case where presence duration is undefined
|
||||||
|
[\#982](https://github.com/matrix-org/matrix-react-sdk/pull/982)
|
||||||
|
* add concept of platform handling loudNotifications (bings/pings/whatHaveYou)
|
||||||
|
[\#985](https://github.com/matrix-org/matrix-react-sdk/pull/985)
|
||||||
|
* Fixes to i18n code
|
||||||
|
[\#984](https://github.com/matrix-org/matrix-react-sdk/pull/984)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#978](https://github.com/matrix-org/matrix-react-sdk/pull/978)
|
||||||
|
* Add partial support for RTL languages
|
||||||
|
[\#955](https://github.com/matrix-org/matrix-react-sdk/pull/955)
|
||||||
|
* Added two strings to translate
|
||||||
|
[\#975](https://github.com/matrix-org/matrix-react-sdk/pull/975)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#976](https://github.com/matrix-org/matrix-react-sdk/pull/976)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#974](https://github.com/matrix-org/matrix-react-sdk/pull/974)
|
||||||
|
* Initial Electron Settings - for Auto Launch
|
||||||
|
[\#920](https://github.com/matrix-org/matrix-react-sdk/pull/920)
|
||||||
|
* Fix missing string in the room settings
|
||||||
|
[\#973](https://github.com/matrix-org/matrix-react-sdk/pull/973)
|
||||||
|
* fix error in i18n string
|
||||||
|
[\#972](https://github.com/matrix-org/matrix-react-sdk/pull/972)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#970](https://github.com/matrix-org/matrix-react-sdk/pull/970)
|
||||||
|
* Support 12hr time in full date
|
||||||
|
[\#971](https://github.com/matrix-org/matrix-react-sdk/pull/971)
|
||||||
|
* Add _tJsx()
|
||||||
|
[\#968](https://github.com/matrix-org/matrix-react-sdk/pull/968)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#966](https://github.com/matrix-org/matrix-react-sdk/pull/966)
|
||||||
|
* Remove space between time and AM/PM
|
||||||
|
[\#969](https://github.com/matrix-org/matrix-react-sdk/pull/969)
|
||||||
|
* Piwik Analytics
|
||||||
|
[\#948](https://github.com/matrix-org/matrix-react-sdk/pull/948)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#965](https://github.com/matrix-org/matrix-react-sdk/pull/965)
|
||||||
|
* Improve ChatInviteDialog perf by ditching fuse, using indexOf and
|
||||||
|
lastActiveTs()
|
||||||
|
[\#960](https://github.com/matrix-org/matrix-react-sdk/pull/960)
|
||||||
|
* Say "X removed the room name" instead of showing nothing
|
||||||
|
[\#958](https://github.com/matrix-org/matrix-react-sdk/pull/958)
|
||||||
|
* roomview/roomheader fixes
|
||||||
|
[\#959](https://github.com/matrix-org/matrix-react-sdk/pull/959)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#953](https://github.com/matrix-org/matrix-react-sdk/pull/953)
|
||||||
|
* fix i18n in a situation where navigator.languages=[]
|
||||||
|
[\#956](https://github.com/matrix-org/matrix-react-sdk/pull/956)
|
||||||
|
* `t_` -> `_t` fix typo
|
||||||
|
[\#957](https://github.com/matrix-org/matrix-react-sdk/pull/957)
|
||||||
|
* Change redact -> remove for clarity
|
||||||
|
[\#831](https://github.com/matrix-org/matrix-react-sdk/pull/831)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#950](https://github.com/matrix-org/matrix-react-sdk/pull/950)
|
||||||
|
* fix mis-linting - missed it in code review :(
|
||||||
|
[\#952](https://github.com/matrix-org/matrix-react-sdk/pull/952)
|
||||||
|
* i18n fixes
|
||||||
|
[\#951](https://github.com/matrix-org/matrix-react-sdk/pull/951)
|
||||||
|
* Message Forwarding
|
||||||
|
[\#812](https://github.com/matrix-org/matrix-react-sdk/pull/812)
|
||||||
|
* don't focus_composer on window focus
|
||||||
|
[\#944](https://github.com/matrix-org/matrix-react-sdk/pull/944)
|
||||||
|
* Fix vector-im/riot-web#4042
|
||||||
|
[\#947](https://github.com/matrix-org/matrix-react-sdk/pull/947)
|
||||||
|
* import _t, drop two unused imports
|
||||||
|
[\#946](https://github.com/matrix-org/matrix-react-sdk/pull/946)
|
||||||
|
* Fix punctuation in TextForEvent to be i18n'd consistently
|
||||||
|
[\#945](https://github.com/matrix-org/matrix-react-sdk/pull/945)
|
||||||
|
* actually wire up alwaysShowTimestamps
|
||||||
|
[\#940](https://github.com/matrix-org/matrix-react-sdk/pull/940)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#943](https://github.com/matrix-org/matrix-react-sdk/pull/943)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#942](https://github.com/matrix-org/matrix-react-sdk/pull/942)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#941](https://github.com/matrix-org/matrix-react-sdk/pull/941)
|
||||||
|
* Update from Weblate.
|
||||||
|
[\#938](https://github.com/matrix-org/matrix-react-sdk/pull/938)
|
||||||
|
* Fix PM being AM
|
||||||
|
[\#939](https://github.com/matrix-org/matrix-react-sdk/pull/939)
|
||||||
|
* pass call state through dispatcher, for poor electron
|
||||||
|
[\#918](https://github.com/matrix-org/matrix-react-sdk/pull/918)
|
||||||
|
* Translations!
|
||||||
|
[\#934](https://github.com/matrix-org/matrix-react-sdk/pull/934)
|
||||||
|
* Remove suffix and prefix from login input username
|
||||||
|
[\#906](https://github.com/matrix-org/matrix-react-sdk/pull/906)
|
||||||
|
* Kierangould/12hourtimestamp
|
||||||
|
[\#903](https://github.com/matrix-org/matrix-react-sdk/pull/903)
|
||||||
|
* Don't include src in the test resolve root
|
||||||
|
[\#931](https://github.com/matrix-org/matrix-react-sdk/pull/931)
|
||||||
|
* Make the linked versions open a new tab, turt2live complained :P
|
||||||
|
[\#910](https://github.com/matrix-org/matrix-react-sdk/pull/910)
|
||||||
|
* Fix lint errors in SlashCommands
|
||||||
|
[\#919](https://github.com/matrix-org/matrix-react-sdk/pull/919)
|
||||||
|
* autoFocus input box
|
||||||
|
[\#911](https://github.com/matrix-org/matrix-react-sdk/pull/911)
|
||||||
|
* Make travis test against riot-web new-guest-access
|
||||||
|
[\#917](https://github.com/matrix-org/matrix-react-sdk/pull/917)
|
||||||
|
* Add right-branch logic to travis test script
|
||||||
|
[\#916](https://github.com/matrix-org/matrix-react-sdk/pull/916)
|
||||||
|
* Group e2e keys into blocks of 4 characters
|
||||||
|
[\#914](https://github.com/matrix-org/matrix-react-sdk/pull/914)
|
||||||
|
* Factor out DeviceVerifyDialog
|
||||||
|
[\#913](https://github.com/matrix-org/matrix-react-sdk/pull/913)
|
||||||
|
* Fix 'missing page_type' error
|
||||||
|
[\#909](https://github.com/matrix-org/matrix-react-sdk/pull/909)
|
||||||
|
* code style update
|
||||||
|
[\#904](https://github.com/matrix-org/matrix-react-sdk/pull/904)
|
||||||
|
|
||||||
|
Changes in [0.8.9](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.9) (2017-05-22)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.9-rc.1...v0.8.9)
|
||||||
|
|
||||||
|
* No changes
|
||||||
|
|
||||||
|
|
||||||
|
Changes in [0.8.9-rc.1](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.9-rc.1) (2017-05-19)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.8...v0.8.9-rc.1)
|
||||||
|
|
||||||
|
* Prevent an exception getting scroll node
|
||||||
|
[\#902](https://github.com/matrix-org/matrix-react-sdk/pull/902)
|
||||||
|
* Fix a few remaining snags with country dd
|
||||||
|
[\#901](https://github.com/matrix-org/matrix-react-sdk/pull/901)
|
||||||
|
* Add left_aligned class to CountryDropdown
|
||||||
|
[\#900](https://github.com/matrix-org/matrix-react-sdk/pull/900)
|
||||||
|
* Swap to new flag files (which are stored as GB.png)
|
||||||
|
[\#899](https://github.com/matrix-org/matrix-react-sdk/pull/899)
|
||||||
|
* Improve phone number country dropdown for registration and login (Act. 2,
|
||||||
|
Return of the Prefix)
|
||||||
|
[\#897](https://github.com/matrix-org/matrix-react-sdk/pull/897)
|
||||||
|
* Support for pasting files into normal composer
|
||||||
|
[\#892](https://github.com/matrix-org/matrix-react-sdk/pull/892)
|
||||||
|
* tell guests they can't use filepanel until they register
|
||||||
|
[\#887](https://github.com/matrix-org/matrix-react-sdk/pull/887)
|
||||||
|
* Prevent reskindex -w from running when file names have not changed
|
||||||
|
[\#888](https://github.com/matrix-org/matrix-react-sdk/pull/888)
|
||||||
|
* I broke UserSettings for webpack-dev-server
|
||||||
|
[\#884](https://github.com/matrix-org/matrix-react-sdk/pull/884)
|
||||||
|
* various fixes to RoomHeader
|
||||||
|
[\#880](https://github.com/matrix-org/matrix-react-sdk/pull/880)
|
||||||
|
* remove /me whether or not it has a space after it
|
||||||
|
[\#885](https://github.com/matrix-org/matrix-react-sdk/pull/885)
|
||||||
|
* show error if we can't set a filter because no room
|
||||||
|
[\#883](https://github.com/matrix-org/matrix-react-sdk/pull/883)
|
||||||
|
* Fix RM not updating if RR event unpaginated
|
||||||
|
[\#874](https://github.com/matrix-org/matrix-react-sdk/pull/874)
|
||||||
|
* change roomsettings wording
|
||||||
|
[\#878](https://github.com/matrix-org/matrix-react-sdk/pull/878)
|
||||||
|
* make reskindex windows friendly
|
||||||
|
[\#875](https://github.com/matrix-org/matrix-react-sdk/pull/875)
|
||||||
|
* Fixes 2 issues with Dialog closing
|
||||||
|
[\#867](https://github.com/matrix-org/matrix-react-sdk/pull/867)
|
||||||
|
* Automatic Reskindex
|
||||||
|
[\#871](https://github.com/matrix-org/matrix-react-sdk/pull/871)
|
||||||
|
* Put room name in 'leave room' confirmation dialog
|
||||||
|
[\#873](https://github.com/matrix-org/matrix-react-sdk/pull/873)
|
||||||
|
* Fix this/self fail in LeftPanel
|
||||||
|
[\#872](https://github.com/matrix-org/matrix-react-sdk/pull/872)
|
||||||
|
* Don't show null URL previews
|
||||||
|
[\#870](https://github.com/matrix-org/matrix-react-sdk/pull/870)
|
||||||
|
* Fix keys for AddressSelector
|
||||||
|
[\#869](https://github.com/matrix-org/matrix-react-sdk/pull/869)
|
||||||
|
* Make left panel better for new users (mk II)
|
||||||
|
[\#859](https://github.com/matrix-org/matrix-react-sdk/pull/859)
|
||||||
|
* Explicitly save composer content onUnload
|
||||||
|
[\#866](https://github.com/matrix-org/matrix-react-sdk/pull/866)
|
||||||
|
* Warn on unload
|
||||||
|
[\#851](https://github.com/matrix-org/matrix-react-sdk/pull/851)
|
||||||
|
* Log deviceid at login
|
||||||
|
[\#862](https://github.com/matrix-org/matrix-react-sdk/pull/862)
|
||||||
|
* Guests can't send RR so no point trying
|
||||||
|
[\#860](https://github.com/matrix-org/matrix-react-sdk/pull/860)
|
||||||
|
* Remove babelcheck
|
||||||
|
[\#861](https://github.com/matrix-org/matrix-react-sdk/pull/861)
|
||||||
|
* T3chguy/settings versions improvements
|
||||||
|
[\#857](https://github.com/matrix-org/matrix-react-sdk/pull/857)
|
||||||
|
* Change max-len 90->120
|
||||||
|
[\#852](https://github.com/matrix-org/matrix-react-sdk/pull/852)
|
||||||
|
* Remove DM-guessing code
|
||||||
|
[\#829](https://github.com/matrix-org/matrix-react-sdk/pull/829)
|
||||||
|
* Fix jumping to an unread event when in MELS
|
||||||
|
[\#855](https://github.com/matrix-org/matrix-react-sdk/pull/855)
|
||||||
|
* Validate phone number on login
|
||||||
|
[\#856](https://github.com/matrix-org/matrix-react-sdk/pull/856)
|
||||||
|
* Failed to enable HTML5 Notifications Error Dialogs
|
||||||
|
[\#827](https://github.com/matrix-org/matrix-react-sdk/pull/827)
|
||||||
|
* Pin filesize ver to fix break upstream
|
||||||
|
[\#854](https://github.com/matrix-org/matrix-react-sdk/pull/854)
|
||||||
|
* Improve RoomDirectory Look & Feel
|
||||||
|
[\#848](https://github.com/matrix-org/matrix-react-sdk/pull/848)
|
||||||
|
* Only show jumpToReadMarker bar when RM !== RR
|
||||||
|
[\#845](https://github.com/matrix-org/matrix-react-sdk/pull/845)
|
||||||
|
* Allow MELS to have its own RM
|
||||||
|
[\#846](https://github.com/matrix-org/matrix-react-sdk/pull/846)
|
||||||
|
* Use document.onkeydown instead of onkeypress
|
||||||
|
[\#844](https://github.com/matrix-org/matrix-react-sdk/pull/844)
|
||||||
|
* (Room)?Avatar: Request 96x96 avatars on high DPI screens
|
||||||
|
[\#808](https://github.com/matrix-org/matrix-react-sdk/pull/808)
|
||||||
|
* Add mx_EventTile_emote class
|
||||||
|
[\#842](https://github.com/matrix-org/matrix-react-sdk/pull/842)
|
||||||
|
* Fix dialog reappearing after hitting Enter
|
||||||
|
[\#841](https://github.com/matrix-org/matrix-react-sdk/pull/841)
|
||||||
|
* Fix spinner that shows until the first sync
|
||||||
|
[\#840](https://github.com/matrix-org/matrix-react-sdk/pull/840)
|
||||||
|
* Show spinner until first sync has completed
|
||||||
|
[\#839](https://github.com/matrix-org/matrix-react-sdk/pull/839)
|
||||||
|
* Style fixes for LoggedInView
|
||||||
|
[\#838](https://github.com/matrix-org/matrix-react-sdk/pull/838)
|
||||||
|
* Fix specifying custom server for registration
|
||||||
|
[\#834](https://github.com/matrix-org/matrix-react-sdk/pull/834)
|
||||||
|
* Improve country dropdown UX and expose +prefix
|
||||||
|
[\#833](https://github.com/matrix-org/matrix-react-sdk/pull/833)
|
||||||
|
* Fix user settings store
|
||||||
|
[\#836](https://github.com/matrix-org/matrix-react-sdk/pull/836)
|
||||||
|
* show the room name in the UDE Dialog
|
||||||
|
[\#832](https://github.com/matrix-org/matrix-react-sdk/pull/832)
|
||||||
|
* summarise profile changes in MELS
|
||||||
|
[\#826](https://github.com/matrix-org/matrix-react-sdk/pull/826)
|
||||||
|
* Transform h1 and h2 tags to h3 tags
|
||||||
|
[\#820](https://github.com/matrix-org/matrix-react-sdk/pull/820)
|
||||||
|
* limit our keyboard shortcut modifiers correctly
|
||||||
|
[\#825](https://github.com/matrix-org/matrix-react-sdk/pull/825)
|
||||||
|
* Specify cross platform regexes and add olm to noParse
|
||||||
|
[\#823](https://github.com/matrix-org/matrix-react-sdk/pull/823)
|
||||||
|
* Remember element that was in focus before rendering dialog
|
||||||
|
[\#822](https://github.com/matrix-org/matrix-react-sdk/pull/822)
|
||||||
|
* move user settings outward and use built in read receipts disabling
|
||||||
|
[\#824](https://github.com/matrix-org/matrix-react-sdk/pull/824)
|
||||||
|
* File Download Consistency
|
||||||
|
[\#802](https://github.com/matrix-org/matrix-react-sdk/pull/802)
|
||||||
|
* Show Access Token under Advanced in Settings
|
||||||
|
[\#806](https://github.com/matrix-org/matrix-react-sdk/pull/806)
|
||||||
|
* Link tags/commit hashes in the UserSettings version section
|
||||||
|
[\#810](https://github.com/matrix-org/matrix-react-sdk/pull/810)
|
||||||
|
* On return to RoomView from auxPanel, send focus back to Composer
|
||||||
|
[\#813](https://github.com/matrix-org/matrix-react-sdk/pull/813)
|
||||||
|
* Change presence status labels to 'for' instead of 'ago'
|
||||||
|
[\#817](https://github.com/matrix-org/matrix-react-sdk/pull/817)
|
||||||
|
* Disable Scalar Integrations if urls passed to it are falsey
|
||||||
|
[\#816](https://github.com/matrix-org/matrix-react-sdk/pull/816)
|
||||||
|
* Add option to hide other people's read receipts.
|
||||||
|
[\#818](https://github.com/matrix-org/matrix-react-sdk/pull/818)
|
||||||
|
* Add option to not send typing notifications
|
||||||
|
[\#819](https://github.com/matrix-org/matrix-react-sdk/pull/819)
|
||||||
|
* Sync RM across instances of Riot
|
||||||
|
[\#805](https://github.com/matrix-org/matrix-react-sdk/pull/805)
|
||||||
|
* First iteration on improving login UI
|
||||||
|
[\#811](https://github.com/matrix-org/matrix-react-sdk/pull/811)
|
||||||
|
* focus on composer after jumping to bottom
|
||||||
|
[\#809](https://github.com/matrix-org/matrix-react-sdk/pull/809)
|
||||||
|
* Improve RoomList performance via side-stepping React
|
||||||
|
[\#807](https://github.com/matrix-org/matrix-react-sdk/pull/807)
|
||||||
|
* Don't show link preview when link is inside of a quote
|
||||||
|
[\#762](https://github.com/matrix-org/matrix-react-sdk/pull/762)
|
||||||
|
* Escape closes UserSettings
|
||||||
|
[\#765](https://github.com/matrix-org/matrix-react-sdk/pull/765)
|
||||||
|
* Implement user power-level changes in timeline
|
||||||
|
[\#794](https://github.com/matrix-org/matrix-react-sdk/pull/794)
|
||||||
|
|
||||||
Changes in [0.8.8](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.8) (2017-04-25)
|
Changes in [0.8.8](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.8) (2017-04-25)
|
||||||
===================================================================================================
|
===================================================================================================
|
||||||
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.8-rc.2...v0.8.8)
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.8-rc.2...v0.8.8)
|
||||||
|
|
|
@ -24,6 +24,10 @@ In the interim, `vector-im/riot-web` and `matrix-org/matrix-react-sdk` should
|
||||||
be considered as a single project (for instance, matrix-react-sdk bugs
|
be considered as a single project (for instance, matrix-react-sdk bugs
|
||||||
are currently filed against vector-im/riot-web rather than this project).
|
are currently filed against vector-im/riot-web rather than this project).
|
||||||
|
|
||||||
|
Translation Status
|
||||||
|
==================
|
||||||
|
[](https://translate.nordgedanken.de/engage/riot-web/?utm_source=widget)
|
||||||
|
|
||||||
Developer Guide
|
Developer Guide
|
||||||
===============
|
===============
|
||||||
|
|
||||||
|
@ -190,4 +194,3 @@ Alternative instructions:
|
||||||
* Create an index.html file pulling in your compiled javascript and the
|
* Create an index.html file pulling in your compiled javascript and the
|
||||||
CSS bundle from the skin you use. For now, you'll also need to manually
|
CSS bundle from the skin you use. For now, you'll also need to manually
|
||||||
import CSS from any skins that your skin inherts from.
|
import CSS from any skins that your skin inherts from.
|
||||||
|
|
||||||
|
|
|
@ -69,25 +69,41 @@ General Style
|
||||||
console.log("I am a fish"); // Bad
|
console.log("I am a fish"); // Bad
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
- No new line before else, catch, finally, etc:
|
||||||
|
|
||||||
|
```javascript
|
||||||
|
if (x) {
|
||||||
|
console.log("I am a fish");
|
||||||
|
} else {
|
||||||
|
console.log("I am a chimp"); // Good
|
||||||
|
}
|
||||||
|
|
||||||
|
if (x) {
|
||||||
|
console.log("I am a fish");
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
console.log("I am a chimp"); // Bad
|
||||||
|
}
|
||||||
|
```
|
||||||
- Declare one variable per var statement (consistent with Node). Unless they
|
- Declare one variable per var statement (consistent with Node). Unless they
|
||||||
are simple and closely related. If you put the next declaration on a new line,
|
are simple and closely related. If you put the next declaration on a new line,
|
||||||
treat yourself to another `var`:
|
treat yourself to another `var`:
|
||||||
|
|
||||||
```javascript
|
```javascript
|
||||||
var key = "foo",
|
const key = "foo",
|
||||||
comparator = function(x, y) {
|
comparator = function(x, y) {
|
||||||
return x - y;
|
return x - y;
|
||||||
}; // Bad
|
}; // Bad
|
||||||
|
|
||||||
var key = "foo";
|
const key = "foo";
|
||||||
var comparator = function(x, y) {
|
const comparator = function(x, y) {
|
||||||
return x - y;
|
return x - y;
|
||||||
}; // Good
|
}; // Good
|
||||||
|
|
||||||
var x = 0, y = 0; // Fine
|
let x = 0, y = 0; // Fine
|
||||||
|
|
||||||
var x = 0;
|
let x = 0;
|
||||||
var y = 0; // Also fine
|
let y = 0; // Also fine
|
||||||
```
|
```
|
||||||
- A single line `if` is fine, all others have braces. This prevents errors when adding to the code.:
|
- A single line `if` is fine, all others have braces. This prevents errors when adding to the code.:
|
||||||
|
|
||||||
|
|
1
header
1
header
|
@ -1,5 +1,6 @@
|
||||||
/*
|
/*
|
||||||
Copyright 2015, 2016 OpenMarket Ltd
|
Copyright 2015, 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
you may not use this file except in compliance with the License.
|
you may not use this file except in compliance with the License.
|
||||||
|
|
|
@ -21,6 +21,11 @@ npm run test
|
||||||
# run eslint
|
# run eslint
|
||||||
npm run lintall -- -f checkstyle -o eslint.xml || true
|
npm run lintall -- -f checkstyle -o eslint.xml || true
|
||||||
|
|
||||||
|
# re-run the linter, excluding any files known to have errors or warnings.
|
||||||
|
./node_modules/.bin/eslint --max-warnings 0 \
|
||||||
|
--ignore-path .eslintignore.errorfiles \
|
||||||
|
src test
|
||||||
|
|
||||||
# delete the old tarball, if it exists
|
# delete the old tarball, if it exists
|
||||||
rm -f matrix-react-sdk-*.tgz
|
rm -f matrix-react-sdk-*.tgz
|
||||||
|
|
||||||
|
|
|
@ -55,11 +55,18 @@ module.exports = function (config) {
|
||||||
// some images to reduce noise from the tests
|
// some images to reduce noise from the tests
|
||||||
{pattern: 'test/img/*', watched: false, included: false,
|
{pattern: 'test/img/*', watched: false, included: false,
|
||||||
served: true, nocache: false},
|
served: true, nocache: false},
|
||||||
|
// translation files
|
||||||
|
{pattern: 'src/i18n/strings/*', watcheed: false, included: false, served: true},
|
||||||
|
{pattern: 'test/i18n/*', watched: false, included: false, served: true},
|
||||||
],
|
],
|
||||||
|
|
||||||
// redirect img links to the karma server
|
|
||||||
proxies: {
|
proxies: {
|
||||||
|
// redirect img links to the karma server
|
||||||
"/img/": "/base/test/img/",
|
"/img/": "/base/test/img/",
|
||||||
|
// special languages.json file for the tests
|
||||||
|
"/i18n/languages.json": "/base/test/i18n/languages.json",
|
||||||
|
// and redirect i18n requests
|
||||||
|
"/i18n/": "/base/src/i18n/strings/",
|
||||||
},
|
},
|
||||||
|
|
||||||
// list of files to exclude
|
// list of files to exclude
|
||||||
|
@ -166,11 +173,15 @@ module.exports = function (config) {
|
||||||
'sinon': 'sinon/pkg/sinon.js',
|
'sinon': 'sinon/pkg/sinon.js',
|
||||||
},
|
},
|
||||||
root: [
|
root: [
|
||||||
path.resolve('./src'),
|
|
||||||
path.resolve('./test'),
|
path.resolve('./test'),
|
||||||
],
|
],
|
||||||
},
|
},
|
||||||
devtool: 'inline-source-map',
|
devtool: 'inline-source-map',
|
||||||
|
externals: {
|
||||||
|
// Don't try to bundle electron: leave it as a commonjs dependency
|
||||||
|
// (the 'commonjs' here means it will output a 'require')
|
||||||
|
"electron": "commonjs electron",
|
||||||
|
},
|
||||||
},
|
},
|
||||||
|
|
||||||
webpackMiddleware: {
|
webpackMiddleware: {
|
||||||
|
|
18
package.json
18
package.json
|
@ -1,6 +1,6 @@
|
||||||
{
|
{
|
||||||
"name": "matrix-react-sdk",
|
"name": "matrix-react-sdk",
|
||||||
"version": "0.8.8",
|
"version": "0.9.7",
|
||||||
"description": "SDK for matrix.org using React",
|
"description": "SDK for matrix.org using React",
|
||||||
"author": "matrix.org",
|
"author": "matrix.org",
|
||||||
"repository": {
|
"repository": {
|
||||||
|
@ -31,9 +31,11 @@
|
||||||
"reskindex": "scripts/reskindex.js"
|
"reskindex": "scripts/reskindex.js"
|
||||||
},
|
},
|
||||||
"scripts": {
|
"scripts": {
|
||||||
"reskindex": "scripts/reskindex.js -h header",
|
"reskindex": "node scripts/reskindex.js -h header",
|
||||||
"build": "babel src -d lib --source-maps",
|
"reskindex:watch": "node scripts/reskindex.js -h header -w",
|
||||||
"start": "babel src -w -d lib --source-maps",
|
"build": "npm run reskindex && babel src -d lib --source-maps",
|
||||||
|
"build:watch": "babel src -w -d lib --source-maps",
|
||||||
|
"start": "parallelshell \"npm run build:watch\" \"npm run reskindex:watch\"",
|
||||||
"lint": "eslint src/",
|
"lint": "eslint src/",
|
||||||
"lintall": "eslint src/ test/",
|
"lintall": "eslint src/ test/",
|
||||||
"clean": "rimraf lib",
|
"clean": "rimraf lib",
|
||||||
|
@ -48,13 +50,15 @@
|
||||||
"browser-request": "^0.3.3",
|
"browser-request": "^0.3.3",
|
||||||
"classnames": "^2.1.2",
|
"classnames": "^2.1.2",
|
||||||
"commonmark": "^0.27.0",
|
"commonmark": "^0.27.0",
|
||||||
|
"counterpart": "^0.18.0",
|
||||||
"draft-js": "^0.9.1",
|
"draft-js": "^0.9.1",
|
||||||
"draft-js-export-html": "^0.5.0",
|
"draft-js-export-html": "^0.5.0",
|
||||||
"draft-js-export-markdown": "^0.2.0",
|
"draft-js-export-markdown": "^0.2.0",
|
||||||
"emojione": "2.2.3",
|
"emojione": "2.2.3",
|
||||||
"file-saver": "^1.3.3",
|
"file-saver": "^1.3.3",
|
||||||
"filesize": "3.5.6",
|
"filesize": "3.5.6",
|
||||||
"flux": "^2.0.3",
|
"flux": "2.1.1",
|
||||||
|
"fuse.js": "^2.2.0",
|
||||||
"glob": "^5.0.14",
|
"glob": "^5.0.14",
|
||||||
"highlight.js": "^8.9.1",
|
"highlight.js": "^8.9.1",
|
||||||
"isomorphic-fetch": "^2.2.1",
|
"isomorphic-fetch": "^2.2.1",
|
||||||
|
@ -68,7 +72,7 @@
|
||||||
"react": "^15.4.0",
|
"react": "^15.4.0",
|
||||||
"react-addons-css-transition-group": "15.3.2",
|
"react-addons-css-transition-group": "15.3.2",
|
||||||
"react-dom": "^15.4.0",
|
"react-dom": "^15.4.0",
|
||||||
"react-gemini-scrollbar": "matrix-org/react-gemini-scrollbar#39d858c",
|
"react-gemini-scrollbar": "matrix-org/react-gemini-scrollbar#5e97aef",
|
||||||
"sanitize-html": "^1.11.1",
|
"sanitize-html": "^1.11.1",
|
||||||
"text-encoding-utf-8": "^1.0.1",
|
"text-encoding-utf-8": "^1.0.1",
|
||||||
"velocity-vector": "vector-im/velocity#059e3b2",
|
"velocity-vector": "vector-im/velocity#059e3b2",
|
||||||
|
@ -89,6 +93,7 @@
|
||||||
"babel-preset-es2016": "^6.11.3",
|
"babel-preset-es2016": "^6.11.3",
|
||||||
"babel-preset-es2017": "^6.14.0",
|
"babel-preset-es2017": "^6.14.0",
|
||||||
"babel-preset-react": "^6.11.1",
|
"babel-preset-react": "^6.11.1",
|
||||||
|
"chokidar": "^1.6.1",
|
||||||
"eslint": "^3.13.1",
|
"eslint": "^3.13.1",
|
||||||
"eslint-config-google": "^0.7.1",
|
"eslint-config-google": "^0.7.1",
|
||||||
"eslint-plugin-babel": "^4.0.1",
|
"eslint-plugin-babel": "^4.0.1",
|
||||||
|
@ -105,6 +110,7 @@
|
||||||
"karma-sourcemap-loader": "^0.3.7",
|
"karma-sourcemap-loader": "^0.3.7",
|
||||||
"karma-webpack": "^1.7.0",
|
"karma-webpack": "^1.7.0",
|
||||||
"mocha": "^2.4.5",
|
"mocha": "^2.4.5",
|
||||||
|
"parallelshell": "^1.2.0",
|
||||||
"phantomjs-prebuilt": "^2.1.7",
|
"phantomjs-prebuilt": "^2.1.7",
|
||||||
"react-addons-test-utils": "^15.4.0",
|
"react-addons-test-utils": "^15.4.0",
|
||||||
"require-json": "0.0.1",
|
"require-json": "0.0.1",
|
||||||
|
|
|
@ -0,0 +1,192 @@
|
||||||
|
#!/usr/bin/perl
|
||||||
|
|
||||||
|
use strict;
|
||||||
|
use warnings;
|
||||||
|
use Cwd 'abs_path';
|
||||||
|
|
||||||
|
# script which checks how out of sync the i18ns are drifting
|
||||||
|
|
||||||
|
# example i18n format:
|
||||||
|
# "%(oneUser)sleft": "%(oneUser)sleft",
|
||||||
|
|
||||||
|
$|=1;
|
||||||
|
|
||||||
|
$0 =~ /^(.*\/)/;
|
||||||
|
my $i18ndir = abs_path($1."/../src/i18n/strings");
|
||||||
|
my $srcdir = abs_path($1."/../src");
|
||||||
|
|
||||||
|
my $en = read_i18n($i18ndir."/en_EN.json");
|
||||||
|
|
||||||
|
my $src_strings = read_src_strings($srcdir);
|
||||||
|
my $src = {};
|
||||||
|
|
||||||
|
print "Checking strings in src\n";
|
||||||
|
foreach my $tuple (@$src_strings) {
|
||||||
|
my ($s, $file) = (@$tuple);
|
||||||
|
$src->{$s} = $file;
|
||||||
|
if (!$en->{$s}) {
|
||||||
|
if ($en->{$s . '.'}) {
|
||||||
|
printf ("%50s %24s\t%s\n", $file, "en_EN has fullstop!", $s);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
$s =~ /^(.*)\.?$/;
|
||||||
|
if ($en->{$1}) {
|
||||||
|
printf ("%50s %24s\t%s\n", $file, "en_EN lacks fullstop!", $s);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
printf ("%50s %24s\t%s\n", $file, "Translation missing!", $s);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
print "\nChecking en_EN\n";
|
||||||
|
my $count = 0;
|
||||||
|
my $remaining_src = {};
|
||||||
|
foreach (keys %$src) { $remaining_src->{$_}++ };
|
||||||
|
|
||||||
|
foreach my $k (sort keys %$en) {
|
||||||
|
# crappy heuristic to ignore country codes for now...
|
||||||
|
next if ($k =~ /^(..|..-..)$/);
|
||||||
|
|
||||||
|
if ($en->{$k} ne $k) {
|
||||||
|
printf ("%50s %24s\t%s\n", "en_EN", "en_EN is not symmetrical", $k);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!$src->{$k}) {
|
||||||
|
if ($src->{$k. '.'}) {
|
||||||
|
printf ("%50s %24s\t%s\n", $src->{$k. '.'}, "src has fullstop!", $k);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
$k =~ /^(.*)\.?$/;
|
||||||
|
if ($src->{$1}) {
|
||||||
|
printf ("%50s %24s\t%s\n", $src->{$1}, "src lacks fullstop!", $k);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
printf ("%50s %24s\t%s\n", '???', "Not present in src?", $k);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
$count++;
|
||||||
|
delete $remaining_src->{$k};
|
||||||
|
}
|
||||||
|
}
|
||||||
|
printf ("$count/" . (scalar keys %$src) . " strings found in src are present in en_EN\n");
|
||||||
|
foreach (keys %$remaining_src) {
|
||||||
|
print "missing: $_\n";
|
||||||
|
}
|
||||||
|
|
||||||
|
opendir(DIR, $i18ndir) || die $!;
|
||||||
|
my @files = readdir(DIR);
|
||||||
|
closedir(DIR);
|
||||||
|
foreach my $lang (grep { -f "$i18ndir/$_" && !/(basefile|en_EN)\.json/ } @files) {
|
||||||
|
print "\nChecking $lang\n";
|
||||||
|
|
||||||
|
my $map = read_i18n($i18ndir."/".$lang);
|
||||||
|
my $count = 0;
|
||||||
|
|
||||||
|
my $remaining_en = {};
|
||||||
|
foreach (keys %$en) { $remaining_en->{$_}++ };
|
||||||
|
|
||||||
|
foreach my $k (sort keys %$map) {
|
||||||
|
{
|
||||||
|
no warnings 'uninitialized';
|
||||||
|
my $vars = {};
|
||||||
|
while ($k =~ /%\((.*?)\)s/g) {
|
||||||
|
$vars->{$1}++;
|
||||||
|
}
|
||||||
|
while ($map->{$k} =~ /%\((.*?)\)s/g) {
|
||||||
|
$vars->{$1}--;
|
||||||
|
}
|
||||||
|
foreach my $var (keys %$vars) {
|
||||||
|
if ($vars->{$var} != 0) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Broken var ($var)s", $k);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if ($en->{$k}) {
|
||||||
|
if ($map->{$k} eq $k) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Untranslated string?", $k);
|
||||||
|
}
|
||||||
|
$count++;
|
||||||
|
delete $remaining_en->{$k};
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
if ($en->{$k . "."}) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "en_EN has fullstop!", $k);
|
||||||
|
next;
|
||||||
|
}
|
||||||
|
|
||||||
|
$k =~ /^(.*)\.?$/;
|
||||||
|
if ($en->{$1}) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "en_EN lacks fullstop!", $k);
|
||||||
|
next;
|
||||||
|
}
|
||||||
|
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Not present in en_EN", $k);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (scalar keys %$remaining_en < 100) {
|
||||||
|
foreach (keys %$remaining_en) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Not yet translated", $_);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
printf ("$count/" . (scalar keys %$en) . " strings translated\n");
|
||||||
|
}
|
||||||
|
|
||||||
|
sub read_i18n {
|
||||||
|
my $path = shift;
|
||||||
|
my $map = {};
|
||||||
|
$path =~ /.*\/(.*)$/;
|
||||||
|
my $lang = $1;
|
||||||
|
|
||||||
|
open(FILE, "<", $path) || die $!;
|
||||||
|
while(<FILE>) {
|
||||||
|
if ($_ =~ m/^(\s+)"(.*?)"(: *)"(.*?)"(,?)$/) {
|
||||||
|
my ($indent, $src, $colon, $dst, $comma) = ($1, $2, $3, $4, $5);
|
||||||
|
$src =~ s/\\"/"/g;
|
||||||
|
$dst =~ s/\\"/"/g;
|
||||||
|
|
||||||
|
if ($map->{$src}) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Duplicate translation!", $src);
|
||||||
|
}
|
||||||
|
$map->{$src} = $dst;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
close(FILE);
|
||||||
|
|
||||||
|
return $map;
|
||||||
|
}
|
||||||
|
|
||||||
|
sub read_src_strings {
|
||||||
|
my $path = shift;
|
||||||
|
|
||||||
|
use File::Find;
|
||||||
|
use File::Slurp;
|
||||||
|
|
||||||
|
my $strings = [];
|
||||||
|
|
||||||
|
my @files;
|
||||||
|
find( sub { push @files, $File::Find::name if (-f $_ && /\.jsx?$/) }, $path );
|
||||||
|
foreach my $file (@files) {
|
||||||
|
my $src = read_file($file);
|
||||||
|
$src =~ s/'\s*\+\s*'//g;
|
||||||
|
$src =~ s/"\s*\+\s*"//g;
|
||||||
|
|
||||||
|
$file =~ s/^.*\/src/src/;
|
||||||
|
while ($src =~ /_t(?:Jsx)?\(\s*'(.*?[^\\])'/sg) {
|
||||||
|
my $s = $1;
|
||||||
|
$s =~ s/\\'/'/g;
|
||||||
|
push @$strings, [$s, $file];
|
||||||
|
}
|
||||||
|
while ($src =~ /_t(?:Jsx)?\(\s*"(.*?[^\\])"/sg) {
|
||||||
|
push @$strings, [$1, $file];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return $strings;
|
||||||
|
}
|
|
@ -0,0 +1,47 @@
|
||||||
|
#!/usr/bin/env python
|
||||||
|
|
||||||
|
import json
|
||||||
|
import sys
|
||||||
|
import os
|
||||||
|
|
||||||
|
if len(sys.argv) < 3:
|
||||||
|
print "Usage: %s <source> <dest>" % (sys.argv[0],)
|
||||||
|
print "eg. %s pt_BR.json pt.json" % (sys.argv[0],)
|
||||||
|
print
|
||||||
|
print "Adds any translations to <dest> that exist in <source> but not <dest>"
|
||||||
|
sys.exit(1)
|
||||||
|
|
||||||
|
srcpath = sys.argv[1]
|
||||||
|
dstpath = sys.argv[2]
|
||||||
|
tmppath = dstpath + ".tmp"
|
||||||
|
|
||||||
|
with open(srcpath) as f:
|
||||||
|
src = json.load(f)
|
||||||
|
|
||||||
|
with open(dstpath) as f:
|
||||||
|
dst = json.load(f)
|
||||||
|
|
||||||
|
toAdd = {}
|
||||||
|
for k,v in src.iteritems():
|
||||||
|
if k not in dst:
|
||||||
|
print "Adding %s" % (k,)
|
||||||
|
toAdd[k] = v
|
||||||
|
|
||||||
|
# don't just json.dumps as we'll probably re-order all the keys (and they're
|
||||||
|
# not in any given order so we can't just sort_keys). Append them to the end.
|
||||||
|
with open(dstpath) as ifp:
|
||||||
|
with open(tmppath, 'w') as ofp:
|
||||||
|
for line in ifp:
|
||||||
|
strippedline = line.strip()
|
||||||
|
if strippedline in ('{', '}'):
|
||||||
|
ofp.write(line)
|
||||||
|
elif strippedline.endswith(','):
|
||||||
|
ofp.write(line)
|
||||||
|
else:
|
||||||
|
ofp.write(' '+strippedline+',')
|
||||||
|
toAddStr = json.dumps(toAdd, indent=4, separators=(',', ': '), ensure_ascii=False, encoding="utf8").strip("{}\n")
|
||||||
|
ofp.write("\n")
|
||||||
|
ofp.write(toAddStr.encode('utf8'))
|
||||||
|
ofp.write("\n")
|
||||||
|
|
||||||
|
os.rename(tmppath, dstpath)
|
|
@ -0,0 +1,114 @@
|
||||||
|
#!/usr/bin/perl -ni
|
||||||
|
|
||||||
|
use strict;
|
||||||
|
use warnings;
|
||||||
|
|
||||||
|
# script which synchronises i18n strings to include punctuation.
|
||||||
|
# i've cherry-picked ones which seem to have diverged between the different translations
|
||||||
|
# from TextForEvent, causing missing events all over the place
|
||||||
|
|
||||||
|
BEGIN {
|
||||||
|
$::fixups = [split(/\n/, <<EOT
|
||||||
|
%(targetName)s accepted the invitation for %(displayName)s.
|
||||||
|
%(targetName)s accepted an invitation.
|
||||||
|
%(senderName)s requested a VoIP conference.
|
||||||
|
%(senderName)s invited %(targetName)s.
|
||||||
|
%(senderName)s banned %(targetName)s.
|
||||||
|
%(senderName)s changed their display name from %(oldDisplayName)s to %(displayName)s.
|
||||||
|
%(senderName)s set their display name to %(displayName)s.
|
||||||
|
%(senderName)s removed their display name (%(oldDisplayName)s).
|
||||||
|
%(senderName)s removed their profile picture.
|
||||||
|
%(senderName)s changed their profile picture.
|
||||||
|
%(senderName)s set a profile picture.
|
||||||
|
VoIP conference started.
|
||||||
|
%(targetName)s joined the room.
|
||||||
|
VoIP conference finished.
|
||||||
|
%(targetName)s rejected the invitation.
|
||||||
|
%(targetName)s left the room.
|
||||||
|
%(senderName)s unbanned %(targetName)s.
|
||||||
|
%(senderName)s kicked %(targetName)s.
|
||||||
|
%(senderName)s withdrew %(targetName)s's inivitation.
|
||||||
|
%(targetName)s left the room.
|
||||||
|
%(senderDisplayName)s changed the topic to "%(topic)s".
|
||||||
|
%(senderDisplayName)s changed the room name to %(roomName)s.
|
||||||
|
%(senderDisplayName)s sent an image.
|
||||||
|
%(senderName)s answered the call.
|
||||||
|
%(senderName)s ended the call.
|
||||||
|
%(senderName)s placed a %(callType)s call.
|
||||||
|
%(senderName)s sent an invitation to %(targetDisplayName)s to join the room.
|
||||||
|
%(senderName)s turned on end-to-end encryption (algorithm %(algorithm)s).
|
||||||
|
%(senderName)s changed the power level of %(powerLevelDiffText)s.
|
||||||
|
For security, this session has been signed out. Please sign in again.
|
||||||
|
You need to log back in to generate end-to-end encryption keys for this device and submit the public key to your homeserver. This is a once off; sorry for the inconvenience.
|
||||||
|
A new password must be entered.
|
||||||
|
Guests can't set avatars. Please register.
|
||||||
|
Failed to set avatar.
|
||||||
|
Unable to verify email address.
|
||||||
|
Guests can't use labs features. Please register.
|
||||||
|
A new password must be entered.
|
||||||
|
Resetting password will currently reset any end-to-end encryption keys on all devices, making encrypted chat history unreadable, unless you first export your room keys and re-import them afterwards. In future this will be improved.
|
||||||
|
Guests cannot join this room even if explicitly invited.
|
||||||
|
Guest users can't invite users. Please register to invite.
|
||||||
|
This room is inaccessible to guests. You may be able to join if you register.
|
||||||
|
delete the alias.
|
||||||
|
remove %(name)s from the directory.
|
||||||
|
Conference call failed.
|
||||||
|
Conference calling is in development and may not be reliable.
|
||||||
|
Guest users can't create new rooms. Please register to create room and start a chat.
|
||||||
|
Server may be unavailable, overloaded, or you hit a bug.
|
||||||
|
Server unavailable, overloaded, or something else went wrong.
|
||||||
|
You are already in a call.
|
||||||
|
You cannot place VoIP calls in this browser.
|
||||||
|
You cannot place a call with yourself.
|
||||||
|
Your email address does not appear to be associated with a Matrix ID on this Homeserver.
|
||||||
|
Guest users can't upload files. Please register to upload.
|
||||||
|
Some of your messages have not been sent.
|
||||||
|
This room is private or inaccessible to guests. You may be able to join if you register.
|
||||||
|
Tried to load a specific point in this room's timeline, but was unable to find it.
|
||||||
|
Tried to load a specific point in this room's timeline, but you do not have permission to view the message in question.
|
||||||
|
This action cannot be performed by a guest user. Please register to be able to do this.
|
||||||
|
Tried to load a specific point in this room's timeline, but was unable to find it.
|
||||||
|
Tried to load a specific point in this room's timeline, but you do not have permission to view the message in question.
|
||||||
|
You are trying to access %(roomName)s.
|
||||||
|
You will not be able to undo this change as you are promoting the user to have the same power level as yourself.
|
||||||
|
EOT
|
||||||
|
)];
|
||||||
|
}
|
||||||
|
|
||||||
|
# example i18n format:
|
||||||
|
# "%(oneUser)sleft": "%(oneUser)sleft",
|
||||||
|
|
||||||
|
# script called with the line of the file to be checked
|
||||||
|
my $sub = 0;
|
||||||
|
if ($_ =~ m/^(\s+)"(.*?)"(: *)"(.*?)"(,?)$/) {
|
||||||
|
my ($indent, $src, $colon, $dst, $comma) = ($1, $2, $3, $4, $5);
|
||||||
|
$src =~ s/\\"/"/g;
|
||||||
|
$dst =~ s/\\"/"/g;
|
||||||
|
|
||||||
|
foreach my $fixup (@{$::fixups}) {
|
||||||
|
my $dotless_fixup = substr($fixup, 0, -1);
|
||||||
|
|
||||||
|
if ($src eq $dotless_fixup) {
|
||||||
|
print STDERR "fixing up src: $src\n";
|
||||||
|
$src .= '.';
|
||||||
|
$sub = 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
if ($ARGV !~ /(zh_Hans|zh_Hant|th)\.json$/ && $src eq $fixup && $dst !~ /\.$/) {
|
||||||
|
print STDERR "fixing up dst: $dst\n";
|
||||||
|
$dst .= '.';
|
||||||
|
$sub = 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
if ($sub) {
|
||||||
|
$src =~ s/"/\\"/g;
|
||||||
|
$dst =~ s/"/\\"/g;
|
||||||
|
print qq($indent"$src"$colon"$dst"$comma\n);
|
||||||
|
last;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!$sub) {
|
||||||
|
print $_;
|
||||||
|
}
|
|
@ -0,0 +1,21 @@
|
||||||
|
#!/bin/sh
|
||||||
|
#
|
||||||
|
# generates .eslintignore.errorfiles to list the files which have errors in,
|
||||||
|
# so that they can be ignored in future automated linting.
|
||||||
|
|
||||||
|
out=.eslintignore.errorfiles
|
||||||
|
|
||||||
|
cd `dirname $0`/..
|
||||||
|
|
||||||
|
echo "generating $out"
|
||||||
|
|
||||||
|
{
|
||||||
|
cat <<EOF
|
||||||
|
# autogenerated file: run scripts/generate-eslint-error-ignore-file to update.
|
||||||
|
|
||||||
|
EOF
|
||||||
|
|
||||||
|
./node_modules/.bin/eslint --no-ignore -f json src test |
|
||||||
|
jq -r '.[] | select((.errorCount + .warningCount) > 0) | .filePath' |
|
||||||
|
sed -e 's/.*matrix-react-sdk\///';
|
||||||
|
} > "$out"
|
|
@ -1,53 +1,99 @@
|
||||||
#!/usr/bin/env node
|
#!/usr/bin/env node
|
||||||
|
|
||||||
var fs = require('fs');
|
var fs = require('fs');
|
||||||
var path = require('path');
|
var path = require('path');
|
||||||
var glob = require('glob');
|
var glob = require('glob');
|
||||||
|
|
||||||
var args = require('optimist').argv;
|
var args = require('optimist').argv;
|
||||||
|
var chokidar = require('chokidar');
|
||||||
var header = args.h || args.header;
|
|
||||||
|
|
||||||
var componentsDir = path.join('src', 'components');
|
|
||||||
|
|
||||||
var componentIndex = path.join('src', 'component-index.js');
|
var componentIndex = path.join('src', 'component-index.js');
|
||||||
|
var componentIndexTmp = componentIndex+".tmp";
|
||||||
|
var componentsDir = path.join('src', 'components');
|
||||||
|
var componentGlob = '**/*.js';
|
||||||
|
var prevFiles = [];
|
||||||
|
|
||||||
var packageJson = JSON.parse(fs.readFileSync('./package.json'));
|
function reskindex() {
|
||||||
|
var files = glob.sync(componentGlob, {cwd: componentsDir}).sort();
|
||||||
|
if (!filesHaveChanged(files, prevFiles)) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
prevFiles = files;
|
||||||
|
|
||||||
var strm = fs.createWriteStream(componentIndex);
|
var header = args.h || args.header;
|
||||||
|
var packageJson = JSON.parse(fs.readFileSync('./package.json'));
|
||||||
|
|
||||||
if (header) {
|
var strm = fs.createWriteStream(componentIndexTmp);
|
||||||
strm.write(fs.readFileSync(header));
|
|
||||||
strm.write('\n');
|
if (header) {
|
||||||
|
strm.write(fs.readFileSync(header));
|
||||||
|
strm.write('\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
strm.write("/*\n");
|
||||||
|
strm.write(" * THIS FILE IS AUTO-GENERATED\n");
|
||||||
|
strm.write(" * You can edit it you like, but your changes will be overwritten,\n");
|
||||||
|
strm.write(" * so you'd just be trying to swim upstream like a salmon.\n");
|
||||||
|
strm.write(" * You are not a salmon.\n");
|
||||||
|
strm.write(" */\n\n");
|
||||||
|
|
||||||
|
if (packageJson['matrix-react-parent']) {
|
||||||
|
const parentIndex = packageJson['matrix-react-parent'] +
|
||||||
|
'/lib/component-index';
|
||||||
|
strm.write(
|
||||||
|
`let components = require('${parentIndex}').components;
|
||||||
|
if (!components) {
|
||||||
|
throw new Error("'${parentIndex}' didn't export components");
|
||||||
|
}
|
||||||
|
`);
|
||||||
|
} else {
|
||||||
|
strm.write("let components = {};\n");
|
||||||
|
}
|
||||||
|
|
||||||
|
for (var i = 0; i < files.length; ++i) {
|
||||||
|
var file = files[i].replace('.js', '');
|
||||||
|
|
||||||
|
var moduleName = (file.replace(/\//g, '.'));
|
||||||
|
var importName = moduleName.replace(/\./g, "$");
|
||||||
|
|
||||||
|
strm.write("import " + importName + " from './components/" + file + "';\n");
|
||||||
|
strm.write(importName + " && (components['"+moduleName+"'] = " + importName + ");");
|
||||||
|
strm.write('\n');
|
||||||
|
strm.uncork();
|
||||||
|
}
|
||||||
|
|
||||||
|
strm.write("export {components};\n");
|
||||||
|
strm.end();
|
||||||
|
fs.rename(componentIndexTmp, componentIndex, function(err) {
|
||||||
|
if(err) {
|
||||||
|
console.error("Error moving new index into place: " + err);
|
||||||
|
} else {
|
||||||
|
console.log('Reskindex: completed');
|
||||||
|
}
|
||||||
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
strm.write("/*\n");
|
// Expects both arrays of file names to be sorted
|
||||||
strm.write(" * THIS FILE IS AUTO-GENERATED\n");
|
function filesHaveChanged(files, prevFiles) {
|
||||||
strm.write(" * You can edit it you like, but your changes will be overwritten,\n");
|
if (files.length !== prevFiles.length) {
|
||||||
strm.write(" * so you'd just be trying to swim upstream like a salmon.\n");
|
return true;
|
||||||
strm.write(" * You are not a salmon.\n");
|
}
|
||||||
strm.write(" *\n");
|
// Check for name changes
|
||||||
strm.write(" * To update it, run:\n");
|
for (var i = 0; i < files.length; i++) {
|
||||||
strm.write(" * ./reskindex.js -h header\n");
|
if (prevFiles[i] !== files[i]) {
|
||||||
strm.write(" */\n\n");
|
return true;
|
||||||
|
}
|
||||||
if (packageJson['matrix-react-parent']) {
|
}
|
||||||
strm.write("module.exports.components = require('"+packageJson['matrix-react-parent']+"/lib/component-index').components;\n\n");
|
return false;
|
||||||
} else {
|
|
||||||
strm.write("module.exports.components = {};\n");
|
|
||||||
}
|
}
|
||||||
|
|
||||||
var files = glob.sync('**/*.js', {cwd: componentsDir}).sort();
|
// -w indicates watch mode where any FS events will trigger reskindex
|
||||||
for (var i = 0; i < files.length; ++i) {
|
if (!args.w) {
|
||||||
var file = files[i].replace('.js', '');
|
reskindex();
|
||||||
|
return;
|
||||||
var moduleName = (file.replace(/\//g, '.'));
|
|
||||||
var importName = moduleName.replace(/\./g, "$");
|
|
||||||
|
|
||||||
strm.write("import " + importName + " from './components/" + file + "';\n");
|
|
||||||
strm.write(importName + " && (module.exports.components['"+moduleName+"'] = " + importName + ");");
|
|
||||||
strm.write('\n');
|
|
||||||
strm.uncork();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
strm.end();
|
var watchDebouncer = null;
|
||||||
|
chokidar.watch(path.join(componentsDir, componentGlob)).on('all', (event, path) => {
|
||||||
|
if (path === componentIndex) return;
|
||||||
|
if (watchDebouncer) clearTimeout(watchDebouncer);
|
||||||
|
watchDebouncer = setTimeout(reskindex, 1000);
|
||||||
|
});
|
||||||
|
|
|
@ -0,0 +1,11 @@
|
||||||
|
#!/bin/sh
|
||||||
|
|
||||||
|
set -ex
|
||||||
|
|
||||||
|
npm run test
|
||||||
|
./.travis-test-riot.sh
|
||||||
|
|
||||||
|
# run the linter, but exclude any files known to have errors or warnings.
|
||||||
|
./node_modules/.bin/eslint --max-warnings 0 \
|
||||||
|
--ignore-path .eslintignore.errorfiles \
|
||||||
|
src test
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Allows a user to add a third party identifier to their Home Server and,
|
* Allows a user to add a third party identifier to their Home Server and,
|
||||||
|
@ -44,7 +45,7 @@ class AddThreepid {
|
||||||
return res;
|
return res;
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
if (err.errcode == 'M_THREEPID_IN_USE') {
|
if (err.errcode == 'M_THREEPID_IN_USE') {
|
||||||
err.message = "This email address is already in use";
|
err.message = _t('This email address is already in use');
|
||||||
} else if (err.httpStatus) {
|
} else if (err.httpStatus) {
|
||||||
err.message = err.message + ` (Status ${err.httpStatus})`;
|
err.message = err.message + ` (Status ${err.httpStatus})`;
|
||||||
}
|
}
|
||||||
|
@ -69,7 +70,7 @@ class AddThreepid {
|
||||||
return res;
|
return res;
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
if (err.errcode == 'M_THREEPID_IN_USE') {
|
if (err.errcode == 'M_THREEPID_IN_USE') {
|
||||||
err.message = "This phone number is already in use";
|
err.message = _t('This phone number is already in use');
|
||||||
} else if (err.httpStatus) {
|
} else if (err.httpStatus) {
|
||||||
err.message = err.message + ` (Status ${err.httpStatus})`;
|
err.message = err.message + ` (Status ${err.httpStatus})`;
|
||||||
}
|
}
|
||||||
|
@ -91,7 +92,7 @@ class AddThreepid {
|
||||||
id_server: identityServerDomain
|
id_server: identityServerDomain
|
||||||
}, this.bind).catch(function(err) {
|
}, this.bind).catch(function(err) {
|
||||||
if (err.httpStatus === 401) {
|
if (err.httpStatus === 401) {
|
||||||
err.message = "Failed to verify email address: make sure you clicked the link in the email";
|
err.message = _t('Failed to verify email address: make sure you clicked the link in the email');
|
||||||
}
|
}
|
||||||
else if (err.httpStatus) {
|
else if (err.httpStatus) {
|
||||||
err.message += ` (Status ${err.httpStatus})`;
|
err.message += ` (Status ${err.httpStatus})`;
|
||||||
|
|
|
@ -0,0 +1,153 @@
|
||||||
|
/*
|
||||||
|
Copyright 2017 Michael Telatynski <7t3chguy@gmail.com>
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import { getCurrentLanguage } from './languageHandler';
|
||||||
|
import MatrixClientPeg from './MatrixClientPeg';
|
||||||
|
import PlatformPeg from './PlatformPeg';
|
||||||
|
import SdkConfig from './SdkConfig';
|
||||||
|
|
||||||
|
function getRedactedUrl() {
|
||||||
|
const redactedHash = window.location.hash.replace(/#\/(room|user)\/(.+)/, "#/$1/<redacted>");
|
||||||
|
// hardcoded url to make piwik happy
|
||||||
|
return 'https://riot.im/app/' + redactedHash;
|
||||||
|
}
|
||||||
|
|
||||||
|
const customVariables = {
|
||||||
|
'App Platform': 1,
|
||||||
|
'App Version': 2,
|
||||||
|
'User Type': 3,
|
||||||
|
'Chosen Language': 4,
|
||||||
|
'Instance': 5,
|
||||||
|
};
|
||||||
|
|
||||||
|
|
||||||
|
class Analytics {
|
||||||
|
constructor() {
|
||||||
|
this._paq = null;
|
||||||
|
this.disabled = true;
|
||||||
|
this.firstPage = true;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enable Analytics if initialized but disabled
|
||||||
|
* otherwise try and initalize, no-op if piwik config missing
|
||||||
|
*/
|
||||||
|
enable() {
|
||||||
|
if (this._paq || this._init()) {
|
||||||
|
this.disabled = false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Disable Analytics calls, will not fully unload Piwik until a refresh,
|
||||||
|
* but this is second best, Piwik should not pull anything implicitly.
|
||||||
|
*/
|
||||||
|
disable() {
|
||||||
|
this.trackEvent('Analytics', 'opt-out');
|
||||||
|
this.disabled = true;
|
||||||
|
}
|
||||||
|
|
||||||
|
_init() {
|
||||||
|
const config = SdkConfig.get();
|
||||||
|
if (!config || !config.piwik || !config.piwik.url || !config.piwik.siteId) return;
|
||||||
|
|
||||||
|
const url = config.piwik.url;
|
||||||
|
const siteId = config.piwik.siteId;
|
||||||
|
const self = this;
|
||||||
|
|
||||||
|
window._paq = this._paq = window._paq || [];
|
||||||
|
|
||||||
|
this._paq.push(['setTrackerUrl', url+'piwik.php']);
|
||||||
|
this._paq.push(['setSiteId', siteId]);
|
||||||
|
|
||||||
|
this._paq.push(['trackAllContentImpressions']);
|
||||||
|
this._paq.push(['discardHashTag', false]);
|
||||||
|
this._paq.push(['enableHeartBeatTimer']);
|
||||||
|
this._paq.push(['enableLinkTracking', true]);
|
||||||
|
|
||||||
|
const platform = PlatformPeg.get();
|
||||||
|
this._setVisitVariable('App Platform', platform.getHumanReadableName());
|
||||||
|
platform.getAppVersion().then((version) => {
|
||||||
|
this._setVisitVariable('App Version', version);
|
||||||
|
}).catch(() => {
|
||||||
|
this._setVisitVariable('App Version', 'unknown');
|
||||||
|
});
|
||||||
|
|
||||||
|
this._setVisitVariable('Chosen Language', getCurrentLanguage());
|
||||||
|
|
||||||
|
if (window.location.hostname === 'riot.im') {
|
||||||
|
this._setVisitVariable('Instance', window.location.pathname);
|
||||||
|
}
|
||||||
|
|
||||||
|
(function() {
|
||||||
|
const g = document.createElement('script');
|
||||||
|
const s = document.getElementsByTagName('script')[0];
|
||||||
|
g.type='text/javascript'; g.async=true; g.defer=true; g.src=url+'piwik.js';
|
||||||
|
|
||||||
|
g.onload = function() {
|
||||||
|
console.log('Initialised anonymous analytics');
|
||||||
|
self._paq = window._paq;
|
||||||
|
};
|
||||||
|
|
||||||
|
s.parentNode.insertBefore(g, s);
|
||||||
|
})();
|
||||||
|
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
trackPageChange() {
|
||||||
|
if (this.disabled) return;
|
||||||
|
if (this.firstPage) {
|
||||||
|
// De-duplicate first page
|
||||||
|
// router seems to hit the fn twice
|
||||||
|
this.firstPage = false;
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
this._paq.push(['setCustomUrl', getRedactedUrl()]);
|
||||||
|
this._paq.push(['trackPageView']);
|
||||||
|
}
|
||||||
|
|
||||||
|
trackEvent(category, action, name) {
|
||||||
|
if (this.disabled) return;
|
||||||
|
this._paq.push(['trackEvent', category, action, name]);
|
||||||
|
}
|
||||||
|
|
||||||
|
logout() {
|
||||||
|
if (this.disabled) return;
|
||||||
|
this._paq.push(['deleteCookies']);
|
||||||
|
}
|
||||||
|
|
||||||
|
login() { // not used currently
|
||||||
|
const cli = MatrixClientPeg.get();
|
||||||
|
if (this.disabled || !cli) return;
|
||||||
|
|
||||||
|
this._paq.push(['setUserId', `@${cli.getUserIdLocalpart()}:${cli.getDomain()}`]);
|
||||||
|
}
|
||||||
|
|
||||||
|
_setVisitVariable(key, value) {
|
||||||
|
this._paq.push(['setCustomVariable', customVariables[key], key, value, 'visit']);
|
||||||
|
}
|
||||||
|
|
||||||
|
setGuest(guest) {
|
||||||
|
if (this.disabled) return;
|
||||||
|
this._setVisitVariable('User Type', guest ? 'Guest' : 'Logged In');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!global.mxAnalytics) {
|
||||||
|
global.mxAnalytics = new Analytics();
|
||||||
|
}
|
||||||
|
module.exports = global.mxAnalytics;
|
|
@ -17,6 +17,8 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
|
import dis from './dispatcher';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Base class for classes that provide platform-specific functionality
|
* Base class for classes that provide platform-specific functionality
|
||||||
* eg. Setting an application badge or displaying notifications
|
* eg. Setting an application badge or displaying notifications
|
||||||
|
@ -27,6 +29,21 @@ export default class BasePlatform {
|
||||||
constructor() {
|
constructor() {
|
||||||
this.notificationCount = 0;
|
this.notificationCount = 0;
|
||||||
this.errorDidOccur = false;
|
this.errorDidOccur = false;
|
||||||
|
|
||||||
|
dis.register(this._onAction.bind(this));
|
||||||
|
}
|
||||||
|
|
||||||
|
_onAction(payload: Object) {
|
||||||
|
switch (payload.action) {
|
||||||
|
case 'on_logged_out':
|
||||||
|
this.setNotificationCount(0);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Used primarily for Analytics
|
||||||
|
getHumanReadableName(): string {
|
||||||
|
return 'Base Platform';
|
||||||
}
|
}
|
||||||
|
|
||||||
setNotificationCount(count: number) {
|
setNotificationCount(count: number) {
|
||||||
|
@ -66,11 +83,14 @@ export default class BasePlatform {
|
||||||
displayNotification(title: string, msg: string, avatarUrl: string, room: Object) {
|
displayNotification(title: string, msg: string, avatarUrl: string, room: Object) {
|
||||||
}
|
}
|
||||||
|
|
||||||
|
loudNotification(ev: Event, room: Object) {
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns a promise that resolves to a string representing
|
* Returns a promise that resolves to a string representing
|
||||||
* the current version of the application.
|
* the current version of the application.
|
||||||
*/
|
*/
|
||||||
getAppVersion() {
|
getAppVersion(): Promise<string> {
|
||||||
throw new Error("getAppVersion not implemented!");
|
throw new Error("getAppVersion not implemented!");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -79,10 +99,12 @@ export default class BasePlatform {
|
||||||
* with getUserMedia, return a string explaining why not.
|
* with getUserMedia, return a string explaining why not.
|
||||||
* Otherwise, return null.
|
* Otherwise, return null.
|
||||||
*/
|
*/
|
||||||
screenCaptureErrorString() {
|
screenCaptureErrorString(): string {
|
||||||
return "Not implemented";
|
return "Not implemented";
|
||||||
}
|
}
|
||||||
|
|
||||||
|
isElectron(): boolean { return false; }
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Restarts the application, without neccessarily reloading
|
* Restarts the application, without neccessarily reloading
|
||||||
* any application code
|
* any application code
|
||||||
|
|
|
@ -51,12 +51,14 @@ limitations under the License.
|
||||||
* }
|
* }
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var MatrixClientPeg = require('./MatrixClientPeg');
|
import MatrixClientPeg from './MatrixClientPeg';
|
||||||
var PlatformPeg = require("./PlatformPeg");
|
import UserSettingsStore from './UserSettingsStore';
|
||||||
var Modal = require('./Modal');
|
import PlatformPeg from './PlatformPeg';
|
||||||
var sdk = require('./index');
|
import Modal from './Modal';
|
||||||
var Matrix = require("matrix-js-sdk");
|
import sdk from './index';
|
||||||
var dis = require("./dispatcher");
|
import { _t } from './languageHandler';
|
||||||
|
import Matrix from 'matrix-js-sdk';
|
||||||
|
import dis from './dispatcher';
|
||||||
|
|
||||||
global.mxCalls = {
|
global.mxCalls = {
|
||||||
//room_id: MatrixCall
|
//room_id: MatrixCall
|
||||||
|
@ -142,8 +144,8 @@ function _setCallListeners(call) {
|
||||||
play("busyAudio");
|
play("busyAudio");
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Call Timeout",
|
title: _t('Call Timeout'),
|
||||||
description: "The remote side failed to pick up."
|
description: _t('The remote side failed to pick up') + '.',
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
else if (oldState === "invite_sent") {
|
else if (oldState === "invite_sent") {
|
||||||
|
@ -179,7 +181,8 @@ function _setCallState(call, roomId, status) {
|
||||||
}
|
}
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'call_state',
|
action: 'call_state',
|
||||||
room_id: roomId
|
room_id: roomId,
|
||||||
|
state: status,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -203,8 +206,8 @@ function _onAction(payload) {
|
||||||
console.log("Can't capture screen: " + screenCapErrorString);
|
console.log("Can't capture screen: " + screenCapErrorString);
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Unable to capture screen",
|
title: _t('Unable to capture screen'),
|
||||||
description: screenCapErrorString
|
description: screenCapErrorString,
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -223,8 +226,8 @@ function _onAction(payload) {
|
||||||
if (module.exports.getAnyActiveCall()) {
|
if (module.exports.getAnyActiveCall()) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Existing Call",
|
title: _t('Existing Call'),
|
||||||
description: "You are already in a call."
|
description: _t('You are already in a call.'),
|
||||||
});
|
});
|
||||||
return; // don't allow >1 call to be placed.
|
return; // don't allow >1 call to be placed.
|
||||||
}
|
}
|
||||||
|
@ -233,8 +236,8 @@ function _onAction(payload) {
|
||||||
if (!MatrixClientPeg.get().supportsVoip()) {
|
if (!MatrixClientPeg.get().supportsVoip()) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "VoIP is unsupported",
|
title: _t('VoIP is unsupported'),
|
||||||
description: "You cannot place VoIP calls in this browser."
|
description: _t('You cannot place VoIP calls in this browser.'),
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -249,15 +252,15 @@ function _onAction(payload) {
|
||||||
if (members.length <= 1) {
|
if (members.length <= 1) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
description: "You cannot place a call with yourself."
|
description: _t('You cannot place a call with yourself.'),
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
else if (members.length === 2) {
|
else if (members.length === 2) {
|
||||||
console.log("Place %s call in %s", payload.type, payload.room_id);
|
console.log("Place %s call in %s", payload.type, payload.room_id);
|
||||||
var call = Matrix.createNewMatrixCall(
|
const call = Matrix.createNewMatrixCall(MatrixClientPeg.get(), payload.room_id, {
|
||||||
MatrixClientPeg.get(), payload.room_id
|
forceTURN: UserSettingsStore.getLocalSetting('webRtcForceTURN', false),
|
||||||
);
|
});
|
||||||
placeCall(call);
|
placeCall(call);
|
||||||
}
|
}
|
||||||
else { // > 2
|
else { // > 2
|
||||||
|
@ -275,14 +278,14 @@ function _onAction(payload) {
|
||||||
if (!ConferenceHandler) {
|
if (!ConferenceHandler) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
description: "Conference calls are not supported in this client"
|
description: _t('Conference calls are not supported in this client'),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
else if (!MatrixClientPeg.get().supportsVoip()) {
|
else if (!MatrixClientPeg.get().supportsVoip()) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "VoIP is unsupported",
|
title: _t('VoIP is unsupported'),
|
||||||
description: "You cannot place VoIP calls in this browser."
|
description: _t('You cannot place VoIP calls in this browser.'),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
else if (MatrixClientPeg.get().isRoomEncrypted(payload.room_id)) {
|
else if (MatrixClientPeg.get().isRoomEncrypted(payload.room_id)) {
|
||||||
|
@ -294,14 +297,14 @@ function _onAction(payload) {
|
||||||
// Therefore we disable conference calling in E2E rooms.
|
// Therefore we disable conference calling in E2E rooms.
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
description: "Conference calls are not supported in encrypted rooms",
|
description: _t('Conference calls are not supported in encrypted rooms'),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning!",
|
title: _t('Warning!'),
|
||||||
description: "Conference calling is in development and may not be reliable.",
|
description: _t('Conference calling is in development and may not be reliable.'),
|
||||||
onFinished: confirm=>{
|
onFinished: confirm=>{
|
||||||
if (confirm) {
|
if (confirm) {
|
||||||
ConferenceHandler.createNewMatrixCall(
|
ConferenceHandler.createNewMatrixCall(
|
||||||
|
@ -312,8 +315,8 @@ function _onAction(payload) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Conference call failed: " + err);
|
console.error("Conference call failed: " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to set up conference call",
|
title: _t('Failed to set up conference call'),
|
||||||
description: "Conference call failed. " + ((err && err.message) ? err.message : ""),
|
description: _t('Conference call failed.') + ' ' + ((err && err.message) ? err.message : ''),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
|
@ -0,0 +1,64 @@
|
||||||
|
/*
|
||||||
|
Copyright 2017 Michael Telatynski <7t3chguy@gmail.com>
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import UserSettingsStore from './UserSettingsStore';
|
||||||
|
import * as Matrix from 'matrix-js-sdk';
|
||||||
|
|
||||||
|
export default {
|
||||||
|
getDevices: function() {
|
||||||
|
// Only needed for Electron atm, though should work in modern browsers
|
||||||
|
// once permission has been granted to the webapp
|
||||||
|
return navigator.mediaDevices.enumerateDevices().then(function(devices) {
|
||||||
|
const audioIn = [];
|
||||||
|
const videoIn = [];
|
||||||
|
|
||||||
|
if (devices.some((device) => !device.label)) return false;
|
||||||
|
|
||||||
|
devices.forEach((device) => {
|
||||||
|
switch (device.kind) {
|
||||||
|
case 'audioinput': audioIn.push(device); break;
|
||||||
|
case 'videoinput': videoIn.push(device); break;
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
// console.log("Loaded WebRTC Devices", mediaDevices);
|
||||||
|
return {
|
||||||
|
audioinput: audioIn,
|
||||||
|
videoinput: videoIn,
|
||||||
|
};
|
||||||
|
}, (error) => { console.log('Unable to refresh WebRTC Devices: ', error); });
|
||||||
|
},
|
||||||
|
|
||||||
|
loadDevices: function() {
|
||||||
|
// this.getDevices().then((devices) => {
|
||||||
|
const localSettings = UserSettingsStore.getLocalSettings();
|
||||||
|
// // if deviceId is not found, automatic fallback is in spec
|
||||||
|
// // recall previously stored inputs if any
|
||||||
|
Matrix.setMatrixCallAudioInput(localSettings['webrtc_audioinput']);
|
||||||
|
Matrix.setMatrixCallVideoInput(localSettings['webrtc_videoinput']);
|
||||||
|
// });
|
||||||
|
},
|
||||||
|
|
||||||
|
setAudioInput: function(deviceId) {
|
||||||
|
UserSettingsStore.setLocalSetting('webrtc_audioinput', deviceId);
|
||||||
|
Matrix.setMatrixCallAudioInput(deviceId);
|
||||||
|
},
|
||||||
|
|
||||||
|
setVideoInput: function(deviceId) {
|
||||||
|
UserSettingsStore.setLocalSetting('webrtc_videoinput', deviceId);
|
||||||
|
Matrix.setMatrixCallVideoInput(deviceId);
|
||||||
|
},
|
||||||
|
};
|
|
@ -1,62 +0,0 @@
|
||||||
/*
|
|
||||||
Copyright 2017 Vector Creations Ltd
|
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
you may not use this file except in compliance with the License.
|
|
||||||
You may obtain a copy of the License at
|
|
||||||
|
|
||||||
http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
|
|
||||||
Unless required by applicable law or agreed to in writing, software
|
|
||||||
distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
See the License for the specific language governing permissions and
|
|
||||||
limitations under the License.
|
|
||||||
*/
|
|
||||||
|
|
||||||
// singleton which dispatches invocations of a given type & argument
|
|
||||||
// rather than just a type (as per EventEmitter and Flux's dispatcher etc)
|
|
||||||
//
|
|
||||||
// This means you can have a single point which listens for an EventEmitter event
|
|
||||||
// and then dispatches out to one of thousands of RoomTiles (for instance) rather than
|
|
||||||
// having each RoomTile register for the EventEmitter event and having to
|
|
||||||
// iterate over all of them.
|
|
||||||
class ConstantTimeDispatcher {
|
|
||||||
constructor() {
|
|
||||||
// type -> arg -> [ listener(arg, params) ]
|
|
||||||
this.listeners = {};
|
|
||||||
}
|
|
||||||
|
|
||||||
register(type, arg, listener) {
|
|
||||||
if (!this.listeners[type]) this.listeners[type] = {};
|
|
||||||
if (!this.listeners[type][arg]) this.listeners[type][arg] = [];
|
|
||||||
this.listeners[type][arg].push(listener);
|
|
||||||
}
|
|
||||||
|
|
||||||
unregister(type, arg, listener) {
|
|
||||||
if (this.listeners[type] && this.listeners[type][arg]) {
|
|
||||||
var i = this.listeners[type][arg].indexOf(listener);
|
|
||||||
if (i > -1) {
|
|
||||||
this.listeners[type][arg].splice(i, 1);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
else {
|
|
||||||
console.warn("Unregistering unrecognised listener (type=" + type + ", arg=" + arg + ")");
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
dispatch(type, arg, params) {
|
|
||||||
if (!this.listeners[type] || !this.listeners[type][arg]) {
|
|
||||||
//console.warn("No registered listeners for dispatch (type=" + type + ", arg=" + arg + ")");
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
this.listeners[type][arg].forEach(listener=>{
|
|
||||||
listener.call(arg, params);
|
|
||||||
});
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (!global.constantTimeDispatcher) {
|
|
||||||
global.constantTimeDispatcher = new ConstantTimeDispatcher();
|
|
||||||
}
|
|
||||||
module.exports = global.constantTimeDispatcher;
|
|
|
@ -21,6 +21,7 @@ var extend = require('./extend');
|
||||||
var dis = require('./dispatcher');
|
var dis = require('./dispatcher');
|
||||||
var MatrixClientPeg = require('./MatrixClientPeg');
|
var MatrixClientPeg = require('./MatrixClientPeg');
|
||||||
var sdk = require('./index');
|
var sdk = require('./index');
|
||||||
|
import { _t } from './languageHandler';
|
||||||
var Modal = require('./Modal');
|
var Modal = require('./Modal');
|
||||||
|
|
||||||
var encrypt = require("browser-encrypt-attachment");
|
var encrypt = require("browser-encrypt-attachment");
|
||||||
|
@ -347,14 +348,14 @@ class ContentMessages {
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
error = err;
|
error = err;
|
||||||
if (!upload.canceled) {
|
if (!upload.canceled) {
|
||||||
var desc = "The file '"+upload.fileName+"' failed to upload.";
|
var desc = _t('The file \'%(fileName)s\' failed to upload', {fileName: upload.fileName}) + '.';
|
||||||
if (err.http_status == 413) {
|
if (err.http_status == 413) {
|
||||||
desc = "The file '"+upload.fileName+"' exceeds this home server's size limit for uploads";
|
desc = _t('The file \'%(fileName)s\' exceeds this home server\'s size limit for uploads', {fileName: upload.fileName});
|
||||||
}
|
}
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Upload Failed",
|
title: _t('Upload Failed'),
|
||||||
description: desc
|
description: desc,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}).finally(() => {
|
}).finally(() => {
|
||||||
|
|
|
@ -1,5 +1,6 @@
|
||||||
/*
|
/*
|
||||||
Copyright 2015, 2016 OpenMarket Ltd
|
Copyright 2015, 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
you may not use this file except in compliance with the License.
|
you may not use this file except in compliance with the License.
|
||||||
|
@ -15,38 +16,89 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
var days = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"];
|
function getDaysArray() {
|
||||||
var months = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"];
|
return [
|
||||||
|
_t('Sun'),
|
||||||
|
_t('Mon'),
|
||||||
|
_t('Tue'),
|
||||||
|
_t('Wed'),
|
||||||
|
_t('Thu'),
|
||||||
|
_t('Fri'),
|
||||||
|
_t('Sat'),
|
||||||
|
];
|
||||||
|
}
|
||||||
|
|
||||||
|
function getMonthsArray() {
|
||||||
|
return [
|
||||||
|
_t('Jan'),
|
||||||
|
_t('Feb'),
|
||||||
|
_t('Mar'),
|
||||||
|
_t('Apr'),
|
||||||
|
_t('May'),
|
||||||
|
_t('Jun'),
|
||||||
|
_t('Jul'),
|
||||||
|
_t('Aug'),
|
||||||
|
_t('Sep'),
|
||||||
|
_t('Oct'),
|
||||||
|
_t('Nov'),
|
||||||
|
_t('Dec'),
|
||||||
|
];
|
||||||
|
}
|
||||||
|
|
||||||
|
function pad(n) {
|
||||||
|
return (n < 10 ? '0' : '') + n;
|
||||||
|
}
|
||||||
|
|
||||||
|
function twelveHourTime(date) {
|
||||||
|
let hours = date.getHours() % 12;
|
||||||
|
const minutes = pad(date.getMinutes());
|
||||||
|
const ampm = date.getHours() >= 12 ? 'PM' : 'AM';
|
||||||
|
hours = pad(hours ? hours : 12);
|
||||||
|
return `${hours}:${minutes}${ampm}`;
|
||||||
|
}
|
||||||
|
|
||||||
module.exports = {
|
module.exports = {
|
||||||
formatDate: function(date) {
|
formatDate: function(date, showTwelveHour=false) {
|
||||||
// date.toLocaleTimeString is completely system dependent.
|
|
||||||
// just go 24h for now
|
|
||||||
function pad(n) {
|
|
||||||
return (n < 10 ? '0' : '') + n;
|
|
||||||
}
|
|
||||||
|
|
||||||
var now = new Date();
|
var now = new Date();
|
||||||
|
const days = getDaysArray();
|
||||||
|
const months = getMonthsArray();
|
||||||
if (date.toDateString() === now.toDateString()) {
|
if (date.toDateString() === now.toDateString()) {
|
||||||
return pad(date.getHours()) + ':' + pad(date.getMinutes());
|
return this.formatTime(date);
|
||||||
}
|
}
|
||||||
else if (now.getTime() - date.getTime() < 6 * 24 * 60 * 60 * 1000) {
|
else if (now.getTime() - date.getTime() < 6 * 24 * 60 * 60 * 1000) {
|
||||||
return days[date.getDay()] + " " + pad(date.getHours()) + ':' + pad(date.getMinutes());
|
// TODO: use standard date localize function provided in counterpart
|
||||||
|
return _t('%(weekDayName)s %(time)s', {weekDayName: days[date.getDay()], time: this.formatTime(date, showTwelveHour)});
|
||||||
}
|
}
|
||||||
else /* if (now.getFullYear() === date.getFullYear()) */ {
|
else if (now.getFullYear() === date.getFullYear()) {
|
||||||
return days[date.getDay()] + ", " + months[date.getMonth()] + " " + date.getDate() + " " + pad(date.getHours()) + ':' + pad(date.getMinutes());
|
// TODO: use standard date localize function provided in counterpart
|
||||||
|
return _t('%(weekDayName)s, %(monthName)s %(day)s %(time)s', {
|
||||||
|
weekDayName: days[date.getDay()],
|
||||||
|
monthName: months[date.getMonth()],
|
||||||
|
day: date.getDate(),
|
||||||
|
time: this.formatTime(date),
|
||||||
|
});
|
||||||
}
|
}
|
||||||
/*
|
return this.formatFullDate(date, showTwelveHour);
|
||||||
else {
|
|
||||||
return days[date.getDay()] + ", " + months[date.getMonth()] + " " + date.getDate() + " " + date.getFullYear() + " " + pad(date.getHours()) + ':' + pad(date.getMinutes());
|
|
||||||
}
|
|
||||||
*/
|
|
||||||
},
|
},
|
||||||
|
|
||||||
formatTime: function(date) {
|
formatFullDate: function(date, showTwelveHour=false) {
|
||||||
//return pad(date.getHours()) + ':' + pad(date.getMinutes());
|
const days = getDaysArray();
|
||||||
return ('00' + date.getHours()).slice(-2) + ':' + ('00' + date.getMinutes()).slice(-2);
|
const months = getMonthsArray();
|
||||||
}
|
return _t('%(weekDayName)s, %(monthName)s %(day)s %(fullYear)s %(time)s', {
|
||||||
};
|
weekDayName: days[date.getDay()],
|
||||||
|
monthName: months[date.getMonth()],
|
||||||
|
day: date.getDate(),
|
||||||
|
fullYear: date.getFullYear(),
|
||||||
|
time: showTwelveHour ? twelveHourTime(date) : this.formatTime(date),
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
formatTime: function(date, showTwelveHour=false) {
|
||||||
|
if (showTwelveHour) {
|
||||||
|
return twelveHourTime(date);
|
||||||
|
}
|
||||||
|
return pad(date.getHours()) + ':' + pad(date.getMinutes());
|
||||||
|
},
|
||||||
|
};
|
||||||
|
|
|
@ -148,17 +148,18 @@ var sanitizeHtmlParams = {
|
||||||
attribs.href = m[1];
|
attribs.href = m[1];
|
||||||
delete attribs.target;
|
delete attribs.target;
|
||||||
}
|
}
|
||||||
|
else {
|
||||||
m = attribs.href.match(linkifyMatrix.MATRIXTO_URL_PATTERN);
|
m = attribs.href.match(linkifyMatrix.MATRIXTO_URL_PATTERN);
|
||||||
if (m) {
|
if (m) {
|
||||||
var entity = m[1];
|
var entity = m[1];
|
||||||
if (entity[0] === '@') {
|
if (entity[0] === '@') {
|
||||||
attribs.href = '#/user/' + entity;
|
attribs.href = '#/user/' + entity;
|
||||||
|
}
|
||||||
|
else if (entity[0] === '#' || entity[0] === '!') {
|
||||||
|
attribs.href = '#/room/' + entity;
|
||||||
|
}
|
||||||
|
delete attribs.target;
|
||||||
}
|
}
|
||||||
else if (entity[0] === '#' || entity[0] === '!') {
|
|
||||||
attribs.href = '#/room/' + entity;
|
|
||||||
}
|
|
||||||
delete attribs.target;
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
attribs.rel = 'noopener'; // https://mathiasbynens.github.io/rel-noopener/
|
attribs.rel = 'noopener'; // https://mathiasbynens.github.io/rel-noopener/
|
||||||
|
@ -344,6 +345,7 @@ export function bodyToHtml(content, highlights, opts) {
|
||||||
}
|
}
|
||||||
safeBody = sanitizeHtml(body, sanitizeHtmlParams);
|
safeBody = sanitizeHtml(body, sanitizeHtmlParams);
|
||||||
safeBody = unicodeToImage(safeBody);
|
safeBody = unicodeToImage(safeBody);
|
||||||
|
safeBody = addCodeCopyButton(safeBody);
|
||||||
}
|
}
|
||||||
finally {
|
finally {
|
||||||
delete sanitizeHtmlParams.textFilter;
|
delete sanitizeHtmlParams.textFilter;
|
||||||
|
@ -359,7 +361,24 @@ export function bodyToHtml(content, highlights, opts) {
|
||||||
'mx_EventTile_bigEmoji': emojiBody,
|
'mx_EventTile_bigEmoji': emojiBody,
|
||||||
'markdown-body': isHtml,
|
'markdown-body': isHtml,
|
||||||
});
|
});
|
||||||
return <span className={className} dangerouslySetInnerHTML={{ __html: safeBody }} />;
|
return <span className={className} dangerouslySetInnerHTML={{ __html: safeBody }} dir="auto" />;
|
||||||
|
}
|
||||||
|
|
||||||
|
function addCodeCopyButton(safeBody) {
|
||||||
|
// Adds 'copy' buttons to pre blocks
|
||||||
|
// Note that this only manipulates the markup to add the buttons:
|
||||||
|
// we need to add the event handlers once the nodes are in the DOM
|
||||||
|
// since we can't save functions in the markup.
|
||||||
|
// This is done in TextualBody
|
||||||
|
const el = document.createElement("div");
|
||||||
|
el.innerHTML = safeBody;
|
||||||
|
const codeBlocks = Array.from(el.getElementsByTagName("pre"));
|
||||||
|
codeBlocks.forEach(p => {
|
||||||
|
const button = document.createElement("span");
|
||||||
|
button.className = "mx_EventTile_copyButton";
|
||||||
|
p.appendChild(button);
|
||||||
|
});
|
||||||
|
return el.innerHTML;
|
||||||
}
|
}
|
||||||
|
|
||||||
export function emojifyText(text) {
|
export function emojifyText(text) {
|
||||||
|
|
|
@ -32,5 +32,5 @@ module.exports = {
|
||||||
DELETE: 46,
|
DELETE: 46,
|
||||||
KEY_D: 68,
|
KEY_D: 68,
|
||||||
KEY_E: 69,
|
KEY_E: 69,
|
||||||
KEY_K: 75,
|
KEY_M: 77,
|
||||||
};
|
};
|
||||||
|
|
|
@ -0,0 +1,138 @@
|
||||||
|
/*
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import sdk from './index';
|
||||||
|
import Modal from './Modal';
|
||||||
|
|
||||||
|
export default class KeyRequestHandler {
|
||||||
|
constructor(matrixClient) {
|
||||||
|
this._matrixClient = matrixClient;
|
||||||
|
|
||||||
|
// the user/device for which we currently have a dialog open
|
||||||
|
this._currentUser = null;
|
||||||
|
this._currentDevice = null;
|
||||||
|
|
||||||
|
// userId -> deviceId -> [keyRequest]
|
||||||
|
this._pendingKeyRequests = Object.create(null);
|
||||||
|
}
|
||||||
|
|
||||||
|
handleKeyRequest(keyRequest) {
|
||||||
|
const userId = keyRequest.userId;
|
||||||
|
const deviceId = keyRequest.deviceId;
|
||||||
|
const requestId = keyRequest.requestId;
|
||||||
|
|
||||||
|
if (!this._pendingKeyRequests[userId]) {
|
||||||
|
this._pendingKeyRequests[userId] = Object.create(null);
|
||||||
|
}
|
||||||
|
if (!this._pendingKeyRequests[userId][deviceId]) {
|
||||||
|
this._pendingKeyRequests[userId][deviceId] = [];
|
||||||
|
}
|
||||||
|
|
||||||
|
// check if we already have this request
|
||||||
|
const requests = this._pendingKeyRequests[userId][deviceId];
|
||||||
|
if (requests.find((r) => r.requestId === requestId)) {
|
||||||
|
console.log("Already have this key request, ignoring");
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
requests.push(keyRequest);
|
||||||
|
|
||||||
|
if (this._currentUser) {
|
||||||
|
// ignore for now
|
||||||
|
console.log("Key request, but we already have a dialog open");
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
this._processNextRequest();
|
||||||
|
}
|
||||||
|
|
||||||
|
handleKeyRequestCancellation(cancellation) {
|
||||||
|
// see if we can find the request in the queue
|
||||||
|
const userId = cancellation.userId;
|
||||||
|
const deviceId = cancellation.deviceId;
|
||||||
|
const requestId = cancellation.requestId;
|
||||||
|
|
||||||
|
if (userId === this._currentUser && deviceId === this._currentDevice) {
|
||||||
|
console.log(
|
||||||
|
"room key request cancellation for the user we currently have a"
|
||||||
|
+ " dialog open for",
|
||||||
|
);
|
||||||
|
// TODO: update the dialog. For now, we just ignore the
|
||||||
|
// cancellation.
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!this._pendingKeyRequests[userId]) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
const requests = this._pendingKeyRequests[userId][deviceId];
|
||||||
|
if (!requests) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
const idx = requests.findIndex((r) => r.requestId === requestId);
|
||||||
|
if (idx < 0) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
console.log("Forgetting room key request");
|
||||||
|
requests.splice(idx, 1);
|
||||||
|
if (requests.length === 0) {
|
||||||
|
delete this._pendingKeyRequests[userId][deviceId];
|
||||||
|
if (Object.keys(this._pendingKeyRequests[userId]).length === 0) {
|
||||||
|
delete this._pendingKeyRequests[userId];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
_processNextRequest() {
|
||||||
|
const userId = Object.keys(this._pendingKeyRequests)[0];
|
||||||
|
if (!userId) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
const deviceId = Object.keys(this._pendingKeyRequests[userId])[0];
|
||||||
|
if (!deviceId) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
console.log(`Starting KeyShareDialog for ${userId}:${deviceId}`);
|
||||||
|
|
||||||
|
const finished = (r) => {
|
||||||
|
this._currentUser = null;
|
||||||
|
this._currentDevice = null;
|
||||||
|
|
||||||
|
if (r) {
|
||||||
|
for (const req of this._pendingKeyRequests[userId][deviceId]) {
|
||||||
|
req.share();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
delete this._pendingKeyRequests[userId][deviceId];
|
||||||
|
if (Object.keys(this._pendingKeyRequests[userId]).length === 0) {
|
||||||
|
delete this._pendingKeyRequests[userId];
|
||||||
|
}
|
||||||
|
|
||||||
|
this._processNextRequest();
|
||||||
|
};
|
||||||
|
|
||||||
|
const KeyShareDialog = sdk.getComponent("dialogs.KeyShareDialog");
|
||||||
|
Modal.createDialog(KeyShareDialog, {
|
||||||
|
matrixClient: this._matrixClient,
|
||||||
|
userId: userId,
|
||||||
|
deviceId: deviceId,
|
||||||
|
onFinished: finished,
|
||||||
|
});
|
||||||
|
this._currentUser = userId;
|
||||||
|
this._currentDevice = deviceId;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
270
src/Lifecycle.js
270
src/Lifecycle.js
|
@ -19,6 +19,8 @@ import q from 'q';
|
||||||
import Matrix from 'matrix-js-sdk';
|
import Matrix from 'matrix-js-sdk';
|
||||||
|
|
||||||
import MatrixClientPeg from './MatrixClientPeg';
|
import MatrixClientPeg from './MatrixClientPeg';
|
||||||
|
import createMatrixClient from './utils/createMatrixClient';
|
||||||
|
import Analytics from './Analytics';
|
||||||
import Notifier from './Notifier';
|
import Notifier from './Notifier';
|
||||||
import UserActivity from './UserActivity';
|
import UserActivity from './UserActivity';
|
||||||
import Presence from './Presence';
|
import Presence from './Presence';
|
||||||
|
@ -32,29 +34,20 @@ import sdk from './index';
|
||||||
* Called at startup, to attempt to build a logged-in Matrix session. It tries
|
* Called at startup, to attempt to build a logged-in Matrix session. It tries
|
||||||
* a number of things:
|
* a number of things:
|
||||||
*
|
*
|
||||||
* 0. if it looks like we are in the middle of a registration process, it does
|
|
||||||
* nothing.
|
|
||||||
*
|
*
|
||||||
* 1. if we have a loginToken in the (real) query params, it uses that to log
|
* 1. if we have a guest access token in the fragment query params, it uses
|
||||||
* in.
|
|
||||||
*
|
|
||||||
* 2. if we have a guest access token in the fragment query params, it uses
|
|
||||||
* that.
|
* that.
|
||||||
*
|
*
|
||||||
* 3. if an access token is stored in local storage (from a previous session),
|
* 2. if an access token is stored in local storage (from a previous session),
|
||||||
* it uses that.
|
* it uses that.
|
||||||
*
|
*
|
||||||
* 4. it attempts to auto-register as a guest user.
|
* 3. it attempts to auto-register as a guest user.
|
||||||
*
|
*
|
||||||
* If any of steps 1-4 are successful, it will call {setLoggedIn}, which in
|
* If any of steps 1-4 are successful, it will call {_doSetLoggedIn}, which in
|
||||||
* turn will raise on_logged_in and will_start_client events.
|
* turn will raise on_logged_in and will_start_client events.
|
||||||
*
|
*
|
||||||
* @param {object} opts
|
* @param {object} opts
|
||||||
*
|
*
|
||||||
* @param {object} opts.realQueryParams: string->string map of the
|
|
||||||
* query-parameters extracted from the real query-string of the starting
|
|
||||||
* URI.
|
|
||||||
*
|
|
||||||
* @param {object} opts.fragmentQueryParams: string->string map of the
|
* @param {object} opts.fragmentQueryParams: string->string map of the
|
||||||
* query-parameters extracted from the #-fragment of the starting URI.
|
* query-parameters extracted from the #-fragment of the starting URI.
|
||||||
*
|
*
|
||||||
|
@ -68,54 +61,38 @@ import sdk from './index';
|
||||||
* true; defines the IS to use.
|
* true; defines the IS to use.
|
||||||
*
|
*
|
||||||
* @returns {Promise} a promise which resolves when the above process completes.
|
* @returns {Promise} a promise which resolves when the above process completes.
|
||||||
|
* Resolves to `true` if we ended up starting a session, or `false` if we
|
||||||
|
* failed.
|
||||||
*/
|
*/
|
||||||
export function loadSession(opts) {
|
export function loadSession(opts) {
|
||||||
const realQueryParams = opts.realQueryParams || {};
|
|
||||||
const fragmentQueryParams = opts.fragmentQueryParams || {};
|
const fragmentQueryParams = opts.fragmentQueryParams || {};
|
||||||
let enableGuest = opts.enableGuest || false;
|
let enableGuest = opts.enableGuest || false;
|
||||||
const guestHsUrl = opts.guestHsUrl;
|
const guestHsUrl = opts.guestHsUrl;
|
||||||
const guestIsUrl = opts.guestIsUrl;
|
const guestIsUrl = opts.guestIsUrl;
|
||||||
const defaultDeviceDisplayName = opts.defaultDeviceDisplayName;
|
const defaultDeviceDisplayName = opts.defaultDeviceDisplayName;
|
||||||
|
|
||||||
if (fragmentQueryParams.client_secret && fragmentQueryParams.sid) {
|
|
||||||
// this happens during email validation: the email contains a link to the
|
|
||||||
// IS, which in turn redirects back to vector. We let MatrixChat create a
|
|
||||||
// Registration component which completes the next stage of registration.
|
|
||||||
console.log("Not registering as guest: registration already in progress.");
|
|
||||||
return q();
|
|
||||||
}
|
|
||||||
|
|
||||||
if (!guestHsUrl) {
|
if (!guestHsUrl) {
|
||||||
console.warn("Cannot enable guest access: can't determine HS URL to use");
|
console.warn("Cannot enable guest access: can't determine HS URL to use");
|
||||||
enableGuest = false;
|
enableGuest = false;
|
||||||
}
|
}
|
||||||
|
|
||||||
if (realQueryParams.loginToken) {
|
|
||||||
if (!realQueryParams.homeserver) {
|
|
||||||
console.warn("Cannot log in with token: can't determine HS URL to use");
|
|
||||||
} else {
|
|
||||||
return _loginWithToken(realQueryParams, defaultDeviceDisplayName);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (enableGuest &&
|
if (enableGuest &&
|
||||||
fragmentQueryParams.guest_user_id &&
|
fragmentQueryParams.guest_user_id &&
|
||||||
fragmentQueryParams.guest_access_token
|
fragmentQueryParams.guest_access_token
|
||||||
) {
|
) {
|
||||||
console.log("Using guest access credentials");
|
console.log("Using guest access credentials");
|
||||||
setLoggedIn({
|
return _doSetLoggedIn({
|
||||||
userId: fragmentQueryParams.guest_user_id,
|
userId: fragmentQueryParams.guest_user_id,
|
||||||
accessToken: fragmentQueryParams.guest_access_token,
|
accessToken: fragmentQueryParams.guest_access_token,
|
||||||
homeserverUrl: guestHsUrl,
|
homeserverUrl: guestHsUrl,
|
||||||
identityServerUrl: guestIsUrl,
|
identityServerUrl: guestIsUrl,
|
||||||
guest: true,
|
guest: true,
|
||||||
});
|
}, true).then(() => true);
|
||||||
return q();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
return _restoreFromLocalStorage().then((success) => {
|
return _restoreFromLocalStorage().then((success) => {
|
||||||
if (success) {
|
if (success) {
|
||||||
return;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
if (enableGuest) {
|
if (enableGuest) {
|
||||||
|
@ -123,10 +100,30 @@ export function loadSession(opts) {
|
||||||
}
|
}
|
||||||
|
|
||||||
// fall back to login screen
|
// fall back to login screen
|
||||||
|
return false;
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
function _loginWithToken(queryParams, defaultDeviceDisplayName) {
|
/**
|
||||||
|
* @param {Object} queryParams string->string map of the
|
||||||
|
* query-parameters extracted from the real query-string of the starting
|
||||||
|
* URI.
|
||||||
|
*
|
||||||
|
* @param {String} defaultDeviceDisplayName
|
||||||
|
*
|
||||||
|
* @returns {Promise} promise which resolves to true if we completed the token
|
||||||
|
* login, else false
|
||||||
|
*/
|
||||||
|
export function attemptTokenLogin(queryParams, defaultDeviceDisplayName) {
|
||||||
|
if (!queryParams.loginToken) {
|
||||||
|
return q(false);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!queryParams.homeserver) {
|
||||||
|
console.warn("Cannot log in with token: can't determine HS URL to use");
|
||||||
|
return q(false);
|
||||||
|
}
|
||||||
|
|
||||||
// create a temporary MatrixClient to do the login
|
// create a temporary MatrixClient to do the login
|
||||||
const client = Matrix.createClient({
|
const client = Matrix.createClient({
|
||||||
baseUrl: queryParams.homeserver,
|
baseUrl: queryParams.homeserver,
|
||||||
|
@ -139,22 +136,26 @@ function _loginWithToken(queryParams, defaultDeviceDisplayName) {
|
||||||
},
|
},
|
||||||
).then(function(data) {
|
).then(function(data) {
|
||||||
console.log("Logged in with token");
|
console.log("Logged in with token");
|
||||||
setLoggedIn({
|
return _clearStorage().then(() => {
|
||||||
userId: data.user_id,
|
_persistCredentialsToLocalStorage({
|
||||||
deviceId: data.device_id,
|
userId: data.user_id,
|
||||||
accessToken: data.access_token,
|
deviceId: data.device_id,
|
||||||
homeserverUrl: queryParams.homeserver,
|
accessToken: data.access_token,
|
||||||
identityServerUrl: queryParams.identityServer,
|
homeserverUrl: queryParams.homeserver,
|
||||||
guest: false,
|
identityServerUrl: queryParams.identityServer,
|
||||||
|
guest: false,
|
||||||
|
});
|
||||||
|
return true;
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}).catch((err) => {
|
||||||
console.error("Failed to log in with login token: " + err + " " +
|
console.error("Failed to log in with login token: " + err + " " +
|
||||||
err.data);
|
err.data);
|
||||||
|
return false;
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
function _registerAsGuest(hsUrl, isUrl, defaultDeviceDisplayName) {
|
function _registerAsGuest(hsUrl, isUrl, defaultDeviceDisplayName) {
|
||||||
console.log("Doing guest login on %s", hsUrl);
|
console.log(`Doing guest login on ${hsUrl}`);
|
||||||
|
|
||||||
// TODO: we should probably de-duplicate this and Login.loginAsGuest.
|
// TODO: we should probably de-duplicate this and Login.loginAsGuest.
|
||||||
// Not really sure where the right home for it is.
|
// Not really sure where the right home for it is.
|
||||||
|
@ -169,22 +170,31 @@ function _registerAsGuest(hsUrl, isUrl, defaultDeviceDisplayName) {
|
||||||
initial_device_display_name: defaultDeviceDisplayName,
|
initial_device_display_name: defaultDeviceDisplayName,
|
||||||
},
|
},
|
||||||
}).then((creds) => {
|
}).then((creds) => {
|
||||||
console.log("Registered as guest: %s", creds.user_id);
|
console.log(`Registered as guest: ${creds.user_id}`);
|
||||||
setLoggedIn({
|
return _doSetLoggedIn({
|
||||||
userId: creds.user_id,
|
userId: creds.user_id,
|
||||||
deviceId: creds.device_id,
|
deviceId: creds.device_id,
|
||||||
accessToken: creds.access_token,
|
accessToken: creds.access_token,
|
||||||
homeserverUrl: hsUrl,
|
homeserverUrl: hsUrl,
|
||||||
identityServerUrl: isUrl,
|
identityServerUrl: isUrl,
|
||||||
guest: true,
|
guest: true,
|
||||||
});
|
}, true).then(() => true);
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
console.error("Failed to register as guest: " + err + " " + err.data);
|
console.error("Failed to register as guest: " + err + " " + err.data);
|
||||||
|
return false;
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
// returns a promise which resolves to true if a session is found in
|
// returns a promise which resolves to true if a session is found in
|
||||||
// localstorage
|
// localstorage
|
||||||
|
//
|
||||||
|
// N.B. Lifecycle.js should not maintain any further localStorage state, we
|
||||||
|
// are moving towards using SessionStore to keep track of state related
|
||||||
|
// to the current session (which is typically backed by localStorage).
|
||||||
|
//
|
||||||
|
// The plan is to gradually move the localStorage access done here into
|
||||||
|
// SessionStore to avoid bugs where the view becomes out-of-sync with
|
||||||
|
// localStorage (e.g. teamToken, isGuest etc.)
|
||||||
function _restoreFromLocalStorage() {
|
function _restoreFromLocalStorage() {
|
||||||
if (!localStorage) {
|
if (!localStorage) {
|
||||||
return q(false);
|
return q(false);
|
||||||
|
@ -204,17 +214,16 @@ function _restoreFromLocalStorage() {
|
||||||
}
|
}
|
||||||
|
|
||||||
if (accessToken && userId && hsUrl) {
|
if (accessToken && userId && hsUrl) {
|
||||||
console.log("Restoring session for %s", userId);
|
console.log(`Restoring session for ${userId}`);
|
||||||
try {
|
try {
|
||||||
setLoggedIn({
|
return _doSetLoggedIn({
|
||||||
userId: userId,
|
userId: userId,
|
||||||
deviceId: deviceId,
|
deviceId: deviceId,
|
||||||
accessToken: accessToken,
|
accessToken: accessToken,
|
||||||
homeserverUrl: hsUrl,
|
homeserverUrl: hsUrl,
|
||||||
identityServerUrl: isUrl,
|
identityServerUrl: isUrl,
|
||||||
guest: isGuest,
|
guest: isGuest,
|
||||||
});
|
}, false).then(() => true);
|
||||||
return q(true);
|
|
||||||
} catch (e) {
|
} catch (e) {
|
||||||
return _handleRestoreFailure(e);
|
return _handleRestoreFailure(e);
|
||||||
}
|
}
|
||||||
|
@ -227,25 +236,12 @@ function _restoreFromLocalStorage() {
|
||||||
function _handleRestoreFailure(e) {
|
function _handleRestoreFailure(e) {
|
||||||
console.log("Unable to restore session", e);
|
console.log("Unable to restore session", e);
|
||||||
|
|
||||||
let msg = e.message;
|
|
||||||
if (msg == "OLM.BAD_LEGACY_ACCOUNT_PICKLE") {
|
|
||||||
msg = "You need to log back in to generate end-to-end encryption keys "
|
|
||||||
+ "for this device and submit the public key to your homeserver. "
|
|
||||||
+ "This is a once off; sorry for the inconvenience.";
|
|
||||||
|
|
||||||
_clearLocalStorage();
|
|
||||||
|
|
||||||
return q.reject(new Error(
|
|
||||||
"Unable to restore previous session: " + msg,
|
|
||||||
));
|
|
||||||
}
|
|
||||||
|
|
||||||
const def = q.defer();
|
const def = q.defer();
|
||||||
const SessionRestoreErrorDialog =
|
const SessionRestoreErrorDialog =
|
||||||
sdk.getComponent('views.dialogs.SessionRestoreErrorDialog');
|
sdk.getComponent('views.dialogs.SessionRestoreErrorDialog');
|
||||||
|
|
||||||
Modal.createDialog(SessionRestoreErrorDialog, {
|
Modal.createDialog(SessionRestoreErrorDialog, {
|
||||||
error: msg,
|
error: e.message,
|
||||||
onFinished: (success) => {
|
onFinished: (success) => {
|
||||||
def.resolve(success);
|
def.resolve(success);
|
||||||
},
|
},
|
||||||
|
@ -254,7 +250,7 @@ function _handleRestoreFailure(e) {
|
||||||
return def.promise.then((success) => {
|
return def.promise.then((success) => {
|
||||||
if (success) {
|
if (success) {
|
||||||
// user clicked continue.
|
// user clicked continue.
|
||||||
_clearLocalStorage();
|
_clearStorage();
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -265,50 +261,79 @@ function _handleRestoreFailure(e) {
|
||||||
|
|
||||||
let rtsClient = null;
|
let rtsClient = null;
|
||||||
export function initRtsClient(url) {
|
export function initRtsClient(url) {
|
||||||
rtsClient = new RtsClient(url);
|
if (url) {
|
||||||
|
rtsClient = new RtsClient(url);
|
||||||
|
} else {
|
||||||
|
rtsClient = null;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Transitions to a logged-in state using the given credentials
|
* Transitions to a logged-in state using the given credentials.
|
||||||
|
*
|
||||||
|
* Starts the matrix client and all other react-sdk services that
|
||||||
|
* listen for events while a session is logged in.
|
||||||
|
*
|
||||||
|
* Also stops the old MatrixClient and clears old credentials/etc out of
|
||||||
|
* storage before starting the new client.
|
||||||
|
*
|
||||||
* @param {MatrixClientCreds} credentials The credentials to use
|
* @param {MatrixClientCreds} credentials The credentials to use
|
||||||
|
*
|
||||||
|
* @returns {Promise} promise which resolves to the new MatrixClient once it has been started
|
||||||
*/
|
*/
|
||||||
export function setLoggedIn(credentials) {
|
export function setLoggedIn(credentials) {
|
||||||
|
stopMatrixClient();
|
||||||
|
return _doSetLoggedIn(credentials, true);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* fires on_logging_in, optionally clears localstorage, persists new credentials
|
||||||
|
* to localstorage, starts the new client.
|
||||||
|
*
|
||||||
|
* @param {MatrixClientCreds} credentials
|
||||||
|
* @param {Boolean} clearStorage
|
||||||
|
*
|
||||||
|
* @returns {Promise} promise which resolves to the new MatrixClient once it has been started
|
||||||
|
*/
|
||||||
|
async function _doSetLoggedIn(credentials, clearStorage) {
|
||||||
credentials.guest = Boolean(credentials.guest);
|
credentials.guest = Boolean(credentials.guest);
|
||||||
|
|
||||||
console.log(
|
console.log(
|
||||||
"setLoggedIn: mxid:", credentials.userId,
|
"setLoggedIn: mxid: " + credentials.userId +
|
||||||
"deviceId:", credentials.deviceId,
|
" deviceId: " + credentials.deviceId +
|
||||||
"guest:", credentials.guest,
|
" guest: " + credentials.guest +
|
||||||
"hs:", credentials.homeserverUrl,
|
" hs: " + credentials.homeserverUrl,
|
||||||
);
|
);
|
||||||
|
|
||||||
// This is dispatched to indicate that the user is still in the process of logging in
|
// This is dispatched to indicate that the user is still in the process of logging in
|
||||||
// because `teamPromise` may take some time to resolve, breaking the assumption that
|
// because `teamPromise` may take some time to resolve, breaking the assumption that
|
||||||
// `setLoggedIn` takes an "instant" to complete, and dispatch `on_logged_in` a few ms
|
// `setLoggedIn` takes an "instant" to complete, and dispatch `on_logged_in` a few ms
|
||||||
// later than MatrixChat might assume.
|
// later than MatrixChat might assume.
|
||||||
dis.dispatch({action: 'on_logging_in'});
|
dis.dispatch({action: 'on_logging_in'});
|
||||||
|
|
||||||
|
if (clearStorage) {
|
||||||
|
await _clearStorage();
|
||||||
|
}
|
||||||
|
|
||||||
|
Analytics.setGuest(credentials.guest);
|
||||||
|
|
||||||
// Resolves by default
|
// Resolves by default
|
||||||
let teamPromise = Promise.resolve(null);
|
let teamPromise = Promise.resolve(null);
|
||||||
|
|
||||||
// persist the session
|
|
||||||
if (localStorage) {
|
if (localStorage) {
|
||||||
try {
|
try {
|
||||||
localStorage.setItem("mx_hs_url", credentials.homeserverUrl);
|
_persistCredentialsToLocalStorage(credentials);
|
||||||
localStorage.setItem("mx_is_url", credentials.identityServerUrl);
|
|
||||||
localStorage.setItem("mx_user_id", credentials.userId);
|
|
||||||
localStorage.setItem("mx_access_token", credentials.accessToken);
|
|
||||||
localStorage.setItem("mx_is_guest", JSON.stringify(credentials.guest));
|
|
||||||
|
|
||||||
// if we didn't get a deviceId from the login, leave mx_device_id unset,
|
// The user registered as a PWLU (PassWord-Less User), the generated password
|
||||||
// rather than setting it to "undefined".
|
// is cached here such that the user can change it at a later time.
|
||||||
//
|
if (credentials.password) {
|
||||||
// (in this case MatrixClient doesn't bother with the crypto stuff
|
// Update SessionStore
|
||||||
// - that's fine for us).
|
dis.dispatch({
|
||||||
if (credentials.deviceId) {
|
action: 'cached_password',
|
||||||
localStorage.setItem("mx_device_id", credentials.deviceId);
|
cachedPassword: credentials.password,
|
||||||
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
console.log("Session persisted for %s", credentials.userId);
|
|
||||||
} catch (e) {
|
} catch (e) {
|
||||||
console.warn("Error using local storage: can't persist session!", e);
|
console.warn("Error using local storage: can't persist session!", e);
|
||||||
}
|
}
|
||||||
|
@ -325,9 +350,6 @@ export function setLoggedIn(credentials) {
|
||||||
console.warn("No local storage available: can't persist session!");
|
console.warn("No local storage available: can't persist session!");
|
||||||
}
|
}
|
||||||
|
|
||||||
// stop any running clients before we create a new one with these new credentials
|
|
||||||
stopMatrixClient();
|
|
||||||
|
|
||||||
MatrixClientPeg.replaceUsingCreds(credentials);
|
MatrixClientPeg.replaceUsingCreds(credentials);
|
||||||
|
|
||||||
teamPromise.then((teamToken) => {
|
teamPromise.then((teamToken) => {
|
||||||
|
@ -338,6 +360,26 @@ export function setLoggedIn(credentials) {
|
||||||
});
|
});
|
||||||
|
|
||||||
startMatrixClient();
|
startMatrixClient();
|
||||||
|
return MatrixClientPeg.get();
|
||||||
|
}
|
||||||
|
|
||||||
|
function _persistCredentialsToLocalStorage(credentials) {
|
||||||
|
localStorage.setItem("mx_hs_url", credentials.homeserverUrl);
|
||||||
|
localStorage.setItem("mx_is_url", credentials.identityServerUrl);
|
||||||
|
localStorage.setItem("mx_user_id", credentials.userId);
|
||||||
|
localStorage.setItem("mx_access_token", credentials.accessToken);
|
||||||
|
localStorage.setItem("mx_is_guest", JSON.stringify(credentials.guest));
|
||||||
|
|
||||||
|
// if we didn't get a deviceId from the login, leave mx_device_id unset,
|
||||||
|
// rather than setting it to "undefined".
|
||||||
|
//
|
||||||
|
// (in this case MatrixClient doesn't bother with the crypto stuff
|
||||||
|
// - that's fine for us).
|
||||||
|
if (credentials.deviceId) {
|
||||||
|
localStorage.setItem("mx_device_id", credentials.deviceId);
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log(`Session persisted for ${credentials.userId}`);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
@ -376,7 +418,7 @@ export function logout() {
|
||||||
* Starts the matrix client and all other react-sdk services that
|
* Starts the matrix client and all other react-sdk services that
|
||||||
* listen for events while a session is logged in.
|
* listen for events while a session is logged in.
|
||||||
*/
|
*/
|
||||||
export function startMatrixClient() {
|
function startMatrixClient() {
|
||||||
// dispatch this before starting the matrix client: it's used
|
// dispatch this before starting the matrix client: it's used
|
||||||
// to add listeners for the 'sync' event so otherwise we'd have
|
// to add listeners for the 'sync' event so otherwise we'd have
|
||||||
// a race condition (and we need to dispatch synchronously for this
|
// a race condition (and we need to dispatch synchronously for this
|
||||||
|
@ -392,33 +434,44 @@ export function startMatrixClient() {
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Stops a running client and all related services, used after
|
* Stops a running client and all related services, and clears persistent
|
||||||
* a session has been logged out / ended.
|
* storage. Used after a session has been logged out.
|
||||||
*/
|
*/
|
||||||
export function onLoggedOut() {
|
export function onLoggedOut() {
|
||||||
_clearLocalStorage();
|
|
||||||
stopMatrixClient();
|
stopMatrixClient();
|
||||||
|
_clearStorage().done();
|
||||||
dis.dispatch({action: 'on_logged_out'});
|
dis.dispatch({action: 'on_logged_out'});
|
||||||
}
|
}
|
||||||
|
|
||||||
function _clearLocalStorage() {
|
/**
|
||||||
if (!window.localStorage) {
|
* @returns {Promise} promise which resolves once the stores have been cleared
|
||||||
return;
|
*/
|
||||||
}
|
function _clearStorage() {
|
||||||
const hsUrl = window.localStorage.getItem("mx_hs_url");
|
Analytics.logout();
|
||||||
const isUrl = window.localStorage.getItem("mx_is_url");
|
|
||||||
window.localStorage.clear();
|
|
||||||
|
|
||||||
// preserve our HS & IS URLs for convenience
|
if (window.localStorage) {
|
||||||
// N.B. we cache them in hsUrl/isUrl and can't really inline them
|
const hsUrl = window.localStorage.getItem("mx_hs_url");
|
||||||
// as getCurrentHsUrl() may call through to localStorage.
|
const isUrl = window.localStorage.getItem("mx_is_url");
|
||||||
// NB. We do clear the device ID (as well as all the settings)
|
window.localStorage.clear();
|
||||||
if (hsUrl) window.localStorage.setItem("mx_hs_url", hsUrl);
|
|
||||||
if (isUrl) window.localStorage.setItem("mx_is_url", isUrl);
|
// preserve our HS & IS URLs for convenience
|
||||||
|
// N.B. we cache them in hsUrl/isUrl and can't really inline them
|
||||||
|
// as getCurrentHsUrl() may call through to localStorage.
|
||||||
|
// NB. We do clear the device ID (as well as all the settings)
|
||||||
|
if (hsUrl) window.localStorage.setItem("mx_hs_url", hsUrl);
|
||||||
|
if (isUrl) window.localStorage.setItem("mx_is_url", isUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
// create a temporary client to clear out the persistent stores.
|
||||||
|
const cli = createMatrixClient({
|
||||||
|
// we'll never make any requests, so can pass a bogus HS URL
|
||||||
|
baseUrl: "",
|
||||||
|
});
|
||||||
|
return cli.clearStores();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Stop all the background processes related to the current client
|
* Stop all the background processes related to the current client.
|
||||||
*/
|
*/
|
||||||
export function stopMatrixClient() {
|
export function stopMatrixClient() {
|
||||||
Notifier.stop();
|
Notifier.stop();
|
||||||
|
@ -429,7 +482,6 @@ export function stopMatrixClient() {
|
||||||
if (cli) {
|
if (cli) {
|
||||||
cli.stopClient();
|
cli.stopClient();
|
||||||
cli.removeAllListeners();
|
cli.removeAllListeners();
|
||||||
cli.store.deleteAllData();
|
|
||||||
MatrixClientPeg.unset();
|
MatrixClientPeg.unset();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
34
src/Login.js
34
src/Login.js
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
import Matrix from "matrix-js-sdk";
|
import Matrix from "matrix-js-sdk";
|
||||||
|
import { _t } from "./languageHandler";
|
||||||
|
|
||||||
import q from 'q';
|
import q from 'q';
|
||||||
import url from 'url';
|
import url from 'url';
|
||||||
|
@ -96,11 +97,6 @@ export default class Login {
|
||||||
guest: true
|
guest: true
|
||||||
};
|
};
|
||||||
}, (error) => {
|
}, (error) => {
|
||||||
if (error.httpStatus === 403) {
|
|
||||||
error.friendlyText = "Guest access is disabled on this Home Server.";
|
|
||||||
} else {
|
|
||||||
error.friendlyText = "Failed to register as guest: " + error.data;
|
|
||||||
}
|
|
||||||
throw error;
|
throw error;
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
@ -156,15 +152,7 @@ export default class Login {
|
||||||
accessToken: data.access_token
|
accessToken: data.access_token
|
||||||
});
|
});
|
||||||
}, function(error) {
|
}, function(error) {
|
||||||
if (error.httpStatus == 400 && loginParams.medium) {
|
if (error.httpStatus === 403) {
|
||||||
error.friendlyText = (
|
|
||||||
'This Home Server does not support login using email address.'
|
|
||||||
);
|
|
||||||
}
|
|
||||||
else if (error.httpStatus === 403) {
|
|
||||||
error.friendlyText = (
|
|
||||||
'Incorrect username and/or password.'
|
|
||||||
);
|
|
||||||
if (self._fallbackHsUrl) {
|
if (self._fallbackHsUrl) {
|
||||||
var fbClient = Matrix.createClient({
|
var fbClient = Matrix.createClient({
|
||||||
baseUrl: self._fallbackHsUrl,
|
baseUrl: self._fallbackHsUrl,
|
||||||
|
@ -185,21 +173,23 @@ export default class Login {
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else {
|
|
||||||
error.friendlyText = (
|
|
||||||
'There was a problem logging in. (HTTP ' + error.httpStatus + ")"
|
|
||||||
);
|
|
||||||
}
|
|
||||||
throw error;
|
throw error;
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
redirectToCas() {
|
redirectToCas() {
|
||||||
var client = this._createTemporaryClient();
|
const client = this._createTemporaryClient();
|
||||||
var parsedUrl = url.parse(window.location.href, true);
|
const parsedUrl = url.parse(window.location.href, true);
|
||||||
|
|
||||||
|
// XXX: at this point, the fragment will always be #/login, which is no
|
||||||
|
// use to anyone. Ideally, we would get the intended fragment from
|
||||||
|
// MatrixChat.screenAfterLogin so that you could follow #/room links etc
|
||||||
|
// through a CAS login.
|
||||||
|
parsedUrl.hash = "";
|
||||||
|
|
||||||
parsedUrl.query["homeserver"] = client.getHomeserverUrl();
|
parsedUrl.query["homeserver"] = client.getHomeserverUrl();
|
||||||
parsedUrl.query["identityServer"] = client.getIdentityServerUrl();
|
parsedUrl.query["identityServer"] = client.getIdentityServerUrl();
|
||||||
var casUrl = client.getCasLoginUrl(url.format(parsedUrl));
|
const casUrl = client.getCasLoginUrl(url.format(parsedUrl));
|
||||||
window.location.href = casUrl;
|
window.location.href = casUrl;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,5 +1,6 @@
|
||||||
/*
|
/*
|
||||||
Copyright 2015, 2016 OpenMarket Ltd
|
Copyright 2015, 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd.
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
you may not use this file except in compliance with the License.
|
you may not use this file except in compliance with the License.
|
||||||
|
@ -16,13 +17,10 @@ limitations under the License.
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
import q from "q";
|
|
||||||
import Matrix from 'matrix-js-sdk';
|
|
||||||
import utils from 'matrix-js-sdk/lib/utils';
|
import utils from 'matrix-js-sdk/lib/utils';
|
||||||
import EventTimeline from 'matrix-js-sdk/lib/models/event-timeline';
|
import EventTimeline from 'matrix-js-sdk/lib/models/event-timeline';
|
||||||
import EventTimelineSet from 'matrix-js-sdk/lib/models/event-timeline-set';
|
import EventTimelineSet from 'matrix-js-sdk/lib/models/event-timeline-set';
|
||||||
|
import createMatrixClient from './utils/createMatrixClient';
|
||||||
const localStorage = window.localStorage;
|
|
||||||
|
|
||||||
interface MatrixClientCreds {
|
interface MatrixClientCreds {
|
||||||
homeserverUrl: string,
|
homeserverUrl: string,
|
||||||
|
@ -50,7 +48,6 @@ class MatrixClientPeg {
|
||||||
this.opts = {
|
this.opts = {
|
||||||
initialSyncLimit: 20,
|
initialSyncLimit: 20,
|
||||||
};
|
};
|
||||||
this.indexedDbWorkerScript = null;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
@ -61,7 +58,7 @@ class MatrixClientPeg {
|
||||||
* @param {string} script href to the script to be passed to the web worker
|
* @param {string} script href to the script to be passed to the web worker
|
||||||
*/
|
*/
|
||||||
setIndexedDbWorkerScript(script) {
|
setIndexedDbWorkerScript(script) {
|
||||||
this.indexedDbWorkerScript = script;
|
createMatrixClient.indexedDbWorkerScript = script;
|
||||||
}
|
}
|
||||||
|
|
||||||
get(): MatrixClient {
|
get(): MatrixClient {
|
||||||
|
@ -87,7 +84,9 @@ class MatrixClientPeg {
|
||||||
|
|
||||||
let promise = this.matrixClient.store.startup();
|
let promise = this.matrixClient.store.startup();
|
||||||
// log any errors when starting up the database (if one exists)
|
// log any errors when starting up the database (if one exists)
|
||||||
promise.catch((err) => { console.error(err); });
|
promise.catch((err) => {
|
||||||
|
console.error(`Error starting matrixclient store: ${err}`);
|
||||||
|
});
|
||||||
|
|
||||||
// regardless of errors, start the client. If we did error out, we'll
|
// regardless of errors, start the client. If we did error out, we'll
|
||||||
// just end up doing a full initial /sync.
|
// just end up doing a full initial /sync.
|
||||||
|
@ -130,22 +129,7 @@ class MatrixClientPeg {
|
||||||
timelineSupport: true,
|
timelineSupport: true,
|
||||||
};
|
};
|
||||||
|
|
||||||
if (localStorage) {
|
this.matrixClient = createMatrixClient(opts, this.indexedDbWorkerScript);
|
||||||
opts.sessionStore = new Matrix.WebStorageSessionStore(localStorage);
|
|
||||||
}
|
|
||||||
if (window.indexedDB && localStorage) {
|
|
||||||
// FIXME: bodge to remove old database. Remove this after a few weeks.
|
|
||||||
window.indexedDB.deleteDatabase("matrix-js-sdk:default");
|
|
||||||
|
|
||||||
opts.store = new Matrix.IndexedDBStore({
|
|
||||||
indexedDB: window.indexedDB,
|
|
||||||
dbName: "riot-web-sync",
|
|
||||||
localStorage: localStorage,
|
|
||||||
workerScript: this.indexedDbWorkerScript,
|
|
||||||
});
|
|
||||||
}
|
|
||||||
|
|
||||||
this.matrixClient = Matrix.createClient(opts);
|
|
||||||
|
|
||||||
// we're going to add eventlisteners for each matrix event tile, so the
|
// we're going to add eventlisteners for each matrix event tile, so the
|
||||||
// potential number of event listeners is quite high.
|
// potential number of event listeners is quite high.
|
||||||
|
|
10
src/Modal.js
10
src/Modal.js
|
@ -19,6 +19,7 @@ limitations under the License.
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
var ReactDOM = require('react-dom');
|
var ReactDOM = require('react-dom');
|
||||||
|
import Analytics from './Analytics';
|
||||||
import sdk from './index';
|
import sdk from './index';
|
||||||
|
|
||||||
const DIALOG_CONTAINER_ID = "mx_Dialog_Container";
|
const DIALOG_CONTAINER_ID = "mx_Dialog_Container";
|
||||||
|
@ -63,7 +64,6 @@ const AsyncWrapper = React.createClass({
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
const {loader, ...otherProps} = this.props;
|
const {loader, ...otherProps} = this.props;
|
||||||
|
|
||||||
if (this.state.component) {
|
if (this.state.component) {
|
||||||
const Component = this.state.component;
|
const Component = this.state.component;
|
||||||
return <Component {...otherProps} />;
|
return <Component {...otherProps} />;
|
||||||
|
@ -104,6 +104,9 @@ class ModalManager {
|
||||||
}
|
}
|
||||||
|
|
||||||
createDialog(Element, props, className) {
|
createDialog(Element, props, className) {
|
||||||
|
if (props && props.title) {
|
||||||
|
Analytics.trackEvent('Modal', props.title, 'createDialog');
|
||||||
|
}
|
||||||
return this.createDialogAsync((cb) => {cb(Element);}, props, className);
|
return this.createDialogAsync((cb) => {cb(Element);}, props, className);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -195,4 +198,7 @@ class ModalManager {
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
export default new ModalManager();
|
if (!global.singletonModalManager) {
|
||||||
|
global.singletonModalManager = new ModalManager();
|
||||||
|
}
|
||||||
|
export default global.singletonModalManager;
|
||||||
|
|
|
@ -18,9 +18,11 @@ limitations under the License.
|
||||||
import MatrixClientPeg from './MatrixClientPeg';
|
import MatrixClientPeg from './MatrixClientPeg';
|
||||||
import PlatformPeg from './PlatformPeg';
|
import PlatformPeg from './PlatformPeg';
|
||||||
import TextForEvent from './TextForEvent';
|
import TextForEvent from './TextForEvent';
|
||||||
|
import Analytics from './Analytics';
|
||||||
import Avatar from './Avatar';
|
import Avatar from './Avatar';
|
||||||
import dis from './dispatcher';
|
import dis from './dispatcher';
|
||||||
import sdk from './index';
|
import sdk from './index';
|
||||||
|
import { _t } from './languageHandler';
|
||||||
import Modal from './Modal';
|
import Modal from './Modal';
|
||||||
|
|
||||||
/*
|
/*
|
||||||
|
@ -120,6 +122,9 @@ const Notifier = {
|
||||||
setEnabled: function(enable, callback) {
|
setEnabled: function(enable, callback) {
|
||||||
const plaf = PlatformPeg.get();
|
const plaf = PlatformPeg.get();
|
||||||
if (!plaf) return;
|
if (!plaf) return;
|
||||||
|
|
||||||
|
Analytics.trackEvent('Notifier', 'Set Enabled', enable);
|
||||||
|
|
||||||
// make sure that we persist the current setting audio_enabled setting
|
// make sure that we persist the current setting audio_enabled setting
|
||||||
// before changing anything
|
// before changing anything
|
||||||
if (global.localStorage) {
|
if (global.localStorage) {
|
||||||
|
@ -134,13 +139,11 @@ const Notifier = {
|
||||||
if (result !== 'granted') {
|
if (result !== 'granted') {
|
||||||
// The permission request was dismissed or denied
|
// The permission request was dismissed or denied
|
||||||
const description = result === 'denied'
|
const description = result === 'denied'
|
||||||
? 'Riot does not have permission to send you notifications'
|
? _t('Riot does not have permission to send you notifications - please check your browser settings')
|
||||||
+ ' - please check your browser settings'
|
: _t('Riot was not given permission to send notifications - please try again');
|
||||||
: 'Riot was not given permission to send notifications'
|
|
||||||
+ ' - please try again';
|
|
||||||
const ErrorDialog = sdk.getComponent('dialogs.ErrorDialog');
|
const ErrorDialog = sdk.getComponent('dialogs.ErrorDialog');
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: 'Unable to enable Notifications',
|
title: _t('Unable to enable Notifications'),
|
||||||
description,
|
description,
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
|
@ -200,6 +203,8 @@ const Notifier = {
|
||||||
setToolbarHidden: function(hidden, persistent = true) {
|
setToolbarHidden: function(hidden, persistent = true) {
|
||||||
this.toolbarHidden = hidden;
|
this.toolbarHidden = hidden;
|
||||||
|
|
||||||
|
Analytics.trackEvent('Notifier', 'Set Toolbar Hidden', hidden);
|
||||||
|
|
||||||
// XXX: why are we dispatching this here?
|
// XXX: why are we dispatching this here?
|
||||||
// this is nothing to do with notifier_enabled
|
// this is nothing to do with notifier_enabled
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
|
@ -245,6 +250,7 @@ const Notifier = {
|
||||||
this._displayPopupNotification(ev, room);
|
this._displayPopupNotification(ev, room);
|
||||||
}
|
}
|
||||||
if (actions.tweaks.sound && this.isAudioEnabled()) {
|
if (actions.tweaks.sound && this.isAudioEnabled()) {
|
||||||
|
PlatformPeg.get().loudNotification(ev, room);
|
||||||
this._playAudioNotification(ev, room);
|
this._playAudioNotification(ev, room);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
|
@ -15,6 +15,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var Matrix = require("matrix-js-sdk");
|
var Matrix = require("matrix-js-sdk");
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Allows a user to reset their password on a homeserver.
|
* Allows a user to reset their password on a homeserver.
|
||||||
|
@ -53,7 +54,7 @@ class PasswordReset {
|
||||||
return res;
|
return res;
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
if (err.errcode == 'M_THREEPID_NOT_FOUND') {
|
if (err.errcode == 'M_THREEPID_NOT_FOUND') {
|
||||||
err.message = "This email address was not found";
|
err.message = _t('This email address was not found');
|
||||||
} else if (err.httpStatus) {
|
} else if (err.httpStatus) {
|
||||||
err.message = err.message + ` (Status ${err.httpStatus})`;
|
err.message = err.message + ` (Status ${err.httpStatus})`;
|
||||||
}
|
}
|
||||||
|
@ -78,10 +79,10 @@ class PasswordReset {
|
||||||
}
|
}
|
||||||
}, this.password).catch(function(err) {
|
}, this.password).catch(function(err) {
|
||||||
if (err.httpStatus === 401) {
|
if (err.httpStatus === 401) {
|
||||||
err.message = "Failed to verify email address: make sure you clicked the link in the email";
|
err.message = _t('Failed to verify email address: make sure you clicked the link in the email');
|
||||||
}
|
}
|
||||||
else if (err.httpStatus === 404) {
|
else if (err.httpStatus === 404) {
|
||||||
err.message = "Your email address does not appear to be associated with a Matrix ID on this Homeserver.";
|
err.message = _t('Your email address does not appear to be associated with a Matrix ID on this Homeserver.');
|
||||||
}
|
}
|
||||||
else if (err.httpStatus) {
|
else if (err.httpStatus) {
|
||||||
err.message += ` (Status ${err.httpStatus})`;
|
err.message += ` (Status ${err.httpStatus})`;
|
||||||
|
|
17
src/Roles.js
17
src/Roles.js
|
@ -13,14 +13,19 @@ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
See the License for the specific language governing permissions and
|
See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
export const LEVEL_ROLE_MAP = {
|
import { _t } from './languageHandler';
|
||||||
undefined: 'Default',
|
|
||||||
0: 'User',
|
export function levelRoleMap() {
|
||||||
50: 'Moderator',
|
return {
|
||||||
100: 'Admin',
|
undefined: _t('Default'),
|
||||||
};
|
0: _t('User'),
|
||||||
|
50: _t('Moderator'),
|
||||||
|
100: _t('Admin'),
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
export function textualPowerLevel(level, userDefault) {
|
export function textualPowerLevel(level, userDefault) {
|
||||||
|
const LEVEL_ROLE_MAP = this.levelRoleMap();
|
||||||
if (LEVEL_ROLE_MAP[level]) {
|
if (LEVEL_ROLE_MAP[level]) {
|
||||||
return LEVEL_ROLE_MAP[level] + (level !== undefined ? ` (${level})` : ` (${userDefault})`);
|
return LEVEL_ROLE_MAP[level] + (level !== undefined ? ` (${level})` : ` (${userDefault})`);
|
||||||
} else {
|
} else {
|
||||||
|
|
14
src/Rooms.js
14
src/Rooms.js
|
@ -15,7 +15,6 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
import MatrixClientPeg from './MatrixClientPeg';
|
import MatrixClientPeg from './MatrixClientPeg';
|
||||||
import DMRoomMap from './utils/DMRoomMap';
|
|
||||||
import q from 'q';
|
import q from 'q';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
@ -145,7 +144,18 @@ export function guessDMRoomTarget(room, me) {
|
||||||
let oldestTs;
|
let oldestTs;
|
||||||
let oldestUser;
|
let oldestUser;
|
||||||
|
|
||||||
// Pick the user who's been here longest (and isn't us)
|
// Pick the joined user who's been here longest (and isn't us),
|
||||||
|
for (const user of room.getJoinedMembers()) {
|
||||||
|
if (user.userId == me.userId) continue;
|
||||||
|
|
||||||
|
if (oldestTs === undefined || user.events.member.getTs() < oldestTs) {
|
||||||
|
oldestUser = user;
|
||||||
|
oldestTs = user.events.member.getTs();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (oldestUser) return oldestUser;
|
||||||
|
|
||||||
|
// if there are no joined members other than us, use the oldest member
|
||||||
for (const user of room.currentState.getMembers()) {
|
for (const user of room.currentState.getMembers()) {
|
||||||
if (user.userId == me.userId) continue;
|
if (user.userId == me.userId) continue;
|
||||||
|
|
||||||
|
|
|
@ -1,5 +1,7 @@
|
||||||
import 'whatwg-fetch';
|
import 'whatwg-fetch';
|
||||||
|
|
||||||
|
let fetchFunction = fetch;
|
||||||
|
|
||||||
function checkStatus(response) {
|
function checkStatus(response) {
|
||||||
if (!response.ok) {
|
if (!response.ok) {
|
||||||
return response.text().then((text) => {
|
return response.text().then((text) => {
|
||||||
|
@ -31,7 +33,7 @@ const request = (url, opts) => {
|
||||||
opts.body = JSON.stringify(opts.body);
|
opts.body = JSON.stringify(opts.body);
|
||||||
opts.headers['Content-Type'] = 'application/json';
|
opts.headers['Content-Type'] = 'application/json';
|
||||||
}
|
}
|
||||||
return fetch(url, opts)
|
return fetchFunction(url, opts)
|
||||||
.then(checkStatus)
|
.then(checkStatus)
|
||||||
.then(parseJson);
|
.then(parseJson);
|
||||||
};
|
};
|
||||||
|
@ -64,7 +66,7 @@ export default class RtsClient {
|
||||||
client_secret: clientSecret,
|
client_secret: clientSecret,
|
||||||
},
|
},
|
||||||
method: 'POST',
|
method: 'POST',
|
||||||
}
|
},
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -74,7 +76,7 @@ export default class RtsClient {
|
||||||
qs: {
|
qs: {
|
||||||
team_token: teamToken,
|
team_token: teamToken,
|
||||||
},
|
},
|
||||||
}
|
},
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -91,7 +93,12 @@ export default class RtsClient {
|
||||||
qs: {
|
qs: {
|
||||||
user_id: userId,
|
user_id: userId,
|
||||||
},
|
},
|
||||||
}
|
},
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// allow fetch to be replaced, for testing.
|
||||||
|
static setFetch(fn) {
|
||||||
|
fetchFunction = fn;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
|
@ -94,6 +94,22 @@ Example:
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
get_membership_count
|
||||||
|
--------------------
|
||||||
|
Get the number of joined users in the room.
|
||||||
|
|
||||||
|
Request:
|
||||||
|
- room_id is the room to get the count in.
|
||||||
|
Response:
|
||||||
|
78
|
||||||
|
Example:
|
||||||
|
{
|
||||||
|
action: "get_membership_count",
|
||||||
|
room_id: "!foo:bar",
|
||||||
|
response: 78
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
membership_state AND bot_options
|
membership_state AND bot_options
|
||||||
--------------------------------
|
--------------------------------
|
||||||
Get the content of the "m.room.member" or "m.room.bot.options" state event respectively.
|
Get the content of the "m.room.member" or "m.room.bot.options" state event respectively.
|
||||||
|
@ -125,6 +141,7 @@ const SdkConfig = require('./SdkConfig');
|
||||||
const MatrixClientPeg = require("./MatrixClientPeg");
|
const MatrixClientPeg = require("./MatrixClientPeg");
|
||||||
const MatrixEvent = require("matrix-js-sdk").MatrixEvent;
|
const MatrixEvent = require("matrix-js-sdk").MatrixEvent;
|
||||||
const dis = require("./dispatcher");
|
const dis = require("./dispatcher");
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
function sendResponse(event, res) {
|
function sendResponse(event, res) {
|
||||||
const data = JSON.parse(JSON.stringify(event.data));
|
const data = JSON.parse(JSON.stringify(event.data));
|
||||||
|
@ -150,7 +167,7 @@ function inviteUser(event, roomId, userId) {
|
||||||
console.log(`Received request to invite ${userId} into room ${roomId}`);
|
console.log(`Received request to invite ${userId} into room ${roomId}`);
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
const room = client.getRoom(roomId);
|
const room = client.getRoom(roomId);
|
||||||
|
@ -170,7 +187,7 @@ function inviteUser(event, roomId, userId) {
|
||||||
success: true,
|
success: true,
|
||||||
});
|
});
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
sendError(event, "You need to be able to invite users to do that.", err);
|
sendError(event, _t('You need to be able to invite users to do that.'), err);
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -181,7 +198,7 @@ function setPlumbingState(event, roomId, status) {
|
||||||
console.log(`Received request to set plumbing state to status "${status}" in room ${roomId}`);
|
console.log(`Received request to set plumbing state to status "${status}" in room ${roomId}`);
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
client.sendStateEvent(roomId, "m.room.plumbing", { status : status }).done(() => {
|
client.sendStateEvent(roomId, "m.room.plumbing", { status : status }).done(() => {
|
||||||
|
@ -189,7 +206,7 @@ function setPlumbingState(event, roomId, status) {
|
||||||
success: true,
|
success: true,
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
sendError(event, err.message ? err.message : "Failed to send request.", err);
|
sendError(event, err.message ? err.message : _t('Failed to send request.'), err);
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -197,7 +214,7 @@ function setBotOptions(event, roomId, userId) {
|
||||||
console.log(`Received request to set options for bot ${userId} in room ${roomId}`);
|
console.log(`Received request to set options for bot ${userId} in room ${roomId}`);
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
client.sendStateEvent(roomId, "m.room.bot.options", event.data.content, "_" + userId).done(() => {
|
client.sendStateEvent(roomId, "m.room.bot.options", event.data.content, "_" + userId).done(() => {
|
||||||
|
@ -205,20 +222,20 @@ function setBotOptions(event, roomId, userId) {
|
||||||
success: true,
|
success: true,
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
sendError(event, err.message ? err.message : "Failed to send request.", err);
|
sendError(event, err.message ? err.message : _t('Failed to send request.'), err);
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
function setBotPower(event, roomId, userId, level) {
|
function setBotPower(event, roomId, userId, level) {
|
||||||
if (!(Number.isInteger(level) && level >= 0)) {
|
if (!(Number.isInteger(level) && level >= 0)) {
|
||||||
sendError(event, "Power level must be positive integer.");
|
sendError(event, _t('Power level must be positive integer.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
console.log(`Received request to set power level to ${level} for bot ${userId} in room ${roomId}.`);
|
console.log(`Received request to set power level to ${level} for bot ${userId} in room ${roomId}.`);
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -235,7 +252,7 @@ function setBotPower(event, roomId, userId, level) {
|
||||||
success: true,
|
success: true,
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
sendError(event, err.message ? err.message : "Failed to send request.", err);
|
sendError(event, err.message ? err.message : _t('Failed to send request.'), err);
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
@ -255,15 +272,30 @@ function botOptions(event, roomId, userId) {
|
||||||
returnStateEvent(event, roomId, "m.room.bot.options", "_" + userId);
|
returnStateEvent(event, roomId, "m.room.bot.options", "_" + userId);
|
||||||
}
|
}
|
||||||
|
|
||||||
function returnStateEvent(event, roomId, eventType, stateKey) {
|
function getMembershipCount(event, roomId) {
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
const room = client.getRoom(roomId);
|
const room = client.getRoom(roomId);
|
||||||
if (!room) {
|
if (!room) {
|
||||||
sendError(event, "This room is not recognised.");
|
sendError(event, _t('This room is not recognised.'));
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
const count = room.getJoinedMembers().length;
|
||||||
|
sendResponse(event, count);
|
||||||
|
}
|
||||||
|
|
||||||
|
function returnStateEvent(event, roomId, eventType, stateKey) {
|
||||||
|
const client = MatrixClientPeg.get();
|
||||||
|
if (!client) {
|
||||||
|
sendError(event, _t('You need to be logged in.'));
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
const room = client.getRoom(roomId);
|
||||||
|
if (!room) {
|
||||||
|
sendError(event, _t('This room is not recognised.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
const stateEvent = room.currentState.getStateEvents(eventType, stateKey);
|
const stateEvent = room.currentState.getStateEvents(eventType, stateKey);
|
||||||
|
@ -313,13 +345,13 @@ const onMessage = function(event) {
|
||||||
const roomId = event.data.room_id;
|
const roomId = event.data.room_id;
|
||||||
const userId = event.data.user_id;
|
const userId = event.data.user_id;
|
||||||
if (!roomId) {
|
if (!roomId) {
|
||||||
sendError(event, "Missing room_id in request");
|
sendError(event, _t('Missing room_id in request'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
let promise = Promise.resolve(currentRoomId);
|
let promise = Promise.resolve(currentRoomId);
|
||||||
if (!currentRoomId) {
|
if (!currentRoomId) {
|
||||||
if (!currentRoomAlias) {
|
if (!currentRoomAlias) {
|
||||||
sendError(event, "Must be viewing a room");
|
sendError(event, _t('Must be viewing a room'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
// no room ID but there is an alias, look it up.
|
// no room ID but there is an alias, look it up.
|
||||||
|
@ -331,7 +363,7 @@ const onMessage = function(event) {
|
||||||
|
|
||||||
promise.then((viewingRoomId) => {
|
promise.then((viewingRoomId) => {
|
||||||
if (roomId !== viewingRoomId) {
|
if (roomId !== viewingRoomId) {
|
||||||
sendError(event, "Room " + roomId + " not visible");
|
sendError(event, _t('Room %(roomId)s not visible', {roomId: roomId}));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -342,10 +374,13 @@ const onMessage = function(event) {
|
||||||
} else if (event.data.action === "set_plumbing_state") {
|
} else if (event.data.action === "set_plumbing_state") {
|
||||||
setPlumbingState(event, roomId, event.data.status);
|
setPlumbingState(event, roomId, event.data.status);
|
||||||
return;
|
return;
|
||||||
|
} else if (event.data.action === "get_membership_count") {
|
||||||
|
getMembershipCount(event, roomId);
|
||||||
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
if (!userId) {
|
if (!userId) {
|
||||||
sendError(event, "Missing user_id in request");
|
sendError(event, _t('Missing user_id in request'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
switch (event.data.action) {
|
switch (event.data.action) {
|
||||||
|
@ -370,7 +405,7 @@ const onMessage = function(event) {
|
||||||
}
|
}
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
console.error(err);
|
console.error(err);
|
||||||
sendError(event, "Failed to lookup current room.");
|
sendError(event, _t('Failed to lookup current room') + '.');
|
||||||
});
|
});
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
|
@ -23,22 +23,28 @@ class Skinner {
|
||||||
if (this.components === null) {
|
if (this.components === null) {
|
||||||
throw new Error(
|
throw new Error(
|
||||||
"Attempted to get a component before a skin has been loaded."+
|
"Attempted to get a component before a skin has been loaded."+
|
||||||
"This is probably because either:"+
|
" This is probably because either:"+
|
||||||
" a) Your app has not called sdk.loadSkin(), or"+
|
" a) Your app has not called sdk.loadSkin(), or"+
|
||||||
" b) A component has called getComponent at the root level"
|
" b) A component has called getComponent at the root level",
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
var comp = this.components[name];
|
let comp = this.components[name];
|
||||||
if (comp) {
|
|
||||||
return comp;
|
|
||||||
}
|
|
||||||
// XXX: Temporarily also try 'views.' as we're currently
|
// XXX: Temporarily also try 'views.' as we're currently
|
||||||
// leaving the 'views.' off views.
|
// leaving the 'views.' off views.
|
||||||
var comp = this.components['views.'+name];
|
if (!comp) {
|
||||||
if (comp) {
|
comp = this.components['views.'+name];
|
||||||
return comp;
|
|
||||||
}
|
}
|
||||||
throw new Error("No such component: "+name);
|
|
||||||
|
if (!comp) {
|
||||||
|
throw new Error("No such component: "+name);
|
||||||
|
}
|
||||||
|
|
||||||
|
// components have to be functions.
|
||||||
|
const validType = typeof comp === 'function';
|
||||||
|
if (!validType) {
|
||||||
|
throw new Error(`Not a valid component: ${name}.`);
|
||||||
|
}
|
||||||
|
return comp;
|
||||||
}
|
}
|
||||||
|
|
||||||
load(skinObject) {
|
load(skinObject) {
|
||||||
|
|
|
@ -14,10 +14,11 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
import MatrixClientPeg from "./MatrixClientPeg";
|
||||||
var dis = require("./dispatcher");
|
import dis from "./dispatcher";
|
||||||
var Tinter = require("./Tinter");
|
import Tinter from "./Tinter";
|
||||||
import sdk from './index';
|
import sdk from './index';
|
||||||
|
import { _t } from './languageHandler';
|
||||||
import Modal from './Modal';
|
import Modal from './Modal';
|
||||||
|
|
||||||
|
|
||||||
|
@ -41,58 +42,64 @@ class Command {
|
||||||
}
|
}
|
||||||
|
|
||||||
getUsage() {
|
getUsage() {
|
||||||
return "Usage: " + this.getCommandWithArgs();
|
return _t('Usage') + ': ' + this.getCommandWithArgs();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
var reject = function(msg) {
|
function reject(msg) {
|
||||||
return {
|
return {
|
||||||
error: msg
|
error: msg,
|
||||||
};
|
};
|
||||||
};
|
}
|
||||||
|
|
||||||
var success = function(promise) {
|
function success(promise) {
|
||||||
return {
|
return {
|
||||||
promise: promise
|
promise: promise,
|
||||||
};
|
};
|
||||||
};
|
}
|
||||||
|
|
||||||
var commands = {
|
/* Disable the "unexpected this" error for these commands - all of the run
|
||||||
|
* functions are called with `this` bound to the Command instance.
|
||||||
|
*/
|
||||||
|
|
||||||
|
/* eslint-disable babel/no-invalid-this */
|
||||||
|
|
||||||
|
const commands = {
|
||||||
ddg: new Command("ddg", "<query>", function(roomId, args) {
|
ddg: new Command("ddg", "<query>", function(roomId, args) {
|
||||||
const ErrorDialog = sdk.getComponent('dialogs.ErrorDialog');
|
const ErrorDialog = sdk.getComponent('dialogs.ErrorDialog');
|
||||||
// TODO Don't explain this away, actually show a search UI here.
|
// TODO Don't explain this away, actually show a search UI here.
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "/ddg is not a command",
|
title: _t('/ddg is not a command'),
|
||||||
description: "To use it, just wait for autocomplete results to load and tab through them.",
|
description: _t('To use it, just wait for autocomplete results to load and tab through them.'),
|
||||||
});
|
});
|
||||||
return success();
|
return success();
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Change your nickname
|
// Change your nickname
|
||||||
nick: new Command("nick", "<display_name>", function(room_id, args) {
|
nick: new Command("nick", "<display_name>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setDisplayName(args)
|
MatrixClientPeg.get().setDisplayName(args),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Changes the colorscheme of your current room
|
// Changes the colorscheme of your current room
|
||||||
tint: new Command("tint", "<color1> [<color2>]", function(room_id, args) {
|
tint: new Command("tint", "<color1> [<color2>]", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6}))( +(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6})))?$/);
|
const matches = args.match(/^(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6}))( +(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6})))?$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
Tinter.tint(matches[1], matches[4]);
|
Tinter.tint(matches[1], matches[4]);
|
||||||
var colorScheme = {};
|
const colorScheme = {};
|
||||||
colorScheme.primary_color = matches[1];
|
colorScheme.primary_color = matches[1];
|
||||||
if (matches[4]) {
|
if (matches[4]) {
|
||||||
colorScheme.secondary_color = matches[4];
|
colorScheme.secondary_color = matches[4];
|
||||||
}
|
}
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setRoomAccountData(
|
MatrixClientPeg.get().setRoomAccountData(
|
||||||
room_id, "org.matrix.room.color_scheme", colorScheme
|
roomId, "org.matrix.room.color_scheme", colorScheme,
|
||||||
)
|
),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -100,22 +107,22 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Change the room topic
|
// Change the room topic
|
||||||
topic: new Command("topic", "<topic>", function(room_id, args) {
|
topic: new Command("topic", "<topic>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setRoomTopic(room_id, args)
|
MatrixClientPeg.get().setRoomTopic(roomId, args),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Invite a user
|
// Invite a user
|
||||||
invite: new Command("invite", "<userId>", function(room_id, args) {
|
invite: new Command("invite", "<userId>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().invite(room_id, matches[1])
|
MatrixClientPeg.get().invite(roomId, matches[1]),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -123,21 +130,21 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Join a room
|
// Join a room
|
||||||
join: new Command("join", "#alias:domain", function(room_id, args) {
|
join: new Command("join", "#alias:domain", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
var room_alias = matches[1];
|
let roomAlias = matches[1];
|
||||||
if (room_alias[0] !== '#') {
|
if (roomAlias[0] !== '#') {
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}
|
}
|
||||||
if (!room_alias.match(/:/)) {
|
if (!roomAlias.match(/:/)) {
|
||||||
room_alias += ':' + MatrixClientPeg.get().getDomain();
|
roomAlias += ':' + MatrixClientPeg.get().getDomain();
|
||||||
}
|
}
|
||||||
|
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'view_room',
|
action: 'view_room',
|
||||||
room_alias: room_alias,
|
room_alias: roomAlias,
|
||||||
auto_join: true,
|
auto_join: true,
|
||||||
});
|
});
|
||||||
|
|
||||||
|
@ -147,29 +154,29 @@ var commands = {
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}),
|
}),
|
||||||
|
|
||||||
part: new Command("part", "[#alias:domain]", function(room_id, args) {
|
part: new Command("part", "[#alias:domain]", function(roomId, args) {
|
||||||
var targetRoomId;
|
let targetRoomId;
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
var room_alias = matches[1];
|
let roomAlias = matches[1];
|
||||||
if (room_alias[0] !== '#') {
|
if (roomAlias[0] !== '#') {
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}
|
}
|
||||||
if (!room_alias.match(/:/)) {
|
if (!roomAlias.match(/:/)) {
|
||||||
room_alias += ':' + MatrixClientPeg.get().getDomain();
|
roomAlias += ':' + MatrixClientPeg.get().getDomain();
|
||||||
}
|
}
|
||||||
|
|
||||||
// Try to find a room with this alias
|
// Try to find a room with this alias
|
||||||
var rooms = MatrixClientPeg.get().getRooms();
|
const rooms = MatrixClientPeg.get().getRooms();
|
||||||
for (var i = 0; i < rooms.length; i++) {
|
for (let i = 0; i < rooms.length; i++) {
|
||||||
var aliasEvents = rooms[i].currentState.getStateEvents(
|
const aliasEvents = rooms[i].currentState.getStateEvents(
|
||||||
"m.room.aliases"
|
"m.room.aliases",
|
||||||
);
|
);
|
||||||
for (var j = 0; j < aliasEvents.length; j++) {
|
for (let j = 0; j < aliasEvents.length; j++) {
|
||||||
var aliases = aliasEvents[j].getContent().aliases || [];
|
const aliases = aliasEvents[j].getContent().aliases || [];
|
||||||
for (var k = 0; k < aliases.length; k++) {
|
for (let k = 0; k < aliases.length; k++) {
|
||||||
if (aliases[k] === room_alias) {
|
if (aliases[k] === roomAlias) {
|
||||||
targetRoomId = rooms[i].roomId;
|
targetRoomId = rooms[i].roomId;
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
@ -178,27 +185,28 @@ var commands = {
|
||||||
}
|
}
|
||||||
if (targetRoomId) { break; }
|
if (targetRoomId) { break; }
|
||||||
}
|
}
|
||||||
}
|
if (!targetRoomId) {
|
||||||
if (!targetRoomId) {
|
return reject(_t("Unrecognised room alias:") + ' ' + roomAlias);
|
||||||
return reject("Unrecognised room alias: " + room_alias);
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if (!targetRoomId) targetRoomId = room_id;
|
if (!targetRoomId) targetRoomId = roomId;
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().leave(targetRoomId).then(
|
MatrixClientPeg.get().leave(targetRoomId).then(
|
||||||
function() {
|
function() {
|
||||||
dis.dispatch({action: 'view_next_room'});
|
dis.dispatch({action: 'view_next_room'});
|
||||||
})
|
},
|
||||||
|
),
|
||||||
);
|
);
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Kick a user from the room with an optional reason
|
// Kick a user from the room with an optional reason
|
||||||
kick: new Command("kick", "<userId> [<reason>]", function(room_id, args) {
|
kick: new Command("kick", "<userId> [<reason>]", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+?)( +(.*))?$/);
|
const matches = args.match(/^(\S+?)( +(.*))?$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().kick(room_id, matches[1], matches[3])
|
MatrixClientPeg.get().kick(roomId, matches[1], matches[3]),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -206,12 +214,12 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Ban a user from the room with an optional reason
|
// Ban a user from the room with an optional reason
|
||||||
ban: new Command("ban", "<userId> [<reason>]", function(room_id, args) {
|
ban: new Command("ban", "<userId> [<reason>]", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+?)( +(.*))?$/);
|
const matches = args.match(/^(\S+?)( +(.*))?$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().ban(room_id, matches[1], matches[3])
|
MatrixClientPeg.get().ban(roomId, matches[1], matches[3]),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -219,13 +227,13 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Unban a user from the room
|
// Unban a user from the room
|
||||||
unban: new Command("unban", "<userId>", function(room_id, args) {
|
unban: new Command("unban", "<userId>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
// Reset the user membership to "leave" to unban him
|
// Reset the user membership to "leave" to unban him
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().unban(room_id, matches[1])
|
MatrixClientPeg.get().unban(roomId, matches[1]),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -233,27 +241,27 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Define the power level of a user
|
// Define the power level of a user
|
||||||
op: new Command("op", "<userId> [<power level>]", function(room_id, args) {
|
op: new Command("op", "<userId> [<power level>]", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+?)( +(\d+))?$/);
|
const matches = args.match(/^(\S+?)( +(\d+))?$/);
|
||||||
var powerLevel = 50; // default power level for op
|
let powerLevel = 50; // default power level for op
|
||||||
if (matches) {
|
if (matches) {
|
||||||
var user_id = matches[1];
|
const userId = matches[1];
|
||||||
if (matches.length === 4 && undefined !== matches[3]) {
|
if (matches.length === 4 && undefined !== matches[3]) {
|
||||||
powerLevel = parseInt(matches[3]);
|
powerLevel = parseInt(matches[3]);
|
||||||
}
|
}
|
||||||
if (powerLevel !== NaN) {
|
if (!isNaN(powerLevel)) {
|
||||||
var room = MatrixClientPeg.get().getRoom(room_id);
|
const room = MatrixClientPeg.get().getRoom(roomId);
|
||||||
if (!room) {
|
if (!room) {
|
||||||
return reject("Bad room ID: " + room_id);
|
return reject("Bad room ID: " + roomId);
|
||||||
}
|
}
|
||||||
var powerLevelEvent = room.currentState.getStateEvents(
|
const powerLevelEvent = room.currentState.getStateEvents(
|
||||||
"m.room.power_levels", ""
|
"m.room.power_levels", "",
|
||||||
);
|
);
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setPowerLevel(
|
MatrixClientPeg.get().setPowerLevel(
|
||||||
room_id, user_id, powerLevel, powerLevelEvent
|
roomId, userId, powerLevel, powerLevelEvent,
|
||||||
)
|
),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -262,32 +270,94 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Reset the power level of a user
|
// Reset the power level of a user
|
||||||
deop: new Command("deop", "<userId>", function(room_id, args) {
|
deop: new Command("deop", "<userId>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
var room = MatrixClientPeg.get().getRoom(room_id);
|
const room = MatrixClientPeg.get().getRoom(roomId);
|
||||||
if (!room) {
|
if (!room) {
|
||||||
return reject("Bad room ID: " + room_id);
|
return reject("Bad room ID: " + roomId);
|
||||||
}
|
}
|
||||||
|
|
||||||
var powerLevelEvent = room.currentState.getStateEvents(
|
const powerLevelEvent = room.currentState.getStateEvents(
|
||||||
"m.room.power_levels", ""
|
"m.room.power_levels", "",
|
||||||
);
|
);
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setPowerLevel(
|
MatrixClientPeg.get().setPowerLevel(
|
||||||
room_id, args, undefined, powerLevelEvent
|
roomId, args, undefined, powerLevelEvent,
|
||||||
)
|
),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
})
|
}),
|
||||||
|
|
||||||
|
// Verify a user, device, and pubkey tuple
|
||||||
|
verify: new Command("verify", "<userId> <deviceId> <deviceSigningKey>", function(roomId, args) {
|
||||||
|
if (args) {
|
||||||
|
const matches = args.match(/^(\S+) +(\S+) +(\S+)$/);
|
||||||
|
if (matches) {
|
||||||
|
const userId = matches[1];
|
||||||
|
const deviceId = matches[2];
|
||||||
|
const fingerprint = matches[3];
|
||||||
|
|
||||||
|
const device = MatrixClientPeg.get().getStoredDevice(userId, deviceId);
|
||||||
|
if (!device) {
|
||||||
|
return reject(_t(`Unknown (user, device) pair:`) + ` (${userId}, ${deviceId})`);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (device.isVerified()) {
|
||||||
|
if (device.getFingerprint() === fingerprint) {
|
||||||
|
return reject(_t(`Device already verified!`));
|
||||||
|
} else {
|
||||||
|
return reject(_t(`WARNING: Device already verified, but keys do NOT MATCH!`));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (device.getFingerprint() === fingerprint) {
|
||||||
|
MatrixClientPeg.get().setDeviceVerified(
|
||||||
|
userId, deviceId, true,
|
||||||
|
);
|
||||||
|
|
||||||
|
// Tell the user we verified everything!
|
||||||
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
|
Modal.createDialog(QuestionDialog, {
|
||||||
|
title: _t("Verified key"),
|
||||||
|
description: (
|
||||||
|
<div>
|
||||||
|
<p>
|
||||||
|
{
|
||||||
|
_t("The signing key you provided matches the signing key you received " +
|
||||||
|
"from %(userId)s's device %(deviceId)s. Device marked as verified.",
|
||||||
|
{userId: userId, deviceId: deviceId})
|
||||||
|
}
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
),
|
||||||
|
hasCancelButton: false,
|
||||||
|
});
|
||||||
|
|
||||||
|
return success();
|
||||||
|
} else {
|
||||||
|
const fprint = device.getFingerprint();
|
||||||
|
return reject(
|
||||||
|
_t('WARNING: KEY VERIFICATION FAILED! The signing key for %(userId)s and device' +
|
||||||
|
' %(deviceId)s is "%(fprint)s" which does not match the provided key' +
|
||||||
|
' "%(fingerprint)s". This could mean your communications are being intercepted!',
|
||||||
|
{deviceId: deviceId, fprint: fprint, userId: userId, fingerprint: fingerprint})
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return reject(this.getUsage());
|
||||||
|
}),
|
||||||
};
|
};
|
||||||
|
/* eslint-enable babel/no-invalid-this */
|
||||||
|
|
||||||
|
|
||||||
// helpful aliases
|
// helpful aliases
|
||||||
var aliases = {
|
const aliases = {
|
||||||
j: "join"
|
j: "join",
|
||||||
};
|
};
|
||||||
|
|
||||||
module.exports = {
|
module.exports = {
|
||||||
|
@ -304,13 +374,13 @@ module.exports = {
|
||||||
// IRC-style commands
|
// IRC-style commands
|
||||||
input = input.replace(/\s+$/, "");
|
input = input.replace(/\s+$/, "");
|
||||||
if (input[0] === "/" && input[1] !== "/") {
|
if (input[0] === "/" && input[1] !== "/") {
|
||||||
var bits = input.match(/^(\S+?)( +((.|\n)*))?$/);
|
const bits = input.match(/^(\S+?)( +((.|\n)*))?$/);
|
||||||
var cmd, args;
|
let cmd;
|
||||||
|
let args;
|
||||||
if (bits) {
|
if (bits) {
|
||||||
cmd = bits[1].substring(1).toLowerCase();
|
cmd = bits[1].substring(1).toLowerCase();
|
||||||
args = bits[3];
|
args = bits[3];
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
cmd = input;
|
cmd = input;
|
||||||
}
|
}
|
||||||
if (cmd === "me") return null;
|
if (cmd === "me") return null;
|
||||||
|
@ -319,9 +389,8 @@ module.exports = {
|
||||||
}
|
}
|
||||||
if (commands[cmd]) {
|
if (commands[cmd]) {
|
||||||
return commands[cmd].run(roomId, args);
|
return commands[cmd].run(roomId, args);
|
||||||
}
|
} else {
|
||||||
else {
|
return reject(_t("Unrecognised command:") + ' ' + input);
|
||||||
return reject("Unrecognised command: " + input);
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return null; // not a command
|
return null; // not a command
|
||||||
|
@ -329,12 +398,12 @@ module.exports = {
|
||||||
|
|
||||||
getCommandList: function() {
|
getCommandList: function() {
|
||||||
// Return all the commands plus /me and /markdown which aren't handled like normal commands
|
// Return all the commands plus /me and /markdown which aren't handled like normal commands
|
||||||
var cmds = Object.keys(commands).sort().map(function(cmdKey) {
|
const cmds = Object.keys(commands).sort().map(function(cmdKey) {
|
||||||
return commands[cmdKey];
|
return commands[cmdKey];
|
||||||
});
|
});
|
||||||
cmds.push(new Command("me", "<action>", function() {}));
|
cmds.push(new Command("me", "<action>", function() {}));
|
||||||
cmds.push(new Command("markdown", "<on|off>", function() {}));
|
cmds.push(new Command("markdown", "<on|off>", function() {}));
|
||||||
|
|
||||||
return cmds;
|
return cmds;
|
||||||
}
|
},
|
||||||
};
|
};
|
||||||
|
|
|
@ -13,10 +13,9 @@ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
See the License for the specific language governing permissions and
|
See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
import MatrixClientPeg from "./MatrixClientPeg";
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
import CallHandler from "./CallHandler";
|
||||||
var CallHandler = require("./CallHandler");
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
import * as Roles from './Roles';
|
import * as Roles from './Roles';
|
||||||
|
|
||||||
function textForMemberEvent(ev) {
|
function textForMemberEvent(ev) {
|
||||||
|
@ -25,45 +24,45 @@ function textForMemberEvent(ev) {
|
||||||
var targetName = ev.target ? ev.target.name : ev.getStateKey();
|
var targetName = ev.target ? ev.target.name : ev.getStateKey();
|
||||||
var ConferenceHandler = CallHandler.getConferenceHandler();
|
var ConferenceHandler = CallHandler.getConferenceHandler();
|
||||||
var reason = ev.getContent().reason ? (
|
var reason = ev.getContent().reason ? (
|
||||||
" Reason: " + ev.getContent().reason
|
_t('Reason') + ': ' + ev.getContent().reason
|
||||||
) : "";
|
) : "";
|
||||||
switch (ev.getContent().membership) {
|
switch (ev.getContent().membership) {
|
||||||
case 'invite':
|
case 'invite':
|
||||||
var threePidContent = ev.getContent().third_party_invite;
|
var threePidContent = ev.getContent().third_party_invite;
|
||||||
if (threePidContent) {
|
if (threePidContent) {
|
||||||
if (threePidContent.display_name) {
|
if (threePidContent.display_name) {
|
||||||
return targetName + " accepted the invitation for " +
|
return _t('%(targetName)s accepted the invitation for %(displayName)s.', {targetName: targetName, displayName: threePidContent.display_name});
|
||||||
threePidContent.display_name + ".";
|
|
||||||
} else {
|
} else {
|
||||||
return targetName + " accepted an invitation.";
|
return _t('%(targetName)s accepted an invitation.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
||||||
return senderName + " requested a VoIP conference";
|
return _t('%(senderName)s requested a VoIP conference.', {senderName: senderName});
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return senderName + " invited " + targetName + ".";
|
return _t('%(senderName)s invited %(targetName)s.', {senderName: senderName, targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
case 'ban':
|
case 'ban':
|
||||||
return senderName + " banned " + targetName + "." + reason;
|
return _t(
|
||||||
|
'%(senderName)s banned %(targetName)s.',
|
||||||
|
{senderName: senderName, targetName: targetName}
|
||||||
|
) + ' ' + reason;
|
||||||
case 'join':
|
case 'join':
|
||||||
if (ev.getPrevContent() && ev.getPrevContent().membership == 'join') {
|
if (ev.getPrevContent() && ev.getPrevContent().membership == 'join') {
|
||||||
if (ev.getPrevContent().displayname && ev.getContent().displayname && ev.getPrevContent().displayname != ev.getContent().displayname) {
|
if (ev.getPrevContent().displayname && ev.getContent().displayname && ev.getPrevContent().displayname != ev.getContent().displayname) {
|
||||||
return ev.getSender() + " changed their display name from " +
|
return _t('%(senderName)s changed their display name from %(oldDisplayName)s to %(displayName)s.', {senderName: ev.getSender(), oldDisplayName: ev.getPrevContent().displayname, displayName: ev.getContent().displayname});
|
||||||
ev.getPrevContent().displayname + " to " +
|
|
||||||
ev.getContent().displayname;
|
|
||||||
} else if (!ev.getPrevContent().displayname && ev.getContent().displayname) {
|
} else if (!ev.getPrevContent().displayname && ev.getContent().displayname) {
|
||||||
return ev.getSender() + " set their display name to " + ev.getContent().displayname;
|
return _t('%(senderName)s set their display name to %(displayName)s.', {senderName: ev.getSender(), displayName: ev.getContent().displayname});
|
||||||
} else if (ev.getPrevContent().displayname && !ev.getContent().displayname) {
|
} else if (ev.getPrevContent().displayname && !ev.getContent().displayname) {
|
||||||
return ev.getSender() + " removed their display name (" + ev.getPrevContent().displayname + ")";
|
return _t('%(senderName)s removed their display name (%(oldDisplayName)s).', {senderName: ev.getSender(), oldDisplayName: ev.getPrevContent().displayname});
|
||||||
} else if (ev.getPrevContent().avatar_url && !ev.getContent().avatar_url) {
|
} else if (ev.getPrevContent().avatar_url && !ev.getContent().avatar_url) {
|
||||||
return senderName + " removed their profile picture";
|
return _t('%(senderName)s removed their profile picture.', {senderName: senderName});
|
||||||
} else if (ev.getPrevContent().avatar_url && ev.getContent().avatar_url && ev.getPrevContent().avatar_url != ev.getContent().avatar_url) {
|
} else if (ev.getPrevContent().avatar_url && ev.getContent().avatar_url && ev.getPrevContent().avatar_url != ev.getContent().avatar_url) {
|
||||||
return senderName + " changed their profile picture";
|
return _t('%(senderName)s changed their profile picture.', {senderName: senderName});
|
||||||
} else if (!ev.getPrevContent().avatar_url && ev.getContent().avatar_url) {
|
} else if (!ev.getPrevContent().avatar_url && ev.getContent().avatar_url) {
|
||||||
return senderName + " set a profile picture";
|
return _t('%(senderName)s set a profile picture.', {senderName: senderName});
|
||||||
} else {
|
} else {
|
||||||
// suppress null rejoins
|
// suppress null rejoins
|
||||||
return '';
|
return '';
|
||||||
|
@ -71,49 +70,57 @@ function textForMemberEvent(ev) {
|
||||||
} else {
|
} else {
|
||||||
if (!ev.target) console.warn("Join message has no target! -- " + ev.getContent().state_key);
|
if (!ev.target) console.warn("Join message has no target! -- " + ev.getContent().state_key);
|
||||||
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
||||||
return "VoIP conference started";
|
return _t('VoIP conference started.');
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return targetName + " joined the room.";
|
return _t('%(targetName)s joined the room.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
case 'leave':
|
case 'leave':
|
||||||
if (ev.getSender() === ev.getStateKey()) {
|
if (ev.getSender() === ev.getStateKey()) {
|
||||||
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
||||||
return "VoIP conference finished";
|
return _t('VoIP conference finished.');
|
||||||
}
|
}
|
||||||
else if (ev.getPrevContent().membership === "invite") {
|
else if (ev.getPrevContent().membership === "invite") {
|
||||||
return targetName + " rejected the invitation.";
|
return _t('%(targetName)s rejected the invitation.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return targetName + " left the room.";
|
return _t('%(targetName)s left the room.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else if (ev.getPrevContent().membership === "ban") {
|
else if (ev.getPrevContent().membership === "ban") {
|
||||||
return senderName + " unbanned " + targetName + ".";
|
return _t('%(senderName)s unbanned %(targetName)s.', {senderName: senderName, targetName: targetName});
|
||||||
}
|
}
|
||||||
else if (ev.getPrevContent().membership === "join") {
|
else if (ev.getPrevContent().membership === "join") {
|
||||||
return senderName + " kicked " + targetName + "." + reason;
|
return _t(
|
||||||
|
'%(senderName)s kicked %(targetName)s.',
|
||||||
|
{senderName: senderName, targetName: targetName}
|
||||||
|
) + ' ' + reason;
|
||||||
}
|
}
|
||||||
else if (ev.getPrevContent().membership === "invite") {
|
else if (ev.getPrevContent().membership === "invite") {
|
||||||
return senderName + " withdrew " + targetName + "'s invitation." + reason;
|
return _t(
|
||||||
|
'%(senderName)s withdrew %(targetName)s\'s invitation.',
|
||||||
|
{senderName: senderName, targetName: targetName}
|
||||||
|
) + ' ' + reason;
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return targetName + " left the room.";
|
return _t('%(targetName)s left the room.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForTopicEvent(ev) {
|
function textForTopicEvent(ev) {
|
||||||
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
||||||
|
return _t('%(senderDisplayName)s changed the topic to "%(topic)s".', {senderDisplayName: senderDisplayName, topic: ev.getContent().topic});
|
||||||
return senderDisplayName + ' changed the topic to "' + ev.getContent().topic + '"';
|
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForRoomNameEvent(ev) {
|
function textForRoomNameEvent(ev) {
|
||||||
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
||||||
|
|
||||||
return senderDisplayName + ' changed the room name to "' + ev.getContent().name + '"';
|
if (!ev.getContent().name || ev.getContent().name.trim().length === 0) {
|
||||||
|
return _t('%(senderDisplayName)s removed the room name.', {senderDisplayName: senderDisplayName});
|
||||||
|
}
|
||||||
|
return _t('%(senderDisplayName)s changed the room name to %(roomName)s.', {senderDisplayName: senderDisplayName, roomName: ev.getContent().name});
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForMessageEvent(ev) {
|
function textForMessageEvent(ev) {
|
||||||
|
@ -122,66 +129,78 @@ function textForMessageEvent(ev) {
|
||||||
if (ev.getContent().msgtype === "m.emote") {
|
if (ev.getContent().msgtype === "m.emote") {
|
||||||
message = "* " + senderDisplayName + " " + message;
|
message = "* " + senderDisplayName + " " + message;
|
||||||
} else if (ev.getContent().msgtype === "m.image") {
|
} else if (ev.getContent().msgtype === "m.image") {
|
||||||
message = senderDisplayName + " sent an image.";
|
message = _t('%(senderDisplayName)s sent an image.', {senderDisplayName: senderDisplayName});
|
||||||
}
|
}
|
||||||
return message;
|
return message;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForCallAnswerEvent(event) {
|
function textForCallAnswerEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : "Someone";
|
var senderName = event.sender ? event.sender.name : _t('Someone');
|
||||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : " (not supported by this browser)";
|
var supported = MatrixClientPeg.get().supportsVoip() ? "" : _t('(not supported by this browser)');
|
||||||
return senderName + " answered the call." + supported;
|
return _t('%(senderName)s answered the call.', {senderName: senderName}) + ' ' + supported;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForCallHangupEvent(event) {
|
function textForCallHangupEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : "Someone";
|
const senderName = event.sender ? event.sender.name : _t('Someone');
|
||||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : " (not supported by this browser)";
|
const eventContent = event.getContent();
|
||||||
return senderName + " ended the call." + supported;
|
let reason = "";
|
||||||
|
if(!MatrixClientPeg.get().supportsVoip()) {
|
||||||
|
reason = _t('(not supported by this browser)');
|
||||||
|
} else if(eventContent.reason) {
|
||||||
|
if (eventContent.reason === "ice_failed") {
|
||||||
|
reason = _t('(could not connect media)');
|
||||||
|
} else if (eventContent.reason === "invite_timeout") {
|
||||||
|
reason = _t('(no answer)');
|
||||||
|
} else {
|
||||||
|
reason = _t('(unknown failure: %(reason)s)', {reason: eventContent.reason});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return _t('%(senderName)s ended the call.', {senderName}) + ' ' + reason;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForCallInviteEvent(event) {
|
function textForCallInviteEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : "Someone";
|
var senderName = event.sender ? event.sender.name : _t('Someone');
|
||||||
// FIXME: Find a better way to determine this from the event?
|
// FIXME: Find a better way to determine this from the event?
|
||||||
var type = "voice";
|
var type = "voice";
|
||||||
if (event.getContent().offer && event.getContent().offer.sdp &&
|
if (event.getContent().offer && event.getContent().offer.sdp &&
|
||||||
event.getContent().offer.sdp.indexOf('m=video') !== -1) {
|
event.getContent().offer.sdp.indexOf('m=video') !== -1) {
|
||||||
type = "video";
|
type = "video";
|
||||||
}
|
}
|
||||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : " (not supported by this browser)";
|
var supported = MatrixClientPeg.get().supportsVoip() ? "" : _t('(not supported by this browser)');
|
||||||
return senderName + " placed a " + type + " call." + supported;
|
return _t('%(senderName)s placed a %(callType)s call.', {senderName: senderName, callType: type}) + ' ' + supported;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForThreePidInviteEvent(event) {
|
function textForThreePidInviteEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : event.getSender();
|
var senderName = event.sender ? event.sender.name : event.getSender();
|
||||||
return senderName + " sent an invitation to " + event.getContent().display_name +
|
return _t('%(senderName)s sent an invitation to %(targetDisplayName)s to join the room.', {senderName: senderName, targetDisplayName: event.getContent().display_name});
|
||||||
" to join the room.";
|
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForHistoryVisibilityEvent(event) {
|
function textForHistoryVisibilityEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : event.getSender();
|
var senderName = event.sender ? event.sender.name : event.getSender();
|
||||||
var vis = event.getContent().history_visibility;
|
var vis = event.getContent().history_visibility;
|
||||||
var text = senderName + " made future room history visible to ";
|
// XXX: This i18n just isn't going to work for languages with different sentence structure.
|
||||||
|
var text = _t('%(senderName)s made future room history visible to', {senderName: senderName}) + ' ';
|
||||||
if (vis === "invited") {
|
if (vis === "invited") {
|
||||||
text += "all room members, from the point they are invited.";
|
text += _t('all room members, from the point they are invited') + '.';
|
||||||
}
|
}
|
||||||
else if (vis === "joined") {
|
else if (vis === "joined") {
|
||||||
text += "all room members, from the point they joined.";
|
text += _t('all room members, from the point they joined') + '.';
|
||||||
}
|
}
|
||||||
else if (vis === "shared") {
|
else if (vis === "shared") {
|
||||||
text += "all room members.";
|
text += _t('all room members') + '.';
|
||||||
}
|
}
|
||||||
else if (vis === "world_readable") {
|
else if (vis === "world_readable") {
|
||||||
text += "anyone.";
|
text += _t('anyone') + '.';
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
text += " unknown (" + vis + ")";
|
text += ' ' + _t('unknown') + ' (' + vis + ').';
|
||||||
}
|
}
|
||||||
return text;
|
return text;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForEncryptionEvent(event) {
|
function textForEncryptionEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : event.getSender();
|
var senderName = event.sender ? event.sender.name : event.getSender();
|
||||||
return senderName + " turned on end-to-end encryption (algorithm " + event.getContent().algorithm + ")";
|
return _t('%(senderName)s turned on end-to-end encryption (algorithm %(algorithm)s).', {senderName: senderName, algorithm: event.getContent().algorithm});
|
||||||
}
|
}
|
||||||
|
|
||||||
// Currently will only display a change if a user's power level is changed
|
// Currently will only display a change if a user's power level is changed
|
||||||
|
@ -204,6 +223,7 @@ function textForPowerEvent(event) {
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
let diff = [];
|
let diff = [];
|
||||||
|
// XXX: This is also surely broken for i18n
|
||||||
users.forEach((userId) => {
|
users.forEach((userId) => {
|
||||||
// Previous power level
|
// Previous power level
|
||||||
const from = event.getPrevContent().users[userId];
|
const from = event.getPrevContent().users[userId];
|
||||||
|
@ -211,16 +231,21 @@ function textForPowerEvent(event) {
|
||||||
const to = event.getContent().users[userId];
|
const to = event.getContent().users[userId];
|
||||||
if (to !== from) {
|
if (to !== from) {
|
||||||
diff.push(
|
diff.push(
|
||||||
userId +
|
_t('%(userId)s from %(fromPowerLevel)s to %(toPowerLevel)s', {
|
||||||
' from ' + Roles.textualPowerLevel(from, userDefault) +
|
userId: userId,
|
||||||
' to ' + Roles.textualPowerLevel(to, userDefault)
|
fromPowerLevel: Roles.textualPowerLevel(from, userDefault),
|
||||||
|
toPowerLevel: Roles.textualPowerLevel(to, userDefault)
|
||||||
|
})
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
if (!diff.length) {
|
if (!diff.length) {
|
||||||
return '';
|
return '';
|
||||||
}
|
}
|
||||||
return senderName + ' changed the power level of ' + diff.join(', ');
|
return _t('%(senderName)s changed the power level of %(powerLevelDiffText)s.', {
|
||||||
|
senderName: senderName,
|
||||||
|
powerLevelDiffText: diff.join(", ")
|
||||||
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
var handlers = {
|
var handlers = {
|
||||||
|
|
|
@ -22,7 +22,7 @@ let isDialogOpen = false;
|
||||||
|
|
||||||
const onAction = function(payload) {
|
const onAction = function(payload) {
|
||||||
if (payload.action === 'unknown_device_error' && !isDialogOpen) {
|
if (payload.action === 'unknown_device_error' && !isDialogOpen) {
|
||||||
var UnknownDeviceDialog = sdk.getComponent("dialogs.UnknownDeviceDialog");
|
const UnknownDeviceDialog = sdk.getComponent('dialogs.UnknownDeviceDialog');
|
||||||
isDialogOpen = true;
|
isDialogOpen = true;
|
||||||
Modal.createDialog(UnknownDeviceDialog, {
|
Modal.createDialog(UnknownDeviceDialog, {
|
||||||
devices: payload.err.devices,
|
devices: payload.err.devices,
|
||||||
|
@ -33,17 +33,17 @@ const onAction = function(payload) {
|
||||||
// https://github.com/vector-im/riot-web/issues/3148
|
// https://github.com/vector-im/riot-web/issues/3148
|
||||||
console.log('UnknownDeviceDialog closed with '+r);
|
console.log('UnknownDeviceDialog closed with '+r);
|
||||||
},
|
},
|
||||||
}, "mx_Dialog_unknownDevice");
|
}, 'mx_Dialog_unknownDevice');
|
||||||
}
|
}
|
||||||
}
|
};
|
||||||
|
|
||||||
let ref = null;
|
let ref = null;
|
||||||
|
|
||||||
export function startListening () {
|
export function startListening() {
|
||||||
ref = dis.register(onAction);
|
ref = dis.register(onAction);
|
||||||
}
|
}
|
||||||
|
|
||||||
export function stopListening () {
|
export function stopListening() {
|
||||||
if (ref) {
|
if (ref) {
|
||||||
dis.unregister(ref);
|
dis.unregister(ref);
|
||||||
ref = null;
|
ref = null;
|
||||||
|
|
|
@ -25,7 +25,9 @@ module.exports = {
|
||||||
eventTriggersUnreadCount: function(ev) {
|
eventTriggersUnreadCount: function(ev) {
|
||||||
if (ev.sender && ev.sender.userId == MatrixClientPeg.get().credentials.userId) {
|
if (ev.sender && ev.sender.userId == MatrixClientPeg.get().credentials.userId) {
|
||||||
return false;
|
return false;
|
||||||
} else if (ev.getType() == "m.room.member") {
|
} else if (ev.getType() == 'm.room.member') {
|
||||||
|
return false;
|
||||||
|
} else if (ev.getType() == 'm.call.answer' || ev.getType() == 'm.call.hangup') {
|
||||||
return false;
|
return false;
|
||||||
} else if (ev.getType == 'm.room.message' && ev.getContent().msgtype == 'm.notify') {
|
} else if (ev.getType == 'm.room.message' && ev.getContent().msgtype == 'm.notify') {
|
||||||
return false;
|
return false;
|
||||||
|
|
|
@ -14,24 +14,29 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
'use strict';
|
|
||||||
import q from 'q';
|
import q from 'q';
|
||||||
import MatrixClientPeg from './MatrixClientPeg';
|
import MatrixClientPeg from './MatrixClientPeg';
|
||||||
import Notifier from './Notifier';
|
import Notifier from './Notifier';
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* TODO: Make things use this. This is all WIP - see UserSettings.js for usage.
|
* TODO: Make things use this. This is all WIP - see UserSettings.js for usage.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
module.exports = {
|
export default {
|
||||||
LABS_FEATURES: [
|
LABS_FEATURES: [
|
||||||
{
|
{
|
||||||
name: 'New Composer & Autocomplete',
|
name: "-",
|
||||||
id: 'rich_text_editor',
|
id: 'rich_text_editor',
|
||||||
default: false,
|
default: false,
|
||||||
},
|
},
|
||||||
],
|
],
|
||||||
|
|
||||||
|
// horrible but it works. The locality makes this somewhat more palatable.
|
||||||
|
doTranslations: function() {
|
||||||
|
this.LABS_FEATURES[0].name = _t("New Composer & Autocomplete");
|
||||||
|
},
|
||||||
|
|
||||||
loadProfileInfo: function() {
|
loadProfileInfo: function() {
|
||||||
const cli = MatrixClientPeg.get();
|
const cli = MatrixClientPeg.get();
|
||||||
return cli.getProfileInfo(cli.credentials.userId);
|
return cli.getProfileInfo(cli.credentials.userId);
|
||||||
|
|
|
@ -15,6 +15,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
module.exports = {
|
module.exports = {
|
||||||
usersTypingApartFromMe: function(room) {
|
usersTypingApartFromMe: function(room) {
|
||||||
|
@ -56,18 +57,18 @@ module.exports = {
|
||||||
if (whoIsTyping.length == 0) {
|
if (whoIsTyping.length == 0) {
|
||||||
return '';
|
return '';
|
||||||
} else if (whoIsTyping.length == 1) {
|
} else if (whoIsTyping.length == 1) {
|
||||||
return whoIsTyping[0].name + ' is typing';
|
return _t('%(displayName)s is typing', {displayName: whoIsTyping[0].name});
|
||||||
}
|
}
|
||||||
const names = whoIsTyping.map(function(m) {
|
const names = whoIsTyping.map(function(m) {
|
||||||
return m.name;
|
return m.name;
|
||||||
});
|
});
|
||||||
if (othersCount) {
|
if (othersCount==1) {
|
||||||
const other = ' other' + (othersCount > 1 ? 's' : '');
|
return _t('%(names)s and one other are typing', {names: names.slice(0, limit - 1).join(', ')});
|
||||||
return names.slice(0, limit - 1).join(', ') + ' and ' +
|
} else if (othersCount>1) {
|
||||||
othersCount + other + ' are typing';
|
return _t('%(names)s and %(count)s others are typing', {names: names.slice(0, limit - 1).join(', '), count: othersCount});
|
||||||
} else {
|
} else {
|
||||||
const lastPerson = names.pop();
|
const lastPerson = names.pop();
|
||||||
return names.join(', ') + ' and ' + lastPerson + ' are typing';
|
return _t('%(names)s and %(lastPerson)s are typing', {names: names.join(', '), lastPerson: lastPerson});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
|
@ -15,6 +15,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var React = require("react");
|
var React = require("react");
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
||||||
|
|
||||||
|
@ -78,33 +79,33 @@ module.exports = React.createClass({
|
||||||
_renderDeviceInfo: function() {
|
_renderDeviceInfo: function() {
|
||||||
var device = this.state.device;
|
var device = this.state.device;
|
||||||
if (!device) {
|
if (!device) {
|
||||||
return (<i>unknown device</i>);
|
return (<i>{ _t('unknown device') }</i>);
|
||||||
}
|
}
|
||||||
|
|
||||||
var verificationStatus = (<b>NOT verified</b>);
|
var verificationStatus = (<b>{ _t('NOT verified') }</b>);
|
||||||
if (device.isBlocked()) {
|
if (device.isBlocked()) {
|
||||||
verificationStatus = (<b>Blacklisted</b>);
|
verificationStatus = (<b>{ _t('Blacklisted') }</b>);
|
||||||
} else if (device.isVerified()) {
|
} else if (device.isVerified()) {
|
||||||
verificationStatus = "verified";
|
verificationStatus = _t('verified');
|
||||||
}
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<table>
|
<table>
|
||||||
<tbody>
|
<tbody>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Name</td>
|
<td>{ _t('Name') }</td>
|
||||||
<td>{ device.getDisplayName() }</td>
|
<td>{ device.getDisplayName() }</td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Device ID</td>
|
<td>{ _t('Device ID') }</td>
|
||||||
<td><code>{ device.deviceId }</code></td>
|
<td><code>{ device.deviceId }</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Verification</td>
|
<td>{ _t('Verification') }</td>
|
||||||
<td>{ verificationStatus }</td>
|
<td>{ verificationStatus }</td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Ed25519 fingerprint</td>
|
<td>{ _t('Ed25519 fingerprint') }</td>
|
||||||
<td><code>{device.getFingerprint()}</code></td>
|
<td><code>{device.getFingerprint()}</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
</tbody>
|
</tbody>
|
||||||
|
@ -119,32 +120,32 @@ module.exports = React.createClass({
|
||||||
<table>
|
<table>
|
||||||
<tbody>
|
<tbody>
|
||||||
<tr>
|
<tr>
|
||||||
<td>User ID</td>
|
<td>{ _t('User ID') }</td>
|
||||||
<td>{ event.getSender() }</td>
|
<td>{ event.getSender() }</td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Curve25519 identity key</td>
|
<td>{ _t('Curve25519 identity key') }</td>
|
||||||
<td><code>{ event.getSenderKey() || <i>none</i> }</code></td>
|
<td><code>{ event.getSenderKey() || <i>{ _t('none') }</i> }</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Claimed Ed25519 fingerprint key</td>
|
<td>{ _t('Claimed Ed25519 fingerprint key') }</td>
|
||||||
<td><code>{ event.getKeysClaimed().ed25519 || <i>none</i> }</code></td>
|
<td><code>{ event.getKeysClaimed().ed25519 || <i>{ _t('none') }</i> }</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Algorithm</td>
|
<td>{ _t('Algorithm') }</td>
|
||||||
<td>{ event.getWireContent().algorithm || <i>unencrypted</i> }</td>
|
<td>{ event.getWireContent().algorithm || <i>{ _t('unencrypted') }</i> }</td>
|
||||||
</tr>
|
</tr>
|
||||||
{
|
{
|
||||||
event.getContent().msgtype === 'm.bad.encrypted' ? (
|
event.getContent().msgtype === 'm.bad.encrypted' ? (
|
||||||
<tr>
|
<tr>
|
||||||
<td>Decryption error</td>
|
<td>{ _t('Decryption error') }</td>
|
||||||
<td>{ event.getContent().body }</td>
|
<td>{ event.getContent().body }</td>
|
||||||
</tr>
|
</tr>
|
||||||
) : null
|
) : null
|
||||||
}
|
}
|
||||||
<tr>
|
<tr>
|
||||||
<td>Session ID</td>
|
<td>{ _t('Session ID') }</td>
|
||||||
<td><code>{ event.getWireContent().session_id || <i>none</i> }</code></td>
|
<td><code>{ event.getWireContent().session_id || <i>{ _t('none') }</i> }</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
</tbody>
|
</tbody>
|
||||||
</table>
|
</table>
|
||||||
|
@ -166,18 +167,18 @@ module.exports = React.createClass({
|
||||||
return (
|
return (
|
||||||
<div className="mx_EncryptedEventDialog" onKeyDown={ this.onKeyDown }>
|
<div className="mx_EncryptedEventDialog" onKeyDown={ this.onKeyDown }>
|
||||||
<div className="mx_Dialog_title">
|
<div className="mx_Dialog_title">
|
||||||
End-to-end encryption information
|
{ _t('End-to-end encryption information') }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
<h4>Event information</h4>
|
<h4>{ _t('Event information') }</h4>
|
||||||
{this._renderEventInfo()}
|
{this._renderEventInfo()}
|
||||||
|
|
||||||
<h4>Sender device information</h4>
|
<h4>{ _t('Sender device information') }</h4>
|
||||||
{this._renderDeviceInfo()}
|
{this._renderDeviceInfo()}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button className="mx_Dialog_primary" onClick={ this.props.onFinished } autoFocus={ true }>
|
<button className="mx_Dialog_primary" onClick={ this.props.onFinished } autoFocus={ true }>
|
||||||
OK
|
{ _t('OK') }
|
||||||
</button>
|
</button>
|
||||||
{buttons}
|
{buttons}
|
||||||
</div>
|
</div>
|
||||||
|
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
import FileSaver from 'file-saver';
|
import FileSaver from 'file-saver';
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
import * as Matrix from 'matrix-js-sdk';
|
import * as Matrix from 'matrix-js-sdk';
|
||||||
import * as MegolmExportEncryption from '../../../utils/MegolmExportEncryption';
|
import * as MegolmExportEncryption from '../../../utils/MegolmExportEncryption';
|
||||||
|
@ -52,11 +53,11 @@ export default React.createClass({
|
||||||
|
|
||||||
const passphrase = this.refs.passphrase1.value;
|
const passphrase = this.refs.passphrase1.value;
|
||||||
if (passphrase !== this.refs.passphrase2.value) {
|
if (passphrase !== this.refs.passphrase2.value) {
|
||||||
this.setState({errStr: 'Passphrases must match'});
|
this.setState({errStr: _t('Passphrases must match')});
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
if (!passphrase) {
|
if (!passphrase) {
|
||||||
this.setState({errStr: 'Passphrase must not be empty'});
|
this.setState({errStr: _t('Passphrase must not be empty')});
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -80,11 +81,13 @@ export default React.createClass({
|
||||||
FileSaver.saveAs(blob, 'riot-keys.txt');
|
FileSaver.saveAs(blob, 'riot-keys.txt');
|
||||||
this.props.onFinished(true);
|
this.props.onFinished(true);
|
||||||
}).catch((e) => {
|
}).catch((e) => {
|
||||||
|
console.error("Error exporting e2e keys:", e);
|
||||||
if (this._unmounted) {
|
if (this._unmounted) {
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
const msg = e.friendlyText || _t('Unknown error');
|
||||||
this.setState({
|
this.setState({
|
||||||
errStr: e.message,
|
errStr: msg,
|
||||||
phase: PHASE_EDIT,
|
phase: PHASE_EDIT,
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
|
@ -109,24 +112,28 @@ export default React.createClass({
|
||||||
return (
|
return (
|
||||||
<BaseDialog className='mx_exportE2eKeysDialog'
|
<BaseDialog className='mx_exportE2eKeysDialog'
|
||||||
onFinished={this.props.onFinished}
|
onFinished={this.props.onFinished}
|
||||||
title="Export room keys"
|
title={_t("Export room keys")}
|
||||||
>
|
>
|
||||||
<form onSubmit={this._onPassphraseFormSubmit}>
|
<form onSubmit={this._onPassphraseFormSubmit}>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
<p>
|
<p>
|
||||||
This process allows you to export the keys for messages
|
{ _t(
|
||||||
you have received in encrypted rooms to a local file. You
|
'This process allows you to export the keys for messages ' +
|
||||||
will then be able to import the file into another Matrix
|
'you have received in encrypted rooms to a local file. You ' +
|
||||||
client in the future, so that client will also be able to
|
'will then be able to import the file into another Matrix ' +
|
||||||
decrypt these messages.
|
'client in the future, so that client will also be able to ' +
|
||||||
|
'decrypt these messages.',
|
||||||
|
) }
|
||||||
</p>
|
</p>
|
||||||
<p>
|
<p>
|
||||||
The exported file will allow anyone who can read it to decrypt
|
{ _t(
|
||||||
any encrypted messages that you can see, so you should be
|
'The exported file will allow anyone who can read it to decrypt ' +
|
||||||
careful to keep it secure. To help with this, you should enter
|
'any encrypted messages that you can see, so you should be ' +
|
||||||
a passphrase below, which will be used to encrypt the exported
|
'careful to keep it secure. To help with this, you should enter ' +
|
||||||
data. It will only be possible to import the data by using the
|
'a passphrase below, which will be used to encrypt the exported ' +
|
||||||
same passphrase.
|
'data. It will only be possible to import the data by using the ' +
|
||||||
|
'same passphrase.',
|
||||||
|
) }
|
||||||
</p>
|
</p>
|
||||||
<div className='error'>
|
<div className='error'>
|
||||||
{this.state.errStr}
|
{this.state.errStr}
|
||||||
|
@ -135,7 +142,7 @@ export default React.createClass({
|
||||||
<div className='mx_E2eKeysDialog_inputRow'>
|
<div className='mx_E2eKeysDialog_inputRow'>
|
||||||
<div className='mx_E2eKeysDialog_inputLabel'>
|
<div className='mx_E2eKeysDialog_inputLabel'>
|
||||||
<label htmlFor='passphrase1'>
|
<label htmlFor='passphrase1'>
|
||||||
Enter passphrase
|
{_t("Enter passphrase")}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div className='mx_E2eKeysDialog_inputCell'>
|
<div className='mx_E2eKeysDialog_inputCell'>
|
||||||
|
@ -148,7 +155,7 @@ export default React.createClass({
|
||||||
<div className='mx_E2eKeysDialog_inputRow'>
|
<div className='mx_E2eKeysDialog_inputRow'>
|
||||||
<div className='mx_E2eKeysDialog_inputLabel'>
|
<div className='mx_E2eKeysDialog_inputLabel'>
|
||||||
<label htmlFor='passphrase2'>
|
<label htmlFor='passphrase2'>
|
||||||
Confirm passphrase
|
{_t("Confirm passphrase")}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div className='mx_E2eKeysDialog_inputCell'>
|
<div className='mx_E2eKeysDialog_inputCell'>
|
||||||
|
@ -161,11 +168,11 @@ export default React.createClass({
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<div className='mx_Dialog_buttons'>
|
<div className='mx_Dialog_buttons'>
|
||||||
<input className='mx_Dialog_primary' type='submit' value='Export'
|
<input className='mx_Dialog_primary' type='submit' value={_t('Export')}
|
||||||
disabled={disableForm}
|
disabled={disableForm}
|
||||||
/>
|
/>
|
||||||
<button onClick={this._onCancelClick} disabled={disableForm}>
|
<button onClick={this._onCancelClick} disabled={disableForm}>
|
||||||
Cancel
|
{_t("Cancel")}
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
</form>
|
</form>
|
||||||
|
|
|
@ -19,6 +19,7 @@ import React from 'react';
|
||||||
import * as Matrix from 'matrix-js-sdk';
|
import * as Matrix from 'matrix-js-sdk';
|
||||||
import * as MegolmExportEncryption from '../../../utils/MegolmExportEncryption';
|
import * as MegolmExportEncryption from '../../../utils/MegolmExportEncryption';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
function readFileAsArrayBuffer(file) {
|
function readFileAsArrayBuffer(file) {
|
||||||
return new Promise((resolve, reject) => {
|
return new Promise((resolve, reject) => {
|
||||||
|
@ -88,11 +89,13 @@ export default React.createClass({
|
||||||
// TODO: it would probably be nice to give some feedback about what we've imported here.
|
// TODO: it would probably be nice to give some feedback about what we've imported here.
|
||||||
this.props.onFinished(true);
|
this.props.onFinished(true);
|
||||||
}).catch((e) => {
|
}).catch((e) => {
|
||||||
|
console.error("Error importing e2e keys:", e);
|
||||||
if (this._unmounted) {
|
if (this._unmounted) {
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
const msg = e.friendlyText || _t('Unknown error');
|
||||||
this.setState({
|
this.setState({
|
||||||
errStr: e.message,
|
errStr: msg,
|
||||||
phase: PHASE_EDIT,
|
phase: PHASE_EDIT,
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
|
@ -112,20 +115,23 @@ export default React.createClass({
|
||||||
return (
|
return (
|
||||||
<BaseDialog className='mx_importE2eKeysDialog'
|
<BaseDialog className='mx_importE2eKeysDialog'
|
||||||
onFinished={this.props.onFinished}
|
onFinished={this.props.onFinished}
|
||||||
title="Import room keys"
|
title={_t("Import room keys")}
|
||||||
>
|
>
|
||||||
<form onSubmit={this._onFormSubmit}>
|
<form onSubmit={this._onFormSubmit}>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
<p>
|
<p>
|
||||||
This process allows you to import encryption keys
|
{ _t(
|
||||||
that you had previously exported from another Matrix
|
'This process allows you to import encryption keys ' +
|
||||||
client. You will then be able to decrypt any
|
'that you had previously exported from another Matrix ' +
|
||||||
messages that the other client could decrypt.
|
'client. You will then be able to decrypt any ' +
|
||||||
|
'messages that the other client could decrypt.',
|
||||||
|
) }
|
||||||
</p>
|
</p>
|
||||||
<p>
|
<p>
|
||||||
The export file will be protected with a passphrase.
|
{ _t(
|
||||||
You should enter the passphrase here, to decrypt the
|
'The export file will be protected with a passphrase. ' +
|
||||||
file.
|
'You should enter the passphrase here, to decrypt the file.',
|
||||||
|
) }
|
||||||
</p>
|
</p>
|
||||||
<div className='error'>
|
<div className='error'>
|
||||||
{this.state.errStr}
|
{this.state.errStr}
|
||||||
|
@ -134,7 +140,7 @@ export default React.createClass({
|
||||||
<div className='mx_E2eKeysDialog_inputRow'>
|
<div className='mx_E2eKeysDialog_inputRow'>
|
||||||
<div className='mx_E2eKeysDialog_inputLabel'>
|
<div className='mx_E2eKeysDialog_inputLabel'>
|
||||||
<label htmlFor='importFile'>
|
<label htmlFor='importFile'>
|
||||||
File to import
|
{_t("File to import")}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div className='mx_E2eKeysDialog_inputCell'>
|
<div className='mx_E2eKeysDialog_inputCell'>
|
||||||
|
@ -147,7 +153,7 @@ export default React.createClass({
|
||||||
<div className='mx_E2eKeysDialog_inputRow'>
|
<div className='mx_E2eKeysDialog_inputRow'>
|
||||||
<div className='mx_E2eKeysDialog_inputLabel'>
|
<div className='mx_E2eKeysDialog_inputLabel'>
|
||||||
<label htmlFor='passphrase'>
|
<label htmlFor='passphrase'>
|
||||||
Enter passphrase
|
{_t("Enter passphrase")}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div className='mx_E2eKeysDialog_inputCell'>
|
<div className='mx_E2eKeysDialog_inputCell'>
|
||||||
|
@ -160,11 +166,11 @@ export default React.createClass({
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<div className='mx_Dialog_buttons'>
|
<div className='mx_Dialog_buttons'>
|
||||||
<input className='mx_Dialog_primary' type='submit' value='Import'
|
<input className='mx_Dialog_primary' type='submit' value={_t('Import')}
|
||||||
disabled={!this.state.enableSubmit || disableForm}
|
disabled={!this.state.enableSubmit || disableForm}
|
||||||
/>
|
/>
|
||||||
<button onClick={this._onCancelClick} disabled={disableForm}>
|
<button onClick={this._onCancelClick} disabled={disableForm}>
|
||||||
Cancel
|
{_t("Cancel")}
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
</form>
|
</form>
|
||||||
|
|
|
@ -1,3 +1,20 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 Aviral Dasgupta
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import type {Completion, SelectionRange} from './Autocompleter';
|
import type {Completion, SelectionRange} from './Autocompleter';
|
||||||
|
|
||||||
|
|
|
@ -1,3 +1,19 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 Aviral Dasgupta
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
// @flow
|
// @flow
|
||||||
|
|
||||||
import type {Component} from 'react';
|
import type {Component} from 'react';
|
||||||
|
|
|
@ -1,8 +1,27 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 Aviral Dasgupta
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../languageHandler';
|
||||||
import AutocompleteProvider from './AutocompleteProvider';
|
import AutocompleteProvider from './AutocompleteProvider';
|
||||||
import FuzzyMatcher from './FuzzyMatcher';
|
import FuzzyMatcher from './FuzzyMatcher';
|
||||||
import {TextualCompletion} from './Components';
|
import {TextualCompletion} from './Components';
|
||||||
|
|
||||||
|
// Warning: Since the description string will be translated in _t(result.description), all these strings below must be in i18n/strings/en_EN.json file
|
||||||
const COMMANDS = [
|
const COMMANDS = [
|
||||||
{
|
{
|
||||||
command: '/me',
|
command: '/me',
|
||||||
|
@ -61,7 +80,7 @@ const COMMANDS = [
|
||||||
}
|
}
|
||||||
];
|
];
|
||||||
|
|
||||||
let COMMAND_RE = /(^\/\w*)/g;
|
const COMMAND_RE = /(^\/\w*)/g;
|
||||||
|
|
||||||
let instance = null;
|
let instance = null;
|
||||||
|
|
||||||
|
@ -75,7 +94,7 @@ export default class CommandProvider extends AutocompleteProvider {
|
||||||
|
|
||||||
async getCompletions(query: string, selection: {start: number, end: number}) {
|
async getCompletions(query: string, selection: {start: number, end: number}) {
|
||||||
let completions = [];
|
let completions = [];
|
||||||
let {command, range} = this.getCurrentCommand(query, selection);
|
const {command, range} = this.getCurrentCommand(query, selection);
|
||||||
if (command) {
|
if (command) {
|
||||||
completions = this.matcher.match(command[0]).map(result => {
|
completions = this.matcher.match(command[0]).map(result => {
|
||||||
return {
|
return {
|
||||||
|
@ -83,7 +102,7 @@ export default class CommandProvider extends AutocompleteProvider {
|
||||||
component: (<TextualCompletion
|
component: (<TextualCompletion
|
||||||
title={result.command}
|
title={result.command}
|
||||||
subtitle={result.args}
|
subtitle={result.args}
|
||||||
description={result.description}
|
description={ _t(result.description) }
|
||||||
/>),
|
/>),
|
||||||
range,
|
range,
|
||||||
};
|
};
|
||||||
|
@ -93,12 +112,11 @@ export default class CommandProvider extends AutocompleteProvider {
|
||||||
}
|
}
|
||||||
|
|
||||||
getName() {
|
getName() {
|
||||||
return '*️⃣ Commands';
|
return '*️⃣ ' + _t('Commands');
|
||||||
}
|
}
|
||||||
|
|
||||||
static getInstance(): CommandProvider {
|
static getInstance(): CommandProvider {
|
||||||
if (instance == null)
|
if (instance === null) instance = new CommandProvider();
|
||||||
{instance = new CommandProvider();}
|
|
||||||
|
|
||||||
return instance;
|
return instance;
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,5 +1,20 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 Aviral Dasgupta
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import ReactDOM from 'react-dom';
|
|
||||||
import classNames from 'classnames';
|
import classNames from 'classnames';
|
||||||
|
|
||||||
/* These were earlier stateless functional components but had to be converted
|
/* These were earlier stateless functional components but had to be converted
|
||||||
|
|
|
@ -1,4 +1,22 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 Aviral Dasgupta
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../languageHandler';
|
||||||
import AutocompleteProvider from './AutocompleteProvider';
|
import AutocompleteProvider from './AutocompleteProvider';
|
||||||
import 'whatwg-fetch';
|
import 'whatwg-fetch';
|
||||||
|
|
||||||
|
@ -75,7 +93,7 @@ export default class DuckDuckGoProvider extends AutocompleteProvider {
|
||||||
}
|
}
|
||||||
|
|
||||||
getName() {
|
getName() {
|
||||||
return '🔍 Results from DuckDuckGo';
|
return '🔍 ' + _t('Results from DuckDuckGo');
|
||||||
}
|
}
|
||||||
|
|
||||||
static getInstance(): DuckDuckGoProvider {
|
static getInstance(): DuckDuckGoProvider {
|
||||||
|
|
|
@ -1,4 +1,22 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 Aviral Dasgupta
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../languageHandler';
|
||||||
import AutocompleteProvider from './AutocompleteProvider';
|
import AutocompleteProvider from './AutocompleteProvider';
|
||||||
import {emojioneList, shortnameToImage, shortnameToUnicode} from 'emojione';
|
import {emojioneList, shortnameToImage, shortnameToUnicode} from 'emojione';
|
||||||
import FuzzyMatcher from './FuzzyMatcher';
|
import FuzzyMatcher from './FuzzyMatcher';
|
||||||
|
@ -45,7 +63,7 @@ export default class EmojiProvider extends AutocompleteProvider {
|
||||||
}
|
}
|
||||||
|
|
||||||
getName() {
|
getName() {
|
||||||
return '😃 Emoji';
|
return '😃 ' + _t('Emoji');
|
||||||
}
|
}
|
||||||
|
|
||||||
static getInstance() {
|
static getInstance() {
|
||||||
|
|
|
@ -1,4 +1,22 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 Aviral Dasgupta
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../languageHandler';
|
||||||
import AutocompleteProvider from './AutocompleteProvider';
|
import AutocompleteProvider from './AutocompleteProvider';
|
||||||
import MatrixClientPeg from '../MatrixClientPeg';
|
import MatrixClientPeg from '../MatrixClientPeg';
|
||||||
import FuzzyMatcher from './FuzzyMatcher';
|
import FuzzyMatcher from './FuzzyMatcher';
|
||||||
|
@ -48,7 +66,7 @@ export default class RoomProvider extends AutocompleteProvider {
|
||||||
}
|
}
|
||||||
|
|
||||||
getName() {
|
getName() {
|
||||||
return '💬 Rooms';
|
return '💬 ' + _t('Rooms');
|
||||||
}
|
}
|
||||||
|
|
||||||
static getInstance() {
|
static getInstance() {
|
||||||
|
|
|
@ -1,7 +1,24 @@
|
||||||
//@flow
|
//@flow
|
||||||
|
/*
|
||||||
|
Copyright 2016 Aviral Dasgupta
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../languageHandler';
|
||||||
import AutocompleteProvider from './AutocompleteProvider';
|
import AutocompleteProvider from './AutocompleteProvider';
|
||||||
import Q from 'q';
|
|
||||||
import {PillCompletion} from './Components';
|
import {PillCompletion} from './Components';
|
||||||
import sdk from '../index';
|
import sdk from '../index';
|
||||||
import FuzzyMatcher from './FuzzyMatcher';
|
import FuzzyMatcher from './FuzzyMatcher';
|
||||||
|
@ -57,7 +74,7 @@ export default class UserProvider extends AutocompleteProvider {
|
||||||
}
|
}
|
||||||
|
|
||||||
getName() {
|
getName() {
|
||||||
return '👥 Users';
|
return '👥 ' + _t('Users');
|
||||||
}
|
}
|
||||||
|
|
||||||
setUserListFromRoom(room: Room) {
|
setUserListFromRoom(room: Room) {
|
||||||
|
|
|
@ -1,265 +0,0 @@
|
||||||
/*
|
|
||||||
Copyright 2015, 2016 OpenMarket Ltd
|
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
you may not use this file except in compliance with the License.
|
|
||||||
You may obtain a copy of the License at
|
|
||||||
|
|
||||||
http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
|
|
||||||
Unless required by applicable law or agreed to in writing, software
|
|
||||||
distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
See the License for the specific language governing permissions and
|
|
||||||
limitations under the License.
|
|
||||||
*/
|
|
||||||
|
|
||||||
/*
|
|
||||||
* THIS FILE IS AUTO-GENERATED
|
|
||||||
* You can edit it you like, but your changes will be overwritten,
|
|
||||||
* so you'd just be trying to swim upstream like a salmon.
|
|
||||||
* You are not a salmon.
|
|
||||||
*
|
|
||||||
* To update it, run:
|
|
||||||
* ./reskindex.js -h header
|
|
||||||
*/
|
|
||||||
|
|
||||||
module.exports.components = {};
|
|
||||||
import structures$ContextualMenu from './components/structures/ContextualMenu';
|
|
||||||
structures$ContextualMenu && (module.exports.components['structures.ContextualMenu'] = structures$ContextualMenu);
|
|
||||||
import structures$CreateRoom from './components/structures/CreateRoom';
|
|
||||||
structures$CreateRoom && (module.exports.components['structures.CreateRoom'] = structures$CreateRoom);
|
|
||||||
import structures$FilePanel from './components/structures/FilePanel';
|
|
||||||
structures$FilePanel && (module.exports.components['structures.FilePanel'] = structures$FilePanel);
|
|
||||||
import structures$InteractiveAuth from './components/structures/InteractiveAuth';
|
|
||||||
structures$InteractiveAuth && (module.exports.components['structures.InteractiveAuth'] = structures$InteractiveAuth);
|
|
||||||
import structures$LoggedInView from './components/structures/LoggedInView';
|
|
||||||
structures$LoggedInView && (module.exports.components['structures.LoggedInView'] = structures$LoggedInView);
|
|
||||||
import structures$MatrixChat from './components/structures/MatrixChat';
|
|
||||||
structures$MatrixChat && (module.exports.components['structures.MatrixChat'] = structures$MatrixChat);
|
|
||||||
import structures$MessagePanel from './components/structures/MessagePanel';
|
|
||||||
structures$MessagePanel && (module.exports.components['structures.MessagePanel'] = structures$MessagePanel);
|
|
||||||
import structures$NotificationPanel from './components/structures/NotificationPanel';
|
|
||||||
structures$NotificationPanel && (module.exports.components['structures.NotificationPanel'] = structures$NotificationPanel);
|
|
||||||
import structures$RoomStatusBar from './components/structures/RoomStatusBar';
|
|
||||||
structures$RoomStatusBar && (module.exports.components['structures.RoomStatusBar'] = structures$RoomStatusBar);
|
|
||||||
import structures$RoomView from './components/structures/RoomView';
|
|
||||||
structures$RoomView && (module.exports.components['structures.RoomView'] = structures$RoomView);
|
|
||||||
import structures$ScrollPanel from './components/structures/ScrollPanel';
|
|
||||||
structures$ScrollPanel && (module.exports.components['structures.ScrollPanel'] = structures$ScrollPanel);
|
|
||||||
import structures$TimelinePanel from './components/structures/TimelinePanel';
|
|
||||||
structures$TimelinePanel && (module.exports.components['structures.TimelinePanel'] = structures$TimelinePanel);
|
|
||||||
import structures$UploadBar from './components/structures/UploadBar';
|
|
||||||
structures$UploadBar && (module.exports.components['structures.UploadBar'] = structures$UploadBar);
|
|
||||||
import structures$UserSettings from './components/structures/UserSettings';
|
|
||||||
structures$UserSettings && (module.exports.components['structures.UserSettings'] = structures$UserSettings);
|
|
||||||
import structures$login$ForgotPassword from './components/structures/login/ForgotPassword';
|
|
||||||
structures$login$ForgotPassword && (module.exports.components['structures.login.ForgotPassword'] = structures$login$ForgotPassword);
|
|
||||||
import structures$login$Login from './components/structures/login/Login';
|
|
||||||
structures$login$Login && (module.exports.components['structures.login.Login'] = structures$login$Login);
|
|
||||||
import structures$login$PostRegistration from './components/structures/login/PostRegistration';
|
|
||||||
structures$login$PostRegistration && (module.exports.components['structures.login.PostRegistration'] = structures$login$PostRegistration);
|
|
||||||
import structures$login$Registration from './components/structures/login/Registration';
|
|
||||||
structures$login$Registration && (module.exports.components['structures.login.Registration'] = structures$login$Registration);
|
|
||||||
import views$avatars$BaseAvatar from './components/views/avatars/BaseAvatar';
|
|
||||||
views$avatars$BaseAvatar && (module.exports.components['views.avatars.BaseAvatar'] = views$avatars$BaseAvatar);
|
|
||||||
import views$avatars$MemberAvatar from './components/views/avatars/MemberAvatar';
|
|
||||||
views$avatars$MemberAvatar && (module.exports.components['views.avatars.MemberAvatar'] = views$avatars$MemberAvatar);
|
|
||||||
import views$avatars$RoomAvatar from './components/views/avatars/RoomAvatar';
|
|
||||||
views$avatars$RoomAvatar && (module.exports.components['views.avatars.RoomAvatar'] = views$avatars$RoomAvatar);
|
|
||||||
import views$create_room$CreateRoomButton from './components/views/create_room/CreateRoomButton';
|
|
||||||
views$create_room$CreateRoomButton && (module.exports.components['views.create_room.CreateRoomButton'] = views$create_room$CreateRoomButton);
|
|
||||||
import views$create_room$Presets from './components/views/create_room/Presets';
|
|
||||||
views$create_room$Presets && (module.exports.components['views.create_room.Presets'] = views$create_room$Presets);
|
|
||||||
import views$create_room$RoomAlias from './components/views/create_room/RoomAlias';
|
|
||||||
views$create_room$RoomAlias && (module.exports.components['views.create_room.RoomAlias'] = views$create_room$RoomAlias);
|
|
||||||
import views$dialogs$BaseDialog from './components/views/dialogs/BaseDialog';
|
|
||||||
views$dialogs$BaseDialog && (module.exports.components['views.dialogs.BaseDialog'] = views$dialogs$BaseDialog);
|
|
||||||
import views$dialogs$ChatCreateOrReuseDialog from './components/views/dialogs/ChatCreateOrReuseDialog';
|
|
||||||
views$dialogs$ChatCreateOrReuseDialog && (module.exports.components['views.dialogs.ChatCreateOrReuseDialog'] = views$dialogs$ChatCreateOrReuseDialog);
|
|
||||||
import views$dialogs$ChatInviteDialog from './components/views/dialogs/ChatInviteDialog';
|
|
||||||
views$dialogs$ChatInviteDialog && (module.exports.components['views.dialogs.ChatInviteDialog'] = views$dialogs$ChatInviteDialog);
|
|
||||||
import views$dialogs$ConfirmRedactDialog from './components/views/dialogs/ConfirmRedactDialog';
|
|
||||||
views$dialogs$ConfirmRedactDialog && (module.exports.components['views.dialogs.ConfirmRedactDialog'] = views$dialogs$ConfirmRedactDialog);
|
|
||||||
import views$dialogs$ConfirmUserActionDialog from './components/views/dialogs/ConfirmUserActionDialog';
|
|
||||||
views$dialogs$ConfirmUserActionDialog && (module.exports.components['views.dialogs.ConfirmUserActionDialog'] = views$dialogs$ConfirmUserActionDialog);
|
|
||||||
import views$dialogs$DeactivateAccountDialog from './components/views/dialogs/DeactivateAccountDialog';
|
|
||||||
views$dialogs$DeactivateAccountDialog && (module.exports.components['views.dialogs.DeactivateAccountDialog'] = views$dialogs$DeactivateAccountDialog);
|
|
||||||
import views$dialogs$ErrorDialog from './components/views/dialogs/ErrorDialog';
|
|
||||||
views$dialogs$ErrorDialog && (module.exports.components['views.dialogs.ErrorDialog'] = views$dialogs$ErrorDialog);
|
|
||||||
import views$dialogs$InteractiveAuthDialog from './components/views/dialogs/InteractiveAuthDialog';
|
|
||||||
views$dialogs$InteractiveAuthDialog && (module.exports.components['views.dialogs.InteractiveAuthDialog'] = views$dialogs$InteractiveAuthDialog);
|
|
||||||
import views$dialogs$NeedToRegisterDialog from './components/views/dialogs/NeedToRegisterDialog';
|
|
||||||
views$dialogs$NeedToRegisterDialog && (module.exports.components['views.dialogs.NeedToRegisterDialog'] = views$dialogs$NeedToRegisterDialog);
|
|
||||||
import views$dialogs$QuestionDialog from './components/views/dialogs/QuestionDialog';
|
|
||||||
views$dialogs$QuestionDialog && (module.exports.components['views.dialogs.QuestionDialog'] = views$dialogs$QuestionDialog);
|
|
||||||
import views$dialogs$SessionRestoreErrorDialog from './components/views/dialogs/SessionRestoreErrorDialog';
|
|
||||||
views$dialogs$SessionRestoreErrorDialog && (module.exports.components['views.dialogs.SessionRestoreErrorDialog'] = views$dialogs$SessionRestoreErrorDialog);
|
|
||||||
import views$dialogs$SetDisplayNameDialog from './components/views/dialogs/SetDisplayNameDialog';
|
|
||||||
views$dialogs$SetDisplayNameDialog && (module.exports.components['views.dialogs.SetDisplayNameDialog'] = views$dialogs$SetDisplayNameDialog);
|
|
||||||
import views$dialogs$TextInputDialog from './components/views/dialogs/TextInputDialog';
|
|
||||||
views$dialogs$TextInputDialog && (module.exports.components['views.dialogs.TextInputDialog'] = views$dialogs$TextInputDialog);
|
|
||||||
import views$dialogs$UnknownDeviceDialog from './components/views/dialogs/UnknownDeviceDialog';
|
|
||||||
views$dialogs$UnknownDeviceDialog && (module.exports.components['views.dialogs.UnknownDeviceDialog'] = views$dialogs$UnknownDeviceDialog);
|
|
||||||
import views$elements$AccessibleButton from './components/views/elements/AccessibleButton';
|
|
||||||
views$elements$AccessibleButton && (module.exports.components['views.elements.AccessibleButton'] = views$elements$AccessibleButton);
|
|
||||||
import views$elements$ActionButton from './components/views/elements/ActionButton';
|
|
||||||
views$elements$ActionButton && (module.exports.components['views.elements.ActionButton'] = views$elements$ActionButton);
|
|
||||||
import views$elements$AddressSelector from './components/views/elements/AddressSelector';
|
|
||||||
views$elements$AddressSelector && (module.exports.components['views.elements.AddressSelector'] = views$elements$AddressSelector);
|
|
||||||
import views$elements$AddressTile from './components/views/elements/AddressTile';
|
|
||||||
views$elements$AddressTile && (module.exports.components['views.elements.AddressTile'] = views$elements$AddressTile);
|
|
||||||
import views$elements$CreateRoomButton from './components/views/elements/CreateRoomButton';
|
|
||||||
views$elements$CreateRoomButton && (module.exports.components['views.elements.CreateRoomButton'] = views$elements$CreateRoomButton);
|
|
||||||
import views$elements$DeviceVerifyButtons from './components/views/elements/DeviceVerifyButtons';
|
|
||||||
views$elements$DeviceVerifyButtons && (module.exports.components['views.elements.DeviceVerifyButtons'] = views$elements$DeviceVerifyButtons);
|
|
||||||
import views$elements$DirectorySearchBox from './components/views/elements/DirectorySearchBox';
|
|
||||||
views$elements$DirectorySearchBox && (module.exports.components['views.elements.DirectorySearchBox'] = views$elements$DirectorySearchBox);
|
|
||||||
import views$elements$Dropdown from './components/views/elements/Dropdown';
|
|
||||||
views$elements$Dropdown && (module.exports.components['views.elements.Dropdown'] = views$elements$Dropdown);
|
|
||||||
import views$elements$EditableText from './components/views/elements/EditableText';
|
|
||||||
views$elements$EditableText && (module.exports.components['views.elements.EditableText'] = views$elements$EditableText);
|
|
||||||
import views$elements$EditableTextContainer from './components/views/elements/EditableTextContainer';
|
|
||||||
views$elements$EditableTextContainer && (module.exports.components['views.elements.EditableTextContainer'] = views$elements$EditableTextContainer);
|
|
||||||
import views$elements$EmojiText from './components/views/elements/EmojiText';
|
|
||||||
views$elements$EmojiText && (module.exports.components['views.elements.EmojiText'] = views$elements$EmojiText);
|
|
||||||
import views$elements$HomeButton from './components/views/elements/HomeButton';
|
|
||||||
views$elements$HomeButton && (module.exports.components['views.elements.HomeButton'] = views$elements$HomeButton);
|
|
||||||
import views$elements$MemberEventListSummary from './components/views/elements/MemberEventListSummary';
|
|
||||||
views$elements$MemberEventListSummary && (module.exports.components['views.elements.MemberEventListSummary'] = views$elements$MemberEventListSummary);
|
|
||||||
import views$elements$PowerSelector from './components/views/elements/PowerSelector';
|
|
||||||
views$elements$PowerSelector && (module.exports.components['views.elements.PowerSelector'] = views$elements$PowerSelector);
|
|
||||||
import views$elements$ProgressBar from './components/views/elements/ProgressBar';
|
|
||||||
views$elements$ProgressBar && (module.exports.components['views.elements.ProgressBar'] = views$elements$ProgressBar);
|
|
||||||
import views$elements$RoomDirectoryButton from './components/views/elements/RoomDirectoryButton';
|
|
||||||
views$elements$RoomDirectoryButton && (module.exports.components['views.elements.RoomDirectoryButton'] = views$elements$RoomDirectoryButton);
|
|
||||||
import views$elements$SettingsButton from './components/views/elements/SettingsButton';
|
|
||||||
views$elements$SettingsButton && (module.exports.components['views.elements.SettingsButton'] = views$elements$SettingsButton);
|
|
||||||
import views$elements$StartChatButton from './components/views/elements/StartChatButton';
|
|
||||||
views$elements$StartChatButton && (module.exports.components['views.elements.StartChatButton'] = views$elements$StartChatButton);
|
|
||||||
import views$elements$TintableSvg from './components/views/elements/TintableSvg';
|
|
||||||
views$elements$TintableSvg && (module.exports.components['views.elements.TintableSvg'] = views$elements$TintableSvg);
|
|
||||||
import views$elements$TruncatedList from './components/views/elements/TruncatedList';
|
|
||||||
views$elements$TruncatedList && (module.exports.components['views.elements.TruncatedList'] = views$elements$TruncatedList);
|
|
||||||
import views$elements$UserSelector from './components/views/elements/UserSelector';
|
|
||||||
views$elements$UserSelector && (module.exports.components['views.elements.UserSelector'] = views$elements$UserSelector);
|
|
||||||
import views$login$CaptchaForm from './components/views/login/CaptchaForm';
|
|
||||||
views$login$CaptchaForm && (module.exports.components['views.login.CaptchaForm'] = views$login$CaptchaForm);
|
|
||||||
import views$login$CasLogin from './components/views/login/CasLogin';
|
|
||||||
views$login$CasLogin && (module.exports.components['views.login.CasLogin'] = views$login$CasLogin);
|
|
||||||
import views$login$CountryDropdown from './components/views/login/CountryDropdown';
|
|
||||||
views$login$CountryDropdown && (module.exports.components['views.login.CountryDropdown'] = views$login$CountryDropdown);
|
|
||||||
import views$login$CustomServerDialog from './components/views/login/CustomServerDialog';
|
|
||||||
views$login$CustomServerDialog && (module.exports.components['views.login.CustomServerDialog'] = views$login$CustomServerDialog);
|
|
||||||
import views$login$InteractiveAuthEntryComponents from './components/views/login/InteractiveAuthEntryComponents';
|
|
||||||
views$login$InteractiveAuthEntryComponents && (module.exports.components['views.login.InteractiveAuthEntryComponents'] = views$login$InteractiveAuthEntryComponents);
|
|
||||||
import views$login$LoginFooter from './components/views/login/LoginFooter';
|
|
||||||
views$login$LoginFooter && (module.exports.components['views.login.LoginFooter'] = views$login$LoginFooter);
|
|
||||||
import views$login$LoginHeader from './components/views/login/LoginHeader';
|
|
||||||
views$login$LoginHeader && (module.exports.components['views.login.LoginHeader'] = views$login$LoginHeader);
|
|
||||||
import views$login$PasswordLogin from './components/views/login/PasswordLogin';
|
|
||||||
views$login$PasswordLogin && (module.exports.components['views.login.PasswordLogin'] = views$login$PasswordLogin);
|
|
||||||
import views$login$RegistrationForm from './components/views/login/RegistrationForm';
|
|
||||||
views$login$RegistrationForm && (module.exports.components['views.login.RegistrationForm'] = views$login$RegistrationForm);
|
|
||||||
import views$login$ServerConfig from './components/views/login/ServerConfig';
|
|
||||||
views$login$ServerConfig && (module.exports.components['views.login.ServerConfig'] = views$login$ServerConfig);
|
|
||||||
import views$messages$MAudioBody from './components/views/messages/MAudioBody';
|
|
||||||
views$messages$MAudioBody && (module.exports.components['views.messages.MAudioBody'] = views$messages$MAudioBody);
|
|
||||||
import views$messages$MFileBody from './components/views/messages/MFileBody';
|
|
||||||
views$messages$MFileBody && (module.exports.components['views.messages.MFileBody'] = views$messages$MFileBody);
|
|
||||||
import views$messages$MImageBody from './components/views/messages/MImageBody';
|
|
||||||
views$messages$MImageBody && (module.exports.components['views.messages.MImageBody'] = views$messages$MImageBody);
|
|
||||||
import views$messages$MVideoBody from './components/views/messages/MVideoBody';
|
|
||||||
views$messages$MVideoBody && (module.exports.components['views.messages.MVideoBody'] = views$messages$MVideoBody);
|
|
||||||
import views$messages$MessageEvent from './components/views/messages/MessageEvent';
|
|
||||||
views$messages$MessageEvent && (module.exports.components['views.messages.MessageEvent'] = views$messages$MessageEvent);
|
|
||||||
import views$messages$SenderProfile from './components/views/messages/SenderProfile';
|
|
||||||
views$messages$SenderProfile && (module.exports.components['views.messages.SenderProfile'] = views$messages$SenderProfile);
|
|
||||||
import views$messages$TextualBody from './components/views/messages/TextualBody';
|
|
||||||
views$messages$TextualBody && (module.exports.components['views.messages.TextualBody'] = views$messages$TextualBody);
|
|
||||||
import views$messages$TextualEvent from './components/views/messages/TextualEvent';
|
|
||||||
views$messages$TextualEvent && (module.exports.components['views.messages.TextualEvent'] = views$messages$TextualEvent);
|
|
||||||
import views$messages$UnknownBody from './components/views/messages/UnknownBody';
|
|
||||||
views$messages$UnknownBody && (module.exports.components['views.messages.UnknownBody'] = views$messages$UnknownBody);
|
|
||||||
import views$room_settings$AliasSettings from './components/views/room_settings/AliasSettings';
|
|
||||||
views$room_settings$AliasSettings && (module.exports.components['views.room_settings.AliasSettings'] = views$room_settings$AliasSettings);
|
|
||||||
import views$room_settings$ColorSettings from './components/views/room_settings/ColorSettings';
|
|
||||||
views$room_settings$ColorSettings && (module.exports.components['views.room_settings.ColorSettings'] = views$room_settings$ColorSettings);
|
|
||||||
import views$room_settings$UrlPreviewSettings from './components/views/room_settings/UrlPreviewSettings';
|
|
||||||
views$room_settings$UrlPreviewSettings && (module.exports.components['views.room_settings.UrlPreviewSettings'] = views$room_settings$UrlPreviewSettings);
|
|
||||||
import views$rooms$Autocomplete from './components/views/rooms/Autocomplete';
|
|
||||||
views$rooms$Autocomplete && (module.exports.components['views.rooms.Autocomplete'] = views$rooms$Autocomplete);
|
|
||||||
import views$rooms$AuxPanel from './components/views/rooms/AuxPanel';
|
|
||||||
views$rooms$AuxPanel && (module.exports.components['views.rooms.AuxPanel'] = views$rooms$AuxPanel);
|
|
||||||
import views$rooms$EntityTile from './components/views/rooms/EntityTile';
|
|
||||||
views$rooms$EntityTile && (module.exports.components['views.rooms.EntityTile'] = views$rooms$EntityTile);
|
|
||||||
import views$rooms$EventTile from './components/views/rooms/EventTile';
|
|
||||||
views$rooms$EventTile && (module.exports.components['views.rooms.EventTile'] = views$rooms$EventTile);
|
|
||||||
import views$rooms$LinkPreviewWidget from './components/views/rooms/LinkPreviewWidget';
|
|
||||||
views$rooms$LinkPreviewWidget && (module.exports.components['views.rooms.LinkPreviewWidget'] = views$rooms$LinkPreviewWidget);
|
|
||||||
import views$rooms$MemberDeviceInfo from './components/views/rooms/MemberDeviceInfo';
|
|
||||||
views$rooms$MemberDeviceInfo && (module.exports.components['views.rooms.MemberDeviceInfo'] = views$rooms$MemberDeviceInfo);
|
|
||||||
import views$rooms$MemberInfo from './components/views/rooms/MemberInfo';
|
|
||||||
views$rooms$MemberInfo && (module.exports.components['views.rooms.MemberInfo'] = views$rooms$MemberInfo);
|
|
||||||
import views$rooms$MemberList from './components/views/rooms/MemberList';
|
|
||||||
views$rooms$MemberList && (module.exports.components['views.rooms.MemberList'] = views$rooms$MemberList);
|
|
||||||
import views$rooms$MemberTile from './components/views/rooms/MemberTile';
|
|
||||||
views$rooms$MemberTile && (module.exports.components['views.rooms.MemberTile'] = views$rooms$MemberTile);
|
|
||||||
import views$rooms$MessageComposer from './components/views/rooms/MessageComposer';
|
|
||||||
views$rooms$MessageComposer && (module.exports.components['views.rooms.MessageComposer'] = views$rooms$MessageComposer);
|
|
||||||
import views$rooms$MessageComposerInput from './components/views/rooms/MessageComposerInput';
|
|
||||||
views$rooms$MessageComposerInput && (module.exports.components['views.rooms.MessageComposerInput'] = views$rooms$MessageComposerInput);
|
|
||||||
import views$rooms$MessageComposerInputOld from './components/views/rooms/MessageComposerInputOld';
|
|
||||||
views$rooms$MessageComposerInputOld && (module.exports.components['views.rooms.MessageComposerInputOld'] = views$rooms$MessageComposerInputOld);
|
|
||||||
import views$rooms$PresenceLabel from './components/views/rooms/PresenceLabel';
|
|
||||||
views$rooms$PresenceLabel && (module.exports.components['views.rooms.PresenceLabel'] = views$rooms$PresenceLabel);
|
|
||||||
import views$rooms$ReadReceiptMarker from './components/views/rooms/ReadReceiptMarker';
|
|
||||||
views$rooms$ReadReceiptMarker && (module.exports.components['views.rooms.ReadReceiptMarker'] = views$rooms$ReadReceiptMarker);
|
|
||||||
import views$rooms$RoomHeader from './components/views/rooms/RoomHeader';
|
|
||||||
views$rooms$RoomHeader && (module.exports.components['views.rooms.RoomHeader'] = views$rooms$RoomHeader);
|
|
||||||
import views$rooms$RoomList from './components/views/rooms/RoomList';
|
|
||||||
views$rooms$RoomList && (module.exports.components['views.rooms.RoomList'] = views$rooms$RoomList);
|
|
||||||
import views$rooms$RoomNameEditor from './components/views/rooms/RoomNameEditor';
|
|
||||||
views$rooms$RoomNameEditor && (module.exports.components['views.rooms.RoomNameEditor'] = views$rooms$RoomNameEditor);
|
|
||||||
import views$rooms$RoomPreviewBar from './components/views/rooms/RoomPreviewBar';
|
|
||||||
views$rooms$RoomPreviewBar && (module.exports.components['views.rooms.RoomPreviewBar'] = views$rooms$RoomPreviewBar);
|
|
||||||
import views$rooms$RoomSettings from './components/views/rooms/RoomSettings';
|
|
||||||
views$rooms$RoomSettings && (module.exports.components['views.rooms.RoomSettings'] = views$rooms$RoomSettings);
|
|
||||||
import views$rooms$RoomTile from './components/views/rooms/RoomTile';
|
|
||||||
views$rooms$RoomTile && (module.exports.components['views.rooms.RoomTile'] = views$rooms$RoomTile);
|
|
||||||
import views$rooms$RoomTopicEditor from './components/views/rooms/RoomTopicEditor';
|
|
||||||
views$rooms$RoomTopicEditor && (module.exports.components['views.rooms.RoomTopicEditor'] = views$rooms$RoomTopicEditor);
|
|
||||||
import views$rooms$SearchResultTile from './components/views/rooms/SearchResultTile';
|
|
||||||
views$rooms$SearchResultTile && (module.exports.components['views.rooms.SearchResultTile'] = views$rooms$SearchResultTile);
|
|
||||||
import views$rooms$SearchableEntityList from './components/views/rooms/SearchableEntityList';
|
|
||||||
views$rooms$SearchableEntityList && (module.exports.components['views.rooms.SearchableEntityList'] = views$rooms$SearchableEntityList);
|
|
||||||
import views$rooms$SimpleRoomHeader from './components/views/rooms/SimpleRoomHeader';
|
|
||||||
views$rooms$SimpleRoomHeader && (module.exports.components['views.rooms.SimpleRoomHeader'] = views$rooms$SimpleRoomHeader);
|
|
||||||
import views$rooms$TabCompleteBar from './components/views/rooms/TabCompleteBar';
|
|
||||||
views$rooms$TabCompleteBar && (module.exports.components['views.rooms.TabCompleteBar'] = views$rooms$TabCompleteBar);
|
|
||||||
import views$rooms$TopUnreadMessagesBar from './components/views/rooms/TopUnreadMessagesBar';
|
|
||||||
views$rooms$TopUnreadMessagesBar && (module.exports.components['views.rooms.TopUnreadMessagesBar'] = views$rooms$TopUnreadMessagesBar);
|
|
||||||
import views$rooms$UserTile from './components/views/rooms/UserTile';
|
|
||||||
views$rooms$UserTile && (module.exports.components['views.rooms.UserTile'] = views$rooms$UserTile);
|
|
||||||
import views$settings$AddPhoneNumber from './components/views/settings/AddPhoneNumber';
|
|
||||||
views$settings$AddPhoneNumber && (module.exports.components['views.settings.AddPhoneNumber'] = views$settings$AddPhoneNumber);
|
|
||||||
import views$settings$ChangeAvatar from './components/views/settings/ChangeAvatar';
|
|
||||||
views$settings$ChangeAvatar && (module.exports.components['views.settings.ChangeAvatar'] = views$settings$ChangeAvatar);
|
|
||||||
import views$settings$ChangeDisplayName from './components/views/settings/ChangeDisplayName';
|
|
||||||
views$settings$ChangeDisplayName && (module.exports.components['views.settings.ChangeDisplayName'] = views$settings$ChangeDisplayName);
|
|
||||||
import views$settings$ChangePassword from './components/views/settings/ChangePassword';
|
|
||||||
views$settings$ChangePassword && (module.exports.components['views.settings.ChangePassword'] = views$settings$ChangePassword);
|
|
||||||
import views$settings$DevicesPanel from './components/views/settings/DevicesPanel';
|
|
||||||
views$settings$DevicesPanel && (module.exports.components['views.settings.DevicesPanel'] = views$settings$DevicesPanel);
|
|
||||||
import views$settings$DevicesPanelEntry from './components/views/settings/DevicesPanelEntry';
|
|
||||||
views$settings$DevicesPanelEntry && (module.exports.components['views.settings.DevicesPanelEntry'] = views$settings$DevicesPanelEntry);
|
|
||||||
import views$settings$EnableNotificationsButton from './components/views/settings/EnableNotificationsButton';
|
|
||||||
views$settings$EnableNotificationsButton && (module.exports.components['views.settings.EnableNotificationsButton'] = views$settings$EnableNotificationsButton);
|
|
||||||
import views$voip$CallView from './components/views/voip/CallView';
|
|
||||||
views$voip$CallView && (module.exports.components['views.voip.CallView'] = views$voip$CallView);
|
|
||||||
import views$voip$IncomingCallBox from './components/views/voip/IncomingCallBox';
|
|
||||||
views$voip$IncomingCallBox && (module.exports.components['views.voip.IncomingCallBox'] = views$voip$IncomingCallBox);
|
|
||||||
import views$voip$VideoFeed from './components/views/voip/VideoFeed';
|
|
||||||
views$voip$VideoFeed && (module.exports.components['views.voip.VideoFeed'] = views$voip$VideoFeed);
|
|
||||||
import views$voip$VideoView from './components/views/voip/VideoView';
|
|
||||||
views$voip$VideoView && (module.exports.components['views.voip.VideoView'] = views$voip$VideoView);
|
|
|
@ -16,15 +16,15 @@ limitations under the License.
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require("react");
|
import React from 'react';
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
import { _t } from '../../languageHandler';
|
||||||
var PresetValues = {
|
import sdk from '../../index';
|
||||||
|
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||||
|
const PresetValues = {
|
||||||
PrivateChat: "private_chat",
|
PrivateChat: "private_chat",
|
||||||
PublicChat: "public_chat",
|
PublicChat: "public_chat",
|
||||||
Custom: "custom",
|
Custom: "custom",
|
||||||
};
|
};
|
||||||
var q = require('q');
|
|
||||||
var sdk = require('../../index');
|
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'CreateRoom',
|
displayName: 'CreateRoom',
|
||||||
|
@ -231,7 +231,7 @@ module.exports = React.createClass({
|
||||||
if (curr_phase == this.phases.ERROR) {
|
if (curr_phase == this.phases.ERROR) {
|
||||||
error_box = (
|
error_box = (
|
||||||
<div className="mx_Error">
|
<div className="mx_Error">
|
||||||
An error occured: {this.state.error_string}
|
{_t('An error occurred: %(error_string)s', {error_string: this.state.error_string})}
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -246,29 +246,29 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className="mx_CreateRoom">
|
<div className="mx_CreateRoom">
|
||||||
<SimpleRoomHeader title="CreateRoom" collapsedRhs={ this.props.collapsedRhs }/>
|
<SimpleRoomHeader title={_t("Create Room")} collapsedRhs={ this.props.collapsedRhs }/>
|
||||||
<div className="mx_CreateRoom_body">
|
<div className="mx_CreateRoom_body">
|
||||||
<input type="text" ref="room_name" value={this.state.room_name} onChange={this.onNameChange} placeholder="Name"/> <br />
|
<input type="text" ref="room_name" value={this.state.room_name} onChange={this.onNameChange} placeholder={_t('Name')}/> <br />
|
||||||
<textarea className="mx_CreateRoom_description" ref="topic" value={this.state.topic} onChange={this.onTopicChange} placeholder="Topic"/> <br />
|
<textarea className="mx_CreateRoom_description" ref="topic" value={this.state.topic} onChange={this.onTopicChange} placeholder={_t('Topic')}/> <br />
|
||||||
<RoomAlias ref="alias" alias={this.state.alias} homeserver={ domain } onChange={this.onAliasChanged}/> <br />
|
<RoomAlias ref="alias" alias={this.state.alias} homeserver={ domain } onChange={this.onAliasChanged}/> <br />
|
||||||
<UserSelector ref="user_selector" selected_users={this.state.invited_users} onChange={this.onInviteChanged}/> <br />
|
<UserSelector ref="user_selector" selected_users={this.state.invited_users} onChange={this.onInviteChanged}/> <br />
|
||||||
<Presets ref="presets" onChange={this.onPresetChanged} preset={this.state.preset}/> <br />
|
<Presets ref="presets" onChange={this.onPresetChanged} preset={this.state.preset}/> <br />
|
||||||
<div>
|
<div>
|
||||||
<label>
|
<label>
|
||||||
<input type="checkbox" ref="is_private" checked={this.state.is_private} onChange={this.onPrivateChanged}/>
|
<input type="checkbox" ref="is_private" checked={this.state.is_private} onChange={this.onPrivateChanged}/>
|
||||||
Make this room private
|
{_t('Make this room private')}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div>
|
<div>
|
||||||
<label>
|
<label>
|
||||||
<input type="checkbox" ref="share_history" checked={this.state.share_history} onChange={this.onShareHistoryChanged}/>
|
<input type="checkbox" ref="share_history" checked={this.state.share_history} onChange={this.onShareHistoryChanged}/>
|
||||||
Share message history with new users
|
{_t('Share message history with new users')}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_CreateRoom_encrypt">
|
<div className="mx_CreateRoom_encrypt">
|
||||||
<label>
|
<label>
|
||||||
<input type="checkbox" ref="encrypt" checked={this.state.encrypt} onChange={this.onEncryptChanged}/>
|
<input type="checkbox" ref="encrypt" checked={this.state.encrypt} onChange={this.onEncryptChanged}/>
|
||||||
Encrypt room
|
{_t('Encrypt room')}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div>
|
<div>
|
||||||
|
|
|
@ -14,13 +14,12 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var React = require('react');
|
import React from 'react';
|
||||||
var ReactDOM = require("react-dom");
|
|
||||||
|
|
||||||
var Matrix = require("matrix-js-sdk");
|
import Matrix from 'matrix-js-sdk';
|
||||||
var sdk = require('../../index');
|
import sdk from '../../index';
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||||
var dis = require("../../dispatcher");
|
import { _t, _tJsx } from '../../languageHandler';
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Component which shows the filtered file using a TimelinePanel
|
* Component which shows the filtered file using a TimelinePanel
|
||||||
|
@ -59,6 +58,8 @@ var FilePanel = React.createClass({
|
||||||
var client = MatrixClientPeg.get();
|
var client = MatrixClientPeg.get();
|
||||||
var room = client.getRoom(roomId);
|
var room = client.getRoom(roomId);
|
||||||
|
|
||||||
|
this.noRoom = !room;
|
||||||
|
|
||||||
if (room) {
|
if (room) {
|
||||||
var filter = new Matrix.Filter(client.credentials.userId);
|
var filter = new Matrix.Filter(client.credentials.userId);
|
||||||
filter.setDefinition(
|
filter.setDefinition(
|
||||||
|
@ -82,13 +83,24 @@ var FilePanel = React.createClass({
|
||||||
console.error("Failed to get or create file panel filter", error);
|
console.error("Failed to get or create file panel filter", error);
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
console.error("Failed to add filtered timelineSet for FilePanel as no room!");
|
console.error("Failed to add filtered timelineSet for FilePanel as no room!");
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
|
return <div className="mx_FilePanel mx_RoomView_messageListWrapper">
|
||||||
|
<div className="mx_RoomView_empty">
|
||||||
|
{_tJsx("You must <a>register</a> to use this functionality", /<a>(.*?)<\/a>/, (sub) => <a href="#/register" key="sub">{sub}</a>)}
|
||||||
|
</div>
|
||||||
|
</div>;
|
||||||
|
} else if (this.noRoom) {
|
||||||
|
return <div className="mx_FilePanel mx_RoomView_messageListWrapper">
|
||||||
|
<div className="mx_RoomView_empty">{_t("You must join the room to see its files")}</div>
|
||||||
|
</div>;
|
||||||
|
}
|
||||||
|
|
||||||
// wrap a TimelinePanel with the jump-to-event bits turned off.
|
// wrap a TimelinePanel with the jump-to-event bits turned off.
|
||||||
var TimelinePanel = sdk.getComponent("structures.TimelinePanel");
|
var TimelinePanel = sdk.getComponent("structures.TimelinePanel");
|
||||||
var Loader = sdk.getComponent("elements.Spinner");
|
var Loader = sdk.getComponent("elements.Spinner");
|
||||||
|
@ -105,7 +117,7 @@ var FilePanel = React.createClass({
|
||||||
showUrlPreview = { false }
|
showUrlPreview = { false }
|
||||||
tileShape="file_grid"
|
tileShape="file_grid"
|
||||||
opacity={ this.props.opacity }
|
opacity={ this.props.opacity }
|
||||||
empty="There are no visible files in this room"
|
empty={_t('There are no visible files in this room')}
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -19,8 +19,6 @@ const InteractiveAuth = Matrix.InteractiveAuth;
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
|
||||||
import sdk from '../../index';
|
|
||||||
|
|
||||||
import {getEntryComponentForLoginType} from '../views/login/InteractiveAuthEntryComponents';
|
import {getEntryComponentForLoginType} from '../views/login/InteractiveAuthEntryComponents';
|
||||||
|
|
||||||
export default React.createClass({
|
export default React.createClass({
|
||||||
|
|
|
@ -18,11 +18,15 @@ limitations under the License.
|
||||||
import * as Matrix from 'matrix-js-sdk';
|
import * as Matrix from 'matrix-js-sdk';
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
|
||||||
|
import UserSettingsStore from '../../UserSettingsStore';
|
||||||
import KeyCode from '../../KeyCode';
|
import KeyCode from '../../KeyCode';
|
||||||
import Notifier from '../../Notifier';
|
import Notifier from '../../Notifier';
|
||||||
import PageTypes from '../../PageTypes';
|
import PageTypes from '../../PageTypes';
|
||||||
|
import CallMediaHandler from '../../CallMediaHandler';
|
||||||
import sdk from '../../index';
|
import sdk from '../../index';
|
||||||
import dis from '../../dispatcher';
|
import dis from '../../dispatcher';
|
||||||
|
import sessionStore from '../../stores/SessionStore';
|
||||||
|
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* This is what our MatrixChat shows when we are logged in. The precise view is
|
* This is what our MatrixChat shows when we are logged in. The precise view is
|
||||||
|
@ -39,10 +43,13 @@ export default React.createClass({
|
||||||
propTypes: {
|
propTypes: {
|
||||||
matrixClient: React.PropTypes.instanceOf(Matrix.MatrixClient).isRequired,
|
matrixClient: React.PropTypes.instanceOf(Matrix.MatrixClient).isRequired,
|
||||||
page_type: React.PropTypes.string.isRequired,
|
page_type: React.PropTypes.string.isRequired,
|
||||||
onRoomIdResolved: React.PropTypes.func,
|
|
||||||
onRoomCreated: React.PropTypes.func,
|
onRoomCreated: React.PropTypes.func,
|
||||||
onUserSettingsClose: React.PropTypes.func,
|
onUserSettingsClose: React.PropTypes.func,
|
||||||
|
|
||||||
|
// Called with the credentials of a registered user (if they were a ROU that
|
||||||
|
// transitioned to PWLU)
|
||||||
|
onRegistered: React.PropTypes.func,
|
||||||
|
|
||||||
teamToken: React.PropTypes.string,
|
teamToken: React.PropTypes.string,
|
||||||
|
|
||||||
// and lots and lots of other stuff.
|
// and lots and lots of other stuff.
|
||||||
|
@ -63,6 +70,13 @@ export default React.createClass({
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
|
||||||
|
getInitialState: function() {
|
||||||
|
return {
|
||||||
|
// use compact timeline view
|
||||||
|
useCompactLayout: UserSettingsStore.getSyncedSetting('useCompactLayout'),
|
||||||
|
};
|
||||||
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
componentWillMount: function() {
|
||||||
// stash the MatrixClient in case we log out before we are unmounted
|
// stash the MatrixClient in case we log out before we are unmounted
|
||||||
this._matrixClient = this.props.matrixClient;
|
this._matrixClient = this.props.matrixClient;
|
||||||
|
@ -71,11 +85,35 @@ export default React.createClass({
|
||||||
// RoomView.getScrollState()
|
// RoomView.getScrollState()
|
||||||
this._scrollStateMap = {};
|
this._scrollStateMap = {};
|
||||||
|
|
||||||
|
CallMediaHandler.loadDevices();
|
||||||
|
|
||||||
document.addEventListener('keydown', this._onKeyDown);
|
document.addEventListener('keydown', this._onKeyDown);
|
||||||
|
|
||||||
|
this._sessionStore = sessionStore;
|
||||||
|
this._sessionStoreToken = this._sessionStore.addListener(
|
||||||
|
this._setStateFromSessionStore,
|
||||||
|
);
|
||||||
|
this._setStateFromSessionStore();
|
||||||
|
|
||||||
|
this._matrixClient.on("accountData", this.onAccountData);
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillUnmount: function() {
|
componentWillUnmount: function() {
|
||||||
document.removeEventListener('keydown', this._onKeyDown);
|
document.removeEventListener('keydown', this._onKeyDown);
|
||||||
|
this._matrixClient.removeListener("accountData", this.onAccountData);
|
||||||
|
if (this._sessionStoreToken) {
|
||||||
|
this._sessionStoreToken.remove();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
// Child components assume that the client peg will not be null, so give them some
|
||||||
|
// sort of assurance here by only allowing a re-render if the client is truthy.
|
||||||
|
//
|
||||||
|
// This is required because `LoggedInView` maintains its own state and if this state
|
||||||
|
// updates after the client peg has been made null (during logout), then it will
|
||||||
|
// attempt to re-render and the children will throw errors.
|
||||||
|
shouldComponentUpdate: function() {
|
||||||
|
return Boolean(MatrixClientPeg.get());
|
||||||
},
|
},
|
||||||
|
|
||||||
getScrollStateForRoom: function(roomId) {
|
getScrollStateForRoom: function(roomId) {
|
||||||
|
@ -89,6 +127,20 @@ export default React.createClass({
|
||||||
return this.refs.roomView.canResetTimeline();
|
return this.refs.roomView.canResetTimeline();
|
||||||
},
|
},
|
||||||
|
|
||||||
|
_setStateFromSessionStore() {
|
||||||
|
this.setState({
|
||||||
|
userHasGeneratedPassword: Boolean(this._sessionStore.getCachedPassword()),
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
onAccountData: function(event) {
|
||||||
|
if (event.getType() === "im.vector.web.settings") {
|
||||||
|
this.setState({
|
||||||
|
useCompactLayout: event.getContent().useCompactLayout,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
_onKeyDown: function(ev) {
|
_onKeyDown: function(ev) {
|
||||||
/*
|
/*
|
||||||
// Remove this for now as ctrl+alt = alt-gr so this breaks keyboards which rely on alt-gr for numbers
|
// Remove this for now as ctrl+alt = alt-gr so this breaks keyboards which rely on alt-gr for numbers
|
||||||
|
@ -107,18 +159,6 @@ export default React.createClass({
|
||||||
var handled = false;
|
var handled = false;
|
||||||
|
|
||||||
switch (ev.keyCode) {
|
switch (ev.keyCode) {
|
||||||
case KeyCode.ESCAPE:
|
|
||||||
|
|
||||||
// Implemented this way so possible handling for other pages is neater
|
|
||||||
switch (this.props.page_type) {
|
|
||||||
case PageTypes.UserSettings:
|
|
||||||
this.props.onUserSettingsClose();
|
|
||||||
handled = true;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
|
|
||||||
break;
|
|
||||||
|
|
||||||
case KeyCode.UP:
|
case KeyCode.UP:
|
||||||
case KeyCode.DOWN:
|
case KeyCode.DOWN:
|
||||||
if (ev.altKey && !ev.shiftKey && !ev.ctrlKey && !ev.metaKey) {
|
if (ev.altKey && !ev.shiftKey && !ev.ctrlKey && !ev.metaKey) {
|
||||||
|
@ -171,8 +211,9 @@ export default React.createClass({
|
||||||
const RoomDirectory = sdk.getComponent('structures.RoomDirectory');
|
const RoomDirectory = sdk.getComponent('structures.RoomDirectory');
|
||||||
const HomePage = sdk.getComponent('structures.HomePage');
|
const HomePage = sdk.getComponent('structures.HomePage');
|
||||||
const MatrixToolbar = sdk.getComponent('globals.MatrixToolbar');
|
const MatrixToolbar = sdk.getComponent('globals.MatrixToolbar');
|
||||||
const GuestWarningBar = sdk.getComponent('globals.GuestWarningBar');
|
|
||||||
const NewVersionBar = sdk.getComponent('globals.NewVersionBar');
|
const NewVersionBar = sdk.getComponent('globals.NewVersionBar');
|
||||||
|
const UpdateCheckBar = sdk.getComponent('globals.UpdateCheckBar');
|
||||||
|
const PasswordNagBar = sdk.getComponent('globals.PasswordNagBar');
|
||||||
|
|
||||||
let page_element;
|
let page_element;
|
||||||
let right_panel = '';
|
let right_panel = '';
|
||||||
|
@ -181,33 +222,29 @@ export default React.createClass({
|
||||||
case PageTypes.RoomView:
|
case PageTypes.RoomView:
|
||||||
page_element = <RoomView
|
page_element = <RoomView
|
||||||
ref='roomView'
|
ref='roomView'
|
||||||
roomAddress={this.props.currentRoomAlias || this.props.currentRoomId}
|
|
||||||
autoJoin={this.props.autoJoin}
|
autoJoin={this.props.autoJoin}
|
||||||
onRoomIdResolved={this.props.onRoomIdResolved}
|
onRegistered={this.props.onRegistered}
|
||||||
eventId={this.props.initialEventId}
|
|
||||||
thirdPartyInvite={this.props.thirdPartyInvite}
|
thirdPartyInvite={this.props.thirdPartyInvite}
|
||||||
oobData={this.props.roomOobData}
|
oobData={this.props.roomOobData}
|
||||||
highlightedEventId={this.props.highlightedEventId}
|
|
||||||
eventPixelOffset={this.props.initialEventPixelOffset}
|
eventPixelOffset={this.props.initialEventPixelOffset}
|
||||||
key={this.props.currentRoomAlias || this.props.currentRoomId}
|
key={this.props.currentRoomId || 'roomview'}
|
||||||
opacity={this.props.middleOpacity}
|
opacity={this.props.middleOpacity}
|
||||||
collapsedRhs={this.props.collapse_rhs}
|
collapsedRhs={this.props.collapse_rhs}
|
||||||
ConferenceHandler={this.props.ConferenceHandler}
|
ConferenceHandler={this.props.ConferenceHandler}
|
||||||
scrollStateMap={this._scrollStateMap}
|
scrollStateMap={this._scrollStateMap}
|
||||||
/>;
|
/>;
|
||||||
if (!this.props.collapse_rhs) right_panel = <RightPanel roomId={this.props.currentRoomId} opacity={this.props.sideOpacity} />;
|
if (!this.props.collapse_rhs) right_panel = <RightPanel roomId={this.props.currentRoomId} opacity={this.props.rightOpacity} />;
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.UserSettings:
|
case PageTypes.UserSettings:
|
||||||
page_element = <UserSettings
|
page_element = <UserSettings
|
||||||
onClose={this.props.onUserSettingsClose}
|
onClose={this.props.onUserSettingsClose}
|
||||||
brand={this.props.config.brand}
|
brand={this.props.config.brand}
|
||||||
collapsedRhs={this.props.collapse_rhs}
|
|
||||||
enableLabs={this.props.config.enableLabs}
|
enableLabs={this.props.config.enableLabs}
|
||||||
referralBaseUrl={this.props.config.referralBaseUrl}
|
referralBaseUrl={this.props.config.referralBaseUrl}
|
||||||
teamToken={this.props.teamToken}
|
teamToken={this.props.teamToken}
|
||||||
/>;
|
/>;
|
||||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
|
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.rightOpacity}/>;
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.CreateRoom:
|
case PageTypes.CreateRoom:
|
||||||
|
@ -215,7 +252,7 @@ export default React.createClass({
|
||||||
onRoomCreated={this.props.onRoomCreated}
|
onRoomCreated={this.props.onRoomCreated}
|
||||||
collapsedRhs={this.props.collapse_rhs}
|
collapsedRhs={this.props.collapse_rhs}
|
||||||
/>;
|
/>;
|
||||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
|
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.rightOpacity}/>;
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.RoomDirectory:
|
case PageTypes.RoomDirectory:
|
||||||
|
@ -226,30 +263,36 @@ export default React.createClass({
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.HomePage:
|
case PageTypes.HomePage:
|
||||||
|
// If team server config is present, pass the teamServerURL. props.teamToken
|
||||||
|
// must also be set for the team page to be displayed, otherwise the
|
||||||
|
// welcomePageUrl is used (which might be undefined).
|
||||||
|
const teamServerUrl = this.props.config.teamServerConfig ?
|
||||||
|
this.props.config.teamServerConfig.teamServerURL : null;
|
||||||
|
|
||||||
page_element = <HomePage
|
page_element = <HomePage
|
||||||
collapsedRhs={this.props.collapse_rhs}
|
teamServerUrl={teamServerUrl}
|
||||||
teamServerUrl={this.props.config.teamServerConfig.teamServerURL}
|
|
||||||
teamToken={this.props.teamToken}
|
teamToken={this.props.teamToken}
|
||||||
/>
|
homePageUrl={this.props.config.welcomePageUrl}
|
||||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>
|
/>;
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.UserView:
|
case PageTypes.UserView:
|
||||||
page_element = null; // deliberately null for now
|
page_element = null; // deliberately null for now
|
||||||
right_panel = <RightPanel userId={this.props.viewUserId} opacity={this.props.sideOpacity} />;
|
right_panel = <RightPanel userId={this.props.viewUserId} opacity={this.props.rightOpacity} />;
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
|
||||||
var topBar;
|
let topBar;
|
||||||
|
const isGuest = this.props.matrixClient.isGuest();
|
||||||
if (this.props.hasNewVersion) {
|
if (this.props.hasNewVersion) {
|
||||||
topBar = <NewVersionBar version={this.props.version} newVersion={this.props.newVersion}
|
topBar = <NewVersionBar version={this.props.version} newVersion={this.props.newVersion}
|
||||||
releaseNotes={this.props.newVersionReleaseNotes}
|
releaseNotes={this.props.newVersionReleaseNotes}
|
||||||
/>;
|
/>;
|
||||||
}
|
} else if (this.props.checkingForUpdate) {
|
||||||
else if (this.props.matrixClient.isGuest()) {
|
topBar = <UpdateCheckBar {...this.props.checkingForUpdate} />;
|
||||||
topBar = <GuestWarningBar />;
|
} else if (this.state.userHasGeneratedPassword) {
|
||||||
}
|
topBar = <PasswordNagBar />;
|
||||||
else if (Notifier.supportsDesktopNotifications() && !Notifier.isEnabled() && !Notifier.isToolbarHidden()) {
|
} else if (!isGuest && Notifier.supportsDesktopNotifications() && !Notifier.isEnabled() && !Notifier.isToolbarHidden()) {
|
||||||
topBar = <MatrixToolbar />;
|
topBar = <MatrixToolbar />;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -257,6 +300,9 @@ export default React.createClass({
|
||||||
if (topBar) {
|
if (topBar) {
|
||||||
bodyClasses += ' mx_MatrixChat_toolbarShowing';
|
bodyClasses += ' mx_MatrixChat_toolbarShowing';
|
||||||
}
|
}
|
||||||
|
if (this.state.useCompactLayout) {
|
||||||
|
bodyClasses += ' mx_MatrixChat_useCompactLayout';
|
||||||
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className='mx_MatrixChat_wrapper'>
|
<div className='mx_MatrixChat_wrapper'>
|
||||||
|
@ -265,8 +311,7 @@ export default React.createClass({
|
||||||
<LeftPanel
|
<LeftPanel
|
||||||
selectedRoom={this.props.currentRoomId}
|
selectedRoom={this.props.currentRoomId}
|
||||||
collapsed={this.props.collapse_lhs || false}
|
collapsed={this.props.collapse_lhs || false}
|
||||||
opacity={this.props.sideOpacity}
|
opacity={this.props.leftOpacity}
|
||||||
teamToken={this.props.teamToken}
|
|
||||||
/>
|
/>
|
||||||
<main className='mx_MatrixChat_middlePanel'>
|
<main className='mx_MatrixChat_middlePanel'>
|
||||||
{page_element}
|
{page_element}
|
||||||
|
|
File diff suppressed because it is too large
Load Diff
|
@ -84,6 +84,15 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
// shape parameter to be passed to EventTiles
|
// shape parameter to be passed to EventTiles
|
||||||
tileShape: React.PropTypes.string,
|
tileShape: React.PropTypes.string,
|
||||||
|
|
||||||
|
// show twelve hour timestamps
|
||||||
|
isTwelveHour: React.PropTypes.bool,
|
||||||
|
|
||||||
|
// show timestamps always
|
||||||
|
alwaysShowTimestamps: React.PropTypes.bool,
|
||||||
|
|
||||||
|
// hide redacted events as per old behaviour
|
||||||
|
hideRedactions: React.PropTypes.bool,
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
componentWillMount: function() {
|
||||||
|
@ -230,8 +239,8 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
_getEventTiles: function() {
|
_getEventTiles: function() {
|
||||||
var EventTile = sdk.getComponent('rooms.EventTile');
|
const EventTile = sdk.getComponent('rooms.EventTile');
|
||||||
var DateSeparator = sdk.getComponent('messages.DateSeparator');
|
const DateSeparator = sdk.getComponent('messages.DateSeparator');
|
||||||
const MemberEventListSummary = sdk.getComponent('views.elements.MemberEventListSummary');
|
const MemberEventListSummary = sdk.getComponent('views.elements.MemberEventListSummary');
|
||||||
|
|
||||||
this.eventNodes = {};
|
this.eventNodes = {};
|
||||||
|
@ -310,7 +319,7 @@ module.exports = React.createClass({
|
||||||
const key = "membereventlistsummary-" + (prevEvent ? mxEv.getId() : "initial");
|
const key = "membereventlistsummary-" + (prevEvent ? mxEv.getId() : "initial");
|
||||||
|
|
||||||
if (this._wantsDateSeparator(prevEvent, mxEv.getDate())) {
|
if (this._wantsDateSeparator(prevEvent, mxEv.getDate())) {
|
||||||
let dateSeparator = <li key={ts1+'~'}><DateSeparator key={ts1+'~'} ts={ts1}/></li>;
|
let dateSeparator = <li key={ts1+'~'}><DateSeparator key={ts1+'~'} ts={ts1} showTwelveHour={this.props.isTwelveHour}/></li>;
|
||||||
ret.push(dateSeparator);
|
ret.push(dateSeparator);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -413,8 +422,8 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
_getTilesForEvent: function(prevEvent, mxEv, last) {
|
_getTilesForEvent: function(prevEvent, mxEv, last) {
|
||||||
var EventTile = sdk.getComponent('rooms.EventTile');
|
const EventTile = sdk.getComponent('rooms.EventTile');
|
||||||
var DateSeparator = sdk.getComponent('messages.DateSeparator');
|
const DateSeparator = sdk.getComponent('messages.DateSeparator');
|
||||||
var ret = [];
|
var ret = [];
|
||||||
|
|
||||||
// is this a continuation of the previous message?
|
// is this a continuation of the previous message?
|
||||||
|
@ -452,11 +461,13 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
// do we need a date separator since the last event?
|
// do we need a date separator since the last event?
|
||||||
if (this._wantsDateSeparator(prevEvent, eventDate)) {
|
if (this._wantsDateSeparator(prevEvent, eventDate)) {
|
||||||
var dateSeparator = <li key={ts1}><DateSeparator key={ts1} ts={ts1}/></li>;
|
var dateSeparator = <li key={ts1}><DateSeparator key={ts1} ts={ts1} showTwelveHour={this.props.isTwelveHour}/></li>;
|
||||||
ret.push(dateSeparator);
|
ret.push(dateSeparator);
|
||||||
continuation = false;
|
continuation = false;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if (mxEv.isRedacted() && this.props.hideRedactions) return ret;
|
||||||
|
|
||||||
var eventId = mxEv.getId();
|
var eventId = mxEv.getId();
|
||||||
var highlight = (eventId == this.props.highlightedEventId);
|
var highlight = (eventId == this.props.highlightedEventId);
|
||||||
|
|
||||||
|
@ -468,7 +479,6 @@ module.exports = React.createClass({
|
||||||
if (this.props.manageReadReceipts) {
|
if (this.props.manageReadReceipts) {
|
||||||
readReceipts = this._getReadReceiptsForEvent(mxEv);
|
readReceipts = this._getReadReceiptsForEvent(mxEv);
|
||||||
}
|
}
|
||||||
|
|
||||||
ret.push(
|
ret.push(
|
||||||
<li key={eventId}
|
<li key={eventId}
|
||||||
ref={this._collectEventNode.bind(this, eventId)}
|
ref={this._collectEventNode.bind(this, eventId)}
|
||||||
|
@ -482,6 +492,7 @@ module.exports = React.createClass({
|
||||||
checkUnmounting={this._isUnmounting}
|
checkUnmounting={this._isUnmounting}
|
||||||
eventSendStatus={mxEv.status}
|
eventSendStatus={mxEv.status}
|
||||||
tileShape={this.props.tileShape}
|
tileShape={this.props.tileShape}
|
||||||
|
isTwelveHour={this.props.isTwelveHour}
|
||||||
last={last} isSelectedEvent={highlight}/>
|
last={last} isSelectedEvent={highlight}/>
|
||||||
</li>
|
</li>
|
||||||
);
|
);
|
||||||
|
@ -615,8 +626,13 @@ module.exports = React.createClass({
|
||||||
var style = this.props.hidden ? { display: 'none' } : {};
|
var style = this.props.hidden ? { display: 'none' } : {};
|
||||||
style.opacity = this.props.opacity;
|
style.opacity = this.props.opacity;
|
||||||
|
|
||||||
|
var className = this.props.className + " mx_fadable";
|
||||||
|
if (this.props.alwaysShowTimestamps) {
|
||||||
|
className += " mx_MessagePanel_alwaysShowTimestamps";
|
||||||
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<ScrollPanel ref="scrollPanel" className={ this.props.className + " mx_fadable" }
|
<ScrollPanel ref="scrollPanel" className={ className }
|
||||||
onScroll={ this.props.onScroll }
|
onScroll={ this.props.onScroll }
|
||||||
onResize={ this.onResize }
|
onResize={ this.onResize }
|
||||||
onFillRequest={ this.props.onFillRequest }
|
onFillRequest={ this.props.onFillRequest }
|
||||||
|
|
|
@ -16,7 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
var ReactDOM = require("react-dom");
|
var ReactDOM = require("react-dom");
|
||||||
|
import { _t } from '../../languageHandler';
|
||||||
var Matrix = require("matrix-js-sdk");
|
var Matrix = require("matrix-js-sdk");
|
||||||
var sdk = require('../../index');
|
var sdk = require('../../index');
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||||
|
@ -37,7 +37,6 @@ var NotificationPanel = React.createClass({
|
||||||
var Loader = sdk.getComponent("elements.Spinner");
|
var Loader = sdk.getComponent("elements.Spinner");
|
||||||
|
|
||||||
var timelineSet = MatrixClientPeg.get().getNotifTimelineSet();
|
var timelineSet = MatrixClientPeg.get().getNotifTimelineSet();
|
||||||
|
|
||||||
if (timelineSet) {
|
if (timelineSet) {
|
||||||
return (
|
return (
|
||||||
<TimelinePanel key={"NotificationPanel_" + this.props.roomId}
|
<TimelinePanel key={"NotificationPanel_" + this.props.roomId}
|
||||||
|
@ -48,7 +47,7 @@ var NotificationPanel = React.createClass({
|
||||||
showUrlPreview = { false }
|
showUrlPreview = { false }
|
||||||
opacity={ this.props.opacity }
|
opacity={ this.props.opacity }
|
||||||
tileShape="notif"
|
tileShape="notif"
|
||||||
empty="You have no visible notifications"
|
empty={ _t('You have no visible notifications') }
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -14,12 +14,12 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var React = require('react');
|
import React from 'react';
|
||||||
var sdk = require('../../index');
|
import { _t, _tJsx } from '../../languageHandler';
|
||||||
var dis = require("../../dispatcher");
|
import sdk from '../../index';
|
||||||
var WhoIsTyping = require("../../WhoIsTyping");
|
import WhoIsTyping from '../../WhoIsTyping';
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||||
const MemberAvatar = require("../views/avatars/MemberAvatar");
|
import MemberAvatar from '../views/avatars/MemberAvatar';
|
||||||
|
|
||||||
const HIDE_DEBOUNCE_MS = 10000;
|
const HIDE_DEBOUNCE_MS = 10000;
|
||||||
const STATUS_BAR_HIDDEN = 0;
|
const STATUS_BAR_HIDDEN = 0;
|
||||||
|
@ -175,8 +175,8 @@ module.exports = React.createClass({
|
||||||
<div className="mx_RoomStatusBar_scrollDownIndicator"
|
<div className="mx_RoomStatusBar_scrollDownIndicator"
|
||||||
onClick={ this.props.onScrollToBottomClick }>
|
onClick={ this.props.onScrollToBottomClick }>
|
||||||
<img src="img/scrolldown.svg" width="24" height="24"
|
<img src="img/scrolldown.svg" width="24" height="24"
|
||||||
alt="Scroll to bottom of page"
|
alt={ _t("Scroll to bottom of page") }
|
||||||
title="Scroll to bottom of page"/>
|
title={ _t("Scroll to bottom of page") }/>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -250,10 +250,10 @@ module.exports = React.createClass({
|
||||||
<div className="mx_RoomStatusBar_connectionLostBar">
|
<div className="mx_RoomStatusBar_connectionLostBar">
|
||||||
<img src="img/warning.svg" width="24" height="23" title="/!\ " alt="/!\ "/>
|
<img src="img/warning.svg" width="24" height="23" title="/!\ " alt="/!\ "/>
|
||||||
<div className="mx_RoomStatusBar_connectionLostBar_title">
|
<div className="mx_RoomStatusBar_connectionLostBar_title">
|
||||||
Connectivity to the server has been lost.
|
{_t('Connectivity to the server has been lost.')}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
||||||
Sent messages will be stored until your connection has returned.
|
{_t('Sent messages will be stored until your connection has returned.')}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -266,7 +266,7 @@ module.exports = React.createClass({
|
||||||
<TabCompleteBar tabComplete={this.props.tabComplete} />
|
<TabCompleteBar tabComplete={this.props.tabComplete} />
|
||||||
<div className="mx_RoomStatusBar_tabCompleteEol" title="->|">
|
<div className="mx_RoomStatusBar_tabCompleteEol" title="->|">
|
||||||
<TintableSvg src="img/eol.svg" width="22" height="16"/>
|
<TintableSvg src="img/eol.svg" width="22" height="16"/>
|
||||||
Auto-complete
|
{_t('Auto-complete')}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
@ -281,15 +281,13 @@ module.exports = React.createClass({
|
||||||
{ this.props.unsentMessageError }
|
{ this.props.unsentMessageError }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
||||||
<a className="mx_RoomStatusBar_resend_link"
|
{_tJsx("<a>Resend all</a> or <a>cancel all</a> now. You can also select individual messages to resend or cancel.",
|
||||||
onClick={ this.props.onResendAllClick }>
|
[/<a>(.*?)<\/a>/, /<a>(.*?)<\/a>/],
|
||||||
Resend all
|
[
|
||||||
</a> or <a
|
(sub) => <a className="mx_RoomStatusBar_resend_link" key="resend" onClick={ this.props.onResendAllClick }>{sub}</a>,
|
||||||
className="mx_RoomStatusBar_resend_link"
|
(sub) => <a className="mx_RoomStatusBar_resend_link" key="cancel" onClick={ this.props.onCancelAllClick }>{sub}</a>,
|
||||||
onClick={ this.props.onCancelAllClick }>
|
]
|
||||||
cancel all
|
)}
|
||||||
</a> now. You can also select individual messages to
|
|
||||||
resend or cancel.
|
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -298,8 +296,8 @@ module.exports = React.createClass({
|
||||||
// unread count trumps who is typing since the unread count is only
|
// unread count trumps who is typing since the unread count is only
|
||||||
// set when you've scrolled up
|
// set when you've scrolled up
|
||||||
if (this.props.numUnreadMessages) {
|
if (this.props.numUnreadMessages) {
|
||||||
var unreadMsgs = this.props.numUnreadMessages + " new message" +
|
// MUST use var name "count" for pluralization to kick in
|
||||||
(this.props.numUnreadMessages > 1 ? "s" : "");
|
var unreadMsgs = _t("%(count)s new messages", {count: this.props.numUnreadMessages});
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className="mx_RoomStatusBar_unreadMessagesBar"
|
<div className="mx_RoomStatusBar_unreadMessagesBar"
|
||||||
|
@ -324,7 +322,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.hasActiveCall) {
|
if (this.props.hasActiveCall) {
|
||||||
return (
|
return (
|
||||||
<div className="mx_RoomStatusBar_callBar">
|
<div className="mx_RoomStatusBar_callBar">
|
||||||
<b>Active call</b>
|
<b>{_t('Active call')}</b>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -25,6 +25,7 @@ var ReactDOM = require("react-dom");
|
||||||
var q = require("q");
|
var q = require("q");
|
||||||
var classNames = require("classnames");
|
var classNames = require("classnames");
|
||||||
var Matrix = require("matrix-js-sdk");
|
var Matrix = require("matrix-js-sdk");
|
||||||
|
import { _t } from '../../languageHandler';
|
||||||
|
|
||||||
var UserSettingsStore = require('../../UserSettingsStore');
|
var UserSettingsStore = require('../../UserSettingsStore');
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||||
|
@ -44,6 +45,8 @@ import KeyCode from '../../KeyCode';
|
||||||
|
|
||||||
import UserProvider from '../../autocomplete/UserProvider';
|
import UserProvider from '../../autocomplete/UserProvider';
|
||||||
|
|
||||||
|
import RoomViewStore from '../../stores/RoomViewStore';
|
||||||
|
|
||||||
var DEBUG = false;
|
var DEBUG = false;
|
||||||
|
|
||||||
if (DEBUG) {
|
if (DEBUG) {
|
||||||
|
@ -58,16 +61,9 @@ module.exports = React.createClass({
|
||||||
propTypes: {
|
propTypes: {
|
||||||
ConferenceHandler: React.PropTypes.any,
|
ConferenceHandler: React.PropTypes.any,
|
||||||
|
|
||||||
// Either a room ID or room alias for the room to display.
|
// Called with the credentials of a registered user (if they were a ROU that
|
||||||
// If the room is being displayed as a result of the user clicking
|
// transitioned to PWLU)
|
||||||
// on a room alias, the alias should be supplied. Otherwise, a room
|
onRegistered: React.PropTypes.func,
|
||||||
// ID should be supplied.
|
|
||||||
roomAddress: React.PropTypes.string.isRequired,
|
|
||||||
|
|
||||||
// If a room alias is passed to roomAddress, a function can be
|
|
||||||
// provided here that will be called with the ID of the room
|
|
||||||
// once it has been resolved.
|
|
||||||
onRoomIdResolved: React.PropTypes.func,
|
|
||||||
|
|
||||||
// An object representing a third party invite to join this room
|
// An object representing a third party invite to join this room
|
||||||
// Fields:
|
// Fields:
|
||||||
|
@ -87,36 +83,8 @@ module.exports = React.createClass({
|
||||||
// * invited us tovthe room
|
// * invited us tovthe room
|
||||||
oobData: React.PropTypes.object,
|
oobData: React.PropTypes.object,
|
||||||
|
|
||||||
// id of an event to jump to. If not given, will go to the end of the
|
|
||||||
// live timeline.
|
|
||||||
eventId: React.PropTypes.string,
|
|
||||||
|
|
||||||
// where to position the event given by eventId, in pixels from the
|
|
||||||
// bottom of the viewport. If not given, will try to put the event
|
|
||||||
// 1/3 of the way down the viewport.
|
|
||||||
eventPixelOffset: React.PropTypes.number,
|
|
||||||
|
|
||||||
// ID of an event to highlight. If undefined, no event will be highlighted.
|
|
||||||
// Typically this will either be the same as 'eventId', or undefined.
|
|
||||||
highlightedEventId: React.PropTypes.string,
|
|
||||||
|
|
||||||
// is the RightPanel collapsed?
|
// is the RightPanel collapsed?
|
||||||
collapsedRhs: React.PropTypes.bool,
|
collapsedRhs: React.PropTypes.bool,
|
||||||
|
|
||||||
// a map from room id to scroll state, which will be updated on unmount.
|
|
||||||
//
|
|
||||||
// If there is no special scroll state (ie, we are following the live
|
|
||||||
// timeline), the scroll state is null. Otherwise, it is an object with
|
|
||||||
// the following properties:
|
|
||||||
//
|
|
||||||
// focussedEvent: the ID of the 'focussed' event. Typically this is
|
|
||||||
// the last event fully visible in the viewport, though if we
|
|
||||||
// have done an explicit scroll to an explicit event, it will be
|
|
||||||
// that event.
|
|
||||||
//
|
|
||||||
// pixelOffset: the number of pixels the window is scrolled down
|
|
||||||
// from the focussedEvent.
|
|
||||||
scrollStateMap: React.PropTypes.object,
|
|
||||||
},
|
},
|
||||||
|
|
||||||
getInitialState: function() {
|
getInitialState: function() {
|
||||||
|
@ -124,6 +92,17 @@ module.exports = React.createClass({
|
||||||
room: null,
|
room: null,
|
||||||
roomId: null,
|
roomId: null,
|
||||||
roomLoading: true,
|
roomLoading: true,
|
||||||
|
peekLoading: false,
|
||||||
|
shouldPeek: true,
|
||||||
|
|
||||||
|
// The event to be scrolled to initially
|
||||||
|
initialEventId: null,
|
||||||
|
// The offset in pixels from the event with which to scroll vertically
|
||||||
|
initialEventPixelOffset: null,
|
||||||
|
// Whether to highlight the event scrolled to
|
||||||
|
isInitialEventHighlighted: null,
|
||||||
|
|
||||||
|
forwardingEvent: null,
|
||||||
editingRoomSettings: false,
|
editingRoomSettings: false,
|
||||||
uploadingRoomSettings: false,
|
uploadingRoomSettings: false,
|
||||||
numUnreadMessages: 0,
|
numUnreadMessages: 0,
|
||||||
|
@ -169,40 +148,72 @@ module.exports = React.createClass({
|
||||||
onClickCompletes: true,
|
onClickCompletes: true,
|
||||||
onStateChange: (isCompleting) => {
|
onStateChange: (isCompleting) => {
|
||||||
this.forceUpdate();
|
this.forceUpdate();
|
||||||
}
|
},
|
||||||
});
|
});
|
||||||
|
|
||||||
if (this.props.roomAddress[0] == '#') {
|
// Start listening for RoomViewStore updates
|
||||||
// we always look up the alias from the directory server:
|
this._roomStoreToken = RoomViewStore.addListener(this._onRoomViewStoreUpdate);
|
||||||
// we want the room that the given alias is pointing to
|
this._onRoomViewStoreUpdate(true);
|
||||||
// right now. We may have joined that alias before but there's
|
},
|
||||||
// no guarantee the alias hasn't subsequently been remapped.
|
|
||||||
MatrixClientPeg.get().getRoomIdForAlias(this.props.roomAddress).done((result) => {
|
_onRoomViewStoreUpdate: function(initial) {
|
||||||
if (this.props.onRoomIdResolved) {
|
if (this.unmounted) {
|
||||||
this.props.onRoomIdResolved(result.room_id);
|
return;
|
||||||
}
|
|
||||||
var room = MatrixClientPeg.get().getRoom(result.room_id);
|
|
||||||
this.setState({
|
|
||||||
room: room,
|
|
||||||
roomId: result.room_id,
|
|
||||||
roomLoading: !room,
|
|
||||||
unsentMessageError: this._getUnsentMessageError(room),
|
|
||||||
}, this._onHaveRoom);
|
|
||||||
}, (err) => {
|
|
||||||
this.setState({
|
|
||||||
roomLoading: false,
|
|
||||||
roomLoadError: err,
|
|
||||||
});
|
|
||||||
});
|
|
||||||
} else {
|
|
||||||
var room = MatrixClientPeg.get().getRoom(this.props.roomAddress);
|
|
||||||
this.setState({
|
|
||||||
roomId: this.props.roomAddress,
|
|
||||||
room: room,
|
|
||||||
roomLoading: !room,
|
|
||||||
unsentMessageError: this._getUnsentMessageError(room),
|
|
||||||
}, this._onHaveRoom);
|
|
||||||
}
|
}
|
||||||
|
const newState = {
|
||||||
|
roomId: RoomViewStore.getRoomId(),
|
||||||
|
roomAlias: RoomViewStore.getRoomAlias(),
|
||||||
|
roomLoading: RoomViewStore.isRoomLoading(),
|
||||||
|
roomLoadError: RoomViewStore.getRoomLoadError(),
|
||||||
|
joining: RoomViewStore.isJoining(),
|
||||||
|
initialEventId: RoomViewStore.getInitialEventId(),
|
||||||
|
initialEventPixelOffset: RoomViewStore.getInitialEventPixelOffset(),
|
||||||
|
isInitialEventHighlighted: RoomViewStore.isInitialEventHighlighted(),
|
||||||
|
forwardingEvent: RoomViewStore.getForwardingEvent(),
|
||||||
|
shouldPeek: RoomViewStore.shouldPeek(),
|
||||||
|
};
|
||||||
|
|
||||||
|
// finished joining, start waiting for a room and show a spinner. See onRoom.
|
||||||
|
newState.waitingForRoom = this.state.joining && !newState.joining &&
|
||||||
|
!RoomViewStore.getJoinError();
|
||||||
|
|
||||||
|
// Temporary logging to diagnose https://github.com/vector-im/riot-web/issues/4307
|
||||||
|
console.log(
|
||||||
|
'RVS update:',
|
||||||
|
newState.roomId,
|
||||||
|
newState.roomAlias,
|
||||||
|
'loading?', newState.roomLoading,
|
||||||
|
'joining?', newState.joining,
|
||||||
|
'initial?', initial,
|
||||||
|
'waiting?', newState.waitingForRoom,
|
||||||
|
'shouldPeek?', newState.shouldPeek,
|
||||||
|
);
|
||||||
|
|
||||||
|
// NB: This does assume that the roomID will not change for the lifetime of
|
||||||
|
// the RoomView instance
|
||||||
|
if (initial) {
|
||||||
|
newState.room = MatrixClientPeg.get().getRoom(newState.roomId);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Clear the search results when clicking a search result (which changes the
|
||||||
|
// currently scrolled to event, this.state.initialEventId).
|
||||||
|
if (this.state.initialEventId !== newState.initialEventId) {
|
||||||
|
newState.searchResults = null;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Store the scroll state for the previous room so that we can return to this
|
||||||
|
// position when viewing this room in future.
|
||||||
|
if (this.state.roomId !== newState.roomId) {
|
||||||
|
this._updateScrollMap(this.state.roomId);
|
||||||
|
}
|
||||||
|
|
||||||
|
this.setState(newState, () => {
|
||||||
|
// At this point, this.state.roomId could be null (e.g. the alias might not
|
||||||
|
// have been resolved yet) so anything called here must handle this case.
|
||||||
|
if (initial) {
|
||||||
|
this._onHaveRoom();
|
||||||
|
}
|
||||||
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
_onHaveRoom: function() {
|
_onHaveRoom: function() {
|
||||||
|
@ -217,29 +228,31 @@ module.exports = React.createClass({
|
||||||
// which must be by alias or invite wherever possible (peeking currently does
|
// which must be by alias or invite wherever possible (peeking currently does
|
||||||
// not work over federation).
|
// not work over federation).
|
||||||
|
|
||||||
// NB. We peek if we are not in the room, although if we try to peek into
|
// NB. We peek if we have never seen the room before (i.e. js-sdk does not know
|
||||||
// a room in which we have a member event (ie. we've left) synapse will just
|
// about it). We don't peek in the historical case where we were joined but are
|
||||||
// send us the same data as we get in the sync (ie. the last events we saw).
|
// now not joined because the js-sdk peeking API will clobber our historical room,
|
||||||
var user_is_in_room = null;
|
// making it impossible to indicate a newly joined room.
|
||||||
if (this.state.room) {
|
const room = this.state.room;
|
||||||
user_is_in_room = this.state.room.hasMembershipState(
|
if (room) {
|
||||||
MatrixClientPeg.get().credentials.userId, 'join'
|
UserProvider.getInstance().setUserListFromRoom(room);
|
||||||
);
|
this.tabComplete.loadEntries(room);
|
||||||
|
this.setState({
|
||||||
UserProvider.getInstance().setUserListFromRoom(this.state.room);
|
unsentMessageError: this._getUnsentMessageError(room),
|
||||||
this.tabComplete.loadEntries(this.state.room);
|
});
|
||||||
|
this._onRoomLoaded(room);
|
||||||
}
|
}
|
||||||
|
if (!this.state.joining && this.state.roomId) {
|
||||||
if (!user_is_in_room && this.state.roomId) {
|
|
||||||
if (this.props.autoJoin) {
|
if (this.props.autoJoin) {
|
||||||
this.onJoinButtonClicked();
|
this.onJoinButtonClicked();
|
||||||
} else if (this.state.roomId) {
|
} else if (!room && this.state.shouldPeek) {
|
||||||
console.log("Attempting to peek into room %s", this.state.roomId);
|
console.log("Attempting to peek into room %s", this.state.roomId);
|
||||||
|
this.setState({
|
||||||
|
peekLoading: true,
|
||||||
|
});
|
||||||
MatrixClientPeg.get().peekInRoom(this.state.roomId).then((room) => {
|
MatrixClientPeg.get().peekInRoom(this.state.roomId).then((room) => {
|
||||||
this.setState({
|
this.setState({
|
||||||
room: room,
|
room: room,
|
||||||
roomLoading: false,
|
peekLoading: false,
|
||||||
});
|
});
|
||||||
this._onRoomLoaded(room);
|
this._onRoomLoaded(room);
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
|
@ -249,16 +262,16 @@ module.exports = React.createClass({
|
||||||
if (err.errcode == "M_GUEST_ACCESS_FORBIDDEN") {
|
if (err.errcode == "M_GUEST_ACCESS_FORBIDDEN") {
|
||||||
// This is fine: the room just isn't peekable (we assume).
|
// This is fine: the room just isn't peekable (we assume).
|
||||||
this.setState({
|
this.setState({
|
||||||
roomLoading: false,
|
peekLoading: false,
|
||||||
});
|
});
|
||||||
} else {
|
} else {
|
||||||
throw err;
|
throw err;
|
||||||
}
|
}
|
||||||
}).done();
|
}).done();
|
||||||
}
|
}
|
||||||
} else if (user_is_in_room) {
|
} else if (room) {
|
||||||
|
// Stop peeking because we have joined this room previously
|
||||||
MatrixClientPeg.get().stopPeeking();
|
MatrixClientPeg.get().stopPeeking();
|
||||||
this._onRoomLoaded(this.state.room);
|
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -294,17 +307,6 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillReceiveProps: function(newProps) {
|
|
||||||
if (newProps.roomAddress != this.props.roomAddress) {
|
|
||||||
throw new Error("changing room on a RoomView is not supported");
|
|
||||||
}
|
|
||||||
|
|
||||||
if (newProps.eventId != this.props.eventId) {
|
|
||||||
// when we change focussed event id, hide the search results.
|
|
||||||
this.setState({searchResults: null});
|
|
||||||
}
|
|
||||||
},
|
|
||||||
|
|
||||||
shouldComponentUpdate: function(nextProps, nextState) {
|
shouldComponentUpdate: function(nextProps, nextState) {
|
||||||
return (!ObjectUtils.shallowEqual(this.props, nextProps) ||
|
return (!ObjectUtils.shallowEqual(this.props, nextProps) ||
|
||||||
!ObjectUtils.shallowEqual(this.state, nextState));
|
!ObjectUtils.shallowEqual(this.state, nextState));
|
||||||
|
@ -330,7 +332,7 @@ module.exports = React.createClass({
|
||||||
this.unmounted = true;
|
this.unmounted = true;
|
||||||
|
|
||||||
// update the scroll map before we get unmounted
|
// update the scroll map before we get unmounted
|
||||||
this._updateScrollMap();
|
this._updateScrollMap(this.state.roomId);
|
||||||
|
|
||||||
if (this.refs.roomView) {
|
if (this.refs.roomView) {
|
||||||
// disconnect the D&D event listeners from the room view. This
|
// disconnect the D&D event listeners from the room view. This
|
||||||
|
@ -359,6 +361,11 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
document.removeEventListener("keydown", this.onKeyDown);
|
document.removeEventListener("keydown", this.onKeyDown);
|
||||||
|
|
||||||
|
// Remove RoomStore listener
|
||||||
|
if (this._roomStoreToken) {
|
||||||
|
this._roomStoreToken.remove();
|
||||||
|
}
|
||||||
|
|
||||||
// cancel any pending calls to the rate_limited_funcs
|
// cancel any pending calls to the rate_limited_funcs
|
||||||
this._updateRoomMembers.cancelPendingCall();
|
this._updateRoomMembers.cancelPendingCall();
|
||||||
|
|
||||||
|
@ -370,10 +377,10 @@ module.exports = React.createClass({
|
||||||
onPageUnload(event) {
|
onPageUnload(event) {
|
||||||
if (ContentMessages.getCurrentUploads().length > 0) {
|
if (ContentMessages.getCurrentUploads().length > 0) {
|
||||||
return event.returnValue =
|
return event.returnValue =
|
||||||
'You seem to be uploading files, are you sure you want to quit?';
|
_t("You seem to be uploading files, are you sure you want to quit?");
|
||||||
} else if (this._getCallForRoom() && this.state.callState !== 'ended') {
|
} else if (this._getCallForRoom() && this.state.callState !== 'ended') {
|
||||||
return event.returnValue =
|
return event.returnValue =
|
||||||
'You seem to be in a call, are you sure you want to quit?';
|
_t("You seem to be in a call, are you sure you want to quit?");
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -518,7 +525,7 @@ module.exports = React.createClass({
|
||||||
this._updatePreviewUrlVisibility(room);
|
this._updatePreviewUrlVisibility(room);
|
||||||
},
|
},
|
||||||
|
|
||||||
_warnAboutEncryption: function (room) {
|
_warnAboutEncryption: function(room) {
|
||||||
if (!MatrixClientPeg.get().isRoomEncrypted(room.roomId)) {
|
if (!MatrixClientPeg.get().isRoomEncrypted(room.roomId)) {
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -529,14 +536,14 @@ module.exports = React.createClass({
|
||||||
if (!userHasUsedEncryption) {
|
if (!userHasUsedEncryption) {
|
||||||
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning!",
|
title: _t("Warning!"),
|
||||||
hasCancelButton: false,
|
hasCancelButton: false,
|
||||||
description: (
|
description: (
|
||||||
<div>
|
<div>
|
||||||
<p>End-to-end encryption is in beta and may not be reliable.</p>
|
<p>{ _t("End-to-end encryption is in beta and may not be reliable") }.</p>
|
||||||
<p>You should <b>not</b> yet trust it to secure data.</p>
|
<p>{ _t("You should not yet trust it to secure data") }.</p>
|
||||||
<p>Devices will <b>not</b> yet be able to decrypt history from before they joined the room.</p>
|
<p>{ _t("Devices will not yet be able to decrypt history from before they joined the room") }.</p>
|
||||||
<p>Encrypted messages will not be visible on clients that do not yet implement encryption.</p>
|
<p>{ _t("Encrypted messages will not be visible on clients that do not yet implement encryption") }.</p>
|
||||||
</div>
|
</div>
|
||||||
),
|
),
|
||||||
});
|
});
|
||||||
|
@ -598,21 +605,28 @@ module.exports = React.createClass({
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
onRoom: function(room) {
|
_updateScrollMap(roomId) {
|
||||||
// This event is fired when the room is 'stored' by the JS SDK, which
|
// No point updating scroll state if the room ID hasn't been resolved yet
|
||||||
// means it's now a fully-fledged room object ready to be used, so
|
if (!roomId) {
|
||||||
// set it in our state and start using it (ie. init the timeline)
|
return;
|
||||||
// This will happen if we start off viewing a room we're not joined,
|
|
||||||
// then join it whilst RoomView is looking at that room.
|
|
||||||
if (!this.state.room && room.roomId == this._joiningRoomId) {
|
|
||||||
this._joiningRoomId = undefined;
|
|
||||||
this.setState({
|
|
||||||
room: room,
|
|
||||||
joining: false,
|
|
||||||
});
|
|
||||||
|
|
||||||
this._onRoomLoaded(room);
|
|
||||||
}
|
}
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'update_scroll_state',
|
||||||
|
room_id: roomId,
|
||||||
|
scroll_state: this._getScrollState(),
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
onRoom: function(room) {
|
||||||
|
if (!room || room.roomId !== this.state.roomId) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
this.setState({
|
||||||
|
room: room,
|
||||||
|
waitingForRoom: false,
|
||||||
|
}, () => {
|
||||||
|
this._onRoomLoaded(room);
|
||||||
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
updateTint: function() {
|
updateTint: function() {
|
||||||
|
@ -665,7 +679,14 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
onRoomMemberMembership: function(ev, member, oldMembership) {
|
onRoomMemberMembership: function(ev, member, oldMembership) {
|
||||||
if (member.userId == MatrixClientPeg.get().credentials.userId) {
|
if (member.userId == MatrixClientPeg.get().credentials.userId) {
|
||||||
this.forceUpdate();
|
|
||||||
|
if (member.membership === 'join') {
|
||||||
|
this.setState({
|
||||||
|
waitingForRoom: false,
|
||||||
|
});
|
||||||
|
} else {
|
||||||
|
this.forceUpdate();
|
||||||
|
}
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -695,10 +716,6 @@ module.exports = React.createClass({
|
||||||
// compatability workaround, let's not bother.
|
// compatability workaround, let's not bother.
|
||||||
Rooms.setDMRoom(this.state.room.roomId, me.events.member.getSender()).done();
|
Rooms.setDMRoom(this.state.room.roomId, me.events.member.getSender()).done();
|
||||||
}
|
}
|
||||||
|
|
||||||
this.setState({
|
|
||||||
joining: false
|
|
||||||
});
|
|
||||||
}
|
}
|
||||||
}, 500),
|
}, 500),
|
||||||
|
|
||||||
|
@ -707,10 +724,10 @@ module.exports = React.createClass({
|
||||||
if (!unsentMessages.length) return "";
|
if (!unsentMessages.length) return "";
|
||||||
for (const event of unsentMessages) {
|
for (const event of unsentMessages) {
|
||||||
if (!event.error || event.error.name !== "UnknownDeviceError") {
|
if (!event.error || event.error.name !== "UnknownDeviceError") {
|
||||||
return "Some of your messages have not been sent.";
|
return _t("Some of your messages have not been sent.");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return "Message not sent due to unknown devices being present";
|
return _t("Message not sent due to unknown devices being present");
|
||||||
},
|
},
|
||||||
|
|
||||||
_getUnsentMessages: function(room) {
|
_getUnsentMessages: function(room) {
|
||||||
|
@ -773,41 +790,62 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
onJoinButtonClicked: function(ev) {
|
onJoinButtonClicked: function(ev) {
|
||||||
var self = this;
|
const cli = MatrixClientPeg.get();
|
||||||
|
|
||||||
var cli = MatrixClientPeg.get();
|
// If the user is a ROU, allow them to transition to a PWLU
|
||||||
var display_name_promise = q();
|
if (cli && cli.isGuest()) {
|
||||||
// if this is the first room we're joining, check the user has a display name
|
// Join this room once the user has registered and logged in
|
||||||
// and if they don't, prompt them to set one.
|
const signUrl = this.props.thirdPartyInvite ?
|
||||||
// NB. This unfortunately does not re-use the ChangeDisplayName component because
|
this.props.thirdPartyInvite.inviteSignUrl : undefined;
|
||||||
// it doesn't behave quite as desired here (we want an input field here rather than
|
dis.dispatch({
|
||||||
// content-editable, and we want a default).
|
action: 'do_after_sync_prepared',
|
||||||
if (cli.getRooms().filter((r) => {
|
deferred_action: {
|
||||||
return r.hasMembershipState(cli.credentials.userId, "join");
|
action: 'join_room',
|
||||||
})) {
|
opts: { inviteSignUrl: signUrl },
|
||||||
display_name_promise = cli.getProfileInfo(cli.credentials.userId).then((result) => {
|
},
|
||||||
if (!result.displayname) {
|
|
||||||
var SetDisplayNameDialog = sdk.getComponent('views.dialogs.SetDisplayNameDialog');
|
|
||||||
var dialog_defer = q.defer();
|
|
||||||
Modal.createDialog(SetDisplayNameDialog, {
|
|
||||||
currentDisplayName: result.displayname,
|
|
||||||
onFinished: (submitted, newDisplayName) => {
|
|
||||||
if (submitted) {
|
|
||||||
cli.setDisplayName(newDisplayName).done(() => {
|
|
||||||
dialog_defer.resolve();
|
|
||||||
});
|
|
||||||
}
|
|
||||||
else {
|
|
||||||
dialog_defer.reject();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
});
|
|
||||||
return dialog_defer.promise;
|
|
||||||
}
|
|
||||||
});
|
});
|
||||||
|
|
||||||
|
// Don't peek whilst registering otherwise getPendingEventList complains
|
||||||
|
// Do this by indicating our intention to join
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'will_join',
|
||||||
|
});
|
||||||
|
|
||||||
|
const SetMxIdDialog = sdk.getComponent('views.dialogs.SetMxIdDialog');
|
||||||
|
const close = Modal.createDialog(SetMxIdDialog, {
|
||||||
|
homeserverUrl: cli.getHomeserverUrl(),
|
||||||
|
onFinished: (submitted, credentials) => {
|
||||||
|
if (submitted) {
|
||||||
|
this.props.onRegistered(credentials);
|
||||||
|
} else {
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'cancel_after_sync_prepared',
|
||||||
|
});
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'cancel_join',
|
||||||
|
});
|
||||||
|
}
|
||||||
|
},
|
||||||
|
onDifferentServerClicked: (ev) => {
|
||||||
|
dis.dispatch({action: 'start_registration'});
|
||||||
|
close();
|
||||||
|
},
|
||||||
|
onLoginClick: (ev) => {
|
||||||
|
dis.dispatch({action: 'start_login'});
|
||||||
|
close();
|
||||||
|
},
|
||||||
|
}).close;
|
||||||
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
display_name_promise.then(() => {
|
q().then(() => {
|
||||||
|
const signUrl = this.props.thirdPartyInvite ?
|
||||||
|
this.props.thirdPartyInvite.inviteSignUrl : undefined;
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'join_room',
|
||||||
|
opts: { inviteSignUrl: signUrl },
|
||||||
|
});
|
||||||
|
|
||||||
// if this is an invite and has the 'direct' hint set, mark it as a DM room now.
|
// if this is an invite and has the 'direct' hint set, mark it as a DM room now.
|
||||||
if (this.state.room) {
|
if (this.state.room) {
|
||||||
const me = this.state.room.getMember(MatrixClientPeg.get().credentials.userId);
|
const me = this.state.room.getMember(MatrixClientPeg.get().credentials.userId);
|
||||||
|
@ -819,72 +857,7 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
return q();
|
return q();
|
||||||
}).then(() => {
|
|
||||||
var sign_url = this.props.thirdPartyInvite ? this.props.thirdPartyInvite.inviteSignUrl : undefined;
|
|
||||||
return MatrixClientPeg.get().joinRoom(this.props.roomAddress,
|
|
||||||
{ inviteSignUrl: sign_url } );
|
|
||||||
}).then(function(resp) {
|
|
||||||
var roomId = resp.roomId;
|
|
||||||
|
|
||||||
// It is possible that there is no Room yet if state hasn't come down
|
|
||||||
// from /sync - joinRoom will resolve when the HTTP request to join succeeds,
|
|
||||||
// NOT when it comes down /sync. If there is no room, we'll keep the
|
|
||||||
// joining flag set until we see it.
|
|
||||||
|
|
||||||
// We'll need to initialise the timeline when joining, but due to
|
|
||||||
// the above, we can't do it here: we do it in onRoom instead,
|
|
||||||
// once we have a useable room object.
|
|
||||||
var room = MatrixClientPeg.get().getRoom(roomId);
|
|
||||||
if (!room) {
|
|
||||||
// wait for the room to turn up in onRoom.
|
|
||||||
self._joiningRoomId = roomId;
|
|
||||||
} else {
|
|
||||||
// we've got a valid room, but that might also just mean that
|
|
||||||
// it was peekable (so we had one before anyway). If we are
|
|
||||||
// not yet a member of the room, we will need to wait for that
|
|
||||||
// to happen, in onRoomStateMember.
|
|
||||||
var me = MatrixClientPeg.get().credentials.userId;
|
|
||||||
self.setState({
|
|
||||||
joining: !room.hasMembershipState(me, "join"),
|
|
||||||
room: room
|
|
||||||
});
|
|
||||||
}
|
|
||||||
}).catch(function(error) {
|
|
||||||
self.setState({
|
|
||||||
joining: false,
|
|
||||||
joinError: error
|
|
||||||
});
|
|
||||||
|
|
||||||
if (!error) return;
|
|
||||||
|
|
||||||
// https://matrix.org/jira/browse/SYN-659
|
|
||||||
// Need specific error message if joining a room is refused because the user is a guest and guest access is not allowed
|
|
||||||
if (
|
|
||||||
error.errcode == 'M_GUEST_ACCESS_FORBIDDEN' ||
|
|
||||||
(
|
|
||||||
error.errcode == 'M_FORBIDDEN' &&
|
|
||||||
MatrixClientPeg.get().isGuest()
|
|
||||||
)
|
|
||||||
) {
|
|
||||||
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
|
||||||
title: "Failed to join the room",
|
|
||||||
description: "This room is private or inaccessible to guests. You may be able to join if you register."
|
|
||||||
});
|
|
||||||
} else {
|
|
||||||
var msg = error.message ? error.message : JSON.stringify(error);
|
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
|
||||||
Modal.createDialog(ErrorDialog, {
|
|
||||||
title: "Failed to join room",
|
|
||||||
description: msg
|
|
||||||
});
|
|
||||||
}
|
|
||||||
}).done();
|
|
||||||
|
|
||||||
this.setState({
|
|
||||||
joining: true
|
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -936,11 +909,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
uploadFile: function(file) {
|
uploadFile: function(file) {
|
||||||
if (MatrixClientPeg.get().isGuest()) {
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
dis.dispatch({action: 'view_set_mxid'});
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
|
||||||
title: "Please Register",
|
|
||||||
description: "Guest users can't upload files. Please register to upload."
|
|
||||||
});
|
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -958,8 +927,8 @@ module.exports = React.createClass({
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Failed to upload file " + file + " " + error);
|
console.error("Failed to upload file " + file + " " + error);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to upload file",
|
title: _t('Failed to upload file'),
|
||||||
description: ((error && error.message) ? error.message : "Server may be unavailable, overloaded, or the file too big"),
|
description: ((error && error.message) ? error.message : _t("Server may be unavailable, overloaded, or the file too big")),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
@ -1045,8 +1014,8 @@ module.exports = React.createClass({
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Search failed: " + error);
|
console.error("Search failed: " + error);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Search failed",
|
title: _t("Search failed"),
|
||||||
description: ((error && error.message) ? error.message : "Server may be unavailable, overloaded, or search timed out :("),
|
description: ((error && error.message) ? error.message : _t("Server may be unavailable, overloaded, or search timed out :(")),
|
||||||
});
|
});
|
||||||
}).finally(function() {
|
}).finally(function() {
|
||||||
self.setState({
|
self.setState({
|
||||||
|
@ -1081,12 +1050,12 @@ module.exports = React.createClass({
|
||||||
if (!this.state.searchResults.next_batch) {
|
if (!this.state.searchResults.next_batch) {
|
||||||
if (this.state.searchResults.results.length == 0) {
|
if (this.state.searchResults.results.length == 0) {
|
||||||
ret.push(<li key="search-top-marker">
|
ret.push(<li key="search-top-marker">
|
||||||
<h2 className="mx_RoomView_topMarker">No results</h2>
|
<h2 className="mx_RoomView_topMarker">{ _t("No results") }</h2>
|
||||||
</li>
|
</li>
|
||||||
);
|
);
|
||||||
} else {
|
} else {
|
||||||
ret.push(<li key="search-top-marker">
|
ret.push(<li key="search-top-marker">
|
||||||
<h2 className="mx_RoomView_topMarker">No more results</h2>
|
<h2 className="mx_RoomView_topMarker">{ _t("No more results") }</h2>
|
||||||
</li>
|
</li>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -1123,10 +1092,10 @@ module.exports = React.createClass({
|
||||||
// it. We should tell the js sdk to go and find out about
|
// it. We should tell the js sdk to go and find out about
|
||||||
// it. But that's not an issue currently, as synapse only
|
// it. But that's not an issue currently, as synapse only
|
||||||
// returns results for rooms we're joined to.
|
// returns results for rooms we're joined to.
|
||||||
var roomName = room ? room.name : "Unknown room "+roomId;
|
var roomName = room ? room.name : _t("Unknown room %(roomId)s", { roomId: roomId });
|
||||||
|
|
||||||
ret.push(<li key={mxEv.getId() + "-room"}>
|
ret.push(<li key={mxEv.getId() + "-room"}>
|
||||||
<h1>Room: { roomName }</h1>
|
<h1>{ _t("Room") }: { roomName }</h1>
|
||||||
</li>);
|
</li>);
|
||||||
lastRoomId = roomId;
|
lastRoomId = roomId;
|
||||||
}
|
}
|
||||||
|
@ -1172,7 +1141,7 @@ module.exports = React.createClass({
|
||||||
});
|
});
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to save settings",
|
title: _t("Failed to save settings"),
|
||||||
description: fails.map(function(result) { return result.reason; }).join("\n"),
|
description: fails.map(function(result) { return result.reason; }).join("\n"),
|
||||||
});
|
});
|
||||||
// still editing room settings
|
// still editing room settings
|
||||||
|
@ -1193,7 +1162,15 @@ module.exports = React.createClass({
|
||||||
onCancelClick: function() {
|
onCancelClick: function() {
|
||||||
console.log("updateTint from onCancelClick");
|
console.log("updateTint from onCancelClick");
|
||||||
this.updateTint();
|
this.updateTint();
|
||||||
this.setState({editingRoomSettings: false});
|
this.setState({
|
||||||
|
editingRoomSettings: false,
|
||||||
|
});
|
||||||
|
if (this.state.forwardingEvent) {
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'forward_event',
|
||||||
|
event: null,
|
||||||
|
});
|
||||||
|
}
|
||||||
dis.dispatch({action: 'focus_composer'});
|
dis.dispatch({action: 'focus_composer'});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -1208,11 +1185,11 @@ module.exports = React.createClass({
|
||||||
MatrixClientPeg.get().forget(this.state.room.roomId).done(function() {
|
MatrixClientPeg.get().forget(this.state.room.roomId).done(function() {
|
||||||
dis.dispatch({ action: 'view_next_room' });
|
dis.dispatch({ action: 'view_next_room' });
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
var errCode = err.errcode || "unknown error code";
|
var errCode = err.errcode || _t("unknown error code");
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t("Error"),
|
||||||
description: `Failed to forget room (${errCode})`
|
description: _t("Failed to forget room %(errCode)s", { errCode: errCode }),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
@ -1233,8 +1210,8 @@ module.exports = React.createClass({
|
||||||
var msg = error.message ? error.message : JSON.stringify(error);
|
var msg = error.message ? error.message : JSON.stringify(error);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to reject invite",
|
title: _t("Failed to reject invite"),
|
||||||
description: msg
|
description: msg,
|
||||||
});
|
});
|
||||||
|
|
||||||
self.setState({
|
self.setState({
|
||||||
|
@ -1295,21 +1272,6 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
// update scrollStateMap on unmount
|
|
||||||
_updateScrollMap: function() {
|
|
||||||
if (!this.state.room) {
|
|
||||||
// we were instantiated on a room alias and haven't yet joined the room.
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
if (!this.props.scrollStateMap) return;
|
|
||||||
|
|
||||||
var roomId = this.state.room.roomId;
|
|
||||||
|
|
||||||
var state = this._getScrollState();
|
|
||||||
this.props.scrollStateMap[roomId] = state;
|
|
||||||
},
|
|
||||||
|
|
||||||
|
|
||||||
// get the current scroll position of the room, so that it can be
|
// get the current scroll position of the room, so that it can be
|
||||||
// restored when we switch back to it.
|
// restored when we switch back to it.
|
||||||
//
|
//
|
||||||
|
@ -1463,61 +1425,65 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
var RoomHeader = sdk.getComponent('rooms.RoomHeader');
|
const RoomHeader = sdk.getComponent('rooms.RoomHeader');
|
||||||
var MessageComposer = sdk.getComponent('rooms.MessageComposer');
|
const MessageComposer = sdk.getComponent('rooms.MessageComposer');
|
||||||
var RoomSettings = sdk.getComponent("rooms.RoomSettings");
|
const ForwardMessage = sdk.getComponent("rooms.ForwardMessage");
|
||||||
var AuxPanel = sdk.getComponent("rooms.AuxPanel");
|
const RoomSettings = sdk.getComponent("rooms.RoomSettings");
|
||||||
var SearchBar = sdk.getComponent("rooms.SearchBar");
|
const AuxPanel = sdk.getComponent("rooms.AuxPanel");
|
||||||
var ScrollPanel = sdk.getComponent("structures.ScrollPanel");
|
const SearchBar = sdk.getComponent("rooms.SearchBar");
|
||||||
var TintableSvg = sdk.getComponent("elements.TintableSvg");
|
const ScrollPanel = sdk.getComponent("structures.ScrollPanel");
|
||||||
var RoomPreviewBar = sdk.getComponent("rooms.RoomPreviewBar");
|
const TintableSvg = sdk.getComponent("elements.TintableSvg");
|
||||||
var Loader = sdk.getComponent("elements.Spinner");
|
const RoomPreviewBar = sdk.getComponent("rooms.RoomPreviewBar");
|
||||||
var TimelinePanel = sdk.getComponent("structures.TimelinePanel");
|
const Loader = sdk.getComponent("elements.Spinner");
|
||||||
|
const TimelinePanel = sdk.getComponent("structures.TimelinePanel");
|
||||||
|
|
||||||
|
// Whether the preview bar spinner should be shown. We do this when joining or
|
||||||
|
// when waiting for a room to be returned by js-sdk when joining
|
||||||
|
const previewBarSpinner = this.state.joining || this.state.waitingForRoom;
|
||||||
|
|
||||||
if (!this.state.room) {
|
if (!this.state.room) {
|
||||||
if (this.state.roomLoading) {
|
if (this.state.roomLoading || this.state.peekLoading) {
|
||||||
return (
|
return (
|
||||||
<div className="mx_RoomView">
|
<div className="mx_RoomView">
|
||||||
<Loader />
|
<Loader />
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
} else {
|
||||||
|
var inviterName = undefined;
|
||||||
|
if (this.props.oobData) {
|
||||||
|
inviterName = this.props.oobData.inviterName;
|
||||||
|
}
|
||||||
|
var invitedEmail = undefined;
|
||||||
|
if (this.props.thirdPartyInvite) {
|
||||||
|
invitedEmail = this.props.thirdPartyInvite.invitedEmail;
|
||||||
}
|
}
|
||||||
else {
|
|
||||||
var inviterName = undefined;
|
|
||||||
if (this.props.oobData) {
|
|
||||||
inviterName = this.props.oobData.inviterName;
|
|
||||||
}
|
|
||||||
var invitedEmail = undefined;
|
|
||||||
if (this.props.thirdPartyInvite) {
|
|
||||||
invitedEmail = this.props.thirdPartyInvite.invitedEmail;
|
|
||||||
}
|
|
||||||
|
|
||||||
// We have no room object for this room, only the ID.
|
// We have no room object for this room, only the ID.
|
||||||
// We've got to this room by following a link, possibly a third party invite.
|
// We've got to this room by following a link, possibly a third party invite.
|
||||||
var room_alias = this.props.roomAddress[0] == '#' ? this.props.roomAddress : null;
|
const roomAlias = this.state.roomAlias;
|
||||||
return (
|
return (
|
||||||
<div className="mx_RoomView">
|
<div className="mx_RoomView">
|
||||||
<RoomHeader ref="header"
|
<RoomHeader ref="header"
|
||||||
room={this.state.room}
|
room={this.state.room}
|
||||||
oobData={this.props.oobData}
|
oobData={this.props.oobData}
|
||||||
collapsedRhs={ this.props.collapsedRhs }
|
collapsedRhs={ this.props.collapsedRhs }
|
||||||
|
/>
|
||||||
|
<div className="mx_RoomView_auxPanel">
|
||||||
|
<RoomPreviewBar onJoinClick={ this.onJoinButtonClicked }
|
||||||
|
onForgetClick={ this.onForgetClick }
|
||||||
|
onRejectClick={ this.onRejectThreepidInviteButtonClicked }
|
||||||
|
canPreview={ false } error={ this.state.roomLoadError }
|
||||||
|
roomAlias={roomAlias}
|
||||||
|
spinner={previewBarSpinner}
|
||||||
|
inviterName={inviterName}
|
||||||
|
invitedEmail={invitedEmail}
|
||||||
|
room={this.state.room}
|
||||||
/>
|
/>
|
||||||
<div className="mx_RoomView_auxPanel">
|
|
||||||
<RoomPreviewBar onJoinClick={ this.onJoinButtonClicked }
|
|
||||||
onForgetClick={ this.onForgetClick }
|
|
||||||
onRejectClick={ this.onRejectThreepidInviteButtonClicked }
|
|
||||||
canPreview={ false } error={ this.state.roomLoadError }
|
|
||||||
roomAlias={room_alias}
|
|
||||||
spinner={this.state.joining}
|
|
||||||
inviterName={inviterName}
|
|
||||||
invitedEmail={invitedEmail}
|
|
||||||
room={this.state.room}
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
<div className="mx_RoomView_messagePanel"></div>
|
|
||||||
</div>
|
</div>
|
||||||
);
|
<div className="mx_RoomView_messagePanel"></div>
|
||||||
}
|
</div>
|
||||||
|
);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
var myUserId = MatrixClientPeg.get().credentials.userId;
|
var myUserId = MatrixClientPeg.get().credentials.userId;
|
||||||
|
@ -1551,7 +1517,7 @@ module.exports = React.createClass({
|
||||||
onRejectClick={ this.onRejectButtonClicked }
|
onRejectClick={ this.onRejectButtonClicked }
|
||||||
inviterName={ inviterName }
|
inviterName={ inviterName }
|
||||||
canPreview={ false }
|
canPreview={ false }
|
||||||
spinner={this.state.joining}
|
spinner={previewBarSpinner}
|
||||||
room={this.state.room}
|
room={this.state.room}
|
||||||
/>
|
/>
|
||||||
</div>
|
</div>
|
||||||
|
@ -1600,17 +1566,18 @@ module.exports = React.createClass({
|
||||||
/>;
|
/>;
|
||||||
}
|
}
|
||||||
|
|
||||||
var aux = null;
|
let aux = null;
|
||||||
|
let hideCancel = false;
|
||||||
if (this.state.editingRoomSettings) {
|
if (this.state.editingRoomSettings) {
|
||||||
aux = <RoomSettings ref="room_settings" onSaveClick={this.onSettingsSaveClick} onCancelClick={this.onCancelClick} room={this.state.room} />;
|
aux = <RoomSettings ref="room_settings" onSaveClick={this.onSettingsSaveClick} onCancelClick={this.onCancelClick} room={this.state.room} />;
|
||||||
}
|
} else if (this.state.uploadingRoomSettings) {
|
||||||
else if (this.state.uploadingRoomSettings) {
|
|
||||||
aux = <Loader/>;
|
aux = <Loader/>;
|
||||||
}
|
} else if (this.state.forwardingEvent !== null) {
|
||||||
else if (this.state.searching) {
|
aux = <ForwardMessage onCancelClick={this.onCancelClick} />;
|
||||||
|
} else if (this.state.searching) {
|
||||||
|
hideCancel = true; // has own cancel
|
||||||
aux = <SearchBar ref="search_bar" searchInProgress={this.state.searchInProgress } onCancelClick={this.onCancelSearchClick} onSearch={this.onSearch}/>;
|
aux = <SearchBar ref="search_bar" searchInProgress={this.state.searchInProgress } onCancelClick={this.onCancelSearchClick} onSearch={this.onSearch}/>;
|
||||||
}
|
} else if (!myMember || myMember.membership !== "join") {
|
||||||
else if (!myMember || myMember.membership !== "join") {
|
|
||||||
// We do have a room object for this room, but we're not currently in it.
|
// We do have a room object for this room, but we're not currently in it.
|
||||||
// We may have a 3rd party invite to it.
|
// We may have a 3rd party invite to it.
|
||||||
var inviterName = undefined;
|
var inviterName = undefined;
|
||||||
|
@ -1621,11 +1588,12 @@ module.exports = React.createClass({
|
||||||
if (this.props.thirdPartyInvite) {
|
if (this.props.thirdPartyInvite) {
|
||||||
invitedEmail = this.props.thirdPartyInvite.invitedEmail;
|
invitedEmail = this.props.thirdPartyInvite.invitedEmail;
|
||||||
}
|
}
|
||||||
|
hideCancel = true;
|
||||||
aux = (
|
aux = (
|
||||||
<RoomPreviewBar onJoinClick={this.onJoinButtonClicked}
|
<RoomPreviewBar onJoinClick={this.onJoinButtonClicked}
|
||||||
onForgetClick={ this.onForgetClick }
|
onForgetClick={ this.onForgetClick }
|
||||||
onRejectClick={this.onRejectThreepidInviteButtonClicked}
|
onRejectClick={this.onRejectThreepidInviteButtonClicked}
|
||||||
spinner={this.state.joining}
|
spinner={previewBarSpinner}
|
||||||
inviterName={inviterName}
|
inviterName={inviterName}
|
||||||
invitedEmail={invitedEmail}
|
invitedEmail={invitedEmail}
|
||||||
canPreview={this.state.canPeek}
|
canPreview={this.state.canPeek}
|
||||||
|
@ -1672,7 +1640,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
if (call.type === "video") {
|
if (call.type === "video") {
|
||||||
zoomButton = (
|
zoomButton = (
|
||||||
<div className="mx_RoomView_voipButton" onClick={this.onFullscreenClick} title="Fill screen">
|
<div className="mx_RoomView_voipButton" onClick={this.onFullscreenClick} title={ _t("Fill screen") }>
|
||||||
<TintableSvg src="img/fullscreen.svg" width="29" height="22" style={{ marginTop: 1, marginRight: 4 }}/>
|
<TintableSvg src="img/fullscreen.svg" width="29" height="22" style={{ marginTop: 1, marginRight: 4 }}/>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -1680,14 +1648,14 @@ module.exports = React.createClass({
|
||||||
videoMuteButton =
|
videoMuteButton =
|
||||||
<div className="mx_RoomView_voipButton" onClick={this.onMuteVideoClick}>
|
<div className="mx_RoomView_voipButton" onClick={this.onMuteVideoClick}>
|
||||||
<TintableSvg src={call.isLocalVideoMuted() ? "img/video-unmute.svg" : "img/video-mute.svg"}
|
<TintableSvg src={call.isLocalVideoMuted() ? "img/video-unmute.svg" : "img/video-mute.svg"}
|
||||||
alt={call.isLocalVideoMuted() ? "Click to unmute video" : "Click to mute video"}
|
alt={call.isLocalVideoMuted() ? _t("Click to unmute video") : _t("Click to mute video")}
|
||||||
width="31" height="27"/>
|
width="31" height="27"/>
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
voiceMuteButton =
|
voiceMuteButton =
|
||||||
<div className="mx_RoomView_voipButton" onClick={this.onMuteAudioClick}>
|
<div className="mx_RoomView_voipButton" onClick={this.onMuteAudioClick}>
|
||||||
<TintableSvg src={call.isMicrophoneMuted() ? "img/voice-unmute.svg" : "img/voice-mute.svg"}
|
<TintableSvg src={call.isMicrophoneMuted() ? "img/voice-unmute.svg" : "img/voice-mute.svg"}
|
||||||
alt={call.isMicrophoneMuted() ? "Click to unmute audio" : "Click to mute audio"}
|
alt={call.isMicrophoneMuted() ? _t("Click to unmute audio") : _t("Click to mute audio")}
|
||||||
width="21" height="26"/>
|
width="21" height="26"/>
|
||||||
</div>;
|
</div>;
|
||||||
|
|
||||||
|
@ -1722,17 +1690,24 @@ module.exports = React.createClass({
|
||||||
hideMessagePanel = true;
|
hideMessagePanel = true;
|
||||||
}
|
}
|
||||||
|
|
||||||
// console.log("ShowUrlPreview for %s is %s", this.state.room.roomId, this.state.showUrlPreview);
|
const shouldHighlight = this.state.isInitialEventHighlighted;
|
||||||
|
let highlightedEventId = null;
|
||||||
|
if (this.state.forwardingEvent) {
|
||||||
|
highlightedEventId = this.state.forwardingEvent.getId();
|
||||||
|
} else if (shouldHighlight) {
|
||||||
|
highlightedEventId = this.state.initialEventId;
|
||||||
|
}
|
||||||
|
|
||||||
|
// console.log("ShowUrlPreview for %s is %s", this.state.room.roomId, this.state.showUrlPreview);
|
||||||
var messagePanel = (
|
var messagePanel = (
|
||||||
<TimelinePanel ref={this._gatherTimelinePanelRef}
|
<TimelinePanel ref={this._gatherTimelinePanelRef}
|
||||||
timelineSet={this.state.room.getUnfilteredTimelineSet()}
|
timelineSet={this.state.room.getUnfilteredTimelineSet()}
|
||||||
manageReadReceipts={!UserSettingsStore.getSyncedSetting('hideReadReceipts', false)}
|
manageReadReceipts={!UserSettingsStore.getSyncedSetting('hideReadReceipts', false)}
|
||||||
manageReadMarkers={true}
|
manageReadMarkers={true}
|
||||||
hidden={hideMessagePanel}
|
hidden={hideMessagePanel}
|
||||||
highlightedEventId={this.props.highlightedEventId}
|
highlightedEventId={highlightedEventId}
|
||||||
eventId={this.props.eventId}
|
eventId={this.state.initialEventId}
|
||||||
eventPixelOffset={this.props.eventPixelOffset}
|
eventPixelOffset={this.state.initialEventPixelOffset}
|
||||||
onScroll={ this.onMessageListScroll }
|
onScroll={ this.onMessageListScroll }
|
||||||
onReadMarkerUpdated={ this._updateTopUnreadMessagesBar }
|
onReadMarkerUpdated={ this._updateTopUnreadMessagesBar }
|
||||||
showUrlPreview = { this.state.showUrlPreview }
|
showUrlPreview = { this.state.showUrlPreview }
|
||||||
|
@ -1763,17 +1738,15 @@ module.exports = React.createClass({
|
||||||
oobData={this.props.oobData}
|
oobData={this.props.oobData}
|
||||||
editing={this.state.editingRoomSettings}
|
editing={this.state.editingRoomSettings}
|
||||||
saving={this.state.uploadingRoomSettings}
|
saving={this.state.uploadingRoomSettings}
|
||||||
|
inRoom={myMember && myMember.membership === 'join'}
|
||||||
collapsedRhs={ this.props.collapsedRhs }
|
collapsedRhs={ this.props.collapsedRhs }
|
||||||
onSearchClick={this.onSearchClick}
|
onSearchClick={this.onSearchClick}
|
||||||
onSettingsClick={this.onSettingsClick}
|
onSettingsClick={this.onSettingsClick}
|
||||||
onSaveClick={this.onSettingsSaveClick}
|
onSaveClick={this.onSettingsSaveClick}
|
||||||
onCancelClick={this.onCancelClick}
|
onCancelClick={(aux && !hideCancel) ? this.onCancelClick : null}
|
||||||
onForgetClick={
|
onForgetClick={(myMember && myMember.membership === "leave") ? this.onForgetClick : null}
|
||||||
(myMember && myMember.membership === "leave") ? this.onForgetClick : null
|
onLeaveClick={(myMember && myMember.membership === "join") ? this.onLeaveClick : null}
|
||||||
}
|
/>
|
||||||
onLeaveClick={
|
|
||||||
(myMember && myMember.membership === "join") ? this.onLeaveClick : null
|
|
||||||
} />
|
|
||||||
{ auxPanel }
|
{ auxPanel }
|
||||||
{ topUnreadMessagesBar }
|
{ topUnreadMessagesBar }
|
||||||
{ messagePanel }
|
{ messagePanel }
|
||||||
|
|
|
@ -352,13 +352,14 @@ module.exports = React.createClass({
|
||||||
const tile = tiles[backwards ? i : tiles.length - 1 - i];
|
const tile = tiles[backwards ? i : tiles.length - 1 - i];
|
||||||
// Subtract height of tile as if it were unpaginated
|
// Subtract height of tile as if it were unpaginated
|
||||||
excessHeight -= tile.clientHeight;
|
excessHeight -= tile.clientHeight;
|
||||||
|
//If removing the tile would lead to future pagination, break before setting scroll token
|
||||||
|
if (tile.clientHeight > excessHeight) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
// The tile may not have a scroll token, so guard it
|
// The tile may not have a scroll token, so guard it
|
||||||
if (tile.dataset.scrollTokens) {
|
if (tile.dataset.scrollTokens) {
|
||||||
markerScrollToken = tile.dataset.scrollTokens.split(',')[0];
|
markerScrollToken = tile.dataset.scrollTokens.split(',')[0];
|
||||||
}
|
}
|
||||||
if (tile.clientHeight > excessHeight) {
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
if (markerScrollToken) {
|
if (markerScrollToken) {
|
||||||
|
|
|
@ -23,12 +23,14 @@ var Matrix = require("matrix-js-sdk");
|
||||||
var EventTimeline = Matrix.EventTimeline;
|
var EventTimeline = Matrix.EventTimeline;
|
||||||
|
|
||||||
var sdk = require('../../index');
|
var sdk = require('../../index');
|
||||||
|
import { _t } from '../../languageHandler';
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||||
var dis = require("../../dispatcher");
|
var dis = require("../../dispatcher");
|
||||||
var ObjectUtils = require('../../ObjectUtils');
|
var ObjectUtils = require('../../ObjectUtils');
|
||||||
var Modal = require("../../Modal");
|
var Modal = require("../../Modal");
|
||||||
var UserActivity = require("../../UserActivity");
|
var UserActivity = require("../../UserActivity");
|
||||||
var KeyCode = require('../../KeyCode');
|
var KeyCode = require('../../KeyCode');
|
||||||
|
import UserSettingsStore from '../../UserSettingsStore';
|
||||||
|
|
||||||
var PAGINATE_SIZE = 20;
|
var PAGINATE_SIZE = 20;
|
||||||
var INITIAL_SIZE = 20;
|
var INITIAL_SIZE = 20;
|
||||||
|
@ -122,13 +124,15 @@ var TimelinePanel = React.createClass({
|
||||||
let initialReadMarker = null;
|
let initialReadMarker = null;
|
||||||
if (this.props.manageReadMarkers) {
|
if (this.props.manageReadMarkers) {
|
||||||
const readmarker = this.props.timelineSet.room.getAccountData('m.fully_read');
|
const readmarker = this.props.timelineSet.room.getAccountData('m.fully_read');
|
||||||
if (readmarker){
|
if (readmarker) {
|
||||||
initialReadMarker = readmarker.getContent().event_id;
|
initialReadMarker = readmarker.getContent().event_id;
|
||||||
} else {
|
} else {
|
||||||
initialReadMarker = this._getCurrentReadReceipt();
|
initialReadMarker = this._getCurrentReadReceipt();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
const syncedSettings = UserSettingsStore.getSyncedSettings();
|
||||||
|
|
||||||
return {
|
return {
|
||||||
events: [],
|
events: [],
|
||||||
timelineLoading: true, // track whether our room timeline is loading
|
timelineLoading: true, // track whether our room timeline is loading
|
||||||
|
@ -171,14 +175,23 @@ var TimelinePanel = React.createClass({
|
||||||
|
|
||||||
// cache of matrixClient.getSyncState() (but from the 'sync' event)
|
// cache of matrixClient.getSyncState() (but from the 'sync' event)
|
||||||
clientSyncState: MatrixClientPeg.get().getSyncState(),
|
clientSyncState: MatrixClientPeg.get().getSyncState(),
|
||||||
|
|
||||||
|
// should the event tiles have twelve hour times
|
||||||
|
isTwelveHour: syncedSettings.showTwelveHourTimestamps,
|
||||||
|
|
||||||
|
// always show timestamps on event tiles?
|
||||||
|
alwaysShowTimestamps: syncedSettings.alwaysShowTimestamps,
|
||||||
|
|
||||||
|
// hide redacted events as per old behaviour
|
||||||
|
hideRedactions: syncedSettings.hideRedactions,
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
componentWillMount: function() {
|
||||||
debuglog("TimelinePanel: mounting");
|
debuglog("TimelinePanel: mounting");
|
||||||
|
|
||||||
this.last_rr_sent_event_id = undefined;
|
this.lastRRSentEventId = undefined;
|
||||||
this.last_rm_sent_event_id = undefined;
|
this.lastRMSentEventId = undefined;
|
||||||
|
|
||||||
this.dispatcherRef = dis.register(this.onAction);
|
this.dispatcherRef = dis.register(this.onAction);
|
||||||
MatrixClientPeg.get().on("Room.timeline", this.onRoomTimeline);
|
MatrixClientPeg.get().on("Room.timeline", this.onRoomTimeline);
|
||||||
|
@ -504,12 +517,13 @@ var TimelinePanel = React.createClass({
|
||||||
// very possible have logged out within that timeframe, so check
|
// very possible have logged out within that timeframe, so check
|
||||||
// we still have a client.
|
// we still have a client.
|
||||||
const cli = MatrixClientPeg.get();
|
const cli = MatrixClientPeg.get();
|
||||||
// if no client or client is guest don't send RR
|
// if no client or client is guest don't send RR or RM
|
||||||
if (!cli || cli.isGuest()) return;
|
if (!cli || cli.isGuest()) return;
|
||||||
|
|
||||||
var currentReadUpToEventId = this._getCurrentReadReceipt(true);
|
let shouldSendRR = true;
|
||||||
var currentReadUpToEventIndex = this._indexForEventId(currentReadUpToEventId);
|
|
||||||
|
|
||||||
|
const currentRREventId = this._getCurrentReadReceipt(true);
|
||||||
|
const currentRREventIndex = this._indexForEventId(currentRREventId);
|
||||||
// We want to avoid sending out read receipts when we are looking at
|
// We want to avoid sending out read receipts when we are looking at
|
||||||
// events in the past which are before the latest RR.
|
// events in the past which are before the latest RR.
|
||||||
//
|
//
|
||||||
|
@ -523,43 +537,60 @@ var TimelinePanel = React.createClass({
|
||||||
// RRs) - but that is a bit of a niche case. It will sort itself out when
|
// RRs) - but that is a bit of a niche case. It will sort itself out when
|
||||||
// the user eventually hits the live timeline.
|
// the user eventually hits the live timeline.
|
||||||
//
|
//
|
||||||
if (currentReadUpToEventId && currentReadUpToEventIndex === null &&
|
if (currentRREventId && currentRREventIndex === null &&
|
||||||
this._timelineWindow.canPaginate(EventTimeline.FORWARDS)) {
|
this._timelineWindow.canPaginate(EventTimeline.FORWARDS)) {
|
||||||
return;
|
shouldSendRR = false;
|
||||||
}
|
}
|
||||||
|
|
||||||
var lastReadEventIndex = this._getLastDisplayedEventIndex({
|
const lastReadEventIndex = this._getLastDisplayedEventIndex({
|
||||||
ignoreOwn: true
|
ignoreOwn: true,
|
||||||
});
|
});
|
||||||
if (lastReadEventIndex === null) return;
|
if (lastReadEventIndex === null) {
|
||||||
|
shouldSendRR = false;
|
||||||
|
}
|
||||||
|
let lastReadEvent = this.state.events[lastReadEventIndex];
|
||||||
|
shouldSendRR = shouldSendRR &&
|
||||||
|
// Only send a RR if the last read event is ahead in the timeline relative to
|
||||||
|
// the current RR event.
|
||||||
|
lastReadEventIndex > currentRREventIndex &&
|
||||||
|
// Only send a RR if the last RR set != the one we would send
|
||||||
|
this.lastRRSentEventId != lastReadEvent.getId();
|
||||||
|
|
||||||
var lastReadEvent = this.state.events[lastReadEventIndex];
|
// Only send a RM if the last RM sent != the one we would send
|
||||||
|
const shouldSendRM =
|
||||||
|
this.lastRMSentEventId != this.state.readMarkerEventId;
|
||||||
|
|
||||||
// we also remember the last read receipt we sent to avoid spamming the
|
// we also remember the last read receipt we sent to avoid spamming the
|
||||||
// same one at the server repeatedly
|
// same one at the server repeatedly
|
||||||
if ((lastReadEventIndex > currentReadUpToEventIndex &&
|
if (shouldSendRR || shouldSendRM) {
|
||||||
this.last_rr_sent_event_id != lastReadEvent.getId()) ||
|
if (shouldSendRR) {
|
||||||
this.last_rm_sent_event_id != this.state.readMarkerEventId) {
|
this.lastRRSentEventId = lastReadEvent.getId();
|
||||||
|
} else {
|
||||||
this.last_rr_sent_event_id = lastReadEvent.getId();
|
lastReadEvent = null;
|
||||||
this.last_rm_sent_event_id = this.state.readMarkerEventId;
|
}
|
||||||
|
this.lastRMSentEventId = this.state.readMarkerEventId;
|
||||||
|
|
||||||
|
debuglog('TimelinePanel: Sending Read Markers for ',
|
||||||
|
this.props.timelineSet.room.roomId,
|
||||||
|
'rm', this.state.readMarkerEventId,
|
||||||
|
lastReadEvent ? 'rr ' + lastReadEvent.getId() : '',
|
||||||
|
);
|
||||||
MatrixClientPeg.get().setRoomReadMarkers(
|
MatrixClientPeg.get().setRoomReadMarkers(
|
||||||
this.props.timelineSet.room.roomId,
|
this.props.timelineSet.room.roomId,
|
||||||
this.state.readMarkerEventId,
|
this.state.readMarkerEventId,
|
||||||
lastReadEvent
|
lastReadEvent, // Could be null, in which case no RR is sent
|
||||||
).catch((e) => {
|
).catch((e) => {
|
||||||
// /read_markers API is not implemented on this HS, fallback to just RR
|
// /read_markers API is not implemented on this HS, fallback to just RR
|
||||||
if (e.errcode === 'M_UNRECOGNIZED') {
|
if (e.errcode === 'M_UNRECOGNIZED' && lastReadEvent) {
|
||||||
return MatrixClientPeg.get().sendReadReceipt(
|
return MatrixClientPeg.get().sendReadReceipt(
|
||||||
lastReadEvent
|
lastReadEvent,
|
||||||
).catch(() => {
|
).catch(() => {
|
||||||
this.last_rr_sent_event_id = undefined;
|
this.lastRRSentEventId = undefined;
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
// it failed, so allow retries next time the user is active
|
// it failed, so allow retries next time the user is active
|
||||||
this.last_rr_sent_event_id = undefined;
|
this.lastRRSentEventId = undefined;
|
||||||
this.last_rm_sent_event_id = undefined;
|
this.lastRMSentEventId = undefined;
|
||||||
});
|
});
|
||||||
|
|
||||||
// do a quick-reset of our unreadNotificationCount to avoid having
|
// do a quick-reset of our unreadNotificationCount to avoid having
|
||||||
|
@ -572,7 +603,6 @@ var TimelinePanel = React.createClass({
|
||||||
this.props.timelineSet.room.setUnreadNotificationCount('highlight', 0);
|
this.props.timelineSet.room.setUnreadNotificationCount('highlight', 0);
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'on_room_read',
|
action: 'on_room_read',
|
||||||
room: this.props.timelineSet.room,
|
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -872,6 +902,9 @@ var TimelinePanel = React.createClass({
|
||||||
|
|
||||||
var onError = (error) => {
|
var onError = (error) => {
|
||||||
this.setState({timelineLoading: false});
|
this.setState({timelineLoading: false});
|
||||||
|
console.error(
|
||||||
|
`Error loading timeline panel at ${eventId}: ${error}`,
|
||||||
|
);
|
||||||
var msg = error.message ? error.message : JSON.stringify(error);
|
var msg = error.message ? error.message : JSON.stringify(error);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
|
|
||||||
|
@ -890,14 +923,11 @@ var TimelinePanel = React.createClass({
|
||||||
});
|
});
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
var message = "Tried to load a specific point in this room's timeline, but ";
|
var message = (error.errcode == 'M_FORBIDDEN')
|
||||||
if (error.errcode == 'M_FORBIDDEN') {
|
? _t("Tried to load a specific point in this room's timeline, but you do not have permission to view the message in question.")
|
||||||
message += "you do not have permission to view the message in question.";
|
: _t("Tried to load a specific point in this room's timeline, but was unable to find it.");
|
||||||
} else {
|
|
||||||
message += "was unable to find it.";
|
|
||||||
}
|
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to load timeline position",
|
title: _t("Failed to load timeline position"),
|
||||||
description: message,
|
description: message,
|
||||||
onFinished: onFinished,
|
onFinished: onFinished,
|
||||||
});
|
});
|
||||||
|
@ -1089,27 +1119,29 @@ var TimelinePanel = React.createClass({
|
||||||
const forwardPaginating = (
|
const forwardPaginating = (
|
||||||
this.state.forwardPaginating || this.state.clientSyncState == 'PREPARED'
|
this.state.forwardPaginating || this.state.clientSyncState == 'PREPARED'
|
||||||
);
|
);
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<MessagePanel ref="messagePanel"
|
<MessagePanel ref="messagePanel"
|
||||||
hidden={ this.props.hidden }
|
hidden={ this.props.hidden }
|
||||||
backPaginating={ this.state.backPaginating }
|
hideRedactions={ this.state.hideRedactions }
|
||||||
forwardPaginating={ forwardPaginating }
|
backPaginating={ this.state.backPaginating }
|
||||||
events={ this.state.events }
|
forwardPaginating={ forwardPaginating }
|
||||||
highlightedEventId={ this.props.highlightedEventId }
|
events={ this.state.events }
|
||||||
readMarkerEventId={ this.state.readMarkerEventId }
|
highlightedEventId={ this.props.highlightedEventId }
|
||||||
readMarkerVisible={ this.state.readMarkerVisible }
|
readMarkerEventId={ this.state.readMarkerEventId }
|
||||||
suppressFirstDateSeparator={ this.state.canBackPaginate }
|
readMarkerVisible={ this.state.readMarkerVisible }
|
||||||
showUrlPreview = { this.props.showUrlPreview }
|
suppressFirstDateSeparator={ this.state.canBackPaginate }
|
||||||
manageReadReceipts = { this.props.manageReadReceipts }
|
showUrlPreview = { this.props.showUrlPreview }
|
||||||
ourUserId={ MatrixClientPeg.get().credentials.userId }
|
manageReadReceipts = { this.props.manageReadReceipts }
|
||||||
stickyBottom={ stickyBottom }
|
ourUserId={ MatrixClientPeg.get().credentials.userId }
|
||||||
onScroll={ this.onMessageListScroll }
|
stickyBottom={ stickyBottom }
|
||||||
onFillRequest={ this.onMessageListFillRequest }
|
onScroll={ this.onMessageListScroll }
|
||||||
onUnfillRequest={ this.onMessageListUnfillRequest }
|
onFillRequest={ this.onMessageListFillRequest }
|
||||||
opacity={ this.props.opacity }
|
onUnfillRequest={ this.onMessageListUnfillRequest }
|
||||||
className={ this.props.className }
|
opacity={ this.props.opacity }
|
||||||
tileShape={ this.props.tileShape }
|
isTwelveHour={ this.state.isTwelveHour }
|
||||||
|
alwaysShowTimestamps={ this.state.alwaysShowTimestamps }
|
||||||
|
className={ this.props.className }
|
||||||
|
tileShape={ this.props.tileShape }
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
},
|
},
|
||||||
|
|
|
@ -18,6 +18,7 @@ var React = require('react');
|
||||||
var ContentMessages = require('../../ContentMessages');
|
var ContentMessages = require('../../ContentMessages');
|
||||||
var dis = require('../../dispatcher');
|
var dis = require('../../dispatcher');
|
||||||
var filesize = require('filesize');
|
var filesize = require('filesize');
|
||||||
|
import { _t } from '../../languageHandler';
|
||||||
|
|
||||||
module.exports = React.createClass({displayName: 'UploadBar',
|
module.exports = React.createClass({displayName: 'UploadBar',
|
||||||
propTypes: {
|
propTypes: {
|
||||||
|
@ -81,10 +82,8 @@ module.exports = React.createClass({displayName: 'UploadBar',
|
||||||
uploadedSize = uploadedSize.replace(/ .*/, '');
|
uploadedSize = uploadedSize.replace(/ .*/, '');
|
||||||
}
|
}
|
||||||
|
|
||||||
var others;
|
// MUST use var name 'count' for pluralization to kick in
|
||||||
if (uploads.length > 1) {
|
var uploadText = _t("Uploading %(filename)s and %(count)s others", {filename: upload.fileName, count: (uploads.length - 1)});
|
||||||
others = ' and ' + (uploads.length - 1) + ' other' + (uploads.length > 2 ? 's' : '');
|
|
||||||
}
|
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className="mx_UploadBar">
|
<div className="mx_UploadBar">
|
||||||
|
@ -98,7 +97,7 @@ module.exports = React.createClass({displayName: 'UploadBar',
|
||||||
<div className="mx_UploadBar_uploadBytes">
|
<div className="mx_UploadBar_uploadBytes">
|
||||||
{ uploadedSize } / { totalSize }
|
{ uploadedSize } / { totalSize }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_UploadBar_uploadFilename">Uploading {upload.fileName}{others}</div>
|
<div className="mx_UploadBar_uploadFilename">{uploadText}</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
File diff suppressed because it is too large
Load Diff
|
@ -17,6 +17,7 @@ limitations under the License.
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
var Modal = require("../../../Modal");
|
var Modal = require("../../../Modal");
|
||||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
||||||
|
@ -54,7 +55,7 @@ module.exports = React.createClass({
|
||||||
progress: "sent_email"
|
progress: "sent_email"
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
this.showErrorDialog("Failed to send email: " + err.message);
|
this.showErrorDialog(_t('Failed to send email') + ": " + err.message);
|
||||||
this.setState({
|
this.setState({
|
||||||
progress: null
|
progress: null
|
||||||
});
|
});
|
||||||
|
@ -78,30 +79,33 @@ module.exports = React.createClass({
|
||||||
ev.preventDefault();
|
ev.preventDefault();
|
||||||
|
|
||||||
if (!this.state.email) {
|
if (!this.state.email) {
|
||||||
this.showErrorDialog("The email address linked to your account must be entered.");
|
this.showErrorDialog(_t('The email address linked to your account must be entered.'));
|
||||||
}
|
}
|
||||||
else if (!this.state.password || !this.state.password2) {
|
else if (!this.state.password || !this.state.password2) {
|
||||||
this.showErrorDialog("A new password must be entered.");
|
this.showErrorDialog(_t('A new password must be entered.'));
|
||||||
}
|
}
|
||||||
else if (this.state.password !== this.state.password2) {
|
else if (this.state.password !== this.state.password2) {
|
||||||
this.showErrorDialog("New passwords must match each other.");
|
this.showErrorDialog(_t('New passwords must match each other.'));
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning",
|
title: _t('Warning!'),
|
||||||
description:
|
description:
|
||||||
<div>
|
<div>
|
||||||
Resetting password will currently reset any end-to-end encryption keys on all devices,
|
{ _t(
|
||||||
making encrypted chat history unreadable, unless you first export your room keys
|
'Resetting password will currently reset any ' +
|
||||||
and re-import them afterwards.
|
'end-to-end encryption keys on all devices, ' +
|
||||||
In future this <a href="https://github.com/vector-im/riot-web/issues/2671">will be improved</a>.
|
'making encrypted chat history unreadable, ' +
|
||||||
|
'unless you first export your room keys and re-import ' +
|
||||||
|
'them afterwards. In future this will be improved.'
|
||||||
|
) }
|
||||||
</div>,
|
</div>,
|
||||||
button: "Continue",
|
button: _t('Continue'),
|
||||||
extraButtons: [
|
extraButtons: [
|
||||||
<button className="mx_Dialog_primary"
|
<button className="mx_Dialog_primary"
|
||||||
onClick={this._onExportE2eKeysClicked}>
|
onClick={this._onExportE2eKeysClicked}>
|
||||||
Export E2E room keys
|
{ _t('Export E2E room keys') }
|
||||||
</button>
|
</button>
|
||||||
],
|
],
|
||||||
onFinished: (confirmed) => {
|
onFinished: (confirmed) => {
|
||||||
|
@ -150,7 +154,7 @@ module.exports = React.createClass({
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: title,
|
title: title,
|
||||||
description: body
|
description: body,
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -168,22 +172,20 @@ module.exports = React.createClass({
|
||||||
else if (this.state.progress === "sent_email") {
|
else if (this.state.progress === "sent_email") {
|
||||||
resetPasswordJsx = (
|
resetPasswordJsx = (
|
||||||
<div>
|
<div>
|
||||||
An email has been sent to {this.state.email}. Once you've followed
|
{ _t('An email has been sent to') } {this.state.email}. { _t('Once you've followed the link it contains, click below') }.
|
||||||
the link it contains, click below.
|
|
||||||
<br />
|
<br />
|
||||||
<input className="mx_Login_submit" type="button" onClick={this.onVerify}
|
<input className="mx_Login_submit" type="button" onClick={this.onVerify}
|
||||||
value="I have verified my email address" />
|
value={ _t('I have verified my email address') } />
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
else if (this.state.progress === "complete") {
|
else if (this.state.progress === "complete") {
|
||||||
resetPasswordJsx = (
|
resetPasswordJsx = (
|
||||||
<div>
|
<div>
|
||||||
<p>Your password has been reset.</p>
|
<p>{ _t('Your password has been reset') }.</p>
|
||||||
<p>You have been logged out of all devices and will no longer receive push notifications.
|
<p>{ _t('You have been logged out of all devices and will no longer receive push notifications. To re-enable notifications, sign in again on each device') }.</p>
|
||||||
To re-enable notifications, sign in again on each device.</p>
|
|
||||||
<input className="mx_Login_submit" type="button" onClick={this.props.onComplete}
|
<input className="mx_Login_submit" type="button" onClick={this.props.onComplete}
|
||||||
value="Return to login screen" />
|
value={ _t('Return to login screen') } />
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -191,7 +193,7 @@ module.exports = React.createClass({
|
||||||
resetPasswordJsx = (
|
resetPasswordJsx = (
|
||||||
<div>
|
<div>
|
||||||
<div className="mx_Login_prompt">
|
<div className="mx_Login_prompt">
|
||||||
To reset your password, enter the email address linked to your account:
|
{ _t('To reset your password, enter the email address linked to your account') }:
|
||||||
</div>
|
</div>
|
||||||
<div>
|
<div>
|
||||||
<form onSubmit={this.onSubmitForm}>
|
<form onSubmit={this.onSubmitForm}>
|
||||||
|
@ -199,21 +201,21 @@ module.exports = React.createClass({
|
||||||
name="reset_email" // define a name so browser's password autofill gets less confused
|
name="reset_email" // define a name so browser's password autofill gets less confused
|
||||||
value={this.state.email}
|
value={this.state.email}
|
||||||
onChange={this.onInputChanged.bind(this, "email")}
|
onChange={this.onInputChanged.bind(this, "email")}
|
||||||
placeholder="Email address" autoFocus />
|
placeholder={ _t('Email address') } autoFocus />
|
||||||
<br />
|
<br />
|
||||||
<input className="mx_Login_field" ref="pass" type="password"
|
<input className="mx_Login_field" ref="pass" type="password"
|
||||||
name="reset_password"
|
name="reset_password"
|
||||||
value={this.state.password}
|
value={this.state.password}
|
||||||
onChange={this.onInputChanged.bind(this, "password")}
|
onChange={this.onInputChanged.bind(this, "password")}
|
||||||
placeholder="New password" />
|
placeholder={ _t('New password') } />
|
||||||
<br />
|
<br />
|
||||||
<input className="mx_Login_field" ref="pass" type="password"
|
<input className="mx_Login_field" ref="pass" type="password"
|
||||||
name="reset_password_confirm"
|
name="reset_password_confirm"
|
||||||
value={this.state.password2}
|
value={this.state.password2}
|
||||||
onChange={this.onInputChanged.bind(this, "password2")}
|
onChange={this.onInputChanged.bind(this, "password2")}
|
||||||
placeholder="Confirm your new password" />
|
placeholder={ _t('Confirm your new password') } />
|
||||||
<br />
|
<br />
|
||||||
<input className="mx_Login_submit" type="submit" value="Send Reset Email" />
|
<input className="mx_Login_submit" type="submit" value={ _t('Send Reset Email') } />
|
||||||
</form>
|
</form>
|
||||||
<ServerConfig ref="serverConfig"
|
<ServerConfig ref="serverConfig"
|
||||||
withToggleButton={true}
|
withToggleButton={true}
|
||||||
|
@ -227,10 +229,10 @@ module.exports = React.createClass({
|
||||||
<div className="mx_Login_error">
|
<div className="mx_Login_error">
|
||||||
</div>
|
</div>
|
||||||
<a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
|
||||||
Return to login
|
{_t('Return to login screen')}
|
||||||
</a>
|
</a>
|
||||||
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
||||||
Create a new account
|
{ _t('Create an account') }
|
||||||
</a>
|
</a>
|
||||||
<LoginFooter />
|
<LoginFooter />
|
||||||
</div>
|
</div>
|
||||||
|
|
|
@ -18,8 +18,7 @@ limitations under the License.
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import ReactDOM from 'react-dom';
|
import { _t, _tJsx } from '../../../languageHandler';
|
||||||
import url from 'url';
|
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import Login from '../../../Login';
|
import Login from '../../../Login';
|
||||||
|
|
||||||
|
@ -88,7 +87,27 @@ module.exports = React.createClass({
|
||||||
).then((data) => {
|
).then((data) => {
|
||||||
this.props.onLoggedIn(data);
|
this.props.onLoggedIn(data);
|
||||||
}, (error) => {
|
}, (error) => {
|
||||||
this._setStateFromError(error, true);
|
let errorText;
|
||||||
|
|
||||||
|
// Some error strings only apply for logging in
|
||||||
|
const usingEmail = username.indexOf("@") > 0;
|
||||||
|
if (error.httpStatus == 400 && usingEmail) {
|
||||||
|
errorText = _t('This Home Server does not support login using email address.');
|
||||||
|
} else if (error.httpStatus === 401 || error.httpStatus === 403) {
|
||||||
|
errorText = _t('Incorrect username and/or password.');
|
||||||
|
} else {
|
||||||
|
// other errors, not specific to doing a password login
|
||||||
|
errorText = this._errorTextFromError(error);
|
||||||
|
}
|
||||||
|
|
||||||
|
this.setState({
|
||||||
|
errorText: errorText,
|
||||||
|
// 401 would be the sensible status code for 'incorrect password'
|
||||||
|
// but the login API gives a 403 https://matrix.org/jira/browse/SYN-744
|
||||||
|
// mentions this (although the bug is for UI auth which is not this)
|
||||||
|
// We treat both as an incorrect password
|
||||||
|
loginIncorrect: error.httpStatus === 401 || error.httpStatus == 403,
|
||||||
|
});
|
||||||
}).finally(() => {
|
}).finally(() => {
|
||||||
this.setState({
|
this.setState({
|
||||||
busy: false
|
busy: false
|
||||||
|
@ -111,7 +130,16 @@ module.exports = React.createClass({
|
||||||
this._loginLogic.loginAsGuest().then(function(data) {
|
this._loginLogic.loginAsGuest().then(function(data) {
|
||||||
self.props.onLoggedIn(data);
|
self.props.onLoggedIn(data);
|
||||||
}, function(error) {
|
}, function(error) {
|
||||||
self._setStateFromError(error, true);
|
let errorText;
|
||||||
|
if (error.httpStatus === 403) {
|
||||||
|
errorText = _t("Guest access is disabled on this Home Server.");
|
||||||
|
} else {
|
||||||
|
errorText = self._errorTextFromError(error);
|
||||||
|
}
|
||||||
|
self.setState({
|
||||||
|
errorText: errorText,
|
||||||
|
loginIncorrect: false,
|
||||||
|
});
|
||||||
}).finally(function() {
|
}).finally(function() {
|
||||||
self.setState({
|
self.setState({
|
||||||
busy: false
|
busy: false
|
||||||
|
@ -130,7 +158,7 @@ module.exports = React.createClass({
|
||||||
onPhoneNumberChanged: function(phoneNumber) {
|
onPhoneNumberChanged: function(phoneNumber) {
|
||||||
// Validate the phone number entered
|
// Validate the phone number entered
|
||||||
if (!PHONE_NUMBER_REGEX.test(phoneNumber)) {
|
if (!PHONE_NUMBER_REGEX.test(phoneNumber)) {
|
||||||
this.setState({ errorText: 'The phone number entered looks invalid' });
|
this.setState({ errorText: _t('The phone number entered looks invalid') });
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -184,53 +212,48 @@ module.exports = React.createClass({
|
||||||
currentFlow: self._getCurrentFlowStep(),
|
currentFlow: self._getCurrentFlowStep(),
|
||||||
});
|
});
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
self._setStateFromError(err, false);
|
self.setState({
|
||||||
|
errorText: self._errorTextFromError(err),
|
||||||
|
loginIncorrect: false,
|
||||||
|
});
|
||||||
}).finally(function() {
|
}).finally(function() {
|
||||||
self.setState({
|
self.setState({
|
||||||
busy: false,
|
busy: false,
|
||||||
});
|
});
|
||||||
});
|
}).done();
|
||||||
},
|
},
|
||||||
|
|
||||||
_getCurrentFlowStep: function() {
|
_getCurrentFlowStep: function() {
|
||||||
return this._loginLogic ? this._loginLogic.getCurrentFlowStep() : null;
|
return this._loginLogic ? this._loginLogic.getCurrentFlowStep() : null;
|
||||||
},
|
},
|
||||||
|
|
||||||
_setStateFromError: function(err, isLoginAttempt) {
|
|
||||||
this.setState({
|
|
||||||
errorText: this._errorTextFromError(err),
|
|
||||||
// https://matrix.org/jira/browse/SYN-744
|
|
||||||
loginIncorrect: isLoginAttempt && (err.httpStatus == 401 || err.httpStatus == 403)
|
|
||||||
});
|
|
||||||
},
|
|
||||||
|
|
||||||
_errorTextFromError(err) {
|
_errorTextFromError(err) {
|
||||||
if (err.friendlyText) {
|
|
||||||
return err.friendlyText;
|
|
||||||
}
|
|
||||||
|
|
||||||
let errCode = err.errcode;
|
let errCode = err.errcode;
|
||||||
if (!errCode && err.httpStatus) {
|
if (!errCode && err.httpStatus) {
|
||||||
errCode = "HTTP " + err.httpStatus;
|
errCode = "HTTP " + err.httpStatus;
|
||||||
}
|
}
|
||||||
|
|
||||||
let errorText = "Error: Problem communicating with the given homeserver " +
|
let errorText = _t("Error: Problem communicating with the given homeserver.") +
|
||||||
(errCode ? "(" + errCode + ")" : "");
|
(errCode ? " (" + errCode + ")" : "");
|
||||||
|
|
||||||
if (err.cors === 'rejected') {
|
if (err.cors === 'rejected') {
|
||||||
if (window.location.protocol === 'https:' &&
|
if (window.location.protocol === 'https:' &&
|
||||||
(this.state.enteredHomeserverUrl.startsWith("http:") ||
|
(this.state.enteredHomeserverUrl.startsWith("http:") ||
|
||||||
!this.state.enteredHomeserverUrl.startsWith("http")))
|
!this.state.enteredHomeserverUrl.startsWith("http"))
|
||||||
{
|
) {
|
||||||
errorText = <span>
|
errorText = <span>
|
||||||
Can't connect to homeserver via HTTP when an HTTPS URL is in your browser bar.
|
{ _tJsx("Can't connect to homeserver via HTTP when an HTTPS URL is in your browser bar. " +
|
||||||
Either use HTTPS or <a href='https://www.google.com/search?&q=enable%20unsafe%20scripts'>enable unsafe scripts</a>
|
"Either use HTTPS or <a>enable unsafe scripts</a>.",
|
||||||
|
/<a>(.*?)<\/a>/,
|
||||||
|
(sub) => { return <a href="https://www.google.com/search?&q=enable%20unsafe%20scripts">{ sub }</a>; }
|
||||||
|
)}
|
||||||
</span>;
|
</span>;
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
errorText = <span>
|
errorText = <span>
|
||||||
Can't connect to homeserver - please check your connectivity and ensure
|
{ _tJsx("Can't connect to homeserver - please check your connectivity, ensure your <a>homeserver's SSL certificate</a> is trusted, and that a browser extension is not blocking requests.",
|
||||||
your <a href={ this.state.enteredHomeserverUrl }>homeserver's SSL certificate</a> is trusted.
|
/<a>(.*?)<\/a>/,
|
||||||
|
(sub) => { return <a href={this.state.enteredHomeserverUrl}>{ sub }</a>; }
|
||||||
|
)}
|
||||||
</span>;
|
</span>;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -242,12 +265,6 @@ module.exports = React.createClass({
|
||||||
switch (step) {
|
switch (step) {
|
||||||
case 'm.login.password':
|
case 'm.login.password':
|
||||||
const PasswordLogin = sdk.getComponent('login.PasswordLogin');
|
const PasswordLogin = sdk.getComponent('login.PasswordLogin');
|
||||||
// HSs that are not matrix.org may not be configured to have their
|
|
||||||
// domain name === domain part.
|
|
||||||
let hsDomain = url.parse(this.state.enteredHomeserverUrl).hostname;
|
|
||||||
if (hsDomain !== 'matrix.org') {
|
|
||||||
hsDomain = null;
|
|
||||||
}
|
|
||||||
return (
|
return (
|
||||||
<PasswordLogin
|
<PasswordLogin
|
||||||
onSubmit={this.onPasswordLogin}
|
onSubmit={this.onPasswordLogin}
|
||||||
|
@ -259,7 +276,6 @@ module.exports = React.createClass({
|
||||||
onPhoneNumberChanged={this.onPhoneNumberChanged}
|
onPhoneNumberChanged={this.onPhoneNumberChanged}
|
||||||
onForgotPasswordClick={this.props.onForgotPasswordClick}
|
onForgotPasswordClick={this.props.onForgotPasswordClick}
|
||||||
loginIncorrect={this.state.loginIncorrect}
|
loginIncorrect={this.state.loginIncorrect}
|
||||||
hsDomain={hsDomain}
|
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
case 'm.login.cas':
|
case 'm.login.cas':
|
||||||
|
@ -273,8 +289,7 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
return (
|
return (
|
||||||
<div>
|
<div>
|
||||||
Sorry, this homeserver is using a login which is not
|
{ _t('Sorry, this homeserver is using a login which is not recognised ')}({step})
|
||||||
recognised ({step})
|
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -291,7 +306,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.enableGuest) {
|
if (this.props.enableGuest) {
|
||||||
loginAsGuestJsx =
|
loginAsGuestJsx =
|
||||||
<a className="mx_Login_create" onClick={this._onLoginAsGuestClick} href="#">
|
<a className="mx_Login_create" onClick={this._onLoginAsGuestClick} href="#">
|
||||||
Login as guest
|
{ _t('Login as guest')}
|
||||||
</a>;
|
</a>;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -299,7 +314,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.onCancelClick) {
|
if (this.props.onCancelClick) {
|
||||||
returnToAppJsx =
|
returnToAppJsx =
|
||||||
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
||||||
Return to app
|
{ _t('Return to app')}
|
||||||
</a>;
|
</a>;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -308,7 +323,7 @@ module.exports = React.createClass({
|
||||||
<div className="mx_Login_box">
|
<div className="mx_Login_box">
|
||||||
<LoginHeader />
|
<LoginHeader />
|
||||||
<div>
|
<div>
|
||||||
<h2>Sign in
|
<h2>{ _t('Sign in')}
|
||||||
{ loader }
|
{ loader }
|
||||||
</h2>
|
</h2>
|
||||||
{ this.componentForStep(this.state.currentFlow) }
|
{ this.componentForStep(this.state.currentFlow) }
|
||||||
|
@ -324,7 +339,7 @@ module.exports = React.createClass({
|
||||||
{ this.state.errorText }
|
{ this.state.errorText }
|
||||||
</div>
|
</div>
|
||||||
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
||||||
Create a new account
|
{ _t('Create an account')}
|
||||||
</a>
|
</a>
|
||||||
{ loginAsGuestJsx }
|
{ loginAsGuestJsx }
|
||||||
{ returnToAppJsx }
|
{ returnToAppJsx }
|
||||||
|
|
|
@ -16,9 +16,10 @@ limitations under the License.
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require('react');
|
import React from 'react';
|
||||||
var sdk = require('../../../index');
|
import sdk from '../../../index';
|
||||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'PostRegistration',
|
displayName: 'PostRegistration',
|
||||||
|
@ -49,7 +50,7 @@ module.exports = React.createClass({
|
||||||
});
|
});
|
||||||
}, function(error) {
|
}, function(error) {
|
||||||
self.setState({
|
self.setState({
|
||||||
errorString: "Failed to fetch avatar URL",
|
errorString: _t("Failed to fetch avatar URL"),
|
||||||
busy: false
|
busy: false
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
|
@ -64,12 +65,12 @@ module.exports = React.createClass({
|
||||||
<div className="mx_Login_box">
|
<div className="mx_Login_box">
|
||||||
<LoginHeader />
|
<LoginHeader />
|
||||||
<div className="mx_Login_profile">
|
<div className="mx_Login_profile">
|
||||||
Set a display name:
|
{ _t('Set a display name:') }
|
||||||
<ChangeDisplayName />
|
<ChangeDisplayName />
|
||||||
Upload an avatar:
|
{ _t('Upload an avatar:') }
|
||||||
<ChangeAvatar
|
<ChangeAvatar
|
||||||
initialAvatarUrl={this.state.avatarUrl} />
|
initialAvatarUrl={this.state.avatarUrl} />
|
||||||
<button onClick={this.props.onComplete}>Continue</button>
|
<button onClick={this.props.onComplete}>{ _t('Continue') }</button>
|
||||||
{this.state.errorString}
|
{this.state.errorString}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
|
@ -21,12 +21,11 @@ import q from 'q';
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import dis from '../../../dispatcher';
|
|
||||||
import ServerConfig from '../../views/login/ServerConfig';
|
import ServerConfig from '../../views/login/ServerConfig';
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import RegistrationForm from '../../views/login/RegistrationForm';
|
import RegistrationForm from '../../views/login/RegistrationForm';
|
||||||
import CaptchaForm from '../../views/login/CaptchaForm';
|
|
||||||
import RtsClient from '../../../RtsClient';
|
import RtsClient from '../../../RtsClient';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
const MIN_PASSWORD_LENGTH = 6;
|
const MIN_PASSWORD_LENGTH = 6;
|
||||||
|
|
||||||
|
@ -46,8 +45,6 @@ module.exports = React.createClass({
|
||||||
brand: React.PropTypes.string,
|
brand: React.PropTypes.string,
|
||||||
email: React.PropTypes.string,
|
email: React.PropTypes.string,
|
||||||
referrer: React.PropTypes.string,
|
referrer: React.PropTypes.string,
|
||||||
username: React.PropTypes.string,
|
|
||||||
guestAccessToken: React.PropTypes.string,
|
|
||||||
teamServerConfig: React.PropTypes.shape({
|
teamServerConfig: React.PropTypes.shape({
|
||||||
// Email address to request new teams
|
// Email address to request new teams
|
||||||
supportEmail: React.PropTypes.string.isRequired,
|
supportEmail: React.PropTypes.string.isRequired,
|
||||||
|
@ -98,7 +95,7 @@ module.exports = React.createClass({
|
||||||
this.props.teamServerConfig.teamServerURL &&
|
this.props.teamServerConfig.teamServerURL &&
|
||||||
!this._rtsClient
|
!this._rtsClient
|
||||||
) {
|
) {
|
||||||
this._rtsClient = new RtsClient(this.props.teamServerConfig.teamServerURL);
|
this._rtsClient = this.props.rtsClient || new RtsClient(this.props.teamServerConfig.teamServerURL);
|
||||||
|
|
||||||
this.setState({
|
this.setState({
|
||||||
teamServerBusy: true,
|
teamServerBusy: true,
|
||||||
|
@ -162,7 +159,7 @@ module.exports = React.createClass({
|
||||||
msisdn_available |= flow.stages.indexOf('m.login.msisdn') > -1;
|
msisdn_available |= flow.stages.indexOf('m.login.msisdn') > -1;
|
||||||
}
|
}
|
||||||
if (!msisdn_available) {
|
if (!msisdn_available) {
|
||||||
msg = "This server does not support authentication with a phone number";
|
msg = _t('This server does not support authentication with a phone number.');
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
this.setState({
|
this.setState({
|
||||||
|
@ -221,30 +218,29 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
|
|
||||||
trackPromise.then((teamToken) => {
|
trackPromise.then((teamToken) => {
|
||||||
console.info('Team token promise',teamToken);
|
return this.props.onLoggedIn({
|
||||||
this.props.onLoggedIn({
|
|
||||||
userId: response.user_id,
|
userId: response.user_id,
|
||||||
deviceId: response.device_id,
|
deviceId: response.device_id,
|
||||||
homeserverUrl: this._matrixClient.getHomeserverUrl(),
|
homeserverUrl: this._matrixClient.getHomeserverUrl(),
|
||||||
identityServerUrl: this._matrixClient.getIdentityServerUrl(),
|
identityServerUrl: this._matrixClient.getIdentityServerUrl(),
|
||||||
accessToken: response.access_token
|
accessToken: response.access_token
|
||||||
}, teamToken);
|
}, teamToken);
|
||||||
}).then(() => {
|
}).then((cli) => {
|
||||||
return this._setupPushers();
|
return this._setupPushers(cli);
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
_setupPushers: function() {
|
_setupPushers: function(matrixClient) {
|
||||||
if (!this.props.brand) {
|
if (!this.props.brand) {
|
||||||
return q();
|
return q();
|
||||||
}
|
}
|
||||||
return MatrixClientPeg.get().getPushers().then((resp)=>{
|
return matrixClient.getPushers().then((resp)=>{
|
||||||
const pushers = resp.pushers;
|
const pushers = resp.pushers;
|
||||||
for (let i = 0; i < pushers.length; ++i) {
|
for (let i = 0; i < pushers.length; ++i) {
|
||||||
if (pushers[i].kind == 'email') {
|
if (pushers[i].kind == 'email') {
|
||||||
const emailPusher = pushers[i];
|
const emailPusher = pushers[i];
|
||||||
emailPusher.data = { brand: this.props.brand };
|
emailPusher.data = { brand: this.props.brand };
|
||||||
MatrixClientPeg.get().setPusher(emailPusher).done(() => {
|
matrixClient.setPusher(emailPusher).done(() => {
|
||||||
console.log("Set email branding to " + this.props.brand);
|
console.log("Set email branding to " + this.props.brand);
|
||||||
}, (error) => {
|
}, (error) => {
|
||||||
console.error("Couldn't set email branding: " + error);
|
console.error("Couldn't set email branding: " + error);
|
||||||
|
@ -260,29 +256,29 @@ module.exports = React.createClass({
|
||||||
var errMsg;
|
var errMsg;
|
||||||
switch (errCode) {
|
switch (errCode) {
|
||||||
case "RegistrationForm.ERR_PASSWORD_MISSING":
|
case "RegistrationForm.ERR_PASSWORD_MISSING":
|
||||||
errMsg = "Missing password.";
|
errMsg = _t('Missing password.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_PASSWORD_MISMATCH":
|
case "RegistrationForm.ERR_PASSWORD_MISMATCH":
|
||||||
errMsg = "Passwords don't match.";
|
errMsg = _t('Passwords don\'t match.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_PASSWORD_LENGTH":
|
case "RegistrationForm.ERR_PASSWORD_LENGTH":
|
||||||
errMsg = `Password too short (min ${MIN_PASSWORD_LENGTH}).`;
|
errMsg = _t('Password too short (min %(MIN_PASSWORD_LENGTH)s).', {MIN_PASSWORD_LENGTH: MIN_PASSWORD_LENGTH});
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_EMAIL_INVALID":
|
case "RegistrationForm.ERR_EMAIL_INVALID":
|
||||||
errMsg = "This doesn't look like a valid email address";
|
errMsg = _t('This doesn\'t look like a valid email address.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_PHONE_NUMBER_INVALID":
|
case "RegistrationForm.ERR_PHONE_NUMBER_INVALID":
|
||||||
errMsg = "This doesn't look like a valid phone number";
|
errMsg = _t('This doesn\'t look like a valid phone number.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_USERNAME_INVALID":
|
case "RegistrationForm.ERR_USERNAME_INVALID":
|
||||||
errMsg = "User names may only contain letters, numbers, dots, hyphens and underscores.";
|
errMsg = _t('User names may only contain letters, numbers, dots, hyphens and underscores.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_USERNAME_BLANK":
|
case "RegistrationForm.ERR_USERNAME_BLANK":
|
||||||
errMsg = "You need to enter a user name";
|
errMsg = _t('You need to enter a user name.');
|
||||||
break;
|
break;
|
||||||
default:
|
default:
|
||||||
console.error("Unknown error code: %s", errCode);
|
console.error("Unknown error code: %s", errCode);
|
||||||
errMsg = "An unknown error occurred.";
|
errMsg = _t('An unknown error occurred.');
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
this.setState({
|
this.setState({
|
||||||
|
@ -297,17 +293,6 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
_makeRegisterRequest: function(auth) {
|
_makeRegisterRequest: function(auth) {
|
||||||
let guestAccessToken = this.props.guestAccessToken;
|
|
||||||
|
|
||||||
if (
|
|
||||||
this.state.formVals.username !== this.props.username ||
|
|
||||||
this.state.hsUrl != this.props.defaultHsUrl
|
|
||||||
) {
|
|
||||||
// don't try to upgrade if we changed our username
|
|
||||||
// or are registering on a different HS
|
|
||||||
guestAccessToken = null;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Only send the bind params if we're sending username / pw params
|
// Only send the bind params if we're sending username / pw params
|
||||||
// (Since we need to send no params at all to use the ones saved in the
|
// (Since we need to send no params at all to use the ones saved in the
|
||||||
// session).
|
// session).
|
||||||
|
@ -322,7 +307,7 @@ module.exports = React.createClass({
|
||||||
undefined, // session id: included in the auth dict already
|
undefined, // session id: included in the auth dict already
|
||||||
auth,
|
auth,
|
||||||
bindThreepids,
|
bindThreepids,
|
||||||
guestAccessToken,
|
null,
|
||||||
);
|
);
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -359,10 +344,6 @@ module.exports = React.createClass({
|
||||||
} else if (this.state.busy || this.state.teamServerBusy) {
|
} else if (this.state.busy || this.state.teamServerBusy) {
|
||||||
registerBody = <Spinner />;
|
registerBody = <Spinner />;
|
||||||
} else {
|
} else {
|
||||||
let guestUsername = this.props.username;
|
|
||||||
if (this.state.hsUrl != this.props.defaultHsUrl) {
|
|
||||||
guestUsername = null;
|
|
||||||
}
|
|
||||||
let errorSection;
|
let errorSection;
|
||||||
if (this.state.errorText) {
|
if (this.state.errorText) {
|
||||||
errorSection = <div className="mx_Login_error">{this.state.errorText}</div>;
|
errorSection = <div className="mx_Login_error">{this.state.errorText}</div>;
|
||||||
|
@ -376,7 +357,6 @@ module.exports = React.createClass({
|
||||||
defaultPhoneNumber={this.state.formVals.phoneNumber}
|
defaultPhoneNumber={this.state.formVals.phoneNumber}
|
||||||
defaultPassword={this.state.formVals.password}
|
defaultPassword={this.state.formVals.password}
|
||||||
teamsConfig={this.state.teamsConfig}
|
teamsConfig={this.state.teamsConfig}
|
||||||
guestUsername={guestUsername}
|
|
||||||
minPasswordLength={MIN_PASSWORD_LENGTH}
|
minPasswordLength={MIN_PASSWORD_LENGTH}
|
||||||
onError={this.onFormValidationFailed}
|
onError={this.onFormValidationFailed}
|
||||||
onRegisterClick={this.onFormSubmit}
|
onRegisterClick={this.onFormSubmit}
|
||||||
|
@ -400,7 +380,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.onCancelClick) {
|
if (this.props.onCancelClick) {
|
||||||
returnToAppJsx = (
|
returnToAppJsx = (
|
||||||
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
||||||
Return to app
|
{_t('Return to app')}
|
||||||
</a>
|
</a>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -413,10 +393,10 @@ module.exports = React.createClass({
|
||||||
this.state.teamSelected.domain + "/icon.png" :
|
this.state.teamSelected.domain + "/icon.png" :
|
||||||
null}
|
null}
|
||||||
/>
|
/>
|
||||||
<h2>Create an account</h2>
|
<h2>{_t('Create an account')}</h2>
|
||||||
{registerBody}
|
{registerBody}
|
||||||
<a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
|
||||||
I already have an account
|
{_t('I already have an account')}
|
||||||
</a>
|
</a>
|
||||||
{returnToAppJsx}
|
{returnToAppJsx}
|
||||||
<LoginFooter />
|
<LoginFooter />
|
||||||
|
|
|
@ -32,6 +32,7 @@ module.exports = React.createClass({
|
||||||
urls: React.PropTypes.array, // [highest_priority, ... , lowest_priority]
|
urls: React.PropTypes.array, // [highest_priority, ... , lowest_priority]
|
||||||
width: React.PropTypes.number,
|
width: React.PropTypes.number,
|
||||||
height: React.PropTypes.number,
|
height: React.PropTypes.number,
|
||||||
|
// XXX resizeMethod not actually used.
|
||||||
resizeMethod: React.PropTypes.string,
|
resizeMethod: React.PropTypes.string,
|
||||||
defaultToInitialLetter: React.PropTypes.bool // true to add default url
|
defaultToInitialLetter: React.PropTypes.bool // true to add default url
|
||||||
},
|
},
|
||||||
|
|
|
@ -16,8 +16,8 @@ limitations under the License.
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require('react');
|
import React from 'react';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'CreateRoomButton',
|
displayName: 'CreateRoomButton',
|
||||||
propTypes: {
|
propTypes: {
|
||||||
|
@ -36,7 +36,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
return (
|
return (
|
||||||
<button className="mx_CreateRoomButton" onClick={this.onClick}>Create Room</button>
|
<button className="mx_CreateRoomButton" onClick={this.onClick}>{_t("Create Room")}</button>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
|
|
|
@ -17,6 +17,7 @@ limitations under the License.
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
var Presets = {
|
var Presets = {
|
||||||
PrivateChat: "private_chat",
|
PrivateChat: "private_chat",
|
||||||
|
@ -46,9 +47,9 @@ module.exports = React.createClass({
|
||||||
render: function() {
|
render: function() {
|
||||||
return (
|
return (
|
||||||
<select className="mx_Presets" onChange={this.onValueChanged} value={this.props.preset}>
|
<select className="mx_Presets" onChange={this.onValueChanged} value={this.props.preset}>
|
||||||
<option value={this.Presets.PrivateChat}>Private Chat</option>
|
<option value={this.Presets.PrivateChat}>{_t("Private Chat")}</option>
|
||||||
<option value={this.Presets.PublicChat}>Public Chat</option>
|
<option value={this.Presets.PublicChat}>{_t("Public Chat")}</option>
|
||||||
<option value={this.Presets.Custom}>Custom</option>
|
<option value={this.Presets.Custom}>{_t("Custom")}</option>
|
||||||
</select>
|
</select>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -15,6 +15,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'RoomAlias',
|
displayName: 'RoomAlias',
|
||||||
|
@ -94,7 +95,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
return (
|
return (
|
||||||
<input type="text" className="mx_RoomAlias" placeholder="Alias (optional)"
|
<input type="text" className="mx_RoomAlias" placeholder={_t("Alias (optional)")}
|
||||||
onChange={this.onValueChanged} onFocus={this.onFocus} onBlur={this.onBlur}
|
onChange={this.onValueChanged} onFocus={this.onFocus} onBlur={this.onBlur}
|
||||||
value={this.props.alias}/>
|
value={this.props.alias}/>
|
||||||
);
|
);
|
||||||
|
|
|
@ -47,19 +47,7 @@ export default React.createClass({
|
||||||
children: React.PropTypes.node,
|
children: React.PropTypes.node,
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
_onKeyDown: function(e) {
|
||||||
this.priorActiveElement = document.activeElement;
|
|
||||||
},
|
|
||||||
|
|
||||||
componentWillUnmount: function() {
|
|
||||||
if (this.priorActiveElement !== null) {
|
|
||||||
this.priorActiveElement.focus();
|
|
||||||
}
|
|
||||||
},
|
|
||||||
|
|
||||||
// Must be when the key is released (and not pressed) otherwise componentWillUnmount
|
|
||||||
// will focus another element which will receive future key events
|
|
||||||
_onKeyUp: function(e) {
|
|
||||||
if (e.keyCode === KeyCode.ESCAPE) {
|
if (e.keyCode === KeyCode.ESCAPE) {
|
||||||
e.stopPropagation();
|
e.stopPropagation();
|
||||||
e.preventDefault();
|
e.preventDefault();
|
||||||
|
@ -81,7 +69,7 @@ export default React.createClass({
|
||||||
const TintableSvg = sdk.getComponent("elements.TintableSvg");
|
const TintableSvg = sdk.getComponent("elements.TintableSvg");
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div onKeyUp={this._onKeyUp} className={this.props.className}>
|
<div onKeyDown={this._onKeyDown} className={this.props.className}>
|
||||||
<AccessibleButton onClick={this._onCancelClick}
|
<AccessibleButton onClick={this._onCancelClick}
|
||||||
className="mx_Dialog_cancelButton"
|
className="mx_Dialog_cancelButton"
|
||||||
>
|
>
|
||||||
|
|
|
@ -16,36 +16,30 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import dis from '../../../dispatcher';
|
import { _t } from '../../../languageHandler';
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import DMRoomMap from '../../../utils/DMRoomMap';
|
import DMRoomMap from '../../../utils/DMRoomMap';
|
||||||
import AccessibleButton from '../elements/AccessibleButton';
|
import AccessibleButton from '../elements/AccessibleButton';
|
||||||
import Unread from '../../../Unread';
|
import Unread from '../../../Unread';
|
||||||
import classNames from 'classnames';
|
import classNames from 'classnames';
|
||||||
import createRoom from '../../../createRoom';
|
|
||||||
|
|
||||||
export default class ChatCreateOrReuseDialog extends React.Component {
|
export default class ChatCreateOrReuseDialog extends React.Component {
|
||||||
|
|
||||||
constructor(props) {
|
constructor(props) {
|
||||||
super(props);
|
super(props);
|
||||||
this.onNewDMClick = this.onNewDMClick.bind(this);
|
|
||||||
this.onRoomTileClick = this.onRoomTileClick.bind(this);
|
this.onRoomTileClick = this.onRoomTileClick.bind(this);
|
||||||
|
|
||||||
|
this.state = {
|
||||||
|
tiles: [],
|
||||||
|
profile: {
|
||||||
|
displayName: null,
|
||||||
|
avatarUrl: null,
|
||||||
|
},
|
||||||
|
profileError: null,
|
||||||
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
onNewDMClick() {
|
componentWillMount() {
|
||||||
createRoom({dmUserId: this.props.userId});
|
|
||||||
this.props.onFinished(true);
|
|
||||||
}
|
|
||||||
|
|
||||||
onRoomTileClick(roomId) {
|
|
||||||
dis.dispatch({
|
|
||||||
action: 'view_room',
|
|
||||||
room_id: roomId,
|
|
||||||
});
|
|
||||||
this.props.onFinished(true);
|
|
||||||
}
|
|
||||||
|
|
||||||
render() {
|
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
|
|
||||||
const dmRoomMap = new DMRoomMap(client);
|
const dmRoomMap = new DMRoomMap(client);
|
||||||
|
@ -70,40 +64,123 @@ export default class ChatCreateOrReuseDialog extends React.Component {
|
||||||
highlight={highlight}
|
highlight={highlight}
|
||||||
isInvite={me.membership == "invite"}
|
isInvite={me.membership == "invite"}
|
||||||
onClick={this.onRoomTileClick}
|
onClick={this.onRoomTileClick}
|
||||||
/>
|
/>,
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
const labelClasses = classNames({
|
this.setState({
|
||||||
mx_MemberInfo_createRoom_label: true,
|
tiles: tiles,
|
||||||
mx_RoomTile_name: true,
|
|
||||||
});
|
});
|
||||||
const startNewChat = <AccessibleButton
|
|
||||||
className="mx_MemberInfo_createRoom"
|
if (tiles.length === 0) {
|
||||||
onClick={this.onNewDMClick}
|
this.setState({
|
||||||
>
|
busyProfile: true,
|
||||||
<div className="mx_RoomTile_avatar">
|
});
|
||||||
<img src="img/create-big.svg" width="26" height="26" />
|
MatrixClientPeg.get().getProfileInfo(this.props.userId).done((resp) => {
|
||||||
</div>
|
const profile = {
|
||||||
<div className={labelClasses}><i>Start new chat</i></div>
|
displayName: resp.displayname,
|
||||||
</AccessibleButton>;
|
avatarUrl: null,
|
||||||
|
};
|
||||||
|
if (resp.avatar_url) {
|
||||||
|
profile.avatarUrl = MatrixClientPeg.get().mxcUrlToHttp(
|
||||||
|
resp.avatar_url, 48, 48, "crop",
|
||||||
|
);
|
||||||
|
}
|
||||||
|
this.setState({
|
||||||
|
busyProfile: false,
|
||||||
|
profile: profile,
|
||||||
|
});
|
||||||
|
}, (err) => {
|
||||||
|
console.error(
|
||||||
|
'Unable to get profile for user ' + this.props.userId + ':',
|
||||||
|
err,
|
||||||
|
);
|
||||||
|
this.setState({
|
||||||
|
busyProfile: false,
|
||||||
|
profileError: err,
|
||||||
|
});
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
onRoomTileClick(roomId) {
|
||||||
|
this.props.onExistingRoomSelected(roomId);
|
||||||
|
}
|
||||||
|
|
||||||
|
render() {
|
||||||
|
let title = '';
|
||||||
|
let content = null;
|
||||||
|
if (this.state.tiles.length > 0) {
|
||||||
|
// Show the existing rooms with a "+" to add a new dm
|
||||||
|
title = _t('Create a new chat or reuse an existing one');
|
||||||
|
const labelClasses = classNames({
|
||||||
|
mx_MemberInfo_createRoom_label: true,
|
||||||
|
mx_RoomTile_name: true,
|
||||||
|
});
|
||||||
|
const startNewChat = <AccessibleButton
|
||||||
|
className="mx_MemberInfo_createRoom"
|
||||||
|
onClick={this.props.onNewDMClick}
|
||||||
|
>
|
||||||
|
<div className="mx_RoomTile_avatar">
|
||||||
|
<img src="img/create-big.svg" width="26" height="26" />
|
||||||
|
</div>
|
||||||
|
<div className={labelClasses}><i>{ _t("Start new chat") }</i></div>
|
||||||
|
</AccessibleButton>;
|
||||||
|
content = <div className="mx_Dialog_content">
|
||||||
|
{ _t('You already have existing direct chats with this user:') }
|
||||||
|
<div className="mx_ChatCreateOrReuseDialog_tiles">
|
||||||
|
{ this.state.tiles }
|
||||||
|
{ startNewChat }
|
||||||
|
</div>
|
||||||
|
</div>;
|
||||||
|
} else {
|
||||||
|
// Show the avatar, name and a button to confirm that a new chat is requested
|
||||||
|
const BaseAvatar = sdk.getComponent('avatars.BaseAvatar');
|
||||||
|
const Spinner = sdk.getComponent('elements.Spinner');
|
||||||
|
title = _t('Start chatting');
|
||||||
|
|
||||||
|
let profile = null;
|
||||||
|
if (this.state.busyProfile) {
|
||||||
|
profile = <Spinner />;
|
||||||
|
} else if (this.state.profileError) {
|
||||||
|
profile = <div className="error">
|
||||||
|
Unable to load profile information for { this.props.userId }
|
||||||
|
</div>;
|
||||||
|
} else {
|
||||||
|
profile = <div className="mx_ChatCreateOrReuseDialog_profile">
|
||||||
|
<BaseAvatar
|
||||||
|
name={this.state.profile.displayName || this.props.userId}
|
||||||
|
url={this.state.profile.avatarUrl}
|
||||||
|
width={48} height={48}
|
||||||
|
/>
|
||||||
|
<div className="mx_ChatCreateOrReuseDialog_profile_name">
|
||||||
|
{this.state.profile.displayName || this.props.userId}
|
||||||
|
</div>
|
||||||
|
</div>;
|
||||||
|
}
|
||||||
|
content = <div>
|
||||||
|
<div className="mx_Dialog_content">
|
||||||
|
<p>
|
||||||
|
{ _t('Click on the button below to start chatting!') }
|
||||||
|
</p>
|
||||||
|
{ profile }
|
||||||
|
</div>
|
||||||
|
<div className="mx_Dialog_buttons">
|
||||||
|
<button className="mx_Dialog_primary" onClick={this.props.onNewDMClick}>
|
||||||
|
{ _t('Start Chatting') }
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
</div>;
|
||||||
|
}
|
||||||
|
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
return (
|
return (
|
||||||
<BaseDialog className='mx_ChatCreateOrReuseDialog'
|
<BaseDialog className='mx_ChatCreateOrReuseDialog'
|
||||||
onFinished={() => {
|
onFinished={ this.props.onFinished.bind(false) }
|
||||||
this.props.onFinished(false)
|
title={title}
|
||||||
}}
|
|
||||||
title='Create a new chat or reuse an existing one'
|
|
||||||
>
|
>
|
||||||
<div className="mx_Dialog_content">
|
{ content }
|
||||||
You already have existing direct chats with this user:
|
|
||||||
<div className="mx_ChatCreateOrReuseDialog_tiles">
|
|
||||||
{tiles}
|
|
||||||
{startNewChat}
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
</BaseDialog>
|
</BaseDialog>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -111,5 +188,8 @@ export default class ChatCreateOrReuseDialog extends React.Component {
|
||||||
|
|
||||||
ChatCreateOrReuseDialog.propTyps = {
|
ChatCreateOrReuseDialog.propTyps = {
|
||||||
userId: React.PropTypes.string.isRequired,
|
userId: React.PropTypes.string.isRequired,
|
||||||
|
// Called when clicking outside of the dialog
|
||||||
onFinished: React.PropTypes.func.isRequired,
|
onFinished: React.PropTypes.func.isRequired,
|
||||||
|
onNewDMClick: React.PropTypes.func.isRequired,
|
||||||
|
onExistingRoomSelected: React.PropTypes.func.isRequired,
|
||||||
};
|
};
|
||||||
|
|
|
@ -15,25 +15,24 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import classNames from 'classnames';
|
import { _t } from '../../../languageHandler';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import { getAddressType, inviteMultipleToRoom } from '../../../Invite';
|
import { getAddressType, inviteMultipleToRoom } from '../../../Invite';
|
||||||
import createRoom from '../../../createRoom';
|
import createRoom from '../../../createRoom';
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import DMRoomMap from '../../../utils/DMRoomMap';
|
import DMRoomMap from '../../../utils/DMRoomMap';
|
||||||
import rate_limited_func from '../../../ratelimitedfunc';
|
|
||||||
import dis from '../../../dispatcher';
|
|
||||||
import Modal from '../../../Modal';
|
import Modal from '../../../Modal';
|
||||||
import AccessibleButton from '../elements/AccessibleButton';
|
import AccessibleButton from '../elements/AccessibleButton';
|
||||||
import q from 'q';
|
import q from 'q';
|
||||||
import Fuse from 'fuse.js';
|
import dis from '../../../dispatcher';
|
||||||
|
|
||||||
const TRUNCATE_QUERY_LIST = 40;
|
const TRUNCATE_QUERY_LIST = 40;
|
||||||
|
const QUERY_USER_DIRECTORY_DEBOUNCE_MS = 200;
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: "ChatInviteDialog",
|
displayName: "ChatInviteDialog",
|
||||||
propTypes: {
|
propTypes: {
|
||||||
title: React.PropTypes.string,
|
title: React.PropTypes.string.isRequired,
|
||||||
description: React.PropTypes.oneOfType([
|
description: React.PropTypes.oneOfType([
|
||||||
React.PropTypes.element,
|
React.PropTypes.element,
|
||||||
React.PropTypes.string,
|
React.PropTypes.string,
|
||||||
|
@ -43,17 +42,13 @@ module.exports = React.createClass({
|
||||||
roomId: React.PropTypes.string,
|
roomId: React.PropTypes.string,
|
||||||
button: React.PropTypes.string,
|
button: React.PropTypes.string,
|
||||||
focus: React.PropTypes.bool,
|
focus: React.PropTypes.bool,
|
||||||
onFinished: React.PropTypes.func.isRequired
|
onFinished: React.PropTypes.func.isRequired,
|
||||||
},
|
},
|
||||||
|
|
||||||
getDefaultProps: function() {
|
getDefaultProps: function() {
|
||||||
return {
|
return {
|
||||||
title: "Start a chat",
|
|
||||||
description: "Who would you like to communicate with?",
|
|
||||||
value: "",
|
value: "",
|
||||||
placeholder: "Email, name or matrix ID",
|
focus: true,
|
||||||
button: "Start Chat",
|
|
||||||
focus: true
|
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -61,12 +56,20 @@ module.exports = React.createClass({
|
||||||
return {
|
return {
|
||||||
error: false,
|
error: false,
|
||||||
|
|
||||||
// List of AddressTile.InviteAddressType objects represeting
|
// List of AddressTile.InviteAddressType objects representing
|
||||||
// the list of addresses we're going to invite
|
// the list of addresses we're going to invite
|
||||||
inviteList: [],
|
inviteList: [],
|
||||||
|
|
||||||
// List of AddressTile.InviteAddressType objects represeting
|
// Whether a search is ongoing
|
||||||
// the set of autocompletion results for the current search
|
busy: false,
|
||||||
|
// An error message generated during the user directory search
|
||||||
|
searchError: null,
|
||||||
|
// Whether the server supports the user_directory API
|
||||||
|
serverSupportsUserDirectory: true,
|
||||||
|
// The query being searched for
|
||||||
|
query: "",
|
||||||
|
// List of AddressTile.InviteAddressType objects representing
|
||||||
|
// the set of auto-completion results for the current search
|
||||||
// query.
|
// query.
|
||||||
queryList: [],
|
queryList: [],
|
||||||
};
|
};
|
||||||
|
@ -77,20 +80,6 @@ module.exports = React.createClass({
|
||||||
// Set the cursor at the end of the text input
|
// Set the cursor at the end of the text input
|
||||||
this.refs.textinput.value = this.props.value;
|
this.refs.textinput.value = this.props.value;
|
||||||
}
|
}
|
||||||
// Create a Fuse instance for fuzzy searching this._userList
|
|
||||||
this._fuse = new Fuse(
|
|
||||||
// Use an empty list at first that will later be populated
|
|
||||||
// (see this._updateUserList)
|
|
||||||
[],
|
|
||||||
{
|
|
||||||
shouldSort: true,
|
|
||||||
location: 0, // The index of the query in the test string
|
|
||||||
distance: 5, // The distance away from location the query can be
|
|
||||||
// 0.0 = exact match, 1.0 = match anything
|
|
||||||
threshold: 0.3,
|
|
||||||
}
|
|
||||||
);
|
|
||||||
this._updateUserList();
|
|
||||||
},
|
},
|
||||||
|
|
||||||
onButtonClick: function() {
|
onButtonClick: function() {
|
||||||
|
@ -112,17 +101,28 @@ module.exports = React.createClass({
|
||||||
// A Direct Message room already exists for this user, so select a
|
// A Direct Message room already exists for this user, so select a
|
||||||
// room from a list that is similar to the one in MemberInfo panel
|
// room from a list that is similar to the one in MemberInfo panel
|
||||||
const ChatCreateOrReuseDialog = sdk.getComponent(
|
const ChatCreateOrReuseDialog = sdk.getComponent(
|
||||||
"views.dialogs.ChatCreateOrReuseDialog"
|
"views.dialogs.ChatCreateOrReuseDialog",
|
||||||
);
|
);
|
||||||
Modal.createDialog(ChatCreateOrReuseDialog, {
|
const close = Modal.createDialog(ChatCreateOrReuseDialog, {
|
||||||
userId: userId,
|
userId: userId,
|
||||||
onFinished: (success) => {
|
onFinished: (success) => {
|
||||||
if (success) {
|
this.props.onFinished(success);
|
||||||
this.props.onFinished(true, inviteList[0]);
|
},
|
||||||
}
|
onNewDMClick: () => {
|
||||||
// else show this ChatInviteDialog again
|
dis.dispatch({
|
||||||
}
|
action: 'start_chat',
|
||||||
});
|
user_id: userId,
|
||||||
|
});
|
||||||
|
close(true);
|
||||||
|
},
|
||||||
|
onExistingRoomSelected: (roomId) => {
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'view_room',
|
||||||
|
room_id: roomId,
|
||||||
|
});
|
||||||
|
close(true);
|
||||||
|
},
|
||||||
|
}).close;
|
||||||
} else {
|
} else {
|
||||||
this._startChat(inviteList);
|
this._startChat(inviteList);
|
||||||
}
|
}
|
||||||
|
@ -148,15 +148,15 @@ module.exports = React.createClass({
|
||||||
} else if (e.keyCode === 38) { // up arrow
|
} else if (e.keyCode === 38) { // up arrow
|
||||||
e.stopPropagation();
|
e.stopPropagation();
|
||||||
e.preventDefault();
|
e.preventDefault();
|
||||||
this.addressSelector.moveSelectionUp();
|
if (this.addressSelector) this.addressSelector.moveSelectionUp();
|
||||||
} else if (e.keyCode === 40) { // down arrow
|
} else if (e.keyCode === 40) { // down arrow
|
||||||
e.stopPropagation();
|
e.stopPropagation();
|
||||||
e.preventDefault();
|
e.preventDefault();
|
||||||
this.addressSelector.moveSelectionDown();
|
if (this.addressSelector) this.addressSelector.moveSelectionDown();
|
||||||
} else if (this.state.queryList.length > 0 && (e.keyCode === 188 || e.keyCode === 13 || e.keyCode === 9)) { // comma or enter or tab
|
} else if (this.state.queryList.length > 0 && (e.keyCode === 188 || e.keyCode === 13 || e.keyCode === 9)) { // comma or enter or tab
|
||||||
e.stopPropagation();
|
e.stopPropagation();
|
||||||
e.preventDefault();
|
e.preventDefault();
|
||||||
this.addressSelector.chooseSelection();
|
if (this.addressSelector) this.addressSelector.chooseSelection();
|
||||||
} else if (this.refs.textinput.value.length === 0 && this.state.inviteList.length && e.keyCode === 8) { // backspace
|
} else if (this.refs.textinput.value.length === 0 && this.state.inviteList.length && e.keyCode === 8) { // backspace
|
||||||
e.stopPropagation();
|
e.stopPropagation();
|
||||||
e.preventDefault();
|
e.preventDefault();
|
||||||
|
@ -179,71 +179,36 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
onQueryChanged: function(ev) {
|
onQueryChanged: function(ev) {
|
||||||
const query = ev.target.value;
|
const query = ev.target.value;
|
||||||
let queryList = [];
|
|
||||||
|
|
||||||
if (query.length < 2) {
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
if (this.queryChangedDebouncer) {
|
if (this.queryChangedDebouncer) {
|
||||||
clearTimeout(this.queryChangedDebouncer);
|
clearTimeout(this.queryChangedDebouncer);
|
||||||
}
|
}
|
||||||
this.queryChangedDebouncer = setTimeout(() => {
|
// Only do search if there is something to search
|
||||||
// Only do search if there is something to search
|
if (query.length > 0 && query != '@' && query.length >= 2) {
|
||||||
if (query.length > 0 && query != '@') {
|
this.queryChangedDebouncer = setTimeout(() => {
|
||||||
// Weighted keys prefer to match userIds when first char is @
|
if (this.state.serverSupportsUserDirectory) {
|
||||||
this._fuse.options.keys = [{
|
this._doUserDirectorySearch(query);
|
||||||
name: 'displayName',
|
} else {
|
||||||
weight: query[0] === '@' ? 0.1 : 0.9,
|
this._doLocalSearch(query);
|
||||||
},{
|
|
||||||
name: 'userId',
|
|
||||||
weight: query[0] === '@' ? 0.9 : 0.1,
|
|
||||||
}];
|
|
||||||
queryList = this._fuse.search(query).map((user) => {
|
|
||||||
// Return objects, structure of which is defined
|
|
||||||
// by InviteAddressType
|
|
||||||
return {
|
|
||||||
addressType: 'mx',
|
|
||||||
address: user.userId,
|
|
||||||
displayName: user.displayName,
|
|
||||||
avatarMxc: user.avatarUrl,
|
|
||||||
isKnown: true,
|
|
||||||
}
|
|
||||||
});
|
|
||||||
|
|
||||||
// If the query is a valid address, add an entry for that
|
|
||||||
// This is important, otherwise there's no way to invite
|
|
||||||
// a perfectly valid address if there are close matches.
|
|
||||||
const addrType = getAddressType(query);
|
|
||||||
if (addrType !== null) {
|
|
||||||
queryList.unshift({
|
|
||||||
addressType: addrType,
|
|
||||||
address: query,
|
|
||||||
isKnown: false,
|
|
||||||
});
|
|
||||||
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
|
||||||
if (addrType == 'email') {
|
|
||||||
this._lookupThreepid(addrType, query).done();
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
}, QUERY_USER_DIRECTORY_DEBOUNCE_MS);
|
||||||
|
} else {
|
||||||
this.setState({
|
this.setState({
|
||||||
queryList: queryList,
|
queryList: [],
|
||||||
error: false,
|
query: "",
|
||||||
}, () => {
|
searchError: null,
|
||||||
this.addressSelector.moveSelectionTop();
|
|
||||||
});
|
});
|
||||||
}, 200);
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
onDismissed: function(index) {
|
onDismissed: function(index) {
|
||||||
var self = this;
|
var self = this;
|
||||||
return function() {
|
return () => {
|
||||||
var inviteList = self.state.inviteList.slice();
|
var inviteList = self.state.inviteList.slice();
|
||||||
inviteList.splice(index, 1);
|
inviteList.splice(index, 1);
|
||||||
self.setState({
|
self.setState({
|
||||||
inviteList: inviteList,
|
inviteList: inviteList,
|
||||||
queryList: [],
|
queryList: [],
|
||||||
|
query: "",
|
||||||
});
|
});
|
||||||
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
||||||
};
|
};
|
||||||
|
@ -262,10 +227,109 @@ module.exports = React.createClass({
|
||||||
this.setState({
|
this.setState({
|
||||||
inviteList: inviteList,
|
inviteList: inviteList,
|
||||||
queryList: [],
|
queryList: [],
|
||||||
|
query: "",
|
||||||
});
|
});
|
||||||
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
||||||
},
|
},
|
||||||
|
|
||||||
|
_doUserDirectorySearch: function(query) {
|
||||||
|
this.setState({
|
||||||
|
busy: true,
|
||||||
|
query,
|
||||||
|
searchError: null,
|
||||||
|
});
|
||||||
|
MatrixClientPeg.get().searchUserDirectory({
|
||||||
|
term: query,
|
||||||
|
}).then((resp) => {
|
||||||
|
// The query might have changed since we sent the request, so ignore
|
||||||
|
// responses for anything other than the latest query.
|
||||||
|
if (this.state.query !== query) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
this._processResults(resp.results, query);
|
||||||
|
}).catch((err) => {
|
||||||
|
console.error('Error whilst searching user directory: ', err);
|
||||||
|
this.setState({
|
||||||
|
searchError: err.errcode ? err.message : _t('Something went wrong!'),
|
||||||
|
});
|
||||||
|
if (err.errcode === 'M_UNRECOGNIZED') {
|
||||||
|
this.setState({
|
||||||
|
serverSupportsUserDirectory: false,
|
||||||
|
});
|
||||||
|
// Do a local search immediately
|
||||||
|
this._doLocalSearch(query);
|
||||||
|
}
|
||||||
|
}).done(() => {
|
||||||
|
this.setState({
|
||||||
|
busy: false,
|
||||||
|
});
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
_doLocalSearch: function(query) {
|
||||||
|
this.setState({
|
||||||
|
query,
|
||||||
|
searchError: null,
|
||||||
|
});
|
||||||
|
const queryLowercase = query.toLowerCase();
|
||||||
|
const results = [];
|
||||||
|
MatrixClientPeg.get().getUsers().forEach((user) => {
|
||||||
|
if (user.userId.toLowerCase().indexOf(queryLowercase) === -1 &&
|
||||||
|
user.displayName.toLowerCase().indexOf(queryLowercase) === -1
|
||||||
|
) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Put results in the format of the new API
|
||||||
|
results.push({
|
||||||
|
user_id: user.userId,
|
||||||
|
display_name: user.displayName,
|
||||||
|
avatar_url: user.avatarUrl,
|
||||||
|
});
|
||||||
|
});
|
||||||
|
this._processResults(results, query);
|
||||||
|
},
|
||||||
|
|
||||||
|
_processResults: function(results, query) {
|
||||||
|
const queryList = [];
|
||||||
|
results.forEach((user) => {
|
||||||
|
if (user.user_id === MatrixClientPeg.get().credentials.userId) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
// Return objects, structure of which is defined
|
||||||
|
// by InviteAddressType
|
||||||
|
queryList.push({
|
||||||
|
addressType: 'mx',
|
||||||
|
address: user.user_id,
|
||||||
|
displayName: user.display_name,
|
||||||
|
avatarMxc: user.avatar_url,
|
||||||
|
isKnown: true,
|
||||||
|
});
|
||||||
|
});
|
||||||
|
|
||||||
|
// If the query is a valid address, add an entry for that
|
||||||
|
// This is important, otherwise there's no way to invite
|
||||||
|
// a perfectly valid address if there are close matches.
|
||||||
|
const addrType = getAddressType(query);
|
||||||
|
if (addrType !== null) {
|
||||||
|
queryList.unshift({
|
||||||
|
addressType: addrType,
|
||||||
|
address: query,
|
||||||
|
isKnown: false,
|
||||||
|
});
|
||||||
|
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
||||||
|
if (addrType == 'email') {
|
||||||
|
this._lookupThreepid(addrType, query).done();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
this.setState({
|
||||||
|
queryList,
|
||||||
|
error: false,
|
||||||
|
}, () => {
|
||||||
|
if (this.addressSelector) this.addressSelector.moveSelectionTop();
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
_getDirectMessageRooms: function(addr) {
|
_getDirectMessageRooms: function(addr) {
|
||||||
const dmRoomMap = new DMRoomMap(MatrixClientPeg.get());
|
const dmRoomMap = new DMRoomMap(MatrixClientPeg.get());
|
||||||
const dmRooms = dmRoomMap.getDMRoomsForUserId(addr);
|
const dmRooms = dmRoomMap.getDMRoomsForUserId(addr);
|
||||||
|
@ -284,11 +348,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
_startChat: function(addrs) {
|
_startChat: function(addrs) {
|
||||||
if (MatrixClientPeg.get().isGuest()) {
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
dis.dispatch({action: 'view_set_mxid'});
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
|
||||||
title: "Please Register",
|
|
||||||
description: "Guest users can't invite users. Please register."
|
|
||||||
});
|
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -308,8 +368,8 @@ module.exports = React.createClass({
|
||||||
console.error(err.stack);
|
console.error(err.stack);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to invite",
|
title: _t("Failed to invite"),
|
||||||
description: ((err && err.message) ? err.message : "Operation failed"),
|
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||||
});
|
});
|
||||||
return null;
|
return null;
|
||||||
})
|
})
|
||||||
|
@ -321,8 +381,8 @@ module.exports = React.createClass({
|
||||||
console.error(err.stack);
|
console.error(err.stack);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to invite user",
|
title: _t("Failed to invite user"),
|
||||||
description: ((err && err.message) ? err.message : "Operation failed"),
|
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||||
});
|
});
|
||||||
return null;
|
return null;
|
||||||
})
|
})
|
||||||
|
@ -342,8 +402,8 @@ module.exports = React.createClass({
|
||||||
console.error(err.stack);
|
console.error(err.stack);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to invite",
|
title: _t("Failed to invite"),
|
||||||
description: ((err && err.message) ? err.message : "Operation failed"),
|
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||||
});
|
});
|
||||||
return null;
|
return null;
|
||||||
})
|
})
|
||||||
|
@ -354,18 +414,6 @@ module.exports = React.createClass({
|
||||||
this.props.onFinished(true, addrTexts);
|
this.props.onFinished(true, addrTexts);
|
||||||
},
|
},
|
||||||
|
|
||||||
_updateUserList: new rate_limited_func(function() {
|
|
||||||
// Get all the users
|
|
||||||
this._userList = MatrixClientPeg.get().getUsers();
|
|
||||||
// Remove current user
|
|
||||||
const meIx = this._userList.findIndex((u) => {
|
|
||||||
return u.userId === MatrixClientPeg.get().credentials.userId;
|
|
||||||
});
|
|
||||||
this._userList.splice(meIx, 1);
|
|
||||||
|
|
||||||
this._fuse.set(this._userList);
|
|
||||||
}, 500),
|
|
||||||
|
|
||||||
_isOnInviteList: function(uid) {
|
_isOnInviteList: function(uid) {
|
||||||
for (let i = 0; i < this.state.inviteList.length; i++) {
|
for (let i = 0; i < this.state.inviteList.length; i++) {
|
||||||
if (
|
if (
|
||||||
|
@ -401,7 +449,7 @@ module.exports = React.createClass({
|
||||||
if (errorList.length > 0) {
|
if (errorList.length > 0) {
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to invite the following users to the " + room.name + " room:",
|
title: _t("Failed to invite the following users to the %(roomName)s room:", {roomName: room.name}),
|
||||||
description: errorList.join(", "),
|
description: errorList.join(", "),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
@ -433,6 +481,7 @@ module.exports = React.createClass({
|
||||||
this.setState({
|
this.setState({
|
||||||
inviteList: inviteList,
|
inviteList: inviteList,
|
||||||
queryList: [],
|
queryList: [],
|
||||||
|
query: "",
|
||||||
});
|
});
|
||||||
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
if (this._cancelThreepidLookup) this._cancelThreepidLookup();
|
||||||
return inviteList;
|
return inviteList;
|
||||||
|
@ -468,7 +517,7 @@ module.exports = React.createClass({
|
||||||
displayName: res.displayname,
|
displayName: res.displayname,
|
||||||
avatarMxc: res.avatar_url,
|
avatarMxc: res.avatar_url,
|
||||||
isKnown: true,
|
isKnown: true,
|
||||||
}]
|
}],
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
@ -500,23 +549,27 @@ module.exports = React.createClass({
|
||||||
placeholder={this.props.placeholder}
|
placeholder={this.props.placeholder}
|
||||||
defaultValue={this.props.value}
|
defaultValue={this.props.value}
|
||||||
autoFocus={this.props.focus}>
|
autoFocus={this.props.focus}>
|
||||||
</textarea>
|
</textarea>,
|
||||||
);
|
);
|
||||||
|
|
||||||
var error;
|
let error;
|
||||||
var addressSelector;
|
let addressSelector;
|
||||||
if (this.state.error) {
|
if (this.state.error) {
|
||||||
error = <div className="mx_ChatInviteDialog_error">You have entered an invalid contact. Try using their Matrix ID or email address.</div>;
|
error = <div className="mx_ChatInviteDialog_error">{_t("You have entered an invalid contact. Try using their Matrix ID or email address.")}</div>;
|
||||||
|
} else if (this.state.searchError) {
|
||||||
|
error = <div className="mx_ChatInviteDialog_error">{this.state.searchError}</div>;
|
||||||
|
} else if (
|
||||||
|
this.state.query.length > 0 &&
|
||||||
|
this.state.queryList.length === 0 &&
|
||||||
|
!this.state.busy
|
||||||
|
) {
|
||||||
|
error = <div className="mx_ChatInviteDialog_error">{_t("No results")}</div>;
|
||||||
} else {
|
} else {
|
||||||
const addressSelectorHeader = <div className="mx_ChatInviteDialog_addressSelectHeader">
|
|
||||||
Searching known users
|
|
||||||
</div>;
|
|
||||||
addressSelector = (
|
addressSelector = (
|
||||||
<AddressSelector ref={(ref) => {this.addressSelector = ref;}}
|
<AddressSelector ref={(ref) => {this.addressSelector = ref;}}
|
||||||
addressList={ this.state.queryList }
|
addressList={ this.state.queryList }
|
||||||
onSelected={ this.onSelected }
|
onSelected={ this.onSelected }
|
||||||
truncateAt={ TRUNCATE_QUERY_LIST }
|
truncateAt={ TRUNCATE_QUERY_LIST }
|
||||||
header={ addressSelectorHeader }
|
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -17,6 +17,7 @@ limitations under the License.
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import classnames from 'classnames';
|
import classnames from 'classnames';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* A dialog for confirming a redaction.
|
* A dialog for confirming a redaction.
|
||||||
|
@ -42,7 +43,7 @@ export default React.createClass({
|
||||||
render: function() {
|
render: function() {
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
|
|
||||||
const title = "Confirm Redaction";
|
const title = _t("Confirm Removal");
|
||||||
|
|
||||||
const confirmButtonClass = classnames({
|
const confirmButtonClass = classnames({
|
||||||
'mx_Dialog_primary': true,
|
'mx_Dialog_primary': true,
|
||||||
|
@ -55,16 +56,16 @@ export default React.createClass({
|
||||||
title={title}
|
title={title}
|
||||||
>
|
>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
Are you sure you wish to redact (delete) this event?
|
{_t("Are you sure you wish to remove (delete) this event? " +
|
||||||
Note that if you redact a room name or topic change, it could undo the change.
|
"Note that if you delete a room name or topic change, it could undo the change.")}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button className={confirmButtonClass} onClick={this.onOk}>
|
<button className={confirmButtonClass} onClick={this.onOk}>
|
||||||
Redact
|
{_t("Remove")}
|
||||||
</button>
|
</button>
|
||||||
|
|
||||||
<button onClick={this.onCancel}>
|
<button onClick={this.onCancel}>
|
||||||
Cancel
|
{_t("Cancel")}
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
</BaseDialog>
|
</BaseDialog>
|
||||||
|
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import classnames from 'classnames';
|
import classnames from 'classnames';
|
||||||
|
|
||||||
/*
|
/*
|
||||||
|
@ -69,7 +70,7 @@ export default React.createClass({
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
const MemberAvatar = sdk.getComponent("views.avatars.MemberAvatar");
|
const MemberAvatar = sdk.getComponent("views.avatars.MemberAvatar");
|
||||||
|
|
||||||
const title = this.props.action + " this person?";
|
const title = _t("%(actionVerb)s this person?", { actionVerb: this.props.action});
|
||||||
const confirmButtonClass = classnames({
|
const confirmButtonClass = classnames({
|
||||||
'mx_Dialog_primary': true,
|
'mx_Dialog_primary': true,
|
||||||
'danger': this.props.danger,
|
'danger': this.props.danger,
|
||||||
|
@ -82,7 +83,7 @@ export default React.createClass({
|
||||||
<form onSubmit={this.onOk}>
|
<form onSubmit={this.onOk}>
|
||||||
<input className="mx_ConfirmUserActionDialog_reasonField"
|
<input className="mx_ConfirmUserActionDialog_reasonField"
|
||||||
ref={this._collectReasonField}
|
ref={this._collectReasonField}
|
||||||
placeholder="Reason"
|
placeholder={ _t("Reason") }
|
||||||
autoFocus={true}
|
autoFocus={true}
|
||||||
/>
|
/>
|
||||||
</form>
|
</form>
|
||||||
|
@ -111,7 +112,7 @@ export default React.createClass({
|
||||||
</button>
|
</button>
|
||||||
|
|
||||||
<button onClick={this.onCancel}>
|
<button onClick={this.onCancel}>
|
||||||
Cancel
|
{ _t("Cancel") }
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
</BaseDialog>
|
</BaseDialog>
|
||||||
|
|
|
@ -20,6 +20,7 @@ import sdk from '../../../index';
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import * as Lifecycle from '../../../Lifecycle';
|
import * as Lifecycle from '../../../Lifecycle';
|
||||||
import Velocity from 'velocity-vector';
|
import Velocity from 'velocity-vector';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
export default class DeactivateAccountDialog extends React.Component {
|
export default class DeactivateAccountDialog extends React.Component {
|
||||||
constructor(props, context) {
|
constructor(props, context) {
|
||||||
|
@ -56,10 +57,10 @@ export default class DeactivateAccountDialog extends React.Component {
|
||||||
Lifecycle.onLoggedOut();
|
Lifecycle.onLoggedOut();
|
||||||
this.props.onFinished(false);
|
this.props.onFinished(false);
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
let errStr = 'Unknown error';
|
let errStr = _t('Unknown error');
|
||||||
// https://matrix.org/jira/browse/SYN-744
|
// https://matrix.org/jira/browse/SYN-744
|
||||||
if (err.httpStatus == 401 || err.httpStatus == 403) {
|
if (err.httpStatus == 401 || err.httpStatus == 403) {
|
||||||
errStr = 'Incorrect password';
|
errStr = _t('Incorrect password');
|
||||||
Velocity(this._passwordField, "callout.shake", 300);
|
Velocity(this._passwordField, "callout.shake", 300);
|
||||||
}
|
}
|
||||||
this.setState({
|
this.setState({
|
||||||
|
@ -85,29 +86,29 @@ export default class DeactivateAccountDialog extends React.Component {
|
||||||
passwordBoxClass = 'error';
|
passwordBoxClass = 'error';
|
||||||
}
|
}
|
||||||
|
|
||||||
const okLabel = this.state.busy ? <Loader /> : 'Deactivate Account';
|
const okLabel = this.state.busy ? <Loader /> : _t('Deactivate Account');
|
||||||
const okEnabled = this.state.confirmButtonEnabled && !this.state.busy;
|
const okEnabled = this.state.confirmButtonEnabled && !this.state.busy;
|
||||||
|
|
||||||
let cancelButton = null;
|
let cancelButton = null;
|
||||||
if (!this.state.busy) {
|
if (!this.state.busy) {
|
||||||
cancelButton = <button onClick={this._onCancel} autoFocus={true}>
|
cancelButton = <button onClick={this._onCancel} autoFocus={true}>
|
||||||
Cancel
|
{_t("Cancel")}
|
||||||
</button>;
|
</button>;
|
||||||
}
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className="mx_DeactivateAccountDialog">
|
<div className="mx_DeactivateAccountDialog">
|
||||||
<div className="mx_Dialog_title danger">
|
<div className="mx_Dialog_title danger">
|
||||||
Deactivate Account
|
{_t("Deactivate Account")}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
<p>This will make your account permanently unusable. You will not be able to re-register the same user ID.</p>
|
<p>{_t("This will make your account permanently unusable. You will not be able to re-register the same user ID.")}</p>
|
||||||
|
|
||||||
<p>This action is irreversible.</p>
|
<p>{_t("This action is irreversible.")}</p>
|
||||||
|
|
||||||
<p>To continue, please enter your password.</p>
|
<p>{_t("To continue, please enter your password.")}</p>
|
||||||
|
|
||||||
<p>Password:</p>
|
<p>{_t("Password")}:</p>
|
||||||
<input
|
<input
|
||||||
type="password"
|
type="password"
|
||||||
onChange={this._onPasswordFieldChange}
|
onChange={this._onPasswordFieldChange}
|
||||||
|
|
|
@ -0,0 +1,77 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import React from 'react';
|
||||||
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
|
import sdk from '../../../index';
|
||||||
|
import * as FormattingUtils from '../../../utils/FormattingUtils';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
|
export default function DeviceVerifyDialog(props) {
|
||||||
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
|
|
||||||
|
const key = FormattingUtils.formatCryptoKey(props.device.getFingerprint());
|
||||||
|
const body = (
|
||||||
|
<div>
|
||||||
|
<p>
|
||||||
|
{_t("To verify that this device can be trusted, please contact its " +
|
||||||
|
"owner using some other means (e.g. in person or a phone call) " +
|
||||||
|
"and ask them whether the key they see in their User Settings " +
|
||||||
|
"for this device matches the key below:")}
|
||||||
|
</p>
|
||||||
|
<div className="mx_UserSettings_cryptoSection">
|
||||||
|
<ul>
|
||||||
|
<li><label>{_t("Device name")}:</label> <span>{ props.device.getDisplayName() }</span></li>
|
||||||
|
<li><label>{_t("Device ID")}:</label> <span><code>{ props.device.deviceId}</code></span></li>
|
||||||
|
<li><label>{_t("Device key")}:</label> <span><code><b>{ key }</b></code></span></li>
|
||||||
|
</ul>
|
||||||
|
</div>
|
||||||
|
<p>
|
||||||
|
{_t("If it matches, press the verify button below. " +
|
||||||
|
"If it doesn't, then someone else is intercepting this device " +
|
||||||
|
"and you probably want to press the blacklist button instead.")}
|
||||||
|
</p>
|
||||||
|
<p>
|
||||||
|
{_t("In future this verification process will be more sophisticated.")}
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
);
|
||||||
|
|
||||||
|
function onFinished(confirm) {
|
||||||
|
if (confirm) {
|
||||||
|
MatrixClientPeg.get().setDeviceVerified(
|
||||||
|
props.userId, props.device.deviceId, true,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
props.onFinished(confirm);
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<QuestionDialog
|
||||||
|
title={_t("Verify device")}
|
||||||
|
description={body}
|
||||||
|
button={_t("I verify that the keys match")}
|
||||||
|
onFinished={onFinished}
|
||||||
|
/>
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
DeviceVerifyDialog.propTypes = {
|
||||||
|
userId: React.PropTypes.string.isRequired,
|
||||||
|
device: React.PropTypes.object.isRequired,
|
||||||
|
onFinished: React.PropTypes.func.isRequired,
|
||||||
|
};
|
|
@ -27,6 +27,7 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
export default React.createClass({
|
export default React.createClass({
|
||||||
displayName: 'ErrorDialog',
|
displayName: 'ErrorDialog',
|
||||||
|
@ -43,10 +44,10 @@ export default React.createClass({
|
||||||
|
|
||||||
getDefaultProps: function() {
|
getDefaultProps: function() {
|
||||||
return {
|
return {
|
||||||
title: "Error",
|
|
||||||
description: "An error has occurred.",
|
|
||||||
button: "OK",
|
|
||||||
focus: true,
|
focus: true,
|
||||||
|
title: null,
|
||||||
|
description: null,
|
||||||
|
button: null,
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -60,13 +61,13 @@ export default React.createClass({
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
return (
|
return (
|
||||||
<BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
|
<BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
|
||||||
title={this.props.title}>
|
title={this.props.title || _t('Error')}>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
{this.props.description}
|
{this.props.description || _t('An error has occurred.')}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button ref="button" className="mx_Dialog_primary" onClick={this.props.onFinished}>
|
<button ref="button" className="mx_Dialog_primary" onClick={this.props.onFinished}>
|
||||||
{this.props.button}
|
{this.props.button || _t('OK')}
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
</BaseDialog>
|
</BaseDialog>
|
||||||
|
|
|
@ -15,11 +15,10 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
import Matrix from 'matrix-js-sdk';
|
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
import AccessibleButton from '../elements/AccessibleButton';
|
import AccessibleButton from '../elements/AccessibleButton';
|
||||||
|
|
||||||
|
@ -46,12 +45,6 @@ export default React.createClass({
|
||||||
title: React.PropTypes.string,
|
title: React.PropTypes.string,
|
||||||
},
|
},
|
||||||
|
|
||||||
getDefaultProps: function() {
|
|
||||||
return {
|
|
||||||
title: "Authentication",
|
|
||||||
};
|
|
||||||
},
|
|
||||||
|
|
||||||
getInitialState: function() {
|
getInitialState: function() {
|
||||||
return {
|
return {
|
||||||
authError: null,
|
authError: null,
|
||||||
|
@ -85,7 +78,7 @@ export default React.createClass({
|
||||||
<AccessibleButton onClick={this._onDismissClick}
|
<AccessibleButton onClick={this._onDismissClick}
|
||||||
className="mx_UserSettings_button"
|
className="mx_UserSettings_button"
|
||||||
>
|
>
|
||||||
Dismiss
|
{_t("Dismiss")}
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -105,7 +98,7 @@ export default React.createClass({
|
||||||
return (
|
return (
|
||||||
<BaseDialog className="mx_InteractiveAuthDialog"
|
<BaseDialog className="mx_InteractiveAuthDialog"
|
||||||
onFinished={this.props.onFinished}
|
onFinished={this.props.onFinished}
|
||||||
title={this.state.authError ? 'Error' : this.props.title}
|
title={this.state.authError ? 'Error' : (this.props.title || _t('Authentication'))}
|
||||||
>
|
>
|
||||||
{content}
|
{content}
|
||||||
</BaseDialog>
|
</BaseDialog>
|
||||||
|
|
|
@ -0,0 +1,172 @@
|
||||||
|
/*
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import Modal from '../../../Modal';
|
||||||
|
import React from 'react';
|
||||||
|
import sdk from '../../../index';
|
||||||
|
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Dialog which asks the user whether they want to share their keys with
|
||||||
|
* an unverified device.
|
||||||
|
*
|
||||||
|
* onFinished is called with `true` if the key should be shared, `false` if it
|
||||||
|
* should not, and `undefined` if the dialog is cancelled. (In other words:
|
||||||
|
* truthy: do the key share. falsy: don't share the keys).
|
||||||
|
*/
|
||||||
|
export default React.createClass({
|
||||||
|
propTypes: {
|
||||||
|
matrixClient: React.PropTypes.object.isRequired,
|
||||||
|
userId: React.PropTypes.string.isRequired,
|
||||||
|
deviceId: React.PropTypes.string.isRequired,
|
||||||
|
onFinished: React.PropTypes.func.isRequired,
|
||||||
|
},
|
||||||
|
|
||||||
|
getInitialState: function() {
|
||||||
|
return {
|
||||||
|
deviceInfo: null,
|
||||||
|
wasNewDevice: false,
|
||||||
|
};
|
||||||
|
},
|
||||||
|
|
||||||
|
componentDidMount: function() {
|
||||||
|
this._unmounted = false;
|
||||||
|
const userId = this.props.userId;
|
||||||
|
const deviceId = this.props.deviceId;
|
||||||
|
|
||||||
|
// give the client a chance to refresh the device list
|
||||||
|
this.props.matrixClient.downloadKeys([userId], false).then((r) => {
|
||||||
|
if (this._unmounted) { return; }
|
||||||
|
|
||||||
|
const deviceInfo = r[userId][deviceId];
|
||||||
|
|
||||||
|
if(!deviceInfo) {
|
||||||
|
console.warn(`No details found for device ${userId}:${deviceId}`);
|
||||||
|
|
||||||
|
this.props.onFinished(false);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const wasNewDevice = !deviceInfo.isKnown();
|
||||||
|
|
||||||
|
this.setState({
|
||||||
|
deviceInfo: deviceInfo,
|
||||||
|
wasNewDevice: wasNewDevice,
|
||||||
|
});
|
||||||
|
|
||||||
|
// if the device was new before, it's not any more.
|
||||||
|
if (wasNewDevice) {
|
||||||
|
this.props.matrixClient.setDeviceKnown(
|
||||||
|
userId,
|
||||||
|
deviceId,
|
||||||
|
true,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}).done();
|
||||||
|
},
|
||||||
|
|
||||||
|
componentWillUnmount: function() {
|
||||||
|
this._unmounted = true;
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
|
_onVerifyClicked: function() {
|
||||||
|
const DeviceVerifyDialog = sdk.getComponent('views.dialogs.DeviceVerifyDialog');
|
||||||
|
|
||||||
|
console.log("KeyShareDialog: Starting verify dialog");
|
||||||
|
Modal.createDialog(DeviceVerifyDialog, {
|
||||||
|
userId: this.props.userId,
|
||||||
|
device: this.state.deviceInfo,
|
||||||
|
onFinished: (verified) => {
|
||||||
|
if (verified) {
|
||||||
|
// can automatically share the keys now.
|
||||||
|
this.props.onFinished(true);
|
||||||
|
}
|
||||||
|
},
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
_onShareClicked: function() {
|
||||||
|
console.log("KeyShareDialog: User clicked 'share'");
|
||||||
|
this.props.onFinished(true);
|
||||||
|
},
|
||||||
|
|
||||||
|
_onIgnoreClicked: function() {
|
||||||
|
console.log("KeyShareDialog: User clicked 'ignore'");
|
||||||
|
this.props.onFinished(false);
|
||||||
|
},
|
||||||
|
|
||||||
|
_renderContent: function() {
|
||||||
|
const displayName = this.state.deviceInfo.getDisplayName() ||
|
||||||
|
this.state.deviceInfo.deviceId;
|
||||||
|
|
||||||
|
let text;
|
||||||
|
if (this.state.wasNewDevice) {
|
||||||
|
text = "You added a new device '%(displayName)s', which is"
|
||||||
|
+ " requesting encryption keys.";
|
||||||
|
} else {
|
||||||
|
text = "Your unverified device '%(displayName)s' is requesting"
|
||||||
|
+ " encryption keys.";
|
||||||
|
}
|
||||||
|
text = _t(text, {displayName: displayName});
|
||||||
|
|
||||||
|
return (
|
||||||
|
<div>
|
||||||
|
<p>{text}</p>
|
||||||
|
|
||||||
|
<div className="mx_Dialog_buttons">
|
||||||
|
<button onClick={this._onVerifyClicked}>
|
||||||
|
{_t('Start verification')}
|
||||||
|
</button>
|
||||||
|
<button onClick={this._onShareClicked}>
|
||||||
|
{_t('Share without verifying')}
|
||||||
|
</button>
|
||||||
|
<button onClick={this._onIgnoreClicked}>
|
||||||
|
{_t('Ignore request')}
|
||||||
|
</button>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
);
|
||||||
|
},
|
||||||
|
|
||||||
|
render: function() {
|
||||||
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
|
const Spinner = sdk.getComponent('views.elements.Spinner');
|
||||||
|
|
||||||
|
let content;
|
||||||
|
|
||||||
|
if (this.state.deviceInfo) {
|
||||||
|
content = this._renderContent();
|
||||||
|
} else {
|
||||||
|
content = (
|
||||||
|
<div>
|
||||||
|
<p>{_t('Loading device info...')}</p>
|
||||||
|
<Spinner />
|
||||||
|
</div>
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<BaseDialog className='mx_KeyShareRequestDialog'
|
||||||
|
onFinished={this.props.onFinished}
|
||||||
|
title={_t('Encryption key request')}
|
||||||
|
>
|
||||||
|
{content}
|
||||||
|
</BaseDialog>
|
||||||
|
);
|
||||||
|
},
|
||||||
|
});
|
|
@ -1,78 +0,0 @@
|
||||||
/*
|
|
||||||
Copyright 2016 OpenMarket Ltd
|
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
you may not use this file except in compliance with the License.
|
|
||||||
You may obtain a copy of the License at
|
|
||||||
|
|
||||||
http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
|
|
||||||
Unless required by applicable law or agreed to in writing, software
|
|
||||||
distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
See the License for the specific language governing permissions and
|
|
||||||
limitations under the License.
|
|
||||||
*/
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Usage:
|
|
||||||
* Modal.createDialog(NeedToRegisterDialog, {
|
|
||||||
* title: "some text", (default: "Registration required")
|
|
||||||
* description: "some more text",
|
|
||||||
* onFinished: someFunction,
|
|
||||||
* });
|
|
||||||
*/
|
|
||||||
|
|
||||||
import React from 'react';
|
|
||||||
import dis from '../../../dispatcher';
|
|
||||||
import sdk from '../../../index';
|
|
||||||
|
|
||||||
module.exports = React.createClass({
|
|
||||||
displayName: 'NeedToRegisterDialog',
|
|
||||||
propTypes: {
|
|
||||||
title: React.PropTypes.string,
|
|
||||||
description: React.PropTypes.oneOfType([
|
|
||||||
React.PropTypes.element,
|
|
||||||
React.PropTypes.string,
|
|
||||||
]),
|
|
||||||
onFinished: React.PropTypes.func.isRequired,
|
|
||||||
},
|
|
||||||
|
|
||||||
getDefaultProps: function() {
|
|
||||||
return {
|
|
||||||
title: "Registration required",
|
|
||||||
description: "A registered account is required for this action",
|
|
||||||
};
|
|
||||||
},
|
|
||||||
|
|
||||||
onRegisterClicked: function() {
|
|
||||||
dis.dispatch({
|
|
||||||
action: "start_upgrade_registration",
|
|
||||||
});
|
|
||||||
if (this.props.onFinished) {
|
|
||||||
this.props.onFinished();
|
|
||||||
}
|
|
||||||
},
|
|
||||||
|
|
||||||
render: function() {
|
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
|
||||||
return (
|
|
||||||
<BaseDialog className="mx_NeedToRegisterDialog"
|
|
||||||
onFinished={this.props.onFinished}
|
|
||||||
title={this.props.title}
|
|
||||||
>
|
|
||||||
<div className="mx_Dialog_content">
|
|
||||||
{this.props.description}
|
|
||||||
</div>
|
|
||||||
<div className="mx_Dialog_buttons">
|
|
||||||
<button className="mx_Dialog_primary" onClick={this.props.onFinished} autoFocus={true}>
|
|
||||||
Cancel
|
|
||||||
</button>
|
|
||||||
<button onClick={this.onRegisterClicked}>
|
|
||||||
Register
|
|
||||||
</button>
|
|
||||||
</div>
|
|
||||||
</BaseDialog>
|
|
||||||
);
|
|
||||||
},
|
|
||||||
});
|
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
export default React.createClass({
|
export default React.createClass({
|
||||||
displayName: 'QuestionDialog',
|
displayName: 'QuestionDialog',
|
||||||
|
@ -33,7 +34,6 @@ export default React.createClass({
|
||||||
title: "",
|
title: "",
|
||||||
description: "",
|
description: "",
|
||||||
extraButtons: null,
|
extraButtons: null,
|
||||||
button: "OK",
|
|
||||||
focus: true,
|
focus: true,
|
||||||
hasCancelButton: true,
|
hasCancelButton: true,
|
||||||
};
|
};
|
||||||
|
@ -47,17 +47,11 @@ export default React.createClass({
|
||||||
this.props.onFinished(false);
|
this.props.onFinished(false);
|
||||||
},
|
},
|
||||||
|
|
||||||
componentDidMount: function() {
|
|
||||||
if (this.props.focus) {
|
|
||||||
this.refs.button.focus();
|
|
||||||
}
|
|
||||||
},
|
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
const cancelButton = this.props.hasCancelButton ? (
|
const cancelButton = this.props.hasCancelButton ? (
|
||||||
<button onClick={this.onCancel}>
|
<button onClick={this.onCancel}>
|
||||||
Cancel
|
{_t("Cancel")}
|
||||||
</button>
|
</button>
|
||||||
) : null;
|
) : null;
|
||||||
return (
|
return (
|
||||||
|
@ -69,8 +63,8 @@ export default React.createClass({
|
||||||
{this.props.description}
|
{this.props.description}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button ref="button" className="mx_Dialog_primary" onClick={this.onOk}>
|
<button className="mx_Dialog_primary" onClick={this.onOk} autoFocus={this.props.focus}>
|
||||||
{this.props.button}
|
{this.props.button || _t('OK')}
|
||||||
</button>
|
</button>
|
||||||
{this.props.extraButtons}
|
{this.props.extraButtons}
|
||||||
{cancelButton}
|
{cancelButton}
|
||||||
|
|
|
@ -18,6 +18,7 @@ import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import SdkConfig from '../../../SdkConfig';
|
import SdkConfig from '../../../SdkConfig';
|
||||||
import Modal from '../../../Modal';
|
import Modal from '../../../Modal';
|
||||||
|
import { _t, _tJsx } from '../../../languageHandler';
|
||||||
|
|
||||||
|
|
||||||
export default React.createClass({
|
export default React.createClass({
|
||||||
|
@ -43,29 +44,32 @@ export default React.createClass({
|
||||||
|
|
||||||
if (SdkConfig.get().bug_report_endpoint_url) {
|
if (SdkConfig.get().bug_report_endpoint_url) {
|
||||||
bugreport = (
|
bugreport = (
|
||||||
<p>Otherwise, <a onClick={this._sendBugReport} href='#'>
|
<p>
|
||||||
click here</a> to send a bug report.
|
{_tJsx(
|
||||||
|
"Otherwise, <a>click here</a> to send a bug report.",
|
||||||
|
/<a>(.*?)<\/a>/, (sub) => <a onClick={this._sendBugReport} key="bugreport" href='#'>{sub}</a>,
|
||||||
|
)}
|
||||||
</p>
|
</p>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
|
<BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
|
||||||
title='Unable to restore session'>
|
title={_t('Unable to restore session')}>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
<p>We encountered an error trying to restore your previous session. If
|
<p>{_t("We encountered an error trying to restore your previous session. If " +
|
||||||
you continue, you will need to log in again, and encrypted chat
|
"you continue, you will need to log in again, and encrypted chat " +
|
||||||
history will be unreadable.</p>
|
"history will be unreadable.")}</p>
|
||||||
|
|
||||||
<p>If you have previously used a more recent version of Riot, your session
|
<p>{_t("If you have previously used a more recent version of Riot, your session " +
|
||||||
may be incompatible with this version. Close this window and return
|
"may be incompatible with this version. Close this window and return " +
|
||||||
to the more recent version.</p>
|
"to the more recent version.")}</p>
|
||||||
|
|
||||||
{bugreport}
|
{bugreport}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button className="mx_Dialog_primary" onClick={this._continueClicked}>
|
<button className="mx_Dialog_primary" onClick={this._continueClicked}>
|
||||||
Continue anyway
|
{_t("Continue anyway")}
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
</BaseDialog>
|
</BaseDialog>
|
||||||
|
|
|
@ -1,87 +0,0 @@
|
||||||
/*
|
|
||||||
Copyright 2016 OpenMarket Ltd
|
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
you may not use this file except in compliance with the License.
|
|
||||||
You may obtain a copy of the License at
|
|
||||||
|
|
||||||
http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
|
|
||||||
Unless required by applicable law or agreed to in writing, software
|
|
||||||
distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
See the License for the specific language governing permissions and
|
|
||||||
limitations under the License.
|
|
||||||
*/
|
|
||||||
|
|
||||||
import React from 'react';
|
|
||||||
import sdk from '../../../index';
|
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Prompt the user to set a display name.
|
|
||||||
*
|
|
||||||
* On success, `onFinished(true, newDisplayName)` is called.
|
|
||||||
*/
|
|
||||||
export default React.createClass({
|
|
||||||
displayName: 'SetDisplayNameDialog',
|
|
||||||
propTypes: {
|
|
||||||
onFinished: React.PropTypes.func.isRequired,
|
|
||||||
currentDisplayName: React.PropTypes.string,
|
|
||||||
},
|
|
||||||
|
|
||||||
getInitialState: function() {
|
|
||||||
if (this.props.currentDisplayName) {
|
|
||||||
return { value: this.props.currentDisplayName };
|
|
||||||
}
|
|
||||||
|
|
||||||
if (MatrixClientPeg.get().isGuest()) {
|
|
||||||
return { value : "Guest " + MatrixClientPeg.get().getUserIdLocalpart() };
|
|
||||||
}
|
|
||||||
else {
|
|
||||||
return { value : MatrixClientPeg.get().getUserIdLocalpart() };
|
|
||||||
}
|
|
||||||
},
|
|
||||||
|
|
||||||
componentDidMount: function() {
|
|
||||||
this.refs.input_value.select();
|
|
||||||
},
|
|
||||||
|
|
||||||
onValueChange: function(ev) {
|
|
||||||
this.setState({
|
|
||||||
value: ev.target.value
|
|
||||||
});
|
|
||||||
},
|
|
||||||
|
|
||||||
onFormSubmit: function(ev) {
|
|
||||||
ev.preventDefault();
|
|
||||||
this.props.onFinished(true, this.state.value);
|
|
||||||
return false;
|
|
||||||
},
|
|
||||||
|
|
||||||
render: function() {
|
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
|
||||||
return (
|
|
||||||
<BaseDialog className="mx_SetDisplayNameDialog"
|
|
||||||
onFinished={this.props.onFinished}
|
|
||||||
title="Set a Display Name"
|
|
||||||
>
|
|
||||||
<div className="mx_Dialog_content">
|
|
||||||
Your display name is how you'll appear to others when you speak in rooms.<br/>
|
|
||||||
What would you like it to be?
|
|
||||||
</div>
|
|
||||||
<form onSubmit={this.onFormSubmit}>
|
|
||||||
<div className="mx_Dialog_content">
|
|
||||||
<input type="text" ref="input_value" value={this.state.value}
|
|
||||||
autoFocus={true} onChange={this.onValueChange} size="30"
|
|
||||||
className="mx_SetDisplayNameDialog_input"
|
|
||||||
/>
|
|
||||||
</div>
|
|
||||||
<div className="mx_Dialog_buttons">
|
|
||||||
<input className="mx_Dialog_primary" type="submit" value="Set" />
|
|
||||||
</div>
|
|
||||||
</form>
|
|
||||||
</BaseDialog>
|
|
||||||
);
|
|
||||||
},
|
|
||||||
});
|
|
|
@ -0,0 +1,164 @@
|
||||||
|
/*
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import React from 'react';
|
||||||
|
import sdk from '../../../index';
|
||||||
|
import Email from '../../../email';
|
||||||
|
import AddThreepid from '../../../AddThreepid';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
import Modal from '../../../Modal';
|
||||||
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Prompt the user to set an email address.
|
||||||
|
*
|
||||||
|
* On success, `onFinished(true)` is called.
|
||||||
|
*/
|
||||||
|
export default React.createClass({
|
||||||
|
displayName: 'SetEmailDialog',
|
||||||
|
propTypes: {
|
||||||
|
onFinished: React.PropTypes.func.isRequired,
|
||||||
|
},
|
||||||
|
|
||||||
|
getInitialState: function() {
|
||||||
|
return {
|
||||||
|
emailAddress: null,
|
||||||
|
emailBusy: false,
|
||||||
|
};
|
||||||
|
},
|
||||||
|
|
||||||
|
componentDidMount: function() {
|
||||||
|
},
|
||||||
|
|
||||||
|
onEmailAddressChanged: function(value) {
|
||||||
|
this.setState({
|
||||||
|
emailAddress: value,
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
onSubmit: function() {
|
||||||
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
|
|
||||||
|
const emailAddress = this.state.emailAddress;
|
||||||
|
if (!Email.looksValid(emailAddress)) {
|
||||||
|
Modal.createDialog(ErrorDialog, {
|
||||||
|
title: _t("Invalid Email Address"),
|
||||||
|
description: _t("This doesn't appear to be a valid email address"),
|
||||||
|
});
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
this._addThreepid = new AddThreepid();
|
||||||
|
// we always bind emails when registering, so let's do the
|
||||||
|
// same here.
|
||||||
|
this._addThreepid.addEmailAddress(emailAddress, true).done(() => {
|
||||||
|
Modal.createDialog(QuestionDialog, {
|
||||||
|
title: _t("Verification Pending"),
|
||||||
|
description: _t(
|
||||||
|
"Please check your email and click on the link it contains. Once this " +
|
||||||
|
"is done, click continue.",
|
||||||
|
),
|
||||||
|
button: _t('Continue'),
|
||||||
|
onFinished: this.onEmailDialogFinished,
|
||||||
|
});
|
||||||
|
}, (err) => {
|
||||||
|
this.setState({emailBusy: false});
|
||||||
|
console.error("Unable to add email address " + emailAddress + " " + err);
|
||||||
|
Modal.createDialog(ErrorDialog, {
|
||||||
|
title: _t("Unable to add email address"),
|
||||||
|
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||||
|
});
|
||||||
|
});
|
||||||
|
this.setState({emailBusy: true});
|
||||||
|
},
|
||||||
|
|
||||||
|
onCancelled: function() {
|
||||||
|
this.props.onFinished(false);
|
||||||
|
},
|
||||||
|
|
||||||
|
onEmailDialogFinished: function(ok) {
|
||||||
|
if (ok) {
|
||||||
|
this.verifyEmailAddress();
|
||||||
|
} else {
|
||||||
|
this.setState({emailBusy: false});
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
verifyEmailAddress: function() {
|
||||||
|
this._addThreepid.checkEmailLinkClicked().done(() => {
|
||||||
|
this.props.onFinished(true);
|
||||||
|
}, (err) => {
|
||||||
|
this.setState({emailBusy: false});
|
||||||
|
if (err.errcode == 'M_THREEPID_AUTH_FAILED') {
|
||||||
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
|
const message = _t("Unable to verify email address.") + " " +
|
||||||
|
_t("Please check your email and click on the link it contains. Once this is done, click continue.");
|
||||||
|
Modal.createDialog(QuestionDialog, {
|
||||||
|
title: _t("Verification Pending"),
|
||||||
|
description: message,
|
||||||
|
button: _t('Continue'),
|
||||||
|
onFinished: this.onEmailDialogFinished,
|
||||||
|
});
|
||||||
|
} else {
|
||||||
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
|
console.error("Unable to verify email address: " + err);
|
||||||
|
Modal.createDialog(ErrorDialog, {
|
||||||
|
title: _t("Unable to verify email address."),
|
||||||
|
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||||
|
});
|
||||||
|
}
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
render: function() {
|
||||||
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
|
const Spinner = sdk.getComponent('elements.Spinner');
|
||||||
|
const EditableText = sdk.getComponent('elements.EditableText');
|
||||||
|
|
||||||
|
const emailInput = this.state.emailBusy ? <Spinner /> : <EditableText
|
||||||
|
className="mx_SetEmailDialog_email_input"
|
||||||
|
placeholder={ _t("Email address") }
|
||||||
|
placeholderClassName="mx_SetEmailDialog_email_input_placeholder"
|
||||||
|
blurToCancel={ false }
|
||||||
|
onValueChanged={ this.onEmailAddressChanged } />;
|
||||||
|
|
||||||
|
return (
|
||||||
|
<BaseDialog className="mx_SetEmailDialog"
|
||||||
|
onFinished={this.onCancelled}
|
||||||
|
title={this.props.title}
|
||||||
|
>
|
||||||
|
<div className="mx_Dialog_content">
|
||||||
|
<p>
|
||||||
|
{ _t('This will allow you to reset your password and receive notifications.') }
|
||||||
|
</p>
|
||||||
|
{ emailInput }
|
||||||
|
</div>
|
||||||
|
<div className="mx_Dialog_buttons">
|
||||||
|
<input className="mx_Dialog_primary"
|
||||||
|
type="submit"
|
||||||
|
value={_t("Continue")}
|
||||||
|
onClick={this.onSubmit}
|
||||||
|
/>
|
||||||
|
<input
|
||||||
|
type="submit"
|
||||||
|
value={_t("Skip")}
|
||||||
|
onClick={this.onCancelled}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</BaseDialog>
|
||||||
|
);
|
||||||
|
},
|
||||||
|
});
|
|
@ -0,0 +1,294 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import q from 'q';
|
||||||
|
import React from 'react';
|
||||||
|
import sdk from '../../../index';
|
||||||
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
|
import classnames from 'classnames';
|
||||||
|
import KeyCode from '../../../KeyCode';
|
||||||
|
import { _t, _tJsx } from '../../../languageHandler';
|
||||||
|
|
||||||
|
// The amount of time to wait for further changes to the input username before
|
||||||
|
// sending a request to the server
|
||||||
|
const USERNAME_CHECK_DEBOUNCE_MS = 250;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Prompt the user to set a display name.
|
||||||
|
*
|
||||||
|
* On success, `onFinished(true, newDisplayName)` is called.
|
||||||
|
*/
|
||||||
|
export default React.createClass({
|
||||||
|
displayName: 'SetMxIdDialog',
|
||||||
|
propTypes: {
|
||||||
|
onFinished: React.PropTypes.func.isRequired,
|
||||||
|
// Called when the user requests to register with a different homeserver
|
||||||
|
onDifferentServerClicked: React.PropTypes.func.isRequired,
|
||||||
|
// Called if the user wants to switch to login instead
|
||||||
|
onLoginClick: React.PropTypes.func.isRequired,
|
||||||
|
},
|
||||||
|
|
||||||
|
getInitialState: function() {
|
||||||
|
return {
|
||||||
|
// The entered username
|
||||||
|
username: '',
|
||||||
|
// Indicate ongoing work on the username
|
||||||
|
usernameBusy: false,
|
||||||
|
// Indicate error with username
|
||||||
|
usernameError: '',
|
||||||
|
// Assume the homeserver supports username checking until "M_UNRECOGNIZED"
|
||||||
|
usernameCheckSupport: true,
|
||||||
|
|
||||||
|
// Whether the auth UI is currently being used
|
||||||
|
doingUIAuth: false,
|
||||||
|
// Indicate error with auth
|
||||||
|
authError: '',
|
||||||
|
};
|
||||||
|
},
|
||||||
|
|
||||||
|
componentDidMount: function() {
|
||||||
|
this.refs.input_value.select();
|
||||||
|
|
||||||
|
this._matrixClient = MatrixClientPeg.get();
|
||||||
|
},
|
||||||
|
|
||||||
|
onValueChange: function(ev) {
|
||||||
|
this.setState({
|
||||||
|
username: ev.target.value,
|
||||||
|
usernameBusy: true,
|
||||||
|
usernameError: '',
|
||||||
|
}, () => {
|
||||||
|
if (!this.state.username || !this.state.usernameCheckSupport) {
|
||||||
|
this.setState({
|
||||||
|
usernameBusy: false,
|
||||||
|
});
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Debounce the username check to limit number of requests sent
|
||||||
|
if (this._usernameCheckTimeout) {
|
||||||
|
clearTimeout(this._usernameCheckTimeout);
|
||||||
|
}
|
||||||
|
this._usernameCheckTimeout = setTimeout(() => {
|
||||||
|
this._doUsernameCheck().finally(() => {
|
||||||
|
this.setState({
|
||||||
|
usernameBusy: false,
|
||||||
|
});
|
||||||
|
});
|
||||||
|
}, USERNAME_CHECK_DEBOUNCE_MS);
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
onKeyUp: function(ev) {
|
||||||
|
if (ev.keyCode === KeyCode.ENTER) {
|
||||||
|
this.onSubmit();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
onSubmit: function(ev) {
|
||||||
|
this.setState({
|
||||||
|
doingUIAuth: true,
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
_doUsernameCheck: function() {
|
||||||
|
// Check if username is available
|
||||||
|
return this._matrixClient.isUsernameAvailable(this.state.username).then(
|
||||||
|
(isAvailable) => {
|
||||||
|
if (isAvailable) {
|
||||||
|
this.setState({usernameError: ''});
|
||||||
|
}
|
||||||
|
},
|
||||||
|
(err) => {
|
||||||
|
// Indicate whether the homeserver supports username checking
|
||||||
|
const newState = {
|
||||||
|
usernameCheckSupport: err.errcode !== "M_UNRECOGNIZED",
|
||||||
|
};
|
||||||
|
console.error('Error whilst checking username availability: ', err);
|
||||||
|
switch (err.errcode) {
|
||||||
|
case "M_USER_IN_USE":
|
||||||
|
newState.usernameError = _t('Username not available');
|
||||||
|
break;
|
||||||
|
case "M_INVALID_USERNAME":
|
||||||
|
newState.usernameError = _t(
|
||||||
|
'Username invalid: %(errMessage)s',
|
||||||
|
{ errMessage: err.message},
|
||||||
|
);
|
||||||
|
break;
|
||||||
|
case "M_UNRECOGNIZED":
|
||||||
|
// This homeserver doesn't support username checking, assume it's
|
||||||
|
// fine and rely on the error appearing in registration step.
|
||||||
|
newState.usernameError = '';
|
||||||
|
break;
|
||||||
|
case undefined:
|
||||||
|
newState.usernameError = _t('Something went wrong!');
|
||||||
|
break;
|
||||||
|
default:
|
||||||
|
newState.usernameError = _t(
|
||||||
|
'An error occurred: %(error_string)s',
|
||||||
|
{ error_string: err.message },
|
||||||
|
);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
this.setState(newState);
|
||||||
|
},
|
||||||
|
);
|
||||||
|
},
|
||||||
|
|
||||||
|
_generatePassword: function() {
|
||||||
|
return Math.random().toString(36).slice(2);
|
||||||
|
},
|
||||||
|
|
||||||
|
_makeRegisterRequest: function(auth) {
|
||||||
|
// Not upgrading - changing mxids
|
||||||
|
const guestAccessToken = null;
|
||||||
|
if (!this._generatedPassword) {
|
||||||
|
this._generatedPassword = this._generatePassword();
|
||||||
|
}
|
||||||
|
return this._matrixClient.register(
|
||||||
|
this.state.username,
|
||||||
|
this._generatedPassword,
|
||||||
|
undefined, // session id: included in the auth dict already
|
||||||
|
auth,
|
||||||
|
{},
|
||||||
|
guestAccessToken,
|
||||||
|
);
|
||||||
|
},
|
||||||
|
|
||||||
|
_onUIAuthFinished: function(success, response) {
|
||||||
|
this.setState({
|
||||||
|
doingUIAuth: false,
|
||||||
|
});
|
||||||
|
|
||||||
|
if (!success) {
|
||||||
|
this.setState({ authError: response.message });
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// XXX Implement RTS /register here
|
||||||
|
const teamToken = null;
|
||||||
|
|
||||||
|
this.props.onFinished(true, {
|
||||||
|
userId: response.user_id,
|
||||||
|
deviceId: response.device_id,
|
||||||
|
homeserverUrl: this._matrixClient.getHomeserverUrl(),
|
||||||
|
identityServerUrl: this._matrixClient.getIdentityServerUrl(),
|
||||||
|
accessToken: response.access_token,
|
||||||
|
password: this._generatedPassword,
|
||||||
|
teamToken: teamToken,
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
render: function() {
|
||||||
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
|
const InteractiveAuth = sdk.getComponent('structures.InteractiveAuth');
|
||||||
|
const Spinner = sdk.getComponent('elements.Spinner');
|
||||||
|
|
||||||
|
let auth;
|
||||||
|
if (this.state.doingUIAuth) {
|
||||||
|
auth = <InteractiveAuth
|
||||||
|
matrixClient={this._matrixClient}
|
||||||
|
makeRequest={this._makeRegisterRequest}
|
||||||
|
onAuthFinished={this._onUIAuthFinished}
|
||||||
|
inputs={{}}
|
||||||
|
poll={true}
|
||||||
|
/>;
|
||||||
|
}
|
||||||
|
const inputClasses = classnames({
|
||||||
|
"mx_SetMxIdDialog_input": true,
|
||||||
|
"error": Boolean(this.state.usernameError),
|
||||||
|
});
|
||||||
|
|
||||||
|
let usernameIndicator = null;
|
||||||
|
let usernameBusyIndicator = null;
|
||||||
|
if (this.state.usernameBusy) {
|
||||||
|
usernameBusyIndicator = <Spinner w="24" h="24"/>;
|
||||||
|
} else {
|
||||||
|
const usernameAvailable = this.state.username &&
|
||||||
|
this.state.usernameCheckSupport && !this.state.usernameError;
|
||||||
|
const usernameIndicatorClasses = classnames({
|
||||||
|
"error": Boolean(this.state.usernameError),
|
||||||
|
"success": usernameAvailable,
|
||||||
|
});
|
||||||
|
usernameIndicator = <div className={usernameIndicatorClasses}>
|
||||||
|
{ usernameAvailable ? _t('Username available') : this.state.usernameError }
|
||||||
|
</div>;
|
||||||
|
}
|
||||||
|
|
||||||
|
let authErrorIndicator = null;
|
||||||
|
if (this.state.authError) {
|
||||||
|
authErrorIndicator = <div className="error">
|
||||||
|
{ this.state.authError }
|
||||||
|
</div>;
|
||||||
|
}
|
||||||
|
const canContinue = this.state.username &&
|
||||||
|
!this.state.usernameError &&
|
||||||
|
!this.state.usernameBusy;
|
||||||
|
|
||||||
|
return (
|
||||||
|
<BaseDialog className="mx_SetMxIdDialog"
|
||||||
|
onFinished={this.props.onFinished}
|
||||||
|
title="To get started, please pick a username!"
|
||||||
|
>
|
||||||
|
<div className="mx_Dialog_content">
|
||||||
|
<div className="mx_SetMxIdDialog_input_group">
|
||||||
|
<input type="text" ref="input_value" value={this.state.username}
|
||||||
|
autoFocus={true}
|
||||||
|
onChange={this.onValueChange}
|
||||||
|
onKeyUp={this.onKeyUp}
|
||||||
|
size="30"
|
||||||
|
className={inputClasses}
|
||||||
|
/>
|
||||||
|
{ usernameBusyIndicator }
|
||||||
|
</div>
|
||||||
|
{ usernameIndicator }
|
||||||
|
<p>
|
||||||
|
{ _tJsx(
|
||||||
|
'This will be your account name on the <span></span> ' +
|
||||||
|
'homeserver, or you can pick a <a>different server</a>.',
|
||||||
|
[
|
||||||
|
/<span><\/span>/,
|
||||||
|
/<a>(.*?)<\/a>/,
|
||||||
|
],
|
||||||
|
[
|
||||||
|
(sub) => <span>{this.props.homeserverUrl}</span>,
|
||||||
|
(sub) => <a href="#" onClick={this.props.onDifferentServerClicked}>{sub}</a>,
|
||||||
|
],
|
||||||
|
)}
|
||||||
|
</p>
|
||||||
|
<p>
|
||||||
|
{ _tJsx(
|
||||||
|
'If you already have a Matrix account you can <a>log in</a> instead.',
|
||||||
|
/<a>(.*?)<\/a>/,
|
||||||
|
[(sub) => <a href="#" onClick={this.props.onLoginClick}>{sub}</a>],
|
||||||
|
)}
|
||||||
|
</p>
|
||||||
|
{ auth }
|
||||||
|
{ authErrorIndicator }
|
||||||
|
</div>
|
||||||
|
<div className="mx_Dialog_buttons">
|
||||||
|
<input className="mx_Dialog_primary"
|
||||||
|
type="submit"
|
||||||
|
value={_t("Continue")}
|
||||||
|
onClick={this.onSubmit}
|
||||||
|
disabled={!canContinue}
|
||||||
|
/>
|
||||||
|
</div>
|
||||||
|
</BaseDialog>
|
||||||
|
);
|
||||||
|
},
|
||||||
|
});
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
export default React.createClass({
|
export default React.createClass({
|
||||||
displayName: 'TextInputDialog',
|
displayName: 'TextInputDialog',
|
||||||
|
@ -36,7 +37,6 @@ export default React.createClass({
|
||||||
title: "",
|
title: "",
|
||||||
value: "",
|
value: "",
|
||||||
description: "",
|
description: "",
|
||||||
button: "OK",
|
|
||||||
focus: true,
|
focus: true,
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
@ -73,7 +73,7 @@ export default React.createClass({
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button onClick={this.onCancel}>
|
<button onClick={this.onCancel}>
|
||||||
Cancel
|
{ _t("Cancel") }
|
||||||
</button>
|
</button>
|
||||||
<button className="mx_Dialog_primary" onClick={this.onOk}>
|
<button className="mx_Dialog_primary" onClick={this.onOk}>
|
||||||
{this.props.button}
|
{this.props.button}
|
||||||
|
|
|
@ -16,10 +16,10 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import dis from '../../../dispatcher';
|
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import GeminiScrollbar from 'react-gemini-scrollbar';
|
import GeminiScrollbar from 'react-gemini-scrollbar';
|
||||||
import Resend from '../../../Resend';
|
import Resend from '../../../Resend';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
function DeviceListEntry(props) {
|
function DeviceListEntry(props) {
|
||||||
const {userId, device} = props;
|
const {userId, device} = props;
|
||||||
|
@ -120,17 +120,17 @@ export default React.createClass({
|
||||||
if (blacklistUnverified) {
|
if (blacklistUnverified) {
|
||||||
warning = (
|
warning = (
|
||||||
<h4>
|
<h4>
|
||||||
You are currently blacklisting unverified devices; to send
|
{_t("You are currently blacklisting unverified devices; to send " +
|
||||||
messages to these devices you must verify them.
|
"messages to these devices you must verify them.")}
|
||||||
</h4>
|
</h4>
|
||||||
);
|
);
|
||||||
} else {
|
} else {
|
||||||
warning = (
|
warning = (
|
||||||
<div>
|
<div>
|
||||||
<p>
|
<p>
|
||||||
We recommend you go through the verification process
|
{_t("We recommend you go through the verification process " +
|
||||||
for each device to confirm they belong to their legitimate owner,
|
"for each device to confirm they belong to their legitimate owner, " +
|
||||||
but you can resend the message without verifying if you prefer.
|
"but you can resend the message without verifying if you prefer.")}
|
||||||
</p>
|
</p>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -145,14 +145,14 @@ export default React.createClass({
|
||||||
console.log("UnknownDeviceDialog closed by escape");
|
console.log("UnknownDeviceDialog closed by escape");
|
||||||
this.props.onFinished();
|
this.props.onFinished();
|
||||||
}}
|
}}
|
||||||
title='Room contains unknown devices'
|
title={_t('Room contains unknown devices')}
|
||||||
>
|
>
|
||||||
<GeminiScrollbar autoshow={false} className="mx_Dialog_content">
|
<GeminiScrollbar autoshow={false} className="mx_Dialog_content">
|
||||||
<h4>
|
<h4>
|
||||||
"{this.props.room.name}" contains devices that you haven't seen before.
|
{_t('"%(RoomName)s" contains devices that you haven\'t seen before.', {RoomName: this.props.room.name})}
|
||||||
</h4>
|
</h4>
|
||||||
{ warning }
|
{ warning }
|
||||||
Unknown devices:
|
{_t("Unknown devices")}:
|
||||||
|
|
||||||
<UnknownDeviceList devices={this.props.devices} />
|
<UnknownDeviceList devices={this.props.devices} />
|
||||||
</GeminiScrollbar>
|
</GeminiScrollbar>
|
||||||
|
@ -162,7 +162,7 @@ export default React.createClass({
|
||||||
this.props.onFinished();
|
this.props.onFinished();
|
||||||
Resend.resendUnsentEvents(this.props.room);
|
Resend.resendUnsentEvents(this.props.room);
|
||||||
}}>
|
}}>
|
||||||
Send anyway
|
{_t("Send anyway")}
|
||||||
</button>
|
</button>
|
||||||
<button className="mx_Dialog_primary" autoFocus={ true }
|
<button className="mx_Dialog_primary" autoFocus={ true }
|
||||||
onClick={() => {
|
onClick={() => {
|
||||||
|
|
|
@ -27,6 +27,7 @@ export default React.createClass({
|
||||||
size: PropTypes.string,
|
size: PropTypes.string,
|
||||||
tooltip: PropTypes.bool,
|
tooltip: PropTypes.bool,
|
||||||
action: PropTypes.string.isRequired,
|
action: PropTypes.string.isRequired,
|
||||||
|
mouseOverAction: PropTypes.string,
|
||||||
label: PropTypes.string.isRequired,
|
label: PropTypes.string.isRequired,
|
||||||
iconPath: PropTypes.string.isRequired,
|
iconPath: PropTypes.string.isRequired,
|
||||||
},
|
},
|
||||||
|
@ -51,6 +52,9 @@ export default React.createClass({
|
||||||
|
|
||||||
_onMouseEnter: function() {
|
_onMouseEnter: function() {
|
||||||
if (this.props.tooltip) this.setState({showTooltip: true});
|
if (this.props.tooltip) this.setState({showTooltip: true});
|
||||||
|
if (this.props.mouseOverAction) {
|
||||||
|
dis.dispatch({action: this.props.mouseOverAction});
|
||||||
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
_onMouseLeave: function() {
|
_onMouseLeave: function() {
|
||||||
|
|
|
@ -16,12 +16,11 @@ limitations under the License.
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require('react');
|
import React from 'react';
|
||||||
var classNames = require('classnames');
|
import classNames from 'classnames';
|
||||||
var sdk = require("../../../index");
|
import sdk from "../../../index";
|
||||||
var Invite = require("../../../Invite");
|
import MatrixClientPeg from "../../../MatrixClientPeg";
|
||||||
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
import { _t } from '../../../languageHandler';
|
||||||
var Avatar = require('../../../Avatar');
|
|
||||||
|
|
||||||
// React PropType definition for an object describing
|
// React PropType definition for an object describing
|
||||||
// an address that can be invited to a room (which
|
// an address that can be invited to a room (which
|
||||||
|
@ -142,7 +141,7 @@ export default React.createClass({
|
||||||
});
|
});
|
||||||
|
|
||||||
info = (
|
info = (
|
||||||
<div className={unknownClasses}>Unknown Address</div>
|
<div className={unknownClasses}>{_t("Unknown Address")}</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -17,12 +17,14 @@ limitations under the License.
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import PropTypes from 'prop-types';
|
import PropTypes from 'prop-types';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
const CreateRoomButton = function(props) {
|
const CreateRoomButton = function(props) {
|
||||||
const ActionButton = sdk.getComponent('elements.ActionButton');
|
const ActionButton = sdk.getComponent('elements.ActionButton');
|
||||||
return (
|
return (
|
||||||
<ActionButton action="view_create_chat"
|
<ActionButton action="view_create_room"
|
||||||
label="Create new room"
|
mouseOverAction={props.callout ? "callout_create_room" : null}
|
||||||
|
label={ _t("Create new room") }
|
||||||
iconPath="img/icons-create-room.svg"
|
iconPath="img/icons-create-room.svg"
|
||||||
size={props.size}
|
size={props.size}
|
||||||
tooltip={props.tooltip}
|
tooltip={props.tooltip}
|
||||||
|
|
|
@ -18,6 +18,7 @@ import React from 'react';
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import Modal from '../../../Modal';
|
import Modal from '../../../Modal';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
export default React.createClass({
|
export default React.createClass({
|
||||||
displayName: 'DeviceVerifyButtons',
|
displayName: 'DeviceVerifyButtons',
|
||||||
|
@ -50,42 +51,10 @@ export default React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
onVerifyClick: function() {
|
onVerifyClick: function() {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
const DeviceVerifyDialog = sdk.getComponent('views.dialogs.DeviceVerifyDialog');
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(DeviceVerifyDialog, {
|
||||||
title: "Verify device",
|
userId: this.props.userId,
|
||||||
description: (
|
device: this.state.device,
|
||||||
<div>
|
|
||||||
<p>
|
|
||||||
To verify that this device can be trusted, please contact its
|
|
||||||
owner using some other means (e.g. in person or a phone call)
|
|
||||||
and ask them whether the key they see in their User Settings
|
|
||||||
for this device matches the key below:
|
|
||||||
</p>
|
|
||||||
<div className="mx_UserSettings_cryptoSection">
|
|
||||||
<ul>
|
|
||||||
<li><label>Device name:</label> <span>{ this.state.device.getDisplayName() }</span></li>
|
|
||||||
<li><label>Device ID:</label> <span><code>{ this.state.device.deviceId}</code></span></li>
|
|
||||||
<li><label>Device key:</label> <span><code><b>{ this.state.device.getFingerprint() }</b></code></span></li>
|
|
||||||
</ul>
|
|
||||||
</div>
|
|
||||||
<p>
|
|
||||||
If it matches, press the verify button below.
|
|
||||||
If it doesnt, then someone else is intercepting this device
|
|
||||||
and you probably want to press the blacklist button instead.
|
|
||||||
</p>
|
|
||||||
<p>
|
|
||||||
In future this verification process will be more sophisticated.
|
|
||||||
</p>
|
|
||||||
</div>
|
|
||||||
),
|
|
||||||
button: "I verify that the keys match",
|
|
||||||
onFinished: confirm=>{
|
|
||||||
if (confirm) {
|
|
||||||
MatrixClientPeg.get().setDeviceVerified(
|
|
||||||
this.props.userId, this.state.device.deviceId, true
|
|
||||||
);
|
|
||||||
}
|
|
||||||
},
|
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -114,14 +83,14 @@ export default React.createClass({
|
||||||
blacklistButton = (
|
blacklistButton = (
|
||||||
<button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_unblacklist"
|
<button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_unblacklist"
|
||||||
onClick={this.onUnblacklistClick}>
|
onClick={this.onUnblacklistClick}>
|
||||||
Unblacklist
|
{_t("Unblacklist")}
|
||||||
</button>
|
</button>
|
||||||
);
|
);
|
||||||
} else {
|
} else {
|
||||||
blacklistButton = (
|
blacklistButton = (
|
||||||
<button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_blacklist"
|
<button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_blacklist"
|
||||||
onClick={this.onBlacklistClick}>
|
onClick={this.onBlacklistClick}>
|
||||||
Blacklist
|
{_t("Blacklist")}
|
||||||
</button>
|
</button>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -130,14 +99,14 @@ export default React.createClass({
|
||||||
verifyButton = (
|
verifyButton = (
|
||||||
<button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_unverify"
|
<button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_unverify"
|
||||||
onClick={this.onUnverifyClick}>
|
onClick={this.onUnverifyClick}>
|
||||||
Unverify
|
{_t("Unverify")}
|
||||||
</button>
|
</button>
|
||||||
);
|
);
|
||||||
} else {
|
} else {
|
||||||
verifyButton = (
|
verifyButton = (
|
||||||
<button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_verify"
|
<button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_verify"
|
||||||
onClick={this.onVerifyClick}>
|
onClick={this.onVerifyClick}>
|
||||||
Verify...
|
{_t("Verify...")}
|
||||||
</button>
|
</button>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue