From 2c840c7d4fe7d547492520c4aa8d5e345a81ae59 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Thu, 24 Nov 2022 12:50:11 +0100 Subject: [PATCH 01/60] chg: [herlper:bootstrap] Major refactor of the BootstrapHelper to make it more modular + added documentation --- .../templates/LocalTool/GenericRequest.php | 12 +- .../templates/Notification/DataChange.php | 6 +- .../templates/Broods/ResendFailedMessage.php | 10 +- plugins/Tags/src/View/Helper/TagHelper.php | 24 +- .../BootstrapElements/BootstrapAccordion.php | 154 ++ .../BootstrapElements/BootstrapAlert.php | 83 + .../BootstrapElements/BootstrapBadge.php | 70 + .../BootstrapElements/BootstrapButton.php | 143 ++ .../BootstrapElements/BootstrapCard.php | 135 ++ .../BootstrapElements/BootstrapCollapse.php | 120 + .../BootstrapDropdownMenu.php | 205 ++ .../BootstrapElements/BootstrapIcon.php | 61 + .../BootstrapElements/BootstrapListGroup.php | 117 + .../BootstrapElements/BootstrapListTable.php | 222 ++ .../BootstrapElements/BootstrapModal.php | 343 +++ .../BootstrapNotificationBubble.php | 106 + .../BootstrapElements/BootstrapProgress.php | 88 + .../BootstrapProgressTimeline.php | 153 ++ .../BootstrapElements/BootstrapSwitch.php | 81 + .../BootstrapElements/BootstrapTable.php | 238 ++ .../BootstrapElements/BootstrapTabs.php | 307 +++ .../BootstrapElements/BootstrapToast.php | 74 + src/View/Helper/BootstrapHelper.php | 2015 ++--------------- src/View/Helper/SocialProviderHelper.php | 2 +- templates/Instance/migration_index.php | 14 +- templates/MetaTemplates/index.php | 5 +- ..._template_to_newest_version_for_entity.php | 4 +- templates/MetaTemplates/update.php | 2 +- templates/Users/login.php | 4 +- templates/element/Settings/field.php | 10 +- templates/element/Settings/fieldGroup.php | 14 +- templates/element/Settings/notice.php | 14 +- templates/element/Settings/panel.php | 4 +- .../element/UserSettings/saved-bookmarks.php | 12 +- .../Form/formLayouts/formDefault.php | 2 +- .../Form/formLayouts/formRaw.php | 2 +- .../genericElements/Form/metaTemplateForm.php | 2 +- .../index_statistic_field_amount.php | 4 +- .../Statistics/index_statistic_timestamp.php | 8 +- .../IndexTable/index_table.php | 3 +- .../ListTopBar/group_multi_select_actions.php | 2 +- .../ListTopBar/group_search.php | 6 +- .../ListTopBar/group_table_action.php | 4 +- .../group_table_action/hiddenColumns.php | 2 +- .../group_table_action/hiddenMetaColumns.php | 2 +- .../SingleViews/metafields_panel.php | 2 +- .../layouts/header/header-notifications.php | 1 + .../element/layouts/sidebar/bookmark-add.php | 4 +- .../layouts/sidebar/bookmark-entry.php | 2 +- templates/element/layouts/sidebar/entry.php | 1 + templates/element/widgets/highlight-panel.php | 2 +- templates/genericTemplates/filters.php | 18 +- webroot/js/api-helper.js | 3 + webroot/js/bootstrap-helper.js | 81 +- 54 files changed, 3045 insertions(+), 1958 deletions(-) create mode 100644 src/View/Helper/BootstrapElements/BootstrapAccordion.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapAlert.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapBadge.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapButton.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapCard.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapCollapse.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapDropdownMenu.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapIcon.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapListGroup.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapListTable.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapModal.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapNotificationBubble.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapProgress.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapProgressTimeline.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapSwitch.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapTable.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapTabs.php create mode 100644 src/View/Helper/BootstrapElements/BootstrapToast.php diff --git a/libraries/default/InboxProcessors/templates/LocalTool/GenericRequest.php b/libraries/default/InboxProcessors/templates/LocalTool/GenericRequest.php index 15ea91b..6709c7e 100644 --- a/libraries/default/InboxProcessors/templates/LocalTool/GenericRequest.php +++ b/libraries/default/InboxProcessors/templates/LocalTool/GenericRequest.php @@ -50,28 +50,28 @@ $footerButtons[] = [ $table = $this->Bootstrap->table(['small' => true, 'bordered' => false, 'striped' => false, 'hover' => false], [ 'fields' => [ - ['key' => 'created', 'label' => __('Date'), 'formatter' => function($value, $row) { + ['path' => 'created', 'label' => __('Date'), 'formatter' => function($value, $row) { return $value->i18nFormat('yyyy-MM-dd HH:mm:ss'); }], - ['key' => 'connector', 'label' => __('Tool Name'), 'formatter' => function($connector, $row) { + ['path' => 'connector', 'label' => __('Tool Name'), 'formatter' => function($connector, $row) { return sprintf('%s', $this->Url->build(['controller' => 'localTools', 'action' => 'viewConnector', $connector['name']]), sprintf('%s (v%s)', h($connector['name']), h($connector['connector_version'])) ); }], - ['key' => 'brood', 'label' => __('Brood'), 'formatter' => function($brood, $row) { + ['path' => 'brood', 'label' => __('Brood'), 'formatter' => function($brood, $row) { return sprintf('%s', $this->Url->build(['controller' => 'broods', 'action' => 'view', $brood['id']]), h($brood['name']) ); }], - ['key' => 'individual', 'label' => __('Individual'), 'formatter' => function($individual, $row) { + ['path' => 'individual', 'label' => __('Individual'), 'formatter' => function($individual, $row) { return sprintf('%s', $this->Url->build(['controller' => 'users', 'action' => 'view', $individual['id']]), h($individual['email']) ); }], - ['key' => 'individual.alignments', 'label' => __('Alignment'), 'formatter' => function($alignments, $row) { + ['path' => 'individual.alignments', 'label' => __('Alignment'), 'formatter' => function($alignments, $row) { $html = ''; foreach ($alignments as $alignment) { $html .= sprintf('
%s @ %s
', @@ -101,7 +101,7 @@ $localToolHTML = $this->fetch('content', sprintf('
%s
Bootstrap->collapse( [ - 'title' => __('Inter-connection data'), + 'text' => __('Inter-connection data'), 'open' => true, ], sprintf('
%s
', json_encode($request['data'], JSON_PRETTY_PRINT)) diff --git a/libraries/default/InboxProcessors/templates/Notification/DataChange.php b/libraries/default/InboxProcessors/templates/Notification/DataChange.php index 952fae1..eb5679a 100644 --- a/libraries/default/InboxProcessors/templates/Notification/DataChange.php +++ b/libraries/default/InboxProcessors/templates/Notification/DataChange.php @@ -52,8 +52,10 @@ echo $this->Bootstrap->modal([ 'bodyHTML' => $this->element('genericElements/SingleViews/Fields/jsonField', ['field' => ['raw' => $data['changed']]]) ]) ), - 'confirmText' => __('Acknowledge & Discard'), - 'confirmIcon' => 'check', + 'confirmButton' => [ + 'text' => __('Acknowledge & Discard'), + 'icon' => 'check', + ] ]); ?> diff --git a/libraries/default/OutboxProcessors/templates/Broods/ResendFailedMessage.php b/libraries/default/OutboxProcessors/templates/Broods/ResendFailedMessage.php index b9339fb..2d84f1e 100644 --- a/libraries/default/OutboxProcessors/templates/Broods/ResendFailedMessage.php +++ b/libraries/default/OutboxProcessors/templates/Broods/ResendFailedMessage.php @@ -40,22 +40,22 @@ $tools = sprintf( $table = $this->Bootstrap->table(['small' => true, 'bordered' => false, 'striped' => false, 'hover' => false], [ 'fields' => [ - ['key' => 'created', 'label' => __('Date'), 'formatter' => function($value, $row) { + ['path' => 'created', 'label' => __('Date'), 'formatter' => function($value, $row) { return $value->i18nFormat('yyyy-MM-dd HH:mm:ss'); }], - ['key' => 'brood', 'label' => __('Brood'), 'formatter' => function($brood, $row) { + ['path' => 'brood', 'label' => __('Brood'), 'formatter' => function($brood, $row) { return sprintf('%s', $this->Url->build(['controller' => 'broods', 'action' => 'view', $brood['id']]), h($brood['name']) ); }], - ['key' => 'individual', 'label' => __('Individual'), 'formatter' => function($individual, $row) { + ['path' => 'individual', 'label' => __('Individual'), 'formatter' => function($individual, $row) { return sprintf('%s', $this->Url->build(['controller' => 'users', 'action' => 'view', $individual['id']]), h($individual['email']) ); }], - ['key' => 'individual.alignments', 'label' => __('Alignment'), 'formatter' => function($alignments, $row) { + ['path' => 'individual.alignments', 'label' => __('Alignment'), 'formatter' => function($alignments, $row) { $html = ''; foreach ($alignments as $alignment) { $html .= sprintf('
%s @ %s
', @@ -71,7 +71,7 @@ $table = $this->Bootstrap->table(['small' => true, 'bordered' => false, 'striped ]); $requestData = $this->Bootstrap->collapse([ - 'title' => __('Message data'), + 'text' => __('Message data'), 'open' => true, ], sprintf('
%s
', json_encode($request['data']['sent'], JSON_PRETTY_PRINT)) diff --git a/plugins/Tags/src/View/Helper/TagHelper.php b/plugins/Tags/src/View/Helper/TagHelper.php index 71b48d7..405c513 100644 --- a/plugins/Tags/src/View/Helper/TagHelper.php +++ b/plugins/Tags/src/View/Helper/TagHelper.php @@ -60,9 +60,7 @@ class TagHelper extends Helper 'icon' => 'plus', 'variant' => 'secondary', 'class' => ['badge'], - 'params' => [ - 'onclick' => 'createTagPicker(this)', - ] + 'onclick' => 'createTagPicker(this)', ]); } else { $html .= ''; @@ -111,22 +109,20 @@ class TagHelper extends Helper 'class' => ['ms-1', 'border-0', "text-${textColour}"], 'variant' => 'text', 'title' => __('Delete tag'), - 'params' => [ - 'onclick' => sprintf('deleteTag(\'%s\', \'%s\', this)', - $this->Url->build([ - 'controller' => $this->getView()->getName(), - 'action' => 'untag', - $this->getView()->get('entity')['id'] - ]), - h($tag['name']) - ), - ], + 'onclick' => sprintf('deleteTag(\'%s\', \'%s\', this)', + $this->Url->build([ + 'controller' => $this->getView()->getName(), + 'action' => 'untag', + $this->getView()->get('entity')['id'] + ]), + h($tag['name']) + ), ]); } else { $deleteButton = ''; } - $html = $this->Bootstrap->genNode('span', [ + $html = $this->Bootstrap->node('span', [ 'class' => [ 'tag', 'badge', diff --git a/src/View/Helper/BootstrapElements/BootstrapAccordion.php b/src/View/Helper/BootstrapElements/BootstrapAccordion.php new file mode 100644 index 0000000..9bce200 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapAccordion.php @@ -0,0 +1,154 @@ +Bootstrap->accordion( + * [ + * 'stayOpen' => true, + * ], + * [ + * [ + * 'open' => true, + * 'header' => [ + * 'variant' => 'danger', + * 'text' => 'nav 1', + * ], + * 'body' => 'body', + * ], + * [ + * 'class' => ['opacity-50'], + * 'variant' => 'success', + * 'header' => [ + * 'html' => 'nav 1', + * ], + * 'body' => 'body', + * ], + * ] + * ); + */ +class BootstrapAccordion extends BootstrapGeneric +{ + private $defaultOptions = [ + 'stayOpen' => false, + 'class' => [], + ]; + + function __construct($options, $content, $btHelper) + { + $this->allowedOptionValues = []; + $this->content = $content; + $this->btHelper = $btHelper; + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->checkOptionValidity(); + $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); + $this->seed = 'acc-' . mt_rand(); + $this->contentSeeds = []; + foreach ($this->content as $accordionItem) { + $this->contentSeeds[] = mt_rand(); + } + + foreach ($this->content as $i => $item) { + $this->content[$i]['class'] = $this->convertToArrayIfNeeded($item['class'] ?? []); + $this->content[$i]['header']['class'] = $this->convertToArrayIfNeeded($item['header']['class'] ?? []); + } + } + + public function accordion() + { + return $this->genAccordion(); + } + + private function genHeader($accordionItem, $i) + { + $html = $this->nodeOpen('h2', [ + 'class' => ['accordion-header'], + 'id' => 'head-' . $this->contentSeeds[$i] + ]); + $content = $accordionItem['header']['html'] ?? h($accordionItem['header']['text']); + $buttonOptions = [ + 'class' => array_merge( + [ + 'accordion-button', + empty($accordionItem['open']) ? 'collapsed' : '', + self::getBGAndTextClassForVariant($accordionItem['header']['variant'] ?? ''), + ], + $accordionItem['header']['class'], + ), + 'type' => 'button', + 'data-bs-toggle' => 'collapse', + 'data-bs-target' => '#body-' . $this->contentSeeds[$i], + 'aria-expanded' => 'false', + 'aria-controls' => 'body-' . $this->contentSeeds[$i], + ]; + $html .= $this->node('button', $buttonOptions, $content); + $html .= $this->nodeClose(('h2')); + return $html; + } + + private function genBody($accordionItem, $i) + { + $content = $this->node('div', [ + 'class' => ['accordion-body'] + ], $accordionItem['body']); + $divOptions = [ + 'class' => array_merge( + [ + 'accordion-collapse collapse', + empty($accordionItem['open']) ? '' : 'show', + self::getBGAndTextClassForVariant($accordionItem['variant'] ?? ''), + ], + $accordionItem['class'], + ), + 'id' => 'body-' . $this->contentSeeds[$i], + 'aria-labelledby' => 'head-' . $this->contentSeeds[$i], + ]; + if (empty($this->options['stayOpen'])) { + $divOptions['data-bs-parent'] = '#' . $this->seed; + } + $html = $this->node('div', $divOptions, $content); + return $html; + } + + private function genAccordion() + { + $html = $this->nodeOpen('div', [ + 'class' => array_merge(['accordion'], $this->options['class']), + 'id' => $this->seed + ]); + foreach ($this->content as $i => $accordionItem) { + $html .= $this->nodeOpen('div', [ + 'class' => array_merge(['accordion-item']) + ]); + $html .= $this->genHeader($accordionItem, $i); + $html .= $this->genBody($accordionItem, $i); + $html .= $this->nodeClose('div'); + } + $html .= $this->nodeClose('div'); + return $html; + } +} \ No newline at end of file diff --git a/src/View/Helper/BootstrapElements/BootstrapAlert.php b/src/View/Helper/BootstrapElements/BootstrapAlert.php new file mode 100644 index 0000000..49c0240 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapAlert.php @@ -0,0 +1,83 @@ +Bootstrap->alert([ + * 'text' => 'This is an alert', + * 'dismissible' => false, + * 'variant' => 'warning', + * 'fade' => false, + * ]); + */ +class BootstrapAlert extends BootstrapGeneric +{ + private $defaultOptions = [ + 'text' => '', + 'html' => null, + 'dismissible' => true, + 'variant' => 'primary', + 'fade' => true, + 'class' => [], + ]; + + function __construct($options) + { + $this->allowedOptionValues = [ + 'variant' => BootstrapGeneric::$variants, + ]; + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); + $this->checkOptionValidity(); + } + + public function alert() + { + return $this->genAlert(); + } + + private function genAlert() + { + $html = $this->nodeOpen('div', [ + 'class' => array_merge([ + 'alert', + "alert-{$this->options['variant']}", + $this->options['dismissible'] ? 'alert-dismissible' : '', + $this->options['fade'] ? 'fade show' : '', + ], $this->options['class']), + 'role' => "alert" + ]); + + $html .= $this->options['html'] ?? h($this->options['text']); + $html .= $this->genCloseButton(); + $html .= $this->nodeClose('div'); + return $html; + } + + private function genCloseButton() + { + $html = ''; + if ($this->options['dismissible']) { + $html .= $this->genericCloseButton('alert'); + } + return $html; + } +} diff --git a/src/View/Helper/BootstrapElements/BootstrapBadge.php b/src/View/Helper/BootstrapElements/BootstrapBadge.php new file mode 100644 index 0000000..d4cf856 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapBadge.php @@ -0,0 +1,70 @@ +Bootstrap->badge([ + * 'text' => 'text', + * 'variant' => 'success', + * 'pill' => false, + * ]); + */ +class BootstrapBadge extends BootstrapGeneric +{ + private $defaultOptions = [ + 'text' => '', + 'html' => null, + 'variant' => 'primary', + 'pill' => false, + 'title' => '', + 'class' => [], + ]; + + function __construct($options) + { + $this->allowedOptionValues = [ + 'variant' => BootstrapGeneric::$variants, + ]; + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); + $this->checkOptionValidity(); + } + + public function badge() + { + return $this->genBadge(); + } + + private function genBadge() + { + $html = $this->node('span', [ + 'class' => array_merge($this->options['class'], [ + 'ms-1', + 'badge', + self::getBGAndTextClassForVariant($this->options['variant']), + $this->options['pill'] ? 'rounded-pill' : '', + ]), + 'title' => $this->options['title'] + ], $this->options['html'] ?? h($this->options['text'])); + return $html; + } +} diff --git a/src/View/Helper/BootstrapElements/BootstrapButton.php b/src/View/Helper/BootstrapElements/BootstrapButton.php new file mode 100644 index 0000000..7cf2b05 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapButton.php @@ -0,0 +1,143 @@ +Bootstrap->button([ + * 'text' => 'Press me!', + * 'variant' => 'warning', + * 'icon' => 'exclamation-triangle', + * 'onclick' => 'alert(1)', + * ]); + */ +class BootstrapButton extends BootstrapGeneric +{ + private $defaultOptions = [ + 'id' => '', + 'text' => '', + 'html' => null, + 'variant' => 'primary', + 'outline' => false, + 'size' => '', + 'icon' => null, + 'image' => null, + 'class' => [], + 'type' => 'button', + 'nodeType' => 'button', + 'title' => '', + 'badge' => false, + 'onclick' => false, + 'attrs' => [], + ]; + + private $bsClasses = []; + + function __construct($options) + { + $this->allowedOptionValues = [ + 'variant' => array_merge(BootstrapGeneric::$variants, ['link', 'text']), + 'size' => ['', 'xs', 'sm', 'lg'], + 'type' => ['button', 'submit', 'reset'] + ]; + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); + $this->checkOptionValidity(); + + if (!empty($this->options['id'])) { + $this->options['attrs']['id'] = $this->options['id']; + } + + $this->bsClasses[] = 'btn'; + if ($this->options['outline']) { + $this->bsClasses[] = "btn-outline-{$this->options['variant']}"; + } else { + $this->bsClasses[] = "btn-{$this->options['variant']}"; + } + if (!empty($this->options['size'])) { + $this->bsClasses[] = "btn-{$this->options['size']}"; + } + if ($this->options['variant'] == 'text') { + $this->bsClasses[] = 'p-0'; + $this->bsClasses[] = 'lh-1'; + } + if (!empty($this->options['onclick'])) { + $this->options['attrs']['onclick'] = $this->options['onclick']; + } + } + + public function button() + { + return $this->genButton(); + } + + private function genButton() + { + $html = $this->nodeOpen($this->options['nodeType'], array_merge($this->options['attrs'], [ + 'class' => array_merge($this->options['class'], $this->bsClasses), + 'role' => "alert", + 'type' => $this->options['type'], + 'title' => h($this->options['title']), + ])); + + $html .= $this->genIcon(); + $html .= $this->genImage(); + $html .= $this->options['html'] ?? h($this->options['text']); + if (!empty($this->options['badge'])) { + $bsBadge = new BootstrapBadge($this->options['badge']); + $html .= $bsBadge->badge(); + } + $html .= $this->nodeClose($this->options['nodeType']); + return $html; + } + + private function genIcon() + { + if (!empty($this->options['icon'])) { + $bsIcon = new BootstrapIcon($this->options['icon'], [ + 'class' => [(!empty($this->options['text']) ? 'me-1' : '')] + ]); + return $bsIcon->icon(); + } + return ''; + } + + private function genImage() + { + if (!empty($this->options['image'])) { + return $this->node('img', [ + 'src' => $this->options['image']['path'] ?? '', + 'class' => ['img-fluid', 'me-1'], + 'width' => '26', + 'height' => '26', + 'alt' => $this->options['image']['alt'] ?? '' + ]); + } + return ''; + } +} diff --git a/src/View/Helper/BootstrapElements/BootstrapCard.php b/src/View/Helper/BootstrapElements/BootstrapCard.php new file mode 100644 index 0000000..3053660 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapCard.php @@ -0,0 +1,135 @@ +Bootstrap->card([ + * 'headerText' => 'header', + * 'bodyHTML' => 'body', + * 'footerText' => 'footer', + * 'headerVariant' => 'warning', + * 'footerVariant' => 'dark', + * ); + */ +class BootstrapCard extends BootstrapGeneric +{ + private $defaultOptions = [ + 'headerText' => '', + 'bodyText' => '', + 'footerText' => '', + 'headerHTML' => null, + 'bodyHTML' => null, + 'footerHTML' => null, + 'class' => [], + 'headerVariant' => '', + 'bodyVariant' => '', + 'footerVariant' => '', + 'headerClass' => '', + 'bodyClass' => '', + 'footerClass' => '', + ]; + + public function __construct($options) + { + $this->allowedOptionValues = [ + 'headerVariant' => array_merge(BootstrapGeneric::$variants, ['']), + 'bodyVariant' => array_merge(BootstrapGeneric::$variants, ['']), + 'footerVariant' => array_merge(BootstrapGeneric::$variants, ['']), + ]; + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->options['headerClass'] = $this->convertToArrayIfNeeded($this->options['headerClass']); + $this->options['bodyClass'] = $this->convertToArrayIfNeeded($this->options['bodyClass']); + $this->options['footerClass'] = $this->convertToArrayIfNeeded($this->options['footerClass']); + $this->checkOptionValidity(); + $this->options['borderVariant'] = !empty($this->options['headerVariant']) ? "border-{$this->options['headerVariant']}" : ''; + } + + public function card() + { + return $this->genCard(); + } + + private function genCard() + { + $card = $this->node('div', [ + 'class' => array_merge( + [ + 'card', + $this->options['borderVariant'], + ], + $this->options['class'] + ), + ], implode('', [$this->genHeader(), $this->genBody(), $this->genFooter()])); + return $card; + } + + private function genHeader() + { + if (empty($this->options['headerHTML']) && empty($this->options['headerText'])) { + return ''; + } + $content = $this->options['headerHTML'] ?? h($this->options['headerText']); + $header = $this->node('div', [ + 'class' => array_merge( + [ + 'card-header', + self::getBGAndTextClassForVariant($this->options['headerVariant']), + ], + $this->options['headerClass'] + ), + ], $content); + return $header; + } + + private function genBody() + { + if (empty($this->options['bodyHTML']) && empty($this->options['bodyText'])) { + return ''; + } + $content = $this->options['bodyHTML'] ?? h($this->options['bodyText']); + $body = $this->node('div', [ + 'class' => array_merge( + [ + 'card-body', + self::getBGAndTextClassForVariant($this->options['bodyVariant']), + ], + $this->options['bodyClass'] + ) + ], $content); + return $body; + } + + private function genFooter() + { + if (empty($this->options['footerHTML']) && empty($this->options['footerText'])) { + return ''; + } + $content = $this->options['footerHTML'] ?? h($this->options['footerText']); + $footer = $this->node('div', [ + 'class' => array_merge([ + 'card-footer', + self::getBGAndTextClassForVariant($this->options['footerVariant']), + ], + $this->options['footerClass'] + ) + ], $content); + return $footer; + } +} \ No newline at end of file diff --git a/src/View/Helper/BootstrapElements/BootstrapCollapse.php b/src/View/Helper/BootstrapElements/BootstrapCollapse.php new file mode 100644 index 0000000..4441d2d --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapCollapse.php @@ -0,0 +1,120 @@ +Bootstrap->collapse([ + * 'button' => [ + * 'text' => 'Open sesame', + * 'variant' => 'success', + * ], + * 'card' => [ + * 'bodyClass' => 'p-2 rounded-3', + * 'bodyVariant' => 'secondary', + * ] + * ], 'content'); + */ + +class BootstrapCollapse extends BootstrapGeneric +{ + private $defaultOptions = [ + 'text' => '', + 'html' => null, + 'open' => false, + 'horizontal' => false, + 'class' => [], + 'button' => [], + 'card' => [], + 'attrs' => [], + ]; + + function __construct($options, $content, $btHelper) + { + $this->allowedOptionValues = []; + $this->processOptions($options); + $this->content = $content; + $this->btHelper = $btHelper; + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); + $this->options['class'][] = 'collapse'; + if (!empty($this->options['horizontal'])) { + $this->options['class'][] = 'collapse-horizontal'; + } + if ($this->options['open']) { + $this->options['class'][] = 'show'; + } + if (empty($this->options['card']['bodyClass'])) { + $this->options['card']['bodyClass'] = ['p-0']; + } + if (empty($this->options['id'])) { + $this->options['id'] = 'c-' . Security::randomString(8); + } + $this->checkOptionValidity(); + } + + public function collapse() + { + return $this->genCollapse(); + } + + private function genControl() + { + $attrsConfig = [ + 'data-bs-toggle' => 'collapse', + 'role' => 'button', + 'aria-expanded' => 'false', + 'aria-controls' => $this->options['id'], + 'href' => '#' . $this->options['id'], + ]; + $html = ''; + if (!empty($this->options['button'])) { + $btnConfig = array_merge($this->options['button'], ['attrs' => $attrsConfig]); + $html = $this->btHelper->button($btnConfig); + } else { + $nodeConfig = [ + 'class' => ['text-decoration-none'], + ]; + $nodeConfig = array_merge($nodeConfig, $attrsConfig); + $html = $this->node('a', $nodeConfig, $this->options['html'] ?? h($this->options['text'])); + } + return $html; + } + + private function genContent() + { + $cardConfig = $this->options['card']; + $cardConfig['bodyHTML'] = $this->content; + $content = $this->btHelper->card($cardConfig); + $container = $this->node('div', [ + 'class' => $this->options['class'], + 'id' => $this->options['id'], + ], $content); + return $container; + } + + private function genCollapse() + { + return $this->genControl() . $this->genContent(); + } +} \ No newline at end of file diff --git a/src/View/Helper/BootstrapElements/BootstrapDropdownMenu.php b/src/View/Helper/BootstrapElements/BootstrapDropdownMenu.php new file mode 100644 index 0000000..2bea216 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapDropdownMenu.php @@ -0,0 +1,205 @@ + element + * + * # Usage: + * $this->Bootstrap->dropdownMenu([ + * 'dropdown-class' => 'ms-1', + * 'alignment' => 'end', + * 'direction' => 'down', + * 'button' => [ + * 'icon' => 'sliders-h', + * 'variant' => 'primary', + * ], + * 'submenu_alignment' => 'end', + * 'submenu_direction' => 'end', + * 'attrs' => [], + * 'menu' => [ + * [ + * 'text' => __('Eye'), + * 'icon' => 'eye-slash', + * 'keepOpen' => true, + * 'menu' => [ + * ['header' => true, 'text' => 'nested menu'], + * ['text' => 'item 1'], + * ['text' => 'item 2', 'sup' => 'v1'], + * ], + * ], + * [ + * 'html' => 'html item', + * ], + * ] + * ]); + */ + +class BootstrapDropdownMenu extends BootstrapGeneric +{ + private $defaultOptions = [ + 'dropdown-class' => [], + 'alignment' => 'start', + 'direction' => 'end', + 'button' => [], + 'menu' => [], + 'submenu_direction' => 'end', + 'submenu_classes' => [], + 'attrs' => [], + ]; + + function __construct($options, $btHelper) + { + $this->allowedOptionValues = [ + 'direction' => ['start', 'end', 'up', 'down'], + 'alignment' => ['start', 'end'], + 'submenu_direction' => ['start', 'end', 'up', 'down'], + ]; + $this->processOptions($options); + $this->menu = $this->options['menu']; + $this->btHelper = $btHelper; + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->options['dropdown-class'] = $this->convertToArrayIfNeeded($this->options['dropdown-class']); + $this->checkOptionValidity(); + } + + public function dropdownMenu() + { + return $this->fullDropdown(); + } + + public function fullDropdown() + { + return $this->genDropdownWrapper($this->genDropdownToggleButton(), $this->genDropdownMenu($this->menu)); + } + + public function genDropdownWrapper($toggle = '', $menu = '', $direction = null, $classes = null) + { + $classes = !is_null($classes) ? $classes : $this->options['dropdown-class']; + $direction = !is_null($direction) ? $direction : $this->options['direction']; + $content = $toggle . $menu; + $html = $this->node('div', array_merge( + $this->options['attrs'], + [ + 'class' => array_merge( + $classes, + [ + 'dropdown', + "drop{$direction}" + ] + ) + ] + ), $content); + return $html; + } + + public function genDropdownToggleButton() + { + $defaultOptions = [ + 'class' => ['dropdown-toggle'], + 'attrs' => [ + 'data-bs-toggle' => 'dropdown', + 'aria-expanded' => 'false', + ] + ]; + $options = array_merge_recursive($this->options['button'], $defaultOptions); + return $this->btHelper->button($options); + } + + private function genDropdownMenu($entries, $alignment = null) + { + $alignment = !is_null($alignment) ? $alignment : $this->options['alignment']; + $html = $this->node('div', [ + 'class' => ['dropdown-menu', "dropdown-menu-{$alignment}"], + ], $this->genEntries($entries)); + return $html; + } + + private function genEntries($entries) + { + $html = ''; + foreach ($entries as $entry) { + $link = $this->genEntry($entry); + if (!empty($entry['menu'])) { + $html .= $this->genDropdownWrapper($link, $this->genDropdownMenu($entry['menu']), $this->options['submenu_direction'], $this->options['submenu_classes']); + } else { + $html .= $link; + } + } + return $html; + } + + private function genEntry($entry) + { + if (!empty($entry['html'])) { + return $entry['html']; + } + $classes = []; + $icon = ''; + if (!empty($entry['icon'])) { + $icon = $this->btHelper->icon($entry['icon'], ['class' => 'me-2']); + } + $badge = ''; + if (!empty($entry['badge'])) { + $bsBadge = new BootstrapBadge(array_merge( + ['class' => ['ms-auto']], + $entry['badge'] + )); + $badge = $bsBadge->badge(); + } + + if (!empty($entry['header'])) { + return $this->node('h6', [ + 'class' => ['dropdown-header',], + ], $icon . h($entry['text']) . $badge); + } + + $classes = ['dropdown-item']; + $params = ['href' => '#']; + + if (!empty($entry['menu'])) { + $classes[] = 'dropdown-toggle'; + $classes[] = 'd-flex align-items-center'; + $params['data-bs-toggle'] = 'dropdown'; + $params['aria-haspopup'] = 'true'; + $params['aria-expanded'] = 'false'; + if (!empty($entry['keepOpen'])) { + $classes[] = 'open-form'; + } + $params['data-open-form-id'] = mt_rand(); + } + + $labelContent = sprintf( + '%s%s', + h($entry['text']), + !empty($entry['sup']) ? $this->node('sup', ['class' => 'ms-1 text-muted'], $entry['sup']) : '' + ); + $label = $this->node('span', ['class' => 'mx-1'], $labelContent); + $content = $icon . $label . $badge; + + return $this->node('a', array_merge([ + 'class' => $classes, + ], $params), $content); + } +} diff --git a/src/View/Helper/BootstrapElements/BootstrapIcon.php b/src/View/Helper/BootstrapElements/BootstrapIcon.php new file mode 100644 index 0000000..085d9ae --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapIcon.php @@ -0,0 +1,61 @@ +Bootstrap->icon('eye-slash', [ + * 'class' => 'm-3', + * ]); + */ +class BootstrapIcon extends BootstrapGeneric +{ + private $icon = ''; + private $defaultOptions = [ + 'class' => [], + 'title' => '', + 'attrs' => [], + ]; + + function __construct($icon, $options = []) + { + $this->icon = $icon; + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->checkOptionValidity(); + $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); + } + + public function icon() + { + return $this->genIcon(); + } + + private function genIcon() + { + $html = $this->node('span', array_merge( + [ + 'class' => array_merge( + $this->options['class'], + ["fa fa-{$this->icon}"] + ), + 'title' => h($this->options['title']) + ], + $this->options['attrs'] + )); + return $html; + } +} \ No newline at end of file diff --git a/src/View/Helper/BootstrapElements/BootstrapListGroup.php b/src/View/Helper/BootstrapElements/BootstrapListGroup.php new file mode 100644 index 0000000..9c98852 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapListGroup.php @@ -0,0 +1,117 @@ +Bootstrap->listGroup( + * [ + * [ + * 'text' => 'test', + * 'badge' => [ + * 'text' => 'test', + * 'variant' => 'warning' + * ], + * 'attrs' => [ + * 'data-test' => 'tes' + * ] + * ], + * [ + * 'html' => 'test2', + * ], + * ], + * [ + * 'class' => 'container-class' + * ] + * ); + */ +class BootstrapListGroup extends BootstrapGeneric +{ + private $defaultOptions = [ + 'class' => [], + 'attrs' => [], + ]; + + private $defaultItemOptions = [ + 'href' => '#', + 'text' => '', + 'html' => null, + 'badge' => '', + 'class' => [], + 'attrs' => [], + ]; + + private static $defaultClasses = ['list-group',]; + private static $defaultItemClasses = ['list-group-item', 'list-group-item-action', 'd-flex', 'align-items-start', 'justify-content-between']; + + function __construct($items, $options, $btHelper) + { + $this->items = $items; + $this->processOptions($options); + $this->btHelper = $btHelper; + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); + } + + public function listGroup() + { + return $this->genListGroup(); + } + + private function genListGroup() + { + $html = $this->nodeOpen('div', array_merge([ + 'class' => array_merge(self::$defaultClasses, $this->options['class']), + ], $this->options['attrs'])); + foreach ($this->items as $item) { + $html .= $this->genItem($item); + } + $html .= $this->nodeClose('div'); + return $html; + } + + private function genItem($item) + { + $item['class'] = !is_array($item['class']) ? [$item['class']] : $item['class']; + $itemOptions = array_merge($this->defaultItemOptions, $item); + $itemOptions['class'] = array_merge(self::$defaultItemClasses, $itemOptions['class']); + + $html = $this->node('a', + array_merge([ + 'class' => array_merge(self::$defaultItemClasses, $itemOptions['class']), + 'href' => '#', + ], $itemOptions['attrs']), + [ + !is_null($itemOptions['html']) ? $this->node('div', ['class' => 'w-100'], $itemOptions['html']) : h($itemOptions['text']), + $this->genBadge($itemOptions['badge']) + ], + ); + return $html; + } + + private function genBadge($badge) + { + if (empty($badge)) { + return ''; + } + return $this->btHelper->badge($badge); + } +} \ No newline at end of file diff --git a/src/View/Helper/BootstrapElements/BootstrapListTable.php b/src/View/Helper/BootstrapElements/BootstrapListTable.php new file mode 100644 index 0000000..77aaddb --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapListTable.php @@ -0,0 +1,222 @@ + or array + * + * # Options for fields + * - key: The name of the field to be displayed as a label + * - keyHtml: The HTML of the field to be displayed as a label + * - path: The path to be fed to Hash::get() in order to get the value from the $item + * - raw: The raw value to be displayed. Disable the `path` option + * - rawNoEscaping: If the raw value should not be escaped. False by default + * - type: The type of element to use combined with $elementsRootPath from the table's option + * - formatter: A callback function to format the value + * - cellVariant: The bootstrap variant to be applied on the cell + * - rowVariant: The bootstrap variant to be applied on the row + * - notice_$variant: A text with the passed variant to be append at the end + * + * # Usage: + * $this->Bootstrap->listTable( + * [ + * 'hover' => false, + * 'variant' => 'success', + * ], + * [ + * 'item' => [ + * 'key1' => 'value1', + * 'key2' => true, + * 'key3' => 'value3', + * ], + * 'fields' => [ + * [ + * 'key' => 'Label 1', + * 'path' => 'key1', + * 'notice_warning' => '::warning::', + * 'notice_danger' => '::danger::', + * 'rowVariant' => 'danger', + * 'cellVariant' => 'success', + * ], + * [ + * 'key' => 'Label 2', + * 'path' => 'key2', + * 'type' => 'boolean', + * ], + * [ + * 'key' => 'Label 3', + * 'raw' => 'raw_value', + * 'rawNoEscaping' => true, + * ], + * [ + * 'key' => 'Label 4', + * 'path' => 'key3', + * 'formatter' => function ($value) { + * return '' . $value . ''; + * }, + * ], + * ], + * 'caption' => 'This is a caption' + * ] + * ); + */ +class BootstrapListTable extends BootstrapGeneric +{ + private $defaultOptions = [ + 'striped' => true, + 'bordered' => false, + 'borderless' => false, + 'hover' => true, + 'small' => false, + 'variant' => '', + 'tableClass' => [], + 'bodyClass' => [], + 'id' => '', + 'caption' => '', + 'elementsRootPath' => '/genericElements/SingleViews/Fields/', + ]; + + function __construct($options, $data, $btHelper) + { + $this->allowedOptionValues = [ + 'variant' => array_merge(BootstrapGeneric::$variants, ['']) + ]; + $this->processOptions($options); + $this->fields = $data['fields']; + $this->item = $data['item']; + $this->caption = !empty($data['caption']) ? $data['caption'] : ''; + $this->btHelper = $btHelper; + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->options['tableClass'] = $this->convertToArrayIfNeeded($this->options['tableClass']); + $this->options['bodyClass'] = $this->convertToArrayIfNeeded($this->options['bodyClass']); + $this->checkOptionValidity(); + } + + public function table() + { + return $this->genTable(); + } + + private function genTable() + { + $html = $this->nodeOpen('table', [ + 'class' => [ + 'table', + "table-{$this->options['variant']}", + $this->options['striped'] ? 'table-striped' : '', + $this->options['bordered'] ? 'table-bordered' : '', + $this->options['borderless'] ? 'table-borderless' : '', + $this->options['hover'] ? 'table-hover' : '', + $this->options['small'] ? 'table-sm' : '', + implode(' ', $this->options['tableClass']), + !empty($this->options['variant']) ? "table-{$this->options['variant']}" : '', + ], + 'id' => $this->options['id'] ?? '' + ]); + + $html .= $this->genCaption(); + $html .= $this->genBody(); + + $html .= $this->nodeClose('table'); + return $html; + } + + private function genBody() + { + $body = $this->nodeOpen('tbody', [ + 'class' => $this->options['bodyClass'], + ]); + foreach ($this->fields as $i => $field) { + $body .= $this->genRow($field); + } + $body .= $this->nodeClose('tbody'); + return $body; + } + + private function genRow($field) + { + $rowValue = $this->genCell($field); + $rowKey = $this->node('th', [ + 'class' => [ + 'col-4 col-sm-2' + ], + 'scope' => 'row' + ], $field['keyHtml'] ?? h($field['key'])); + $row = $this->node('tr', [ + 'class' => [ + 'd-flex', + !empty($field['rowVariant']) ? "table-{$field['rowVariant']}" : '' + ] + ], [$rowKey, $rowValue]); + return $row; + } + + private function genCell($field = []) + { + if (isset($field['raw'])) { + $cellContent = !empty($field['rawNoEscaping']) ? $field['raw'] : h($field['raw']); + } else if (isset($field['formatter'])) { + $cellContent = $field['formatter']($this->getValueFromObject($field), $this->item); + } else if (isset($field['type'])) { + $cellContent = $this->btHelper->getView()->element($this->getElementPath($field['type']), [ + 'data' => $this->item, + 'field' => $field + ]); + } else { + $cellContent = h($this->getValueFromObject($field)); + } + foreach (BootstrapGeneric::$variants as $variant) { + if (!empty($field["notice_$variant"])) { + $cellContent .= sprintf(' %s', $variant, $field["notice_$variant"]); + } + } + return $this->node('td', [ + 'class' => [ + 'col-8 col-sm-10', + !empty($field['cellVariant']) ? "bg-{$field['cellVariant']}" : '' + ] + ], $cellContent); + } + + private function getValueFromObject($field) + { + $key = is_array($field) ? $field['path'] : $field; + $cellValue = Hash::get($this->item, $key); + return $cellValue; + } + + private function getElementPath($type) + { + return sprintf( + '%s%sField', + $this->options['elementsRootPath'] ?? '', + $type + ); + } + + private function genCaption() + { + return !empty($this->caption) ? $this->node('caption', [], h($this->caption)) : ''; + } +} \ No newline at end of file diff --git a/src/View/Helper/BootstrapElements/BootstrapModal.php b/src/View/Helper/BootstrapElements/BootstrapModal.php new file mode 100644 index 0000000..d04a6fd --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapModal.php @@ -0,0 +1,343 @@ +Bootstrap->modal([ + * 'title' => 'Modal title', + * 'size' => 'lg', + * 'type' => 'ok-only', + * 'body' => 'Body content', + * 'header-variant' => 'dark', + * 'body-variant' => 'light', + * 'footer-variant' => 'warning', + * 'show' => true, + * ]); + + * ## Modal with custom onclick handler + * $this->Bootstrap->modal([ + * 'type' => 'confirm', + * 'bodyHtml' => 'Body content', + * 'confirmButton' => [ + * 'text' => 'Show modal', + * 'icon' => 'eye', + * 'onclick' => 'UI.toast({"title": "confirmed!"})', + * ], + * 'cancelOnclick' => 'UI.toast({"title": "cancelled"})', + * 'show' => true, + * ]); + * + * ## Modal with a onclick handler with prepared arguments bound to the confirm button + * $this->Bootstrap->modal([ + * 'type' => 'confirm', + * 'confirmButton' => [ + * 'text' => 'Confirm', + * 'icon' => 'check', + * ], + * 'confirmFunction' => 'myConfirmFunction', // myConfirmFunction is called with the $modalObject and $tmpApi intialized + * 'show' => true, + * ]); + * + * /* + * Example of confirm function + * - case 1: If void is returned the modal close automatically regardless of the result + * - case 2: If a promise is returned, the modal close automatically if the promise is a success + * A success is defined as follow: + * - No exceptions + * - No data returned + * - Object returned with key `success` evaluting to true + * - case 3: The modal can be closed manually with: `modalObject.hide()` + * + * function myConfirmFunction(modalObject, tmpApi) { + * const $form = modalObject.$modal.find('form') + * const postPromise = $form.length == 1 ? + * tmpApi.postForm($form[0]) : + * tmpApi.fetchJSON('/users/view/', false, true) + * .then((result) => { + * console.log(result) + * constToReturn = { + * success: true, // will close the modal automatically + * } + * return constToReturn + * }) + * .catch((errors) => { + * console.log(errors) + * }) + * + * return postPromise + * } + + * ## Modal with custom footer made of buttons + * $this->Bootstrap->modal([ + * 'type' => 'custom', + * 'footerButtons' => [ + * [ + * 'text' => 'Confirm', + * 'icon' => 'check', + * 'variant' => 'danger', + * 'clickFunction' => 'testapi', + * ], + * [ + * 'text' => 'Cancel', + * 'onclick' => 'UI.toast({"title": "confirmed!"})', + * ], + * ], + * 'show' => true, + * ]); + */ +class BootstrapModal extends BootstrapGeneric +{ + private $defaultOptions = [ + 'size' => '', + 'centered' => true, + 'scrollable' => true, + 'backdropStatic' => false, + 'show' => false, + 'header-variant' => '', + 'body-variant' => '', + 'footer-variant' => '', + 'title' => '', + 'titleHtml' => null, + 'body' => '', + 'bodyHtml' => null, + 'footerHtml' => null, + 'modalClass' => [''], + 'headerClass' => [''], + 'bodyClass' => [''], + 'footerClass' => [''], + 'confirmButton' => [ + 'text' => 'Confirm', + ], + 'cancelButton' => [ + 'text' => 'Cancel', + ], + 'type' => 'ok-only', + 'footerButtons' => [], + 'confirmFunction' => '', // Will be called with the following arguments confirmFunction(modalObject, tmpApi) + 'cancelOnclick' => '' + ]; + + function __construct($options) + { + $this->allowedOptionValues = [ + 'size' => ['sm', 'lg', 'xl', ''], + 'type' => ['ok-only', 'confirm', 'custom'], + 'header-variant' => array_merge(BootstrapGeneric::$variants, ['']), + 'body-variant' => array_merge(BootstrapGeneric::$variants, ['']), + 'footer-variant' => array_merge(BootstrapGeneric::$variants, ['']), + ]; + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->checkOptionValidity(); + $this->options['modalClass'] = $this->convertToArrayIfNeeded($this->options['modalClass']); + $this->options['headerClass'] = $this->convertToArrayIfNeeded($this->options['headerClass']); + $this->options['bodyClass'] = $this->convertToArrayIfNeeded($this->options['bodyClass']); + $this->options['footerClass'] = $this->convertToArrayIfNeeded($this->options['footerClass']); + + $possiblVariants = ['header-variant', 'body-variant', 'footer-variant']; + foreach ($possiblVariants as $possiblVariant) { + if (!empty($this->options[$possiblVariant])) { + $this->options[sprintf('%sClass', substr($possiblVariant, 0, -8))][] = self::getBGAndTextClassForVariant($this->options[$possiblVariant]); + } + } + + if (!empty($options['confirmFunction']) && !empty($options['confirmButton']['onclick'])) { + throw new \InvalidArgumentException(__('Option `{0}` can not be used in conjuction with `{1}` for the confirm button', 'confirmFunction', 'onclick')); + } + } + + public function modal() + { + $modal = $this->genModal(); + if ($this->options['show']) { + return $this->encapsulateWithUIHelper($modal); + } + return $modal; + } + + private function encapsulateWithUIHelper(string $modal): string + { + return $this->node('script', [], sprintf( + "$(document).ready(function() { + setTimeout(() => { + UI.modal({ + rawHtml: \"%s\" + }) + }, 1); + })", + str_replace('"', '\"', $modal) + )); + } + + private function genModal() + { + $dialog = $this->nodeOpen('div', [ + 'class' => array_merge( + ['modal-dialog', (!empty($this->options['size'])) ? "modal-{$this->options['size']}" : ''], + $this->options['modalClass'] + ), + ]); + $content = $this->nodeOpen('div', [ + 'class' => ['modal-content'], + ]); + $header = $this->genHeader(); + $body = $this->genBody(); + $footer = $this->genFooter(); + $closedDiv = $this->nodeClose('div'); + + $html = "{$dialog}{$content}{$header}{$body}{$footer}{$closedDiv}{$closedDiv}"; + return $html; + } + + private function genHeader() + { + $header = $this->nodeOpen('div', ['class' => array_merge(['modal-header'], $this->options['headerClass'])]); + $header .= $this->options['titleHtml'] ?? $this->node('h5', ['class' => ['modal-title']], h($this->options['title'])); + if (empty($this->options['backdropStatic'])) { + $header .= $this->genericCloseButton('modal'); + } + $header .= $this->nodeClose('div'); + return $header; + } + + private function genBody() + { + $body = $this->nodeOpen('div', ['class' => array_merge(['modal-body'], $this->options['bodyClass'])]); + $body .= $this->options['bodyHtml'] ?? h($this->options['body']); + $body .= $this->nodeClose('div'); + return $body; + } + + private function genFooter() + { + $footer = $this->nodeOpen('div', [ + 'class' => array_merge(['modal-footer'], $this->options['footerClass']), + 'data-custom-footer' => $this->options['type'] == 'custom' + ]); + $footer .= $this->options['footerHtml'] ?? $this->getFooterBasedOnType(); + $footer .= $this->nodeClose('div'); + return $footer; + } + + private function getFooterBasedOnType() + { + if ($this->options['type'] == 'ok-only') { + return $this->getFooterOkOnly(); + } else if (str_contains($this->options['type'], 'confirm')) { + return $this->getFooterConfirm(); + } else if ($this->options['type'] == 'custom') { + return $this->getFooterCustom(); + } else { + return $this->getFooterOkOnly(); + } + } + + private function getFooterOkOnly() + { + return (new BootstrapButton([ + 'variant' => 'primary', + 'text' => __('Ok'), + 'onclick' => $this->options['confirmOnclick'], + 'attrs' => [ + 'data-bs-dismiss' => $this->options['confirmOnclick'] ?? 'modal', + ], + ]))->button(); + } + + private function getFooterConfirm() + { + $buttonCancelConfig = array_merge( + [ + 'variant' => 'secondary', + 'attrs' => [ + 'data-bs-dismiss' => 'modal', + 'onclick' => $this->options['cancelOnclick'] + ] + ], + $this->options['cancelButton'], + ); + $buttonCancel = (new BootstrapButton($buttonCancelConfig))->button(); + + $defaultConfig = [ + 'variant' => 'primary', + 'class' => 'modal-confirm-button', + ]; + if (!empty($this->options['confirmOnclick'])) { + $defaultConfig['onclick'] = $this->options['confirmOnclick']; + } + if (!empty($this->options['confirmFunction'])) { + $defaultConfig['attrs']['data-confirmFunction'] = $this->options['confirmFunction']; + } + $buttonConfirmConfig = array_merge( + $defaultConfig, + $this->options['confirmButton'], + ); + $buttonConfirm = (new BootstrapButton($buttonConfirmConfig))->button(); + return $buttonCancel . $buttonConfirm; + } + + private function getFooterCustom() + { + $buttons = []; + foreach ($this->options['footerButtons'] as $buttonConfig) { + $defaultConfig = [ + 'variant' => 'primary', + 'class' => 'modal-confirm-button', + 'attrs' => [ + 'data-bs-dismiss' => !empty($buttonConfig['clickFunction']) ? '' : 'modal', + ] + ]; + if (!empty($buttonConfig['clickFunction'])) { + $defaultConfig['attrs']['data-clickFunction'] = $buttonConfig['clickFunction']; + } + $buttonConfig = array_merge( + $defaultConfig, + $buttonConfig, + ); + $buttons[] = (new BootstrapButton($buttonConfig))->button(); + } + return implode('', $buttons); + } +} diff --git a/src/View/Helper/BootstrapElements/BootstrapNotificationBubble.php b/src/View/Helper/BootstrapElements/BootstrapNotificationBubble.php new file mode 100644 index 0000000..d9744d2 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapNotificationBubble.php @@ -0,0 +1,106 @@ +Bootstrap->notificationBubble([ + * 'text' => '3', + * 'variant' => 'warning', + * 'title' => '3 unread messages', + * ]); + */ +class BootstrapNotificationBubble extends BootstrapGeneric +{ + private $defaultOptions = [ + 'text' => '', + 'variant' => 'warning', + 'borderVariant' => '', + 'title' => '', + 'class' => [], + 'attrs' => [], + ]; + + function __construct($options) + { + $this->allowedOptionValues = [ + 'variant' => BootstrapGeneric::$variants, + 'borderVariant' => array_merge(BootstrapGeneric::$variants, ['']), + ]; + $this->defaultOptions['title'] = __('New notifications'); + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->checkOptionValidity(); + $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); + if (!empty($this->options['borderVariant'])) { + if (!empty($this->options['attrs']['style'])) { + $this->options['attrs']['style'] .= 'box-shadow: 0 0.125rem 0.25rem #00000050;'; + } else { + $this->options['attrs']['style'] = 'box-shadow: 0 0.125rem 0.25rem #00000050;'; + } + } + } + + public function notificationBubble() + { + return $this->genNotificationBubble(); + } + + private function genNotificationBubble() + { + $tmpId = 'tmp-' . mt_rand(); + $defaultClasses = [ + 'position-absolute', + 'top-0', + 'start-100', + 'translate-middle', + 'p-1', + 'rounded-circle', + ]; + if (!empty($this->options['borderVariant'])) { + $defaultClasses[] = "border border-2 border-{$this->options['borderVariant']}"; + } + if (!empty($this->options['variant'])) { + $defaultClasses[] = "bg-{$this->options['variant']}"; + } + + if (!empty($this->options['text'])) { + $this->options['attrs']['style'] .= ' min-width: 0.7rem; line-height: 1; box-sizing: content-box;'; + $defaultClasses[] = 'text-center'; + $defaultClasses[] = 'fs-8'; + $defaultClasses[] = 'fw-bold'; + } + + $html = $this->node('span', + array_merge( + [ + 'id' => $tmpId, + 'class' => array_merge( + $defaultClasses, + $this->options['class'] + ), + 'title' => h($this->options['title']) + ], + $this->options['attrs'] + ), + !empty($this->options['text']) ? $this->node('span', [], h($this->options['text'])) : '' + ); + return $html; + } +} \ No newline at end of file diff --git a/src/View/Helper/BootstrapElements/BootstrapProgress.php b/src/View/Helper/BootstrapElements/BootstrapProgress.php new file mode 100644 index 0000000..7bb861e --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapProgress.php @@ -0,0 +1,88 @@ +Bootstrap->progress([ + * 'value' => 45, + * 'total' => 100, + * 'label' => true, + * ]); + * + */ +class BootstrapProgress extends BootstrapGeneric +{ + private $defaultOptions = [ + 'value' => 0, + 'total' => 100, + 'label' => true, + 'title' => '', + 'variant' => 'primary', + 'height' => '', + 'striped' => false, + 'animated' => false, + 'attrs' => [], + ]; + + function __construct($options) + { + $this->allowedOptionValues = [ + 'variant' => BootstrapGeneric::$variants, + ]; + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->checkOptionValidity(); + } + + public function progress() + { + return $this->genProgress(); + } + + private function genProgress() + { + $percentage = round(100 * $this->options['value'] / $this->options['total']); + $heightStyle = !empty($this->options['height']) ? sprintf('height: %s;', h($this->options['height'])) : ''; + $widthStyle = sprintf('width: %s%%;', $percentage); + $label = !empty($this->options['label']) ? ($this->options['label'] === true ? "{$percentage}%" : h($this->options['label'])) : ''; + $pb = $this->node('div', array_merge([ + 'class' => [ + 'progress-bar', + "bg-{$this->options['variant']}", + $this->options['striped'] ? 'progress-bar-striped' : '', + $this->options['animated'] ? 'progress-bar-animated' : '', + ], + 'role' => "progressbar", + 'aria-valuemin' => "0", 'aria-valuemax' => "100", 'aria-valuenow' => $percentage, + 'style' => $widthStyle, + 'title' => h($this->options['title']), + ], $this->options['attrs']), $label); + $container = $this->node('div', [ + 'class' => [ + 'progress', + ], + 'style' => $heightStyle, + 'title' => h($this->options['title']), + ], $pb); + return $container; + } +} diff --git a/src/View/Helper/BootstrapElements/BootstrapProgressTimeline.php b/src/View/Helper/BootstrapElements/BootstrapProgressTimeline.php new file mode 100644 index 0000000..6243a5e --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapProgressTimeline.php @@ -0,0 +1,153 @@ +Bootstrap->progressTimeline([ + * 'selected' => 1, + * 'steps' => [ + * [ + * 'text' => __('Step 1'), + * 'icon' => 'star', + * 'title' => __('Title'), + * ], + * [ + * 'text' => __('Step 3'), + * 'icon' => 'exchange-alt', + * ] + * ], + * ]); + */ +class BootstrapProgressTimeline extends BootstrapGeneric +{ + private $defaultOptions = [ + 'steps' => [], + 'selected' => 0, + 'variant' => 'primary', + 'variantInactive' => 'secondary', + ]; + + function __construct($options, $btHelper) + { + $this->allowedOptionValues = [ + 'variant' => BootstrapGeneric::$variants, + 'variantInactive' => BootstrapGeneric::$variants, + ]; + $this->processOptions($options); + $this->btHelper = $btHelper; + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->checkOptionValidity(); + } + + public function progressTimeline() + { + return $this->genProgressTimeline(); + } + + private function getStepIcon($step, $i, $nodeActive, $lineActive) + { + $icon = $this->node('b', [ + 'class' => [ + !empty($step['icon']) ? h($this->btHelper->FontAwesome->getClass($step['icon'])) : '', + $this->getTextClassForVariant($this->options['variant']) + ], + ], empty($step['icon']) ? h($i + 1) : ''); + + $containerDefaultClass = [ + 'd-flex', + 'align-items-center', + 'justify-content-center', + 'rounded-circle', + ]; + $containerDefaultClass[] = $nodeActive ? "bg-{$this->options['variant']}" : "bg-{$this->options['variantInactive']}"; + $iconContainer = $this->node('span', [ + 'class' => $containerDefaultClass, + 'style' => 'width:50px; height:50px' + ], $icon); + $li = $this->node('li', [ + 'class' => [ + 'd-flex', 'flex-column', + $nodeActive ? 'progress-active' : 'progress-inactive', + ], + ], $iconContainer); + $html = $li . $this->getHorizontalLine($i, $nodeActive, $lineActive); + return $html; + } + + private function getHorizontalLine($i, $nodeActive, $lineActive) + { + $stepCount = count($this->options['steps']); + if ($i == $stepCount - 1) { + return ''; + } + $progressBar = (new BootstrapProgress([ + 'label' => false, + 'value' => $nodeActive ? ($lineActive ? 100 : 50) : 0, + 'height' => '2px', + 'variant' => $this->options['variant'] + ]))->progress(); + $line = $this->node('span', [ + 'class' => [ + 'progress-line', + 'flex-grow-1', 'align-self-center', + $lineActive ? "bg-{$this->options['variant']}" : '' + ], + ], $progressBar); + return $line; + } + + private function getStepText($step, $isActive) + { + return $this->node('li', [ + 'class' => [ + 'text-center', + 'fw-bold', + $isActive ? 'progress-active' : 'progress-inactive', + ], + ], h($step['text'] ?? '')); + } + + private function genProgressTimeline() + { + $iconLis = ''; + $textLis = ''; + foreach ($this->options['steps'] as $i => $step) { + $nodeActive = $i <= $this->options['selected']; + $lineActive = $i < $this->options['selected']; + $iconLis .= $this->getStepIcon($step, $i, $nodeActive, $lineActive); + $textLis .= $this->getStepText($step, $nodeActive); + } + $ulIcons = $this->node('ul', [ + 'class' => [ + 'd-flex', 'justify-content-around', + ], + ], $iconLis); + $ulText = $this->node('ul', [ + 'class' => [ + 'd-flex', 'justify-content-between', + ], + ], $textLis); + $html = $this->node('div', [ + 'class' => ['progress-timeline', 'mw-75', 'mx-auto'] + ], $ulIcons . $ulText); + return $html; + } +} \ No newline at end of file diff --git a/src/View/Helper/BootstrapElements/BootstrapSwitch.php b/src/View/Helper/BootstrapElements/BootstrapSwitch.php new file mode 100644 index 0000000..984964c --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapSwitch.php @@ -0,0 +1,81 @@ +Bootstrap->switch([ + * 'label' => 'my label', + * 'checked' => true, + * ]); + */ +class BootstrapSwitch extends BootstrapGeneric +{ + private $defaultOptions = [ + 'label' => '', + 'variant' => 'primary', + 'disabled' => false, + 'checked' => false, + 'title' => '', + 'class' => [], + 'attrs' => [], + ]; + + public function __construct($options) + { + $this->allowedOptionValues = [ + 'variant' => BootstrapGeneric::$variants, + ]; + $this->processOptions($options); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->checkOptionValidity(); + } + + public function switch() + { + return $this->genSwitch(); + } + + public function genSwitch() + { + $tmpId = 'tmp-' . mt_rand(); + $input = self::node('input', array_merge( + [ + 'type' => "checkbox", + 'class' => 'form-check-input', + 'id' => $tmpId, + 'disabled' => !empty($this->options['disabled']), + 'checked' => !empty($this->options['checked']), + ], + $this->options['attrs'] + )); + $label = self::node('label', [ + 'class' => 'form-check-label', + 'for' => $tmpId, + ], h($this->options['label'])); + $html = self::node('div', [ + 'class' => [ + 'form-check form-switch', + ], + 'title' => h($this->options['title']), + ], [$input, $label]); + return $html; + } +} \ No newline at end of file diff --git a/src/View/Helper/BootstrapElements/BootstrapTable.php b/src/View/Helper/BootstrapElements/BootstrapTable.php new file mode 100644 index 0000000..c69dc76 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapTable.php @@ -0,0 +1,238 @@ +Bootstrap->table( + * [ + * 'hover' => false, + * 'striped' => 'false', + * ], + * [ + * 'items' => [ + * ['column 1' => 'col1', 'column 2' => 'col2', 'key1' => 'val1', 'key2' => true], + * ['column 1' => 'col1', 'column 2' => 'col2', 'key1' => 'val2', 'key2' => false,'_rowVariant' => 'success'], + * ['column 1' => 'col1', 'column 2' => 'col2', 'key1' => 'val3', 'key2' => true], + * ], + * 'fields' => [ + * 'column 1', + * [ + * 'path' => 'column 2', + * 'label' => 'COLUMN 2', + * 'columnVariant' => 'danger', + * ], + * [ + * 'labelHtml' => 'column 3', + * ], + * [ + * 'path' => 'key1', + * 'label' => __('Field'), + * 'formatter' => function ($field, $row) { + * return sprintf('%s', h($field)); + * } + * ], + * [ + * 'path' => 'key2', + * 'element' => 'boolean', + * ], + * ], + * 'caption' => 'This is a caption' + * ] + * ); + */ +class BootstrapTable extends BootstrapGeneric +{ + private $defaultOptions = [ + 'striped' => true, + 'bordered' => true, + 'borderless' => false, + 'hover' => true, + 'small' => false, + 'variant' => '', + 'tableClass' => [], + 'headerClass' => [], + 'bodyClass' => [], + 'id' => '', + 'caption' => '', + 'elementsRootPath' => '/genericElements/SingleViews/Fields/', + ]; + + function __construct($options, $data, $btHelper) + { + $this->allowedOptionValues = [ + 'variant' => array_merge(BootstrapGeneric::$variants, ['']) + ]; + $this->processOptions($options); + $this->fields = $data['fields']; + $this->items = $data['items']; + $this->caption = !empty($data['caption']) ? $data['caption'] : ''; + $this->btHelper = $btHelper; + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->checkOptionValidity(); + $this->options['tableClass'] = $this->convertToArrayIfNeeded($this->options['tableClass']); + $this->options['bodyClass'] = $this->convertToArrayIfNeeded($this->options['bodyClass']); + $this->options['headerClass'] = $this->convertToArrayIfNeeded($this->options['headerClass']); + } + + public function table() + { + return $this->genTable(); + } + + private function genTable() + { + $html = $this->nodeOpen('table', [ + 'class' => [ + 'table', + "table-{$this->options['variant']}", + $this->options['striped'] ? 'table-striped' : '', + $this->options['bordered'] ? 'table-bordered' : '', + $this->options['borderless'] ? 'table-borderless' : '', + $this->options['hover'] ? 'table-hover' : '', + $this->options['small'] ? 'table-sm' : '', + implode(' ', $this->options['tableClass']), + !empty($this->options['variant']) ? "table-{$this->options['variant']}" : '', + ], + 'id' => $this->options['id'] ?? '' + ]); + + $html .= $this->genCaption(); + $html .= $this->genHeader(); + $html .= $this->genBody(); + + $html .= $this->nodeClose('table'); + return $html; + } + + private function genHeader() + { + $head = $this->nodeOpen('thead', [ + 'class' => $this->options['headerClass'], + ]); + $head .= $this->nodeOpen('tr'); + foreach ($this->fields as $i => $field) { + if (is_array($field)) { + if (!empty($field['labelHtml'])) { + $label = $field['labelHtml']; + } else { + $label = !empty($field['label']) ? $field['label'] : Inflector::humanize($field['path']); + $label = h($label); + } + } else { + $label = Inflector::humanize($field); + $label = h($label); + } + $head .= $this->node('th', [], $label); + } + $head .= $this->nodeClose('tr'); + $head .= $this->nodeClose('thead'); + return $head; + } + + private function genBody() + { + $body = $this->nodeOpen('tbody', [ + 'class' => $this->options['bodyClass'], + ]); + foreach ($this->items as $i => $row) { + $body .= $this->genRow($row, $i); + } + $body .= $this->nodeClose('tbody'); + return $body; + } + + private function genRow($row, $rowIndex) + { + $html = $this->nodeOpen('tr', [ + 'class' => [ + !empty($row['_rowVariant']) ? "table-{$row['_rowVariant']}" : '' + ] + ]); + if (array_keys($row) !== range(0, count($row) - 1)) { // associative array + foreach ($this->fields as $i => $field) { + $cellValue = $this->getValueFromObject($row, $field); + $html .= $this->genCell($cellValue, $field, $row, $rowIndex); + } + } else { // indexed array + foreach ($row as $i => $cellValue) { + $html .= $this->genCell($cellValue, 'index', $row, $rowIndex); + } + } + $html .= $this->nodeClose('tr'); + return $html; + } + + private function genCell($value, $field = [], $row = [], $rowIndex = 0) + { + if (isset($field['formatter'])) { + $cellContent = $field['formatter']($value, $row, $rowIndex); + } else if (isset($field['element'])) { + $cellContent = $this->btHelper->getView()->element($this->getElementPath($field['element']), [ + 'data' => [$value], + 'field' => ['path' => '0'] + ]); + } else { + $cellContent = h($value); + } + return $this->node('td', [ + 'class' => [ + !empty($field['columnVariant']) ? "table-{$field['columnVariant']}" : '' + ] + ], $cellContent); + } + + private function getValueFromObject($row, $field) + { + $path = is_array($field) ? $field['path'] : $field; + $cellValue = Hash::get($row, $path); + return $cellValue; + } + + private function getElementPath($type) + { + return sprintf( + '%s%sField', + $this->options['elementsRootPath'] ?? '', + $type + ); + } + + private function genCaption() + { + return !empty($this->caption) ? $this->node('caption', [], h($this->caption)) : ''; + } +} diff --git a/src/View/Helper/BootstrapElements/BootstrapTabs.php b/src/View/Helper/BootstrapElements/BootstrapTabs.php new file mode 100644 index 0000000..a0a7e59 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapTabs.php @@ -0,0 +1,307 @@ +Bootstrap->tabs([ + * 'horizontal-position' => 'top', + * 'header-variant' => 'danger', + * 'card' => true, + * 'data' => [ + * 'navs' => [ + * ['text' => 'nav 1'], + * ['html' => 'nav 2', 'active' => true], + * ], + * 'content' => [ + * 'content 1', + * 'content 2', + * ] + * ] + * ]); + * + * ## Simple formatted tabs using the card option and vertical options + * echo $this->Bootstrap->tabs([ + * 'pills' => true, + * 'vertical' => true, + * 'vertical-position' => 'start', + * 'card' => true, + * 'data' => [ + * 'navs' => [ + * ['text' => 'nav 1'], + * ['html' => 'nav 2', 'disabled' => true], + * ], + * 'content' => [ + * 'content 1', + * 'content 2', + * ] + * ] + * ]); + */ +class BootstrapTabs extends BootstrapGeneric +{ + private $defaultOptions = [ + 'fill-header' => false, + 'justify-header' => false, + 'pills' => false, + 'vertical' => false, + 'vertical-size' => 3, + 'vertical-position' => 'start', + 'horizontal-position' => 'top', + 'card' => false, + 'header-variant' => '', + 'body-variant' => '', + 'body-class' => [], + 'nav-class' => [], + 'nav-item-class' => [], + 'content-class' => [], + 'data' => [ + 'navs' => [], + 'content' => [], + ], + ]; + private $bsClasses = null; + + function __construct($options) + { + $this->allowedOptionValues = [ + 'justify-header' => [false, 'center', 'end', 'start'], + 'vertical-position' => ['start', 'end'], + 'horizontal-position' => ['top', 'bottom'], + 'body-variant' => array_merge(BootstrapGeneric::$variants, ['']), + 'header-variant' => array_merge(BootstrapGeneric::$variants, ['']), + ]; + $this->processOptions($options); + } + + public function tabs() + { + return $this->genTabs(); + } + + private function processOptions($options) + { + $this->options = array_merge($this->defaultOptions, $options); + $this->data = $this->options['data']; + $this->checkOptionValidity(); + if (empty($this->data['navs'])) { + throw new InvalidArgumentException(__('No navigation data provided')); + } + $this->bsClasses = [ + 'nav' => [], + 'nav-item' => $this->options['nav-item-class'], + ]; + + if (!empty($this->options['justify-header'])) { + $this->bsClasses['nav'][] = 'justify-content-' . $this->options['justify-header']; + } + + if ($this->options['vertical'] && !isset($options['pills']) && !isset($options['card'])) { + $this->options['pills'] = true; + $this->options['card'] = true; + } + + if ($this->options['pills']) { + $this->bsClasses['nav'][] = 'nav-pills'; + if ($this->options['vertical']) { + $this->bsClasses['nav'][] = 'flex-column'; + } + if ($this->options['card']) { + $this->bsClasses['nav'][] = 'card-header-pills'; + } + } else { + $this->bsClasses['nav'][] = 'nav-tabs'; + if ($this->options['card']) { + $this->bsClasses['nav'][] = 'card-header-tabs'; + } + } + + if ($this->options['fill-header']) { + $this->bsClasses['nav'][] = 'nav-fill'; + } + if ($this->options['justify-header']) { + $this->bsClasses['nav'][] = 'nav-justify'; + } + + $activeTab = array_key_first($this->data['navs']); + foreach ($this->data['navs'] as $i => $nav) { + if (!is_array($nav)) { + $this->data['navs'][$i] = ['text' => $nav]; + } + if (!isset($this->data['navs'][$i]['id'])) { + $this->data['navs'][$i]['id'] = 't-' . Security::randomString(8); + } + if (!empty($nav['active'])) { + $activeTab = $i; + } + } + $this->data['navs'][$activeTab]['active'] = true; + + if (!empty($this->options['vertical-size']) && $this->options['vertical-size'] != 'auto') { + $this->options['vertical-size'] = ($this->options['vertical-size'] < 0 || $this->options['vertical-size'] > 11) ? 3 : $this->options['vertical-size']; + } + + if (!is_array($this->options['nav-class'])) { + $this->options['nav-class'] = [$this->options['nav-class']]; + } + if (!is_array($this->options['content-class'])) { + $this->options['content-class'] = [$this->options['content-class']]; + } + } + + private function genTabs() + { + return $this->options['vertical'] ? $this->genVerticalTabs() : $this->genHorizontalTabs(); + } + + private function genHorizontalTabs() + { + if ($this->options['card']) { + $cardOptions = [ + 'bodyHTML' => $this->genContent(), + 'bodyVariant' => $this->options['body-variant'], + ]; + if ($this->options['horizontal-position'] === 'bottom') { + $cardOptions['footerHTML'] = $this->genNav(); + $cardOptions['footerVariant'] = $this->options['header-variant']; + $cardOptions['headerVariant'] = $this->options['header-variant']; + } else { + $cardOptions['headerHTML'] = $this->genNav(); + $cardOptions['headerVariant'] = $this->options['header-variant']; + } + $bsCard = new BootstrapCard($cardOptions); + return $bsCard->card(); + } else { + return $this->genNav() . $this->genContent(); + } + } + + private function genVerticalTabs() + { + $header = $this->node('div', ['class' => array_merge( + [ + ($this->options['vertical-size'] != 'auto' ? 'col-' . $this->options['vertical-size'] : ''), + ($this->options['card'] ? 'card-header border-end' : '') + ], + [ + "bg-{$this->options['header-variant']}", + "text-{$this->options['header-text-variant']}", + "border-{$this->options['header-border-variant']}" + ] + )], $this->genNav()); + $content = $this->node('div', ['class' => array_merge( + [ + ($this->options['vertical-size'] != 'auto' ? 'col-' . (12 - $this->options['vertical-size']) : ''), + ($this->options['card'] ? 'card-body2' : '') + ], + [ + "bg-{$this->options['body-variant']}", + "text-{$this->options['body-text-variant']}" + ] + )], $this->genContent()); + + $containerContent = $this->options['vertical-position'] === 'start' ? [$header, $content] : [$content, $header]; + $container = $this->node('div', ['class' => array_merge( + [ + 'row', + ($this->options['card'] ? 'card flex-row' : ''), + ($this->options['vertical-size'] == 'auto' ? 'flex-nowrap' : '') + ], + [ + "border-{$this->options['header-border-variant']}" + ] + )], $containerContent); + return $container; + } + + private function genNav() + { + $html = $this->nodeOpen('ul', [ + 'class' => array_merge(['nav'], $this->bsClasses['nav'], $this->options['nav-class']), + 'role' => 'tablist', + ]); + foreach ($this->data['navs'] as $navItem) { + $html .= $this->genNavItem($navItem); + } + $html .= $this->nodeClose('ul'); + return $html; + } + + private function genNavItem($navItem) + { + $html = $this->nodeOpen('li', [ + 'class' => array_merge(['nav-item'], $this->bsClasses['nav-item'], $this->options['nav-item-class']), + 'role' => 'presentation', + ]); + $html .= $this->nodeOpen('a', [ + 'class' => array_merge( + ['nav-link'], + [!empty($navItem['active']) ? 'active' : ''], + [!empty($navItem['disabled']) ? 'disabled' : ''] + ), + 'data-bs-toggle' => $this->options['pills'] ? 'pill' : 'tab', + 'id' => $navItem['id'] . '-tab', + 'href' => '#' . $navItem['id'], + 'aria-controls' => $navItem['id'], + 'aria-selected' => !empty($navItem['active']), + 'role' => 'tab', + ]); + $html .= $navItem['html'] ?? h($navItem['text']); + $html .= $this->nodeClose('a'); + $html .= $this->nodeClose('li'); + return $html; + } + + private function genContent() + { + $html = $this->nodeOpen('div', [ + 'class' => array_merge(['tab-content'], $this->options['content-class']), + ]); + foreach ($this->data['content'] as $i => $content) { + $navItem = $this->data['navs'][$i]; + $html .= $this->genContentItem($navItem, $content); + } + $html .= $this->nodeClose('div'); + return $html; + } + + private function genContentItem($navItem, $content) + { + return $this->node('div', [ + 'class' => array_merge(['tab-pane', 'fade'], [!empty($navItem['active']) ? 'show active' : '']), + 'role' => 'tabpanel', + 'id' => $navItem['id'], + 'aria-labelledby' => $navItem['id'] . '-tab' + ], $content); + } +} diff --git a/src/View/Helper/BootstrapElements/BootstrapToast.php b/src/View/Helper/BootstrapElements/BootstrapToast.php new file mode 100644 index 0000000..fc3e264 --- /dev/null +++ b/src/View/Helper/BootstrapElements/BootstrapToast.php @@ -0,0 +1,74 @@ +Bootstrap->toast([ + * 'title' => 'Title', + * 'bodyHtml' => 'Body', + * 'muted' => 'Muted text', + * 'variant' => 'warning', + * 'closeButton' => true, + * ]); + */ +class BootstrapToast extends BootstrapGeneric +{ + private $defaultOptions = [ + 'id' => false, + 'title' => false, + 'muted' => false, + 'body' => false, + 'variant' => 'default', + 'autohide' => true, + 'delay' => 'auto', + 'titleHtml' => false, + 'mutedHtml' => false, + 'bodyHtml' => false, + 'closeButton' => true, + ]; + + function __construct($options) + { + $this->allowedOptionValues = [ + 'variant' => array_merge(BootstrapGeneric::$variants, ['default']), + ]; + $this->processOptions($options); + } + + private function processOptions($options) + { + $validOptions = array_filter($options, function($optionName) { + return isset($this->defaultOptions[$optionName]); + }, ARRAY_FILTER_USE_KEY); + $this->options = array_merge($this->defaultOptions, $validOptions); + $this->checkOptionValidity(); + } + + public function toast() + { + return $this->genToast(); + } + + private function genToast() + { + return $this->node('script', [], sprintf( + "$(document).ready(function() { + UI.toast(%s); + })", + json_encode($this->options, JSON_FORCE_OBJECT) + )); + } +} diff --git a/src/View/Helper/BootstrapHelper.php b/src/View/Helper/BootstrapHelper.php index 5b487c6..8b5a590 100644 --- a/src/View/Helper/BootstrapHelper.php +++ b/src/View/Helper/BootstrapHelper.php @@ -8,7 +8,7 @@ * - justify: Should the navigation items be justified (accept: ['center', 'end']) * - pills: Should the navigation items be pills * - vertical: Should the navigation bar be placed on the left side of the content - * - vertical-size: Specify how many boostrap's `cols` should be used for the navigation (only used when `vertical` is true) + * - vertical-size: Specify how many bootstrap's `cols` should be used for the navigation (only used when `vertical` is true) * - card: Should the navigation be placed in a bootstrap card * - header-variant: The bootstrap variant to be used for the card header * - body-variant: The bootstrap variant to be used for the card body @@ -42,12 +42,47 @@ namespace App\View\Helper; +use App\View\AppView; use Cake\View\Helper; use Cake\Utility\Hash; use Cake\Utility\Inflector; -use Cake\Utility\Security; +use Cake\Utility\Text; use InvalidArgumentException; +use \App\View\Helper\BootstrapElements\BootstrapSwitch; +use \App\View\Helper\BootstrapElements\BootstrapTabs; +use \App\View\Helper\BootstrapElements\BootstrapAlert; +use \App\View\Helper\BootstrapElements\BootstrapAccordion; +use \App\View\Helper\BootstrapElements\BootstrapBadge; +use \App\View\Helper\BootstrapElements\BootstrapButton; +use \App\View\Helper\BootstrapElements\BootstrapCard; +use \App\View\Helper\BootstrapElements\BootstrapCollapse; +use \App\View\Helper\BootstrapElements\BootstrapDropdownMenu; +use \App\View\Helper\BootstrapElements\BootstrapIcon; +use \App\View\Helper\BootstrapElements\BootstrapListGroup; +use \App\View\Helper\BootstrapElements\BootstrapListTable; +use \App\View\Helper\BootstrapElements\BootstrapModal; +use \App\View\Helper\BootstrapElements\BootstrapNotificationBubble; +use \App\View\Helper\BootstrapElements\BootstrapProgress; +use \App\View\Helper\BootstrapElements\BootstrapProgressTimeline; +use \App\View\Helper\BootstrapElements\BootstrapTable; +use \App\View\Helper\BootstrapElements\BootstrapToast; + + +const COMPACT_ATTRIBUTES = [ + 'checked' => true, + 'default' => true, + 'disabled' => true, + 'enabled' => true, + 'hidden' => true, + 'multiple' => true, + 'novalidate' => true, + 'readonly' => true, + 'required' => true, + 'selected' => true, + 'visible' => true, +]; + class BootstrapHelper extends Helper { public $helpers = ['FontAwesome']; @@ -60,73 +95,73 @@ class BootstrapHelper extends Helper public function alert($options) { - $bsAlert = new BoostrapAlert($options); + $bsAlert = new BootstrapAlert($options); return $bsAlert->alert(); } public function table($options, $data) { - $bsTable = new BoostrapTable($options, $data, $this); + $bsTable = new BootstrapTable($options, $data, $this); return $bsTable->table(); } public function listTable($options, $data) { - $bsListTable = new BoostrapListTable($options, $data, $this); + $bsListTable = new BootstrapListTable($options, $data, $this); return $bsListTable->table(); } public function button($options) { - $bsButton = new BoostrapButton($options); + $bsButton = new BootstrapButton($options); return $bsButton->button(); } public function icon($icon, $options = []) { - $bsIcon = new BoostrapIcon($icon, $options); + $bsIcon = new BootstrapIcon($icon, $options); return $bsIcon->icon(); } public function badge($options) { - $bsBadge = new BoostrapBadge($options); + $bsBadge = new BootstrapBadge($options); return $bsBadge->badge(); } public function modal($options) { - $bsModal = new BoostrapModal($options); + $bsModal = new BootstrapModal($options); return $bsModal->modal(); } public function card($options) { - $bsCard = new BoostrapCard($options); + $bsCard = new BootstrapCard($options); return $bsCard->card(); } public function progress($options) { - $bsProgress = new BoostrapProgress($options); + $bsProgress = new BootstrapProgress($options); return $bsProgress->progress(); } public function collapse($options, $content) { - $bsCollapse = new BoostrapCollapse($options, $content, $this); + $bsCollapse = new BootstrapCollapse($options, $content, $this); return $bsCollapse->collapse(); } public function accordion($options, $content) { - $bsAccordion = new BoostrapAccordion($options, $content, $this); + $bsAccordion = new BootstrapAccordion($options, $content, $this); return $bsAccordion->accordion(); } public function progressTimeline($options) { - $bsProgressTimeline = new BoostrapProgressTimeline($options, $this); + $bsProgressTimeline = new BootstrapProgressTimeline($options, $this); return $bsProgressTimeline->progressTimeline(); } @@ -136,30 +171,42 @@ class BootstrapHelper extends Helper return $bsListGroup->listGroup(); } - public function genNode($node, $params = [], $content = '') - { - return BootstrapGeneric::genNode($node, $params, $content); - } - public function switch($options) { - $bsSwitch = new BoostrapSwitch($options, $this); + $bsSwitch = new BootstrapSwitch($options, $this); return $bsSwitch->switch(); } public function notificationBubble($options) { - $bsNotificationBubble = new BoostrapNotificationBuble($options, $this); + $bsNotificationBubble = new BootstrapNotificationBubble($options, $this); return $bsNotificationBubble->notificationBubble(); } public function dropdownMenu($options) { - $bsDropdownMenu = new BoostrapDropdownMenu($options, $this); + $bsDropdownMenu = new BootstrapDropdownMenu($options, $this); return $bsDropdownMenu->dropdownMenu(); } + + public function toast($options) + { + $bsToast = new BootstrapToast($options, $this); + return $bsToast->toast(); + } + + public function node($tag, $attrs=[], $content='', $options=[]): string + { + return BootstrapGeneric::node($tag, $attrs, $content, $options); + } + + public function render($template, $data=[], $options=[]) + { + return BootstrapGeneric::render($template, $data, $options); + } } + class BootstrapGeneric { public static $variants = ['primary', 'secondary', 'success', 'danger', 'warning', 'info', 'light', 'dark', 'white', 'transparent']; @@ -190,19 +237,128 @@ class BootstrapGeneric } } - public static function genNode($node, $params = [], $content = "") + /** + * Replaces {{placeholders}} inside a $template with the given $data + * + * Example: + * ``` + * render('{{name}} is {{age}} years old.', ['name' => 'Bob', 'age' => '65']); + * ``` + * Returns: Bob is 65 years old. + * + * @param string $template The template containing the placeholders + * @param array $data A K-V array where keys are placeholder name to be replaced by their value + * @param array $options Array of options passed to the Text::insert function + * @return string + */ + public static function render(string $template, array $data, array $options=[]): string { - return sprintf('<%s %s>%s', $node, BootstrapGeneric::genHTMLParams($params), $content, $node); + $defaults = [ + 'before' => '{{', 'after' => '}}', 'escape' => '\\', 'format' => null, 'clean' => false, + ]; + $options += $defaults; + return Text::insert( + $template, + $data, + $options + ); } - protected static function openNode($node, $params = []) + /** + * Creates an HTML node + * + * ### Options + * + * - `escape` Set to false to disable escaping of attribute value. + * + * @param string $tag The tag of the node. Example: 'div', 'span' + * @param array $attrs Attributes to be added to the node + * @param string|array $content Optional content to be added as innerHTML. If an array is given, it gets converted into string + * @param array $options Array of options + * @return string + */ + public static function node(string $tag, array $attrs = [], $content = '', array $options = []): string { - return sprintf('<%s %s>', $node, BootstrapGeneric::genHTMLParams($params)); + return self::render( + '<{{tag}} {{attrs}}>{{content}}', + [ + 'tag' => $tag, + 'attrs' => self::buildAttrs($attrs, $options), + 'content' => is_array($content) ? implode('', $content) : $content, + ] + ); } - protected static function closeNode($node) + public static function nodeOpen(string $tag, array $attrs = [], array $options = []): string { - return sprintf('', $node); + return self::render( + '<{{tag}} {{attrs}}>', + [ + 'tag' => $tag, + 'attrs' => self::buildAttrs($attrs, $options), + ] + ); + } + + public static function nodeClose(string $tag): string + { + return self::render( + '', + [ + 'tag' => $tag, + ] + ); + } + + /** + * Build a space-delimited string with each HTML attribute generated. + * + * @param array $attrs + * @param array $options Array of options + * @return string + */ + public static function buildAttrs(array $attrs, array $options): string + { + $defaults = [ + 'escape' => true, + ]; + $options = $options + $defaults; + + $attributes = []; + foreach ($attrs as $key => $value) { + if (!empty($key) && $value !== null) { + $attributes[] = self::__formatAttribute((string) $key, $value, $options['escape']); + } + } + $html = trim(implode(' ', $attributes)); + return $html; + } + + /** + * Format an individual HTML attribute + * Support minimized attributes such as `selected` and `disabled` + * + * @param string $key The name of the attribute + * @param array|string $value The value of the attribute + * @param bool $escape Should the attribute value be escaped + * @return string + */ + public static function __formatAttribute(string $key, $value, bool $escape = true): string + { + $value = is_array($value) ? implode(' ', $value): $value; + if (is_numeric($key)) { + return sprintf('%s="%s"', h($value), (!empty($escape) ? h($value) : $value)); + } + $isMinimized = isset(COMPACT_ATTRIBUTES[$key]); + if ($isMinimized) { + if (!empty($value)) { + return sprintf('%s="%s"', h($key), (!empty($escape) ? h($value) : $value)); + } + return ''; + } else if (empty($value)) { + return ''; + } + return sprintf('%s="%s"', h($key), (!empty($escape) ? h($value) : $value)); } protected static function genHTMLParams($params) @@ -224,9 +380,14 @@ class BootstrapGeneric return sprintf('%s="%s"', $paramName, implode(' ', $values)); } + protected static function convertToArrayIfNeeded($data): array + { + return is_array($data) ? $data : [$data]; + } + protected static function genericCloseButton($dismissTarget) { - return BootstrapGeneric::genNode('button', [ + return self::node('button', [ 'type' => 'button', 'class' => 'btn-close', 'data-bs-dismiss' => $dismissTarget, @@ -234,1803 +395,13 @@ class BootstrapGeneric ]); } - protected static function getTextClassForVariant($variant) + protected static function getTextClassForVariant(string $variant): string { return !empty(self::$textClassByVariants[$variant]) ? self::$textClassByVariants[$variant] : 'text-black'; } -} -class BootstrapTabs extends BootstrapGeneric -{ - private $defaultOptions = [ - 'fill' => false, - 'justify' => false, - 'pills' => false, - 'vertical' => false, - 'vertical-size' => 3, - 'card' => false, - 'header-variant' => '', - 'body-variant' => '', - 'body-class' => [], - 'nav-class' => [], - 'nav-item-class' => [], - 'content-class' => [], - 'data' => [ - 'navs' => [], - 'content' => [], - ], - ]; - private $bsClasses = null; - - function __construct($options) + protected static function getBGAndTextClassForVariant(string $variant): string { - $this->allowedOptionValues = [ - 'justify' => [false, 'center', 'end'], - 'body-variant' => array_merge(BootstrapGeneric::$variants, ['']), - 'header-variant' => array_merge(BootstrapGeneric::$variants, ['']), - ]; - $this->processOptions($options); - } - - public function tabs() - { - return $this->genTabs(); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->data = $this->options['data']; - $this->checkOptionValidity(); - if (empty($this->data['navs'])) { - throw new InvalidArgumentException(__('No navigation data provided')); - } - $this->bsClasses = [ - 'nav' => [], - 'nav-item' => $this->options['nav-item-class'], - ]; - - if (!empty($this->options['justify'])) { - $this->bsClasses['nav'][] = 'justify-content-' . $this->options['justify']; - } - - if ($this->options['vertical'] && !isset($options['pills']) && !isset($options['card'])) { - $this->options['pills'] = true; - $this->options['card'] = true; - } - - if ($this->options['pills']) { - $this->bsClasses['nav'][] = 'nav-pills'; - if ($this->options['vertical']) { - $this->bsClasses['nav'][] = 'flex-column'; - } - if ($this->options['card']) { - $this->bsClasses['nav'][] = 'card-header-pills'; - } - } else { - $this->bsClasses['nav'][] = 'nav-tabs'; - if ($this->options['card']) { - $this->bsClasses['nav'][] = 'card-header-tabs'; - } - } - - if ($this->options['fill']) { - $this->bsClasses['nav'][] = 'nav-fill'; - } - if ($this->options['justify']) { - $this->bsClasses['nav'][] = 'nav-justify'; - } - - $activeTab = array_key_first($this->data['navs']); - foreach ($this->data['navs'] as $i => $nav) { - if (!is_array($nav)) { - $this->data['navs'][$i] = ['text' => $nav]; - } - if (!isset($this->data['navs'][$i]['id'])) { - $this->data['navs'][$i]['id'] = 't-' . Security::randomString(8); - } - if (!empty($nav['active'])) { - $activeTab = $i; - } - } - $this->data['navs'][$activeTab]['active'] = true; - - if (!empty($this->options['vertical-size']) && $this->options['vertical-size'] != 'auto') { - $this->options['vertical-size'] = $this->options['vertical-size'] < 0 || $this->options['vertical-size'] > 11 ? 3 : $this->options['vertical-size']; - } - - $this->options['header-text-variant'] = $this->options['header-variant'] == 'light' ? 'body' : 'white'; - $this->options['header-border-variant'] = $this->options['header-variant'] == 'light' ? '' : $this->options['header-variant']; - $this->options['body-text-variant'] = $this->options['body-variant'] == '' ? 'body' : 'white'; - - if (!is_array($this->options['nav-class'])) { - $this->options['nav-class'] = [$this->options['nav-class']]; - } - if (!is_array($this->options['content-class'])) { - $this->options['content-class'] = [$this->options['content-class']]; - } - } - - private function genTabs() - { - $html = ''; - if ($this->options['vertical']) { - $html .= $this->genVerticalTabs(); - } else { - $html .= $this->genHorizontalTabs(); - } - return $html; - } - - private function genHorizontalTabs() - { - $html = ''; - if ($this->options['card']) { - $html .= $this->openNode('div', ['class' => array_merge(['card'], ["border-{$this->options['header-border-variant']}"])]); - $html .= $this->openNode('div', ['class' => array_merge(['card-header'], ["bg-{$this->options['header-variant']}", "text-{$this->options['header-text-variant']}"])]); - } - $html .= $this->genNav(); - if ($this->options['card']) { - $html .= $this->closeNode('div'); - $html .= $this->openNode('div', [ - 'class' => array_merge( - ['card-body'], - $this->options['body-class'] ?? [], - ["bg-{$this->options['body-variant']}", "text-{$this->options['body-text-variant']}"] - ) - ]); - } - $html .= $this->genContent(); - if ($this->options['card']) { - $html .= $this->closeNode('div'); - $html .= $this->closeNode('div'); - } - return $html; - } - - private function genVerticalTabs() - { - $html = $this->openNode('div', ['class' => array_merge( - [ - 'row', - ($this->options['card'] ? 'card flex-row' : ''), - ($this->options['vertical-size'] == 'auto' ? 'flex-nowrap' : '') - ], - [ - "border-{$this->options['header-border-variant']}" - ] - )]); - $html .= $this->openNode('div', ['class' => array_merge( - [ - ($this->options['vertical-size'] != 'auto' ? 'col-' . $this->options['vertical-size'] : ''), - ($this->options['card'] ? 'card-header border-end' : '') - ], - [ - "bg-{$this->options['header-variant']}", - "text-{$this->options['header-text-variant']}", - "border-{$this->options['header-border-variant']}" - ] - )]); - $html .= $this->genNav(); - $html .= $this->closeNode('div'); - $html .= $this->openNode('div', ['class' => array_merge( - [ - ($this->options['vertical-size'] != 'auto' ? 'col-' . (12 - $this->options['vertical-size']) : ''), - ($this->options['card'] ? 'card-body2' : '') - ], - [ - "bg-{$this->options['body-variant']}", - "text-{$this->options['body-text-variant']}" - ] - )]); - $html .= $this->genContent(); - $html .= $this->closeNode('div'); - $html .= $this->closeNode('div'); - return $html; - } - - private function genNav() - { - $html = $this->openNode('ul', [ - 'class' => array_merge(['nav'], $this->bsClasses['nav'], $this->options['nav-class']), - 'role' => 'tablist', - ]); - foreach ($this->data['navs'] as $navItem) { - $html .= $this->genNavItem($navItem); - } - $html .= $this->closeNode('ul'); - return $html; - } - - private function genNavItem($navItem) - { - $html = $this->openNode('li', [ - 'class' => array_merge(['nav-item'], $this->bsClasses['nav-item'], $this->options['nav-item-class']), - 'role' => 'presentation', - ]); - $html .= $this->openNode('a', [ - 'class' => array_merge( - ['nav-link'], - [!empty($navItem['active']) ? 'active' : ''], - [!empty($navItem['disabled']) ? 'disabled' : ''] - ), - 'data-bs-toggle' => $this->options['pills'] ? 'pill' : 'tab', - 'id' => $navItem['id'] . '-tab', - 'href' => '#' . $navItem['id'], - 'aria-controls' => $navItem['id'], - 'aria-selected' => !empty($navItem['active']), - 'role' => 'tab', - ]); - if (!empty($navItem['html'])) { - $html .= $navItem['html']; - } else { - $html .= h($navItem['text']); - } - $html .= $this->closeNode('a'); - $html .= $this->closeNode('li'); - return $html; - } - - private function genContent() - { - $html = $this->openNode('div', [ - 'class' => array_merge(['tab-content'], $this->options['content-class']), - ]); - foreach ($this->data['content'] as $i => $content) { - $navItem = $this->data['navs'][$i]; - $html .= $this->genContentItem($navItem, $content); - } - $html .= $this->closeNode('div'); - return $html; - } - - private function genContentItem($navItem, $content) - { - return $this->genNode('div', [ - 'class' => array_merge(['tab-pane', 'fade'], [!empty($navItem['active']) ? 'show active' : '']), - 'role' => 'tabpanel', - 'id' => $navItem['id'], - 'aria-labelledby' => $navItem['id'] . '-tab' - ], $content); - } -} - -class BoostrapAlert extends BootstrapGeneric -{ - private $defaultOptions = [ - 'text' => '', - 'html' => null, - 'dismissible' => true, - 'variant' => 'primary', - 'fade' => true - ]; - - private $bsClasses = null; - - function __construct($options) - { - $this->allowedOptionValues = [ - 'variant' => BootstrapGeneric::$variants, - ]; - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function alert() - { - return $this->genAlert(); - } - - private function genAlert() - { - $html = $this->openNode('div', [ - 'class' => [ - 'alert', - "alert-{$this->options['variant']}", - $this->options['dismissible'] ? 'alert-dismissible' : '', - $this->options['fade'] ? 'fade show' : '', - ], - 'role' => "alert" - ]); - - $html .= $this->genContent(); - $html .= $this->genCloseButton(); - $html .= $this->closeNode('div'); - return $html; - } - - private function genCloseButton() - { - $html = ''; - if ($this->options['dismissible']) { - $html .= $this->genericCloseButton('alert'); - } - return $html; - } - - private function genContent() - { - return !is_null($this->options['html']) ? $this->options['html'] : h($this->options['text']); - } -} - -class BoostrapTable extends BootstrapGeneric -{ - private $defaultOptions = [ - 'striped' => true, - 'bordered' => true, - 'borderless' => false, - 'hover' => true, - 'small' => false, - 'variant' => '', - 'tableClass' => [], - 'headerClass' => [], - 'bodyClass' => [], - ]; - - private $bsClasses = null; - - function __construct($options, $data, $btHelper) - { - $this->allowedOptionValues = [ - 'variant' => array_merge(BootstrapGeneric::$variants, ['']) - ]; - $this->processOptions($options); - $this->fields = $data['fields']; - $this->items = $data['items']; - $this->caption = !empty($data['caption']) ? $data['caption'] : ''; - $this->btHelper = $btHelper; - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function table() - { - return $this->genTable(); - } - - private function genTable() - { - $html = $this->openNode('table', [ - 'class' => [ - 'table', - "table-{$this->options['variant']}", - $this->options['striped'] ? 'table-striped' : '', - $this->options['bordered'] ? 'table-bordered' : '', - $this->options['borderless'] ? 'table-borderless' : '', - $this->options['hover'] ? 'table-hover' : '', - $this->options['small'] ? 'table-sm' : '', - !empty($this->options['variant']) ? "table-{$this->options['variant']}" : '', - !empty($this->options['tableClass']) ? (is_array($this->options['tableClass']) ? implode(' ', $this->options['tableClass']) : $this->options['tableClass']) : '' - ], - ]); - - $html .= $this->genCaption(); - $html .= $this->genHeader(); - $html .= $this->genBody(); - - $html .= $this->closeNode('table'); - return $html; - } - - private function genHeader() - { - $head = $this->openNode('thead', [ - 'class' => [ - !empty($this->options['headerClass']) ? $this->options['headerClass'] : '' - ], - ]); - $head .= $this->openNode('tr'); - foreach ($this->fields as $i => $field) { - if (is_array($field)) { - if (!empty($field['labelHtml'])) { - $label = $field['labelHtml']; - } else { - $label = !empty($field['label']) ? $field['label'] : Inflector::humanize($field['key']); - $label = h($label); - } - } else { - $label = Inflector::humanize($field); - $label = h($label); - } - $head .= $this->genNode('th', [], $label); - } - $head .= $this->closeNode('tr'); - $head .= $this->closeNode('thead'); - return $head; - } - - private function genBody() - { - $body = $this->openNode('tbody', [ - 'class' => [ - !empty($this->options['bodyClass']) ? (is_array($this->options['bodyClass']) ? implode(' ', $this->options['bodyClass']) : $this->options['bodyClass']) : '' - ], - ]); - foreach ($this->items as $i => $row) { - $body .= $this->genRow($row, $i); - } - $body .= $this->closeNode('tbody'); - return $body; - } - - private function genRow($row, $rowIndex) - { - $html = $this->openNode('tr', [ - 'class' => [ - !empty($row['_rowVariant']) ? "table-{$row['_rowVariant']}" : '' - ] - ]); - if (array_keys($row) !== range(0, count($row) - 1)) { // associative array - foreach ($this->fields as $i => $field) { - if (is_array($field)) { - $key = $field['key']; - } else { - $key = $field; - } - $cellValue = Hash::get($row, $key); - $html .= $this->genCell($cellValue, $field, $row, $rowIndex); - } - } else { // indexed array - foreach ($row as $i => $cellValue) { - $html .= $this->genCell($cellValue, 'index', $row, $rowIndex); - } - } - $html .= $this->closeNode('tr'); - return $html; - } - - private function genCell($value, $field=[], $row=[], $rowIndex=0) - { - if (isset($field['formatter'])) { - $cellContent = $field['formatter']($value, $row, $rowIndex); - } else if (isset($field['element'])) { - $cellContent = $this->btHelper->getView()->element($field['element'], [ - 'data' => [$value], - 'field' => ['path' => '0'] - ]); - } else { - $cellContent = h($value); - } - return $this->genNode('td', [ - 'class' => [ - !empty($row['_cellVariant']) ? "bg-{$row['_cellVariant']}" : '' - ] - ], $cellContent); - } - - private function genCaption() - { - return !empty($this->caption) ? $this->genNode('caption', [], h($this->caption)) : ''; - } -} - -class BoostrapListTable extends BootstrapGeneric -{ - private $defaultOptions = [ - 'striped' => true, - 'bordered' => false, - 'borderless' => false, - 'hover' => true, - 'small' => false, - 'variant' => '', - 'tableClass' => [], - 'bodyClass' => [], - ]; - - private $bsClasses = null; - - function __construct($options, $data, $btHelper) - { - $this->allowedOptionValues = [ - 'variant' => array_merge(BootstrapGeneric::$variants, ['']) - ]; - $this->processOptions($options); - $this->fields = $data['fields']; - $this->item = $data['item']; - $this->caption = !empty($data['caption']) ? $data['caption'] : ''; - $this->btHelper = $btHelper; - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function table() - { - return $this->genTable(); - } - - private function genTable() - { - $html = $this->openNode('table', [ - 'class' => [ - 'table', - "table-{$this->options['variant']}", - $this->options['striped'] ? 'table-striped' : '', - $this->options['bordered'] ? 'table-bordered' : '', - $this->options['borderless'] ? 'table-borderless' : '', - $this->options['hover'] ? 'table-hover' : '', - $this->options['small'] ? 'table-sm' : '', - !empty($this->options['variant']) ? "table-{$this->options['variant']}" : '', - !empty($this->options['tableClass']) ? (is_array($this->options['tableClass']) ? implode(' ', $this->options['tableClass']) : $this->options['tableClass']) : '' - ], - 'id' => $this->options['id'] ?? '' - ]); - - $html .= $this->genCaption(); - $html .= $this->genBody(); - - $html .= $this->closeNode('table'); - return $html; - } - - private function genBody() - { - $body = $this->openNode('tbody', [ - 'class' => [ - !empty($this->options['bodyClass']) ? (is_array($this->options['bodyClass']) ? implode(' ', $this->options['bodyClass']) : $this->options['bodyClass']) : '' - ], - ]); - foreach ($this->fields as $i => $field) { - $body .= $this->genRow($field); - } - $body .= $this->closeNode('tbody'); - return $body; - } - - private function genRow($field) - { - $rowValue = $this->genCell($field); - $rowKey = $this->genNode('th', [ - 'class' => [ - 'col-4 col-sm-2' - ], - 'scope' => 'row' - ], h($field['key'])); - $row = $this->genNode('tr', [ - 'class' => [ - 'd-flex', - !empty($field['_rowVariant']) ? "table-{$field['_rowVariant']}" : '' - ] - ], implode('', [$rowKey, $rowValue])); - return $row; - } - - private function genCell($field = []) - { - if (isset($field['raw'])) { - $cellContent = $field['raw']; - if (empty($field['no_escaping'])) { - $field['raw'] = h($field['raw']); - } - } else if (isset($field['formatter'])) { - $cellContent = $field['formatter']($this->getValueFromObject($field), $this->item); - } else if (isset($field['type'])) { - $cellContent = $this->btHelper->getView()->element($this->getElementPath($field['type']), [ - 'data' => $this->item, - 'field' => $field - ]); - } else { - $cellContent = h($this->getValueFromObject($field)); - } - foreach (['info', 'warning', 'danger'] as $message_type) { - if (!empty($field[$message_type])) { - $cellContent .= sprintf(' %s', $message_type, $field[$message_type]); - } - } - return $this->genNode('td', [ - 'class' => [ - 'col-8 col-sm-10', - !empty($field['_cellVariant']) ? "bg-{$field['_cellVariant']}" : '' - ] - ], $cellContent); - } - - private function getValueFromObject($field) - { - if (is_array($field)) { - $key = $field['path']; - } else { - $key = $field; - } - $cellValue = Hash::get($this->item, $key); - return $cellValue; - } - - private function getElementPath($type) - { - return sprintf( - '%s%sField', - $this->options['elementsRootPath'] ?? '', - $type - ); - } - - private function genCaption() - { - return !empty($this->caption) ? $this->genNode('caption', [], h($this->caption)) : ''; - } -} - -class BoostrapButton extends BootstrapGeneric -{ - private $defaultOptions = [ - 'id' => '', - 'text' => '', - 'html' => null, - 'variant' => 'primary', - 'outline' => false, - 'size' => '', - 'icon' => null, - 'image' => null, - 'class' => [], - 'type' => 'button', - 'nodeType' => 'button', - 'title' => '', - 'params' => [], - 'badge' => false - ]; - - private $bsClasses = []; - - function __construct($options) - { - $this->allowedOptionValues = [ - 'variant' => array_merge(BootstrapGeneric::$variants, ['link', 'text']), - 'size' => ['', 'xs', 'sm', 'lg'], - 'type' => ['button', 'submit', 'reset'] - ]; - if (empty($options['class'])) { - $options['class'] = ''; - } - $options['class'] = !is_array($options['class']) ? [$options['class']] : $options['class']; - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - - if (!empty($this->options['id'])) { - $this->options['params']['id'] = $this->options['id']; - } - - $this->bsClasses[] = 'btn'; - if ($this->options['outline']) { - $this->bsClasses[] = "btn-outline-{$this->options['variant']}"; - } else { - $this->bsClasses[] = "btn-{$this->options['variant']}"; - } - if (!empty($this->options['size'])) { - $this->bsClasses[] = "btn-{$this->options['size']}"; - } - if ($this->options['variant'] == 'text') { - $this->bsClasses[] = 'p-0'; - $this->bsClasses[] = 'lh-1'; - } - } - - public function button() - { - return $this->genButton(); - } - - private function genButton() - { - $html = $this->openNode($this->options['nodeType'], array_merge($this->options['params'], [ - 'class' => array_merge($this->options['class'], $this->bsClasses), - 'role' => "alert", - 'type' => $this->options['type'], - 'title' => h($this->options['title']), - ])); - - $html .= $this->genIcon(); - $html .= $this->genImage(); - $html .= $this->genContent(); - if (!empty($this->options['badge'])) { - $bsBadge = new BoostrapBadge($this->options['badge']); - $html .= $bsBadge->badge(); - } - $html .= $this->closeNode($this->options['nodeType']); - return $html; - } - - private function genIcon() - { - if (!empty($this->options['icon'])) { - $bsIcon = new BoostrapIcon($this->options['icon'], [ - 'class' => [(!empty($this->options['text']) ? 'me-1' : '')] - ]); - return $bsIcon->icon(); - } - return ''; - } - - private function genImage() - { - if (!empty($this->options['image'])) { - return $this->genNode('img', [ - 'src' => $this->options['image']['path'] ?? '', - 'class' => ['img-fluid', 'me-1'], - 'width' => '26', - 'height' => '26', - 'alt' => $this->options['image']['alt'] ?? '' - ]); - } - return ''; - } - - private function genContent() - { - return !is_null($this->options['html']) ? $this->options['html'] : $this->options['text']; - } -} - -class BoostrapBadge extends BootstrapGeneric -{ - private $defaultOptions = [ - 'text' => '', - 'variant' => 'primary', - 'pill' => false, - 'title' => '', - 'class' => [], - ]; - - function __construct($options) - { - $this->allowedOptionValues = [ - 'variant' => BootstrapGeneric::$variants, - ]; - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->options['class'] = is_array($this->options['class']) ? $this->options['class'] : [$this->options['class']]; - $this->checkOptionValidity(); - } - - public function badge() - { - return $this->genBadge(); - } - - private function genBadge() - { - $html = $this->genNode('span', [ - 'class' => array_merge($this->options['class'], [ - 'ms-1', - 'badge', - "bg-{$this->options['variant']}", - $this->getTextClassForVariant($this->options['variant']), - $this->options['pill'] ? 'rounded-pill' : '', - ]), - 'title' => $this->options['title'] - ], h($this->options['text'])); - return $html; - } -} - -class BoostrapIcon extends BootstrapGeneric -{ - private $icon = ''; - private $defaultOptions = [ - 'class' => [], - 'title' => '', - 'params' => [], - ]; - - function __construct($icon, $options = []) - { - $this->icon = $icon; - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function icon() - { - return $this->genIcon(); - } - - private function genIcon() - { - $html = $this->genNode('span', array_merge([ - 'class' => array_merge( - is_array($this->options['class']) ? $this->options['class'] : [$this->options['class']], - ["fa fa-{$this->icon}"] - ), - 'title' => h($this->options['title']) - ], $this->options['params'])); - return $html; - } -} - -class BoostrapModal extends BootstrapGeneric -{ - private $defaultOptions = [ - 'size' => '', - 'centered' => true, - 'scrollable' => true, - 'backdropStatic' => false, - 'title' => '', - 'titleHtml' => false, - 'body' => '', - 'bodyHtml' => false, - 'footerHtml' => false, - 'confirmText' => 'Confirm', - 'confirmIcon' => false, - 'cancelText' => 'Cancel', - 'modalClass' => [''], - 'headerClass' => [''], - 'bodyClass' => [''], - 'footerClass' => [''], - 'type' => 'ok-only', - 'variant' => '', - 'confirmFunction' => '', // Will be called with the following arguments confirmFunction(modalObject, tmpApi) - 'cancelFunction' => '' - ]; - - private $bsClasses = null; - - function __construct($options) - { - $this->allowedOptionValues = [ - 'size' => ['sm', 'lg', 'xl', ''], - 'type' => ['ok-only', 'confirm', 'confirm-success', 'confirm-warning', 'confirm-danger', 'custom'], - 'variant' => array_merge(BootstrapGeneric::$variants, ['']), - ]; - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function modal() - { - return $this->genModal(); - } - - private function genModal() - { - $this->options['modalClass'] = !empty($this->options['modalClass']) && !is_array($this->options['modalClass']) ? [$this->options['modalClass']] : $this->options['modalClass']; - $dialog = $this->openNode('div', [ - 'class' => array_merge( - ['modal-dialog', (!empty($this->options['size'])) ? "modal-{$this->options['size']}" : ''], - $this->options['modalClass'] - ), - ]); - $content = $this->openNode('div', [ - 'class' => ['modal-content'], - ]); - $header = $this->genHeader(); - $body = $this->genBody(); - $footer = $this->genFooter(); - $closedDiv = $this->closeNode('div'); - - $html = "{$dialog}{$content}{$header}{$body}{$footer}{$closedDiv}{$closedDiv}"; - return $html; - } - - private function genHeader() - { - $header = $this->openNode('div', ['class' => array_merge(['modal-header'], $this->options['headerClass'])]); - if (!empty($this->options['titleHtml'])) { - $header .= $this->options['titleHtml']; - } else { - $header .= $this->genNode('h5', ['class' => ['modal-title']], h($this->options['title'])); - } - if (empty($this->options['backdropStatic'])) { - $header .= $this->genericCloseButton('modal'); - } - $header .= $this->closeNode('div'); - return $header; - } - - private function genBody() - { - $body = $this->openNode('div', ['class' => array_merge(['modal-body'], $this->options['bodyClass'])]); - if (!empty($this->options['bodyHtml'])) { - $body .= $this->options['bodyHtml']; - } else { - $body .= h($this->options['body']); - } - $body .= $this->closeNode('div'); - return $body; - } - - private function genFooter() - { - $footer = $this->openNode('div', [ - 'class' => array_merge(['modal-footer'], $this->options['footerClass']), - 'data-custom-footer' => $this->options['type'] == 'custom' - ]); - if (!empty($this->options['footerHtml'])) { - $footer .= $this->options['footerHtml']; - } else { - $footer .= $this->getFooterBasedOnType(); - } - $footer .= $this->closeNode('div'); - return $footer; - } - - private function getFooterBasedOnType() - { - if ($this->options['type'] == 'ok-only') { - return $this->getFooterOkOnly(); - } else if (str_contains($this->options['type'], 'confirm')) { - return $this->getFooterConfirm(); - } else if ($this->options['type'] == 'custom') { - return $this->getFooterCustom(); - } else { - return $this->getFooterOkOnly(); - } - } - - private function getFooterOkOnly() - { - return (new BoostrapButton([ - 'variant' => 'primary', - 'text' => __('Ok'), - 'params' => [ - 'data-bs-dismiss' => $this->options['confirmFunction'] ? '' : 'modal', - 'onclick' => $this->options['confirmFunction'] - ] - ]))->button(); - } - - private function getFooterConfirm() - { - if ($this->options['type'] == 'confirm') { - $variant = 'primary'; - } else { - $variant = explode('-', $this->options['type'])[1]; - } - $buttonCancel = (new BoostrapButton([ - 'variant' => 'secondary', - 'text' => h($this->options['cancelText']), - 'params' => [ - 'data-bs-dismiss' => 'modal', - 'onclick' => $this->options['cancelFunction'] - ] - ]))->button(); - - $buttonConfirm = (new BoostrapButton([ - 'variant' => $variant, - 'text' => h($this->options['confirmText']), - 'icon' => h($this->options['confirmIcon']), - 'class' => 'modal-confirm-button', - 'params' => [ - // 'data-bs-dismiss' => $this->options['confirmFunction'] ? '' : 'modal', - 'data-confirmFunction' => sprintf('%s', $this->options['confirmFunction']) - ] - ]))->button(); - return $buttonCancel . $buttonConfirm; - } - - private function getFooterCustom() - { - $buttons = []; - foreach ($this->options['footerButtons'] as $buttonConfig) { - $buttons[] = (new BoostrapButton([ - 'variant' => h($buttonConfig['variant'] ?? 'primary'), - 'text' => h($buttonConfig['text']), - 'class' => 'modal-confirm-button', - 'params' => [ - 'data-bs-dismiss' => !empty($buttonConfig['clickFunction']) ? '' : 'modal', - 'data-clickFunction' => sprintf('%s', $buttonConfig['clickFunction']) - ] - ]))->button(); - } - return implode('', $buttons); - } -} - -class BoostrapCard extends BootstrapGeneric -{ - private $defaultOptions = [ - 'variant' => '', - 'headerText' => '', - 'footerText' => '', - 'bodyText' => '', - 'headerHTML' => '', - 'footerHTML' => '', - 'bodyHTML' => '', - 'class' => '', - 'headerClass' => '', - 'bodyClass' => '', - 'footerClass' => '', - ]; - - public function __construct($options) - { - $this->allowedOptionValues = [ - 'variant' => array_merge(BootstrapGeneric::$variants, ['']), - ]; - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function card() - { - return $this->genCard(); - } - - private function genCard() - { - $card = $this->genNode('div', [ - 'class' => [ - 'card', - !empty($this->options['variant']) ? "bg-{$this->options['variant']}" : '', - !empty($this->options['variant']) ? $this->getTextClassForVariant($this->options['variant']) : '', - h(is_array($this->options['class']) ? implode(' ', $this->options['class']) : $this->options['class']), - ], - ], implode('', [$this->genHeader(), $this->genBody(), $this->genFooter()])); - return $card; - } - - private function genHeader() - { - if (empty($this->options['headerHTML']) && empty($this->options['headerText'])) { - return ''; - } - $content = !empty($this->options['headerHTML']) ? $this->options['headerHTML'] : h($this->options['headerText']); - $header = $this->genNode('div', [ - 'class' => [ - 'card-header', - h($this->options['headerClass']), - ], - ], $content); - return $header; - } - - private function genBody() - { - if (empty($this->options['bodyHTML']) && empty($this->options['bodyText'])) { - return ''; - } - $content = !empty($this->options['bodyHTML']) ? $this->options['bodyHTML'] : h($this->options['bodyText']); - $body = $this->genNode('div', [ - 'class' => [ - 'card-body', - h($this->options['bodyClass']), - ], - ], $content); - return $body; - } - - private function genFooter() - { - if (empty($this->options['footerHTML']) && empty($this->options['footerText'])) { - return ''; - } - $content = !empty($this->options['footerHTML']) ? $this->options['footerHTML'] : h($this->options['footerText']); - $footer = $this->genNode('div', [ - 'class' => [ - 'card-footer', - h($this->options['footerClass']), - ], - ], $content); - return $footer; - } -} - -class BoostrapSwitch extends BootstrapGeneric -{ - private $defaultOptions = [ - 'label' => '', - 'variant' => 'primary', - 'disabled' => false, - 'checked' => false, - 'title' => '', - 'class' => [], - 'attrs' => [], - ]; - - function __construct($options) - { - $this->allowedOptionValues = [ - 'variant' => BootstrapGeneric::$variants, - ]; - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function switch() - { - return $this->genSwitch(); - } - - private function genSwitch() - { - $tmpId = 'tmp-' . mt_rand(); - $html = $this->genNode('div', [ - 'class' => [ - 'form-check form-switch', - ], - 'title' => $this->options['title'] - ], implode('', [ - $this->genNode('input', array_merge([ - 'type' => "checkbox", - 'class' => 'form-check-input', - 'id' => $tmpId, - ($this->options['disabled'] ? 'disabled' : '') => '', - ($this->options['checked'] ? 'checked' : '') => $this->options['checked'] ? 'checked' : '', - ], $this->options['attrs'])), - $this->genNode('label', [ - 'class' => 'form-check-label', - 'for' => $tmpId, - ], h($this->options['label'])) - ])); - return $html; - } -} - -class BoostrapNotificationBuble extends BootstrapGeneric -{ - private $defaultOptions = [ - 'label' => '', - 'variant' => 'warning', - 'borderVariant' => 'ligth', - 'title' => 'Notification', - 'class' => [], - 'attrs' => [], - ]; - - function __construct($options) - { - $this->allowedOptionValues = [ - 'variant' => BootstrapGeneric::$variants, - ]; - $this->defaultOptions['label'] = __('New notifications'); - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - if (!empty($this->options['attrs']['style'])) { - $this->options['attrs']['style'] += 'box-shadow: 0 0.125rem 0.25rem #00000050;'; - } else { - $this->options['attrs']['style'] = 'box-shadow: 0 0.125rem 0.25rem #00000050;'; - } - } - - public function notificationBubble() - { - return $this->genNotificationBubble(); - } - - private function genNotificationBubble() - { - $tmpId = 'tmp-' . mt_rand(); - $html = $this->genNode('span', [ - 'id' => $tmpId, - 'class' => [ - 'position-absolute', - 'top-0', - 'start-100', - 'translate-middle', - 'p-1', - 'border border-2 rounded-circle', - "border-{$this->options['borderVariant']}", - "bg-{$this->options['variant']}", - ], - 'title' => $this->options['title'] - ], $this->genNode('span', [ - 'class' => [ - ], - $this->options['label'] - ])); - return $html; - } -} - -class BoostrapProgress extends BootstrapGeneric -{ - private $defaultOptions = [ - 'value' => 0, - 'total' => 100, - 'text' => '', - 'title' => '', - 'variant' => 'primary', - 'height' => '', - 'striped' => false, - 'animated' => false, - 'label' => true - ]; - - function __construct($options) - { - $this->allowedOptionValues = [ - 'variant' => BootstrapGeneric::$variants, - ]; - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function progress() - { - return $this->genProgress(); - } - - private function genProgress() - { - $percentage = round(100 * $this->options['value'] / $this->options['total']); - $heightStyle = !empty($this->options['height']) ? sprintf('height: %s;', h($this->options['height'])) : ''; - $widthStyle = sprintf('width: %s%%;', $percentage); - $label = $this->options['label'] ? "{$percentage}%" : ''; - $pb = $this->genNode('div', [ - 'class' => [ - 'progress-bar', - "bg-{$this->options['variant']}", - $this->options['striped'] ? 'progress-bar-striped' : '', - $this->options['animated'] ? 'progress-bar-animated' : '', - ], - 'role' => "progressbar", - 'aria-valuemin' => "0", 'aria-valuemax' => "100", 'aria-valuenow' => $percentage, - 'style' => "${widthStyle}", - 'title' => $this->options['title'] - ], $label); - $container = $this->genNode('div', [ - 'class' => [ - 'progress', - ], - 'style' => "${heightStyle}", - 'title' => h($this->options['title']), - ], $pb); - return $container; - } -} - -class BoostrapCollapse extends BootstrapGeneric -{ - private $defaultOptions = [ - 'title' => '', - 'open' => false, - ]; - - function __construct($options, $content, $btHelper) - { - $this->allowedOptionValues = []; - $this->processOptions($options); - $this->content = $content; - $this->btHelper = $btHelper; - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function collapse() - { - return $this->genCollapse(); - } - - private function genControl() - { - $html = $this->genNode('a', [ - 'class' => ['text-decoration-none'], - 'data-bs-toggle' => 'collapse', - 'href' => '#collapseExample', - 'role' => 'button', - 'aria-expanded' => 'false', - 'aria-controls' => 'collapseExample', - ], h($this->options['title'])); - return $html; - } - - private function genContent() - { - $content = $this->genNode('div', [ - 'class' => 'card', - ], $this->content); - $container = $this->genNode('div', [ - 'class' => ['collapse', $this->options['open'] ? 'show' : ''], - 'id' => 'collapseExample', - ], $content); - return $container; - } - - private function genCollapse() - { - $html = $this->genControl(); - $html .= $this->genContent(); - return $html; - } -} - -class BoostrapAccordion extends BootstrapGeneric -{ - private $defaultOptions = [ - 'stayOpen' => true, - 'class' => [], - ]; - - function __construct($options, $content, $btHelper) - { - $this->allowedOptionValues = []; - $this->content = $content; - $this->btHelper = $btHelper; - $this->processOptions($options); - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - if (!is_array($this->options['class']) && !empty($this->options['class'])) { - $this->options['class'] = [$this->options['class']]; - } - $this->seed = 'acc-' . mt_rand(); - $this->contentSeeds = []; - foreach ($this->content as $accordionItem) { - $this->contentSeeds[] = mt_rand(); - } - } - - public function accordion() - { - return $this->genAccordion(); - } - - private function genHeader($accordionItem, $i) - { - $html = $this->openNode('h2', [ - 'class' => ['accordion-header'], - 'id' => 'head-' . $this->contentSeeds[$i] - ]); - $content = !empty($accordionItem['header']['html']) ? $accordionItem['header']['html'] : h($accordionItem['header']['title'] ?? '- no title -'); - $buttonOptions = [ - 'class' => array_merge(['accordion-button', empty($accordionItem['_open']) ? 'collapsed' : ''], $accordionItem['header']['__class'] ?? []), - 'type' => 'button', - 'data-bs-toggle' => 'collapse', - 'data-bs-target' => '#body-' . $this->contentSeeds[$i], - 'aria-expanded' => 'false', - 'aria-controls' => 'body-' . $this->contentSeeds[$i], - ]; - $html .= $this->genNode('button', $buttonOptions, $content); - $html .= $this->closeNode(('h2')); - return $html; - } - - private function genBody($accordionItem, $i) - { - $content = $this->genNode('div', [ - 'class' => ['accordion-body'] - ], $accordionItem['body']); - $divOptions = [ - 'class' => array_merge(['accordion-collapse collapse', empty($accordionItem['_open']) ? '' : 'show'], $accordionItem['body']['__class'] ?? []), - 'id' => 'body-' . $this->contentSeeds[$i], - 'aria-labelledby' => 'head-' . $this->contentSeeds[$i], - ]; - if (!empty($this->options['stayOpen'])) { - $divOptions['data-bs-parent'] = '#' . $this->seed; - } - $html = $this->genNode('div', $divOptions, $content); - return $html; - } - - private function genAccordion() - { - $html = $this->openNode('div', [ - 'class' => array_merge(['accordion'], $this->options['class']), - 'id' => $this->seed - ]); - foreach ($this->content as $i => $accordionItem) { - $html .= $this->openNode('div', [ - 'class' => array_merge(['accordion-item'], $accordionItem['__class'] ?? []) - ]); - $html .= $this->genHeader($accordionItem, $i); - $html .= $this->genBody($accordionItem, $i); - $html .= $this->closeNode('div'); - } - $html .= $this->closeNode('div'); - return $html; - } -} - -class BoostrapProgressTimeline extends BootstrapGeneric -{ - private $defaultOptions = [ - 'steps' => [], - 'selected' => 0, - 'variant' => 'info', - 'variantInactive' => 'secondary', - ]; - - function __construct($options, $btHelper) - { - $this->allowedOptionValues = [ - 'variant' => BootstrapGeneric::$variants, - 'variantInactive' => BootstrapGeneric::$variants, - ]; - $this->processOptions($options); - $this->btHelper = $btHelper; - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - $this->checkOptionValidity(); - } - - public function progressTimeline() - { - return $this->genProgressTimeline(); - } - - private function getStepIcon($step, $i, $nodeActive, $lineActive) - { - $icon = $this->genNode('b', [ - 'class' => [ - !empty($step['icon']) ? h($this->btHelper->FontAwesome->getClass($step['icon'])) : '', - $this->getTextClassForVariant($this->options['variant']) - ], - ], empty($step['icon']) ? h($i + 1) : ''); - $iconContainer = $this->genNode('span', [ - 'class' => [ - 'd-flex', 'align-items-center', 'justify-content-center', - 'rounded-circle', - $nodeActive ? "bg-{$this->options['variant']}" : "bg-{$this->options['variantInactive']}" - ], - 'style' => 'width:50px; height:50px' - ], $icon); - $li = $this->genNode('li', [ - 'class' => [ - 'd-flex', 'flex-column', - $nodeActive ? 'progress-active' : 'progress-inactive', - ], - ], $iconContainer); - $html = $li . $this->getHorizontalLine($i, $nodeActive, $lineActive); - return $html; - } - - private function getHorizontalLine($i, $nodeActive, $lineActive) - { - $stepCount = count($this->options['steps']); - if ($i == $stepCount - 1) { - return ''; - } - $progressBar = (new BoostrapProgress([ - 'label' => false, - 'value' => $nodeActive ? ($lineActive ? 100 : 50) : 0, - 'height' => '2px', - 'variant' => $this->options['variant'] - ]))->progress(); - $line = $this->genNode('span', [ - 'class' => [ - 'progress-line', - 'flex-grow-1', 'align-self-center', - $lineActive ? "bg-{$this->options['variant']}" : '' - ], - ], $progressBar); - return $line; - } - - private function getStepText($step, $isActive) - { - return $this->genNode('li', [ - 'class' => [ - 'text-center', - 'fw-bold', - $isActive ? 'progress-active' : 'progress-inactive', - ], - ], h($step['text'] ?? '')); - } - - private function genProgressTimeline() - { - $iconLis = ''; - $textLis = ''; - foreach ($this->options['steps'] as $i => $step) { - $nodeActive = $i <= $this->options['selected']; - $lineActive = $i < $this->options['selected']; - $iconLis .= $this->getStepIcon($step, $i, $nodeActive, $lineActive); - $textLis .= $this->getStepText($step, $nodeActive); - } - $ulIcons = $this->genNode('ul', [ - 'class' => [ - 'd-flex', 'justify-content-around', - ], - ], $iconLis); - $ulText = $this->genNode('ul', [ - 'class' => [ - 'd-flex', 'justify-content-between', - ], - ], $textLis); - $html = $this->genNode('div', [ - 'class' => ['progress-timeline', 'mw-75', 'mx-auto'] - ], $ulIcons . $ulText); - return $html; - } -} - -class BootstrapListGroup extends BootstrapGeneric -{ - private $defaultOptions = [ - 'hover' => false, - ]; - - private $bsClasses = null; - - function __construct($options, $data, $btHelper) - { - $this->data = $data; - $this->processOptions($options); - $this->btHelper = $btHelper; - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - } - - public function listGroup() - { - return $this->genListGroup(); - } - - private function genListGroup() - { - $html = $this->openNode('div', [ - 'class' => ['list-group',], - ]); - foreach ($this->data as $item) { - $html .= $this->genItem($item); - } - $html .= $this->closeNode('div'); - return $html; - } - - private function genItem($item) - { - if (!empty($item['heading'])) { // complex layout with heading, badge and body - $html = $this->genNode('a', [ - 'class' => ['list-group-item', (!empty($this->options['hover']) ? 'list-group-item-action' : ''),], - ], implode('', [ - $this->genHeadingGroup($item), - $this->genBody($item), - ])); - } else { // simple layout with just
  • -like elements - $html = $this->genNode('a', [ - 'class' => ['list-group-item', 'd-flex', 'align-items-center', 'justify-content-between'], - ], implode('', [ - h($item['text']), - $this->genBadge($item) - ])); - } - return $html; - } - - private function genHeadingGroup($item) - { - $html = $this->genNode('div', [ - 'class' => ['d-flex', 'w-100', 'justify-content-between',], - ], implode('', [ - $this->genHeading($item), - $this->genBadge($item) - ])); - return $html; - } - - private function genHeading($item) - { - if (empty($item['heading'])) { - return ''; - } - return $this->genNode('h5', [ - 'class' => ['mb-1'], - ], h($item['heading'])); - } - - private function genBadge($item) - { - if (empty($item['badge'])) { - return ''; - } - return $this->genNode('span', [ - 'class' => ['badge rounded-pill', (!empty($item['badge-variant']) ? "bg-{$item['badge-variant']}" : 'bg-primary')], - ], h($item['badge'])); - } - - private function genBody($item) - { - if (!empty($item['bodyHTML'])) { - return $item['bodyHTML']; - } - return !empty($item['body']) ? h($item['body']) : ''; - } -} - - -class BoostrapDropdownMenu extends BootstrapGeneric -{ - private $defaultOptions = [ - 'dropdown-class' => [], - 'toggle-button' => [], - 'menu' => [], - 'direction' => 'end', - 'alignment' => 'start', - 'submenu_alignment' => 'start', - 'submenu_direction' => 'end', - 'submenu_classes' => [], - ]; - - function __construct($options, $btHelper) - { - $this->allowedOptionValues = [ - 'direction' => ['start', 'end', 'up', 'down'], - 'alignment' => ['start', 'end'], - ]; - $this->processOptions($options); - $this->menu = $this->options['menu']; - $this->btHelper = $btHelper; - } - - private function processOptions($options) - { - $this->options = array_merge($this->defaultOptions, $options); - if (!empty($this->options['dropdown-class']) && !is_array($this->options['dropdown-class'])) { - $this->options['dropdown-class'] = [$this->options['dropdown-class']]; - } - $this->checkOptionValidity(); - } - - public function dropdownMenu() - { - return $this->fullDropdown(); - } - - public function fullDropdown() - { - return $this->genDropdownWrapper($this->genDropdownToggleButton(), $this->genDropdownMenu($this->menu)); - } - - public function genDropdownWrapper($toggle = '', $menu = '', $direction = null, $classes = null) - { - $classes = !is_null($classes) ? $classes : $this->options['dropdown-class']; - $direction = !is_null($direction) ? $direction : $this->options['direction']; - $content = $toggle . $menu; - $html = $this->genNode('div', array_merge( - $this->options['params'], - [ - 'class' => array_merge( - $classes, - [ - 'dropdown', - "drop{$direction}" - ] - ) - ] - ), $content); - return $html; - } - - public function genDropdownToggleButton() - { - $defaultOptions = [ - 'class' => ['dropdown-toggle'], - 'params' => [ - 'data-bs-toggle' => 'dropdown', - 'aria-expanded' => 'false', - ] - ]; - $options = array_merge_recursive($this->options['toggle-button'], $defaultOptions); - return $this->btHelper->button($options); - } - - private function genDropdownMenu($entries, $alignment = null) - { - $alignment = !is_null($alignment) ? $alignment : $this->options['alignment']; - $html = $this->genNode('div', [ - 'class' => ['dropdown-menu', "dropdown-menu-{$alignment}"], - ], $this->genEntries($entries)); - return $html; - } - - private function genEntries($entries) - { - $html = ''; - foreach ($entries as $entry) { - $link = $this->genEntry($entry); - if (!empty($entry['menu'])) { - $html .= $this->genDropdownWrapper($link, $this->genDropdownMenu($entry['menu']), $this->options['submenu_direction'], $this->options['submenu_classes']); - } else { - $html .= $link; - } - } - return $html; - } - - private function genEntry($entry) - { - if (!empty($entry['html'])) { - return $entry['html']; - } - $classes = []; - $icon = ''; - if (!empty($entry['icon'])) { - $icon = $this->btHelper->icon($entry['icon'], ['class' => 'me-2']); - } - $badge = ''; - if (!empty($entry['badge'])) { - $bsBadge = new BoostrapBadge(array_merge( - ['class' => ['ms-auto']], - $entry['badge'] - )); - $badge = $bsBadge->badge(); - } - - if (!empty($entry['header'])) { - return $this->genNode('h6', [ - 'class' => ['dropdown-header',], - ], $icon . h($entry['text']) . $badge); - } - - $classes = ['dropdown-item']; - $params = ['href' => '#']; - - if (!empty($entry['menu'])) { - $classes[] = 'dropdown-toggle'; - $classes[] = 'd-flex align-items-center'; - $params['data-bs-toggle'] = 'dropdown'; - $params['aria-haspopup'] = 'true'; - $params['aria-expanded'] = 'false'; - if (!empty($entry['keepOpen'])) { - $classes[] = 'open-form'; - } - $params['data-open-form-id'] = mt_rand(); - } - - $labelContent = sprintf('%s%s', - h($entry['text']), - !empty($entry['sup']) ? $this->genNode('sup', ['class' => 'ms-1 text-muted'], $entry['sup']) : '' - ); - $label = $this->genNode('span', ['class' => 'mx-1'], $labelContent); - $content = $icon . $label . $badge; - - return $this->genNode('a', array_merge([ - 'class' => $classes, - ], $params), $content); + return sprintf('bg-%s %s', $variant, self::getTextClassForVariant($variant)); } } diff --git a/src/View/Helper/SocialProviderHelper.php b/src/View/Helper/SocialProviderHelper.php index effb8c5..b5125e4 100644 --- a/src/View/Helper/SocialProviderHelper.php +++ b/src/View/Helper/SocialProviderHelper.php @@ -31,7 +31,7 @@ class SocialProviderHelper extends Helper private function genImage($url, $alt) { - return $this->Bootstrap->genNode('img', [ + return $this->Bootstrap->node('img', [ 'src' => $url, 'class' => ['img-fluid'], 'width' => '16', diff --git a/templates/Instance/migration_index.php b/templates/Instance/migration_index.php index 022cc28..68eb7b0 100644 --- a/templates/Instance/migration_index.php +++ b/templates/Instance/migration_index.php @@ -9,9 +9,7 @@ if (!empty($updateAvailables)) { 'icon' => 'arrow-alt-circle-up', 'class' => 'mt-1', 'text' => __n('Run update', 'Run all updates', count($updateAvailables)), - 'params' => [ - 'onclick' => 'runAllUpdate()' - ] + 'onclick' => 'runAllUpdate()', ]) ); echo $this->Bootstrap->alert([ @@ -35,11 +33,11 @@ foreach ($status as $i => &$update) { echo $this->Bootstrap->table([], [ 'fields' => [ - ['key' => 'id', 'label' => __('ID')], - ['key' => 'name', 'label' => __('Name')], - ['key' => 'end_time', 'label' => __('End Time')], - ['key' => 'time_taken_formated', 'label' => __('Time Taken')], - ['key' => 'status', 'label' => __('Status')] + ['path' => 'id', 'label' => __('ID')], + ['path' => 'name', 'label' => __('Name')], + ['path' => 'end_time', 'label' => __('End Time')], + ['path' => 'time_taken_formated', 'label' => __('Time Taken')], + ['path' => 'status', 'label' => __('Status')] ], 'items' => $status, ]); diff --git a/templates/MetaTemplates/index.php b/templates/MetaTemplates/index.php index 799eedc..d67d859 100644 --- a/templates/MetaTemplates/index.php +++ b/templates/MetaTemplates/index.php @@ -18,9 +18,7 @@ if (!empty($updateableTemplates['new'])) { 'size' => 'sm', 'icon' => 'download', 'title' => __('Create this template'), - 'params' => [ - 'onclick' => "UI.submissionModalForIndex('/metaTemplates/createNewTemplate/{$entry['uuid']}', '/meta-templates')" - ] + 'onclick' => "UI.submissionModalForIndex('/metaTemplates/createNewTemplate/{$entry['uuid']}', '/meta-templates')", ]) ); }, $alertList); @@ -225,4 +223,3 @@ function getConflictingTemplate($row, $data) { } return []; } -?> diff --git a/templates/MetaTemplates/migrate_old_meta_template_to_newest_version_for_entity.php b/templates/MetaTemplates/migrate_old_meta_template_to_newest_version_for_entity.php index 8a7ee11..32252c7 100644 --- a/templates/MetaTemplates/migrate_old_meta_template_to_newest_version_for_entity.php +++ b/templates/MetaTemplates/migrate_old_meta_template_to_newest_version_for_entity.php @@ -71,9 +71,7 @@ use Cake\Routing\Router; $this->Bootstrap->button([ 'text' => __('Update to version {0}', h($newMetaTemplate->version)), 'variant' => 'success', - 'params' => [ - 'onclick' => 'submitMigration()' - ] + 'onclick' => 'submitMigration()', ]) ?> diff --git a/templates/MetaTemplates/update.php b/templates/MetaTemplates/update.php index 411e477..473f29a 100644 --- a/templates/MetaTemplates/update.php +++ b/templates/MetaTemplates/update.php @@ -51,7 +51,7 @@ if ($updateStatus['up-to-date']) { 'templateOnDisk' => $templateOnDisk, ]); $bodyHtml .= $this->Bootstrap->collapse([ - 'title' => __('View conflicts'), + 'text' => __('View conflicts'), 'open' => false ], $conflictTable); $bodyHtml .= $this->element('MetaTemplates/conflictResolution', [ diff --git a/templates/Users/login.php b/templates/Users/login.php index 7317a43..60d6054 100644 --- a/templates/Users/login.php +++ b/templates/Users/login.php @@ -52,8 +52,8 @@ use Cake\Core\Configure; 'class' => ['d-block', 'w-100'], 'image' => [ 'path' => '/img/keycloak_logo.png', - 'alt' => 'Keycloak' - ] + 'alt' => 'Keycloak', + ], ]); echo $this->Form->end(); } diff --git a/templates/element/Settings/field.php b/templates/element/Settings/field.php index d52bc14..ed297f0 100644 --- a/templates/element/Settings/field.php +++ b/templates/element/Settings/field.php @@ -2,7 +2,7 @@ if ($setting['type'] == 'string' || $setting['type'] == 'textarea' || empty($setting['type'])) { $input = (function ($settingName, $setting, $appView) { $settingId = str_replace('.', '_', $settingName); - return $appView->Bootstrap->genNode( + return $appView->Bootstrap->node( $setting['type'] == 'textarea' ? 'textarea' : 'input', [ 'class' => [ @@ -43,7 +43,7 @@ } elseif ($setting['type'] == 'integer') { $input = (function ($settingName, $setting, $appView) { $settingId = str_replace('.', '_', $settingName); - return $appView->Bootstrap->genNode('input', [ + return $appView->Bootstrap->node('input', [ 'class' => [ 'form-control', (!empty($setting['error']) ? 'is-invalid' : ''), @@ -73,7 +73,7 @@ } } $options = []; - $options[] = $appView->Bootstrap->genNode('option', ['value' => '-1', 'data-is-empty-option' => '1'], __('Select an option')); + $options[] = $appView->Bootstrap->node('option', ['value' => '-1', 'data-is-empty-option' => '1'], __('Select an option')); foreach ($setting['options'] as $key => $value) { $optionParam = [ 'class' => [], @@ -88,10 +88,10 @@ $optionParam['selected'] = 'selected'; } } - $options[] = $appView->Bootstrap->genNode('option', $optionParam, h($value)); + $options[] = $appView->Bootstrap->node('option', $optionParam, h($value)); } $options = implode('', $options); - return $appView->Bootstrap->genNode('select', [ + return $appView->Bootstrap->node('select', [ 'class' => [ 'form-select', 'pe-4', diff --git a/templates/element/Settings/fieldGroup.php b/templates/element/Settings/fieldGroup.php index cd60977..462ae22 100644 --- a/templates/element/Settings/fieldGroup.php +++ b/templates/element/Settings/fieldGroup.php @@ -3,7 +3,7 @@ $dependsOnHtml = ''; if (!empty($setting['dependsOn'])) { - $dependsOnHtml = $this->Bootstrap->genNode('span', [ + $dependsOnHtml = $this->Bootstrap->node('span', [ 'class' => [ 'ms-1', 'd-inline-block', @@ -11,18 +11,18 @@ ], 'style' => 'min-width: 0.75em;', 'title' => __('This setting depends on the validity of: {0}', h($setting['dependsOn'])), - ], $this->Bootstrap->genNode('sup', [ + ], $this->Bootstrap->node('sup', [ 'class' => $this->FontAwesome->getClass('info'), ])); } - $label = $this->Bootstrap->genNode('label', [ + $label = $this->Bootstrap->node('label', [ 'class' => ['form-label', 'fw-bolder', 'mb-0'], 'for' => $settingId ], sprintf('%s', h($settingId), h($settingId), h($setting['name'])) . $dependsOnHtml); $description = ''; if (!empty($setting['description']) && (empty($setting['type']) || $setting['type'] != 'boolean')) { - $description = $this->Bootstrap->genNode('small', [ + $description = $this->Bootstrap->node('small', [ 'class' => ['form-text', 'text-muted', 'mt-0'], 'id' => "{$settingId}Help" ], h($setting['description'])); @@ -31,7 +31,7 @@ if (!empty($setting['severity'])) { $textColor = "text-{$this->get('variantFromSeverity')[$setting['severity']]}"; } - $validationError = $this->Bootstrap->genNode('div', [ + $validationError = $this->Bootstrap->node('div', [ 'class' => ['d-block', 'invalid-feedback', $textColor], ], (!empty($setting['error']) ? h($setting['errorMessage']) : '')); @@ -50,11 +50,11 @@ 'variant' => 'success', 'class' => ['btn-setting-action', 'btn-save-setting', 'd-none'], ]); - $inputGroup = $this->Bootstrap->genNode('div', [ + $inputGroup = $this->Bootstrap->node('div', [ 'class' => ['input-group'], ], implode('', [$input, $inputGroupSave])); - $container = $this->Bootstrap->genNode('div', [ + $container = $this->Bootstrap->node('div', [ 'class' => ['setting-group', 'row', 'mb-2'] ], implode('', [$label, $inputGroup, $description, $validationError])); diff --git a/templates/element/Settings/notice.php b/templates/element/Settings/notice.php index 9e79877..c7baeb5 100644 --- a/templates/element/Settings/notice.php +++ b/templates/element/Settings/notice.php @@ -50,14 +50,14 @@ foreach (array_keys($mainNoticeHeading) as $level) { 'bordered' => false, ], [ 'fields' => [ - ['key' => 'name', 'label' => __('Name'), 'formatter' => function($name, $row) { + ['path' => 'name', 'label' => __('Name'), 'formatter' => function($name, $row) { $settingID = preg_replace('/(\.|\W)/', '_', h($row['true-name'])); return sprintf('%s', $settingID, $settingID, h($name)); }], - ['key' => 'setting-path', 'label' => __('Category'), 'formatter' => function($path, $row) { + ['path' => 'setting-path', 'label' => __('Category'), 'formatter' => function($path, $row) { return '' . h(str_replace('.', ' â–¸ ', $path)) . ''; }], - ['key' => 'value', 'label' => __('Value'), 'formatter' => function($value, $row) { + ['path' => 'value', 'label' => __('Value'), 'formatter' => function($value, $row) { $formatedValue = ''; if (is_null($value)) { $formatedValue .= '' . __('No value') . ''; @@ -71,7 +71,7 @@ foreach (array_keys($mainNoticeHeading) as $level) { $formatedValue .= ''; return $formatedValue; }], - ['key' => 'description', 'label' => __('Description')] + ['path' => 'description', 'label' => __('Description')] ], 'items' => $notices[$level], ]); @@ -87,14 +87,14 @@ $alertBody = $this->Bootstrap->table([ 'tableClass' => 'mb-0' ], [ 'fields' => [ - ['key' => 'severity', 'label' => __('Severity')], - ['key' => 'issues', 'label' => __('Issues'), 'formatter' => function($count, $row) { + ['path' => 'severity', 'label' => __('Severity')], + ['path' => 'issues', 'label' => __('Issues'), 'formatter' => function($count, $row) { return $this->Bootstrap->badge([ 'variant' => $row['badge-variant'], 'text' => $count ]); }], - ['key' => 'description', 'label' => __('Description')] + ['path' => 'description', 'label' => __('Description')] ], 'items' => $tableItems, ]); diff --git a/templates/element/Settings/panel.php b/templates/element/Settings/panel.php index 6fdb0b0..bc37919 100644 --- a/templates/element/Settings/panel.php +++ b/templates/element/Settings/panel.php @@ -34,7 +34,7 @@ if (isLeaf($panelSettings)) { h($panelName) ); if (!empty($panelSettings['_description'])) { - $panelHTML .= $this->Bootstrap->genNode('div', [ + $panelHTML .= $this->Bootstrap->node('div', [ 'class' => ['mb-1',], ], h($panelSettings['_description'])); } @@ -59,7 +59,7 @@ if (isLeaf($panelSettings)) { } } } - $panelHTML = $this->Bootstrap->genNode('div', [ + $panelHTML = $this->Bootstrap->node('div', [ 'class' => [ 'shadow', 'p-2', diff --git a/templates/element/UserSettings/saved-bookmarks.php b/templates/element/UserSettings/saved-bookmarks.php index c3b5a5f..8671c82 100644 --- a/templates/element/UserSettings/saved-bookmarks.php +++ b/templates/element/UserSettings/saved-bookmarks.php @@ -5,19 +5,17 @@ $table = $this->Bootstrap->table([ 'hover' => false, ], [ 'fields' => [ - ['key' => 'label', 'label' => __('Label')], - ['key' => 'name', 'label' => __('Name')], - ['key' => 'url', 'label' => __('URL'), 'formatter' => function ($value, $row) { + ['path' => 'label', 'label' => __('Label')], + ['path' => 'name', 'label' => __('Name')], + ['path' => 'url', 'label' => __('URL'), 'formatter' => function ($value, $row) { return sprintf('%s', h($value)); }], - ['key' => 'action', 'label' => __('Action'), 'formatter' => function ($value, $row, $index) { + ['path' => 'action', 'label' => __('Action'), 'formatter' => function ($value, $row, $index) { return $this->Bootstrap->button([ 'icon' => 'trash', 'variant' => 'danger', 'size' => 'sm', - 'params' => [ - 'onclick' => sprintf('deleteBookmark(window.bookmarks[%s])', $index), - ] + 'onclick' => sprintf('deleteBookmark(window.bookmarks[%s])', $index), ]); }], ], diff --git a/templates/element/genericElements/Form/formLayouts/formDefault.php b/templates/element/genericElements/Form/formLayouts/formDefault.php index 56a439a..25f7699 100644 --- a/templates/element/genericElements/Form/formLayouts/formDefault.php +++ b/templates/element/genericElements/Form/formLayouts/formDefault.php @@ -22,7 +22,7 @@ ], [ [ - '_open' => true, + 'open' => true, 'header' => [ 'title' => __('Meta fields') ], diff --git a/templates/element/genericElements/Form/formLayouts/formRaw.php b/templates/element/genericElements/Form/formLayouts/formRaw.php index 1e445f7..2817bd6 100644 --- a/templates/element/genericElements/Form/formLayouts/formRaw.php +++ b/templates/element/genericElements/Form/formLayouts/formRaw.php @@ -15,7 +15,7 @@ ], [ [ - '_open' => true, + 'open' => true, 'header' => [ 'title' => __('Meta fields') ], diff --git a/templates/element/genericElements/Form/metaTemplateForm.php b/templates/element/genericElements/Form/metaTemplateForm.php index f52cbb2..5331cf9 100644 --- a/templates/element/genericElements/Form/metaTemplateForm.php +++ b/templates/element/genericElements/Form/metaTemplateForm.php @@ -82,7 +82,7 @@ foreach ($metaTemplate->meta_template_fields as $metaTemplateField) { } } } -$fieldContainer = $this->Bootstrap->genNode('div', [ +$fieldContainer = $this->Bootstrap->node('div', [ 'class' => [], ], $fieldsHtml); echo $fieldContainer; \ No newline at end of file diff --git a/templates/element/genericElements/IndexTable/Statistics/index_statistic_field_amount.php b/templates/element/genericElements/IndexTable/Statistics/index_statistic_field_amount.php index 123da84..dcaff63 100644 --- a/templates/element/genericElements/IndexTable/Statistics/index_statistic_field_amount.php +++ b/templates/element/genericElements/IndexTable/Statistics/index_statistic_field_amount.php @@ -41,7 +41,7 @@ foreach ($statistics['usage'] as $scope => $graphData) { 'nodeType' => 'a', 'onclick' => '', 'class' => ['btn-statistics-pie-configurator-' . $seedPiechart], - 'params' => [ + 'attrs' => [ 'data-bs-toggle' => 'popover', ] ]) @@ -52,7 +52,7 @@ foreach ($statistics['usage'] as $scope => $graphData) { $pieChart ); $statPie = $this->Bootstrap->card([ - 'variant' => 'secondary', + 'bodyVariant' => 'secondary', 'bodyHTML' => $panelHtml, 'bodyClass' => 'py-1 px-2', 'class' => ['shadow-sm', 'h-100'] diff --git a/templates/element/genericElements/IndexTable/Statistics/index_statistic_timestamp.php b/templates/element/genericElements/IndexTable/Statistics/index_statistic_timestamp.php index bd0d43b..11e2a2b 100644 --- a/templates/element/genericElements/IndexTable/Statistics/index_statistic_timestamp.php +++ b/templates/element/genericElements/IndexTable/Statistics/index_statistic_timestamp.php @@ -38,7 +38,7 @@ $panelControlHtml = sprintf( 'nodeType' => 'a', 'onclick' => '', 'class' => ['btn-statistics-days-configurator-' . $seed,], - 'params' => [ + 'attrs' => [ 'data-bs-toggle' => 'popover', ] ]) @@ -46,13 +46,13 @@ $panelControlHtml = sprintf( $createdNumber = empty($timeline['created']) ? '' : sprintf( '
    %s %s
    ', __('{0} Created', $timeline['created']['variation']), - $this->Bootstrap->icon('plus', ['class' => ['fa-fw'], 'params' => ['style' => 'font-size: 60%;']]), + $this->Bootstrap->icon('plus', ['class' => ['fa-fw'], 'attrs' => ['style' => 'font-size: 60%;']]), $timeline['created']['variation'] ); $modifiedNumber = empty($timeline['modified']) ? '' : sprintf( '
    %s %s
    ', __('{0} Modified', $timeline['modified']['variation']), - $this->Bootstrap->icon('edit', ['class' => ['fa-fw'], 'params' => ['style' => 'font-size: 60%;']]), + $this->Bootstrap->icon('edit', ['class' => ['fa-fw'], 'attrs' => ['style' => 'font-size: 60%;']]), $timeline['modified']['variation'] ); $activityNumbers = sprintf('
    %s%s
    ', $createdNumber, $modifiedNumber); @@ -87,7 +87,7 @@ $cardContent = sprintf( ); $card = $this->Bootstrap->card([ - 'variant' => 'secondary', + 'bodyVariant' => 'secondary', 'bodyHTML' => $cardContent, 'bodyClass' => 'py-1 px-2', 'class' => ['shadow-sm', 'h-100'] diff --git a/templates/element/genericElements/IndexTable/index_table.php b/templates/element/genericElements/IndexTable/index_table.php index 956fcf8..b722aa0 100644 --- a/templates/element/genericElements/IndexTable/index_table.php +++ b/templates/element/genericElements/IndexTable/index_table.php @@ -14,6 +14,7 @@ use Cake\Utility\Text; * ), * 'title' => optional title, * 'description' => optional description, + * 'notice' => optional alert to be placed at the top, * 'index_statistics' => optional statistics to be displayed for the index, * 'primary_id_path' => path to each primary ID (extracted and passed as $primary to fields) * )); @@ -48,7 +49,7 @@ if (!empty($data['title'])) { 'help' => $this->Bootstrap->icon('info', [ 'class' => ['fs-6', 'align-text-top',], 'title' => empty($data['description']) ? '' : h($data['description']), - 'params' => [ + 'attrs' => [ 'data-bs-toggle' => 'tooltip', ] ]), diff --git a/templates/element/genericElements/ListTopBar/group_multi_select_actions.php b/templates/element/genericElements/ListTopBar/group_multi_select_actions.php index 382781d..75f77ea 100644 --- a/templates/element/genericElements/ListTopBar/group_multi_select_actions.php +++ b/templates/element/genericElements/ListTopBar/group_multi_select_actions.php @@ -7,7 +7,7 @@ 'text' => $child['text'], 'outline' => !empty($child['outline']), 'icon' => $child['icon'] ?? null, - 'params' => array_merge([ + 'attrs' => array_merge([ 'data-onclick-function' => $child['onclick'] ?? '', 'data-table-random-value' => $tableRandomValue, 'onclick' => 'multiActionClickHandler(this)' diff --git a/templates/element/genericElements/ListTopBar/group_search.php b/templates/element/genericElements/ListTopBar/group_search.php index c2743f1..0cfb2f9 100644 --- a/templates/element/genericElements/ListTopBar/group_search.php +++ b/templates/element/genericElements/ListTopBar/group_search.php @@ -31,10 +31,8 @@ $buttonConfig = [ 'icon' => 'filter', 'variant' => $numberActiveFilters > 0 ? 'warning' : 'primary', - 'params' => [ - 'title' => __('Filter index'), - 'id' => sprintf('toggleFilterButton-%s', h($tableRandomValue)) - ] + 'title' => __('Filter index'), + 'id' => sprintf('toggleFilterButton-%s', h($tableRandomValue)) ]; if (count($activeFilters) > 0) { $buttonConfig['badge'] = [ diff --git a/templates/element/genericElements/ListTopBar/group_table_action.php b/templates/element/genericElements/ListTopBar/group_table_action.php index fe538b2..3ec3ce3 100644 --- a/templates/element/genericElements/ListTopBar/group_table_action.php +++ b/templates/element/genericElements/ListTopBar/group_table_action.php @@ -67,14 +67,14 @@ $numberOfElementHtml = $this->element('/genericElements/ListTopBar/group_table_a 'dropdown-class' => 'ms-1', 'alignment' => 'end', 'direction' => 'down', - 'toggle-button' => [ + 'button' => [ 'icon' => 'sliders-h', 'variant' => 'primary', 'class' => ['table_setting_dropdown_button'], ], 'submenu_alignment' => 'end', 'submenu_direction' => 'start', - 'params' => [ + 'attrs' => [ 'data-table-random-value' => $tableRandomValue, 'data-table_setting_id' => $data['table_setting_id'], ], diff --git a/templates/element/genericElements/ListTopBar/group_table_action/hiddenColumns.php b/templates/element/genericElements/ListTopBar/group_table_action/hiddenColumns.php index 8e14c6d..f826422 100644 --- a/templates/element/genericElements/ListTopBar/group_table_action/hiddenColumns.php +++ b/templates/element/genericElements/ListTopBar/group_table_action/hiddenColumns.php @@ -28,7 +28,7 @@ foreach ($table_data['fields'] as $field) { ); } -$availableColumnsHtml = $this->Bootstrap->genNode('form', [ +$availableColumnsHtml = $this->Bootstrap->node('form', [ 'class' => ['visible-column-form', 'px-2 py-1'], ], $availableColumnsHtml); echo $availableColumnsHtml; diff --git a/templates/element/genericElements/ListTopBar/group_table_action/hiddenMetaColumns.php b/templates/element/genericElements/ListTopBar/group_table_action/hiddenMetaColumns.php index 8415dce..fa3e98d 100644 --- a/templates/element/genericElements/ListTopBar/group_table_action/hiddenMetaColumns.php +++ b/templates/element/genericElements/ListTopBar/group_table_action/hiddenMetaColumns.php @@ -26,7 +26,7 @@ if (!empty($meta_template)) { } } -$availableMetaColumnsHtml = $this->Bootstrap->genNode('form', [ +$availableMetaColumnsHtml = $this->Bootstrap->node('form', [ 'class' => ['visible-meta-column-form', 'px-2 py-1'], ], $availableMetaColumnsHtml); echo $availableMetaColumnsHtml; diff --git a/templates/element/genericElements/SingleViews/metafields_panel.php b/templates/element/genericElements/SingleViews/metafields_panel.php index d7f2e19..2c1df06 100644 --- a/templates/element/genericElements/SingleViews/metafields_panel.php +++ b/templates/element/genericElements/SingleViews/metafields_panel.php @@ -48,7 +48,7 @@ foreach($data['MetaTemplates'] as $metaTemplate) { 'text' => __('Migrate to version {0}', $metaTemplate['hasNewerVersion']->version), 'variant' => 'success', 'nodeType' => 'a', - 'params' => [ + 'attrs' => [ 'href' => Router::url([ 'controller' => 'metaTemplates', 'action' => 'migrateOldMetaTemplateToNewestVersionForEntity', diff --git a/templates/element/layouts/header/header-notifications.php b/templates/element/layouts/header/header-notifications.php index e18b619..fd8f942 100644 --- a/templates/element/layouts/header/header-notifications.php +++ b/templates/element/layouts/header/header-notifications.php @@ -25,6 +25,7 @@ $variant = array_flip($severity)[$maxSeverity]; if ($hasNotification) { echo $this->Bootstrap->notificationBubble([ 'variant' => $variant, + 'borderVariant' => 'light', ]); } ?> diff --git a/templates/element/layouts/sidebar/bookmark-add.php b/templates/element/layouts/sidebar/bookmark-add.php index 69dd353..d68d449 100644 --- a/templates/element/layouts/sidebar/bookmark-add.php +++ b/templates/element/layouts/sidebar/bookmark-add.php @@ -6,7 +6,5 @@ echo $this->Bootstrap->button([ 'variant' => 'primary', 'size' => 'sm', 'class' => 'mb-1', - 'params' => [ - 'id' => 'btn-add-bookmark', - ] + 'id' => 'btn-add-bookmark', ]); diff --git a/templates/element/layouts/sidebar/bookmark-entry.php b/templates/element/layouts/sidebar/bookmark-entry.php index a33ffe4..68b8d4f 100644 --- a/templates/element/layouts/sidebar/bookmark-entry.php +++ b/templates/element/layouts/sidebar/bookmark-entry.php @@ -28,7 +28,7 @@ 'size' => 'sm', 'icon' => h($icon), 'class' => ['mb-1', !$validURI ? 'disabled' : ''], - 'params' => [ + 'attrs' => [ 'href' => $validURI ? h($url) : '#', ] ]); diff --git a/templates/element/layouts/sidebar/entry.php b/templates/element/layouts/sidebar/entry.php index 81949a1..9c0bdab 100644 --- a/templates/element/layouts/sidebar/entry.php +++ b/templates/element/layouts/sidebar/entry.php @@ -71,6 +71,7 @@ if ($childHasNotification || ($hasNotification && !empty($children))) { echo $this->Bootstrap->notificationBubble([ 'variant' => $childHasNotification ? $childNotificationVariant : $notificationVariant, + 'borderVariant' => 'light', ]); } ?> diff --git a/templates/element/widgets/highlight-panel.php b/templates/element/widgets/highlight-panel.php index bbb1645..ef442ba 100644 --- a/templates/element/widgets/highlight-panel.php +++ b/templates/element/widgets/highlight-panel.php @@ -77,7 +77,7 @@ $cardContent = sprintf( ); echo $this->Bootstrap->card([ - 'variant' => 'secondary', + 'bodyVariant' => 'secondary', 'bodyHTML' => $cardContent, 'bodyClass' => 'p-3', 'class' => ['shadow-sm', (empty($panelNoGrow) ? 'grow-on-hover' : '')] diff --git a/templates/genericTemplates/filters.php b/templates/genericTemplates/filters.php index a193721..858d5c3 100644 --- a/templates/genericTemplates/filters.php +++ b/templates/genericTemplates/filters.php @@ -19,12 +19,12 @@ $filteringForm = $this->Bootstrap->table( [ 'fields' => [ [ - 'key' => 'fieldname', 'label' => __('Field'), 'formatter' => function ($field, $row) { + 'path' => 'fieldname', 'label' => __('Field'), 'formatter' => function ($field, $row) { return sprintf('%s', h($field), h($field)); } ], [ - 'key' => 'operator', 'label' => __('Operator'), 'formatter' => function ($field, $row) use ($typeMap) { + 'path' => 'operator', 'label' => __('Operator'), 'formatter' => function ($field, $row) use ($typeMap) { $fieldName = $row['fieldname']; $type = $typeMap[$fieldName] ?? 'text'; $options = [ @@ -41,7 +41,7 @@ $filteringForm = $this->Bootstrap->table( } ], [ - 'key' => 'value', + 'path' => 'value', 'labelHtml' => sprintf( '%s %s', __('Value'), @@ -71,23 +71,23 @@ $filteringForm = $this->Bootstrap->table( $filteringMetafields = ''; if ($metaFieldsEnabled) { - $helpText = $this->Bootstrap->genNode('sup', [ + $helpText = $this->Bootstrap->node('sup', [ 'class' => ['ms-1 fa fa-info'], 'title' => __('Include help'), 'data-bs-toggle' => 'tooltip', ]); - $filteringMetafields = $this->Bootstrap->genNode('h5', [], __('Meta Fields') . $helpText); + $filteringMetafields = $this->Bootstrap->node('h5', [], __('Meta Fields') . $helpText); $filteringMetafields .= $this->element('genericElements/IndexTable/metafield_filtering', $metaTemplates); } $filteringTags = ''; if ($taggingEnabled) { - $helpText = $this->Bootstrap->genNode('sup', [ + $helpText = $this->Bootstrap->node('sup', [ 'class' => ['ms-1 fa fa-info'], 'title' => __('Supports negation matches (with the `!` character) and LIKE matches (with the `%` character). Example: `!exportable`, `%able`'), 'data-bs-toggle' => 'tooltip', ]); - $filteringTags = $this->Bootstrap->genNode('h5', [ + $filteringTags = $this->Bootstrap->node('h5', [ 'class' => 'mt-2' ], __('Tags') . $helpText); $filteringTags .= $this->Tag->tags([], [ @@ -104,7 +104,9 @@ echo $this->Bootstrap->modal([ 'size' => !empty($metaFieldsEnabled) ? 'xl' : 'lg', 'type' => 'confirm', 'bodyHtml' => $modalBody, - 'confirmText' => __('Filter'), + 'confirmButton' => [ + 'text' => __('Filter'), + ], 'confirmFunction' => 'filterIndex' ]); ?> diff --git a/webroot/js/api-helper.js b/webroot/js/api-helper.js index 24d34cc..d01a941 100644 --- a/webroot/js/api-helper.js +++ b/webroot/js/api-helper.js @@ -359,6 +359,9 @@ class AJAXApi { if (!skipRequestHooks) { this.beforeRequest() } + if (form === undefined || form.nodeName !== 'FORM') { + throw new Error(`Form argument must be a valid HTMLFormELement.`) + } let toReturn let feedbackShown = false try { diff --git a/webroot/js/bootstrap-helper.js b/webroot/js/bootstrap-helper.js index 173fdca..18283cd 100644 --- a/webroot/js/bootstrap-helper.js +++ b/webroot/js/bootstrap-helper.js @@ -257,6 +257,9 @@ class Toaster { */ constructor(options) { this.options = Object.assign({}, Toaster.defaultOptions, options) + if (this.options.delay == 'auto') { + this.options.delay = this.computeDelay() + } this.bsToastOptions = { autohide: this.options.autohide, delay: this.options.delay, @@ -271,7 +274,7 @@ class Toaster { * @property {string} body - The body's content of the toast * @property {string=('primary'|'secondary'|'success'|'danger'|'warning'|'info'|'light'|'dark'|'white'|'transparent')} variant - The variant of the toast * @property {boolean} autohide - If the toast show be hidden after some time defined by the delay - * @property {number} delay - The number of milliseconds the toast should stay visible before being hidden + * @property {(number|string)} delay - The number of milliseconds the toast should stay visible before being hidden or 'auto' to deduce the delay based on the content * @property {(jQuery|string)} titleHtml - The raw HTML title's content of the toast * @property {(jQuery|string)} mutedHtml - The raw HTML muted's content of the toast * @property {(jQuery|string)} bodyHtml - The raw HTML body's content of the toast @@ -284,7 +287,7 @@ class Toaster { body: false, variant: 'default', autohide: true, - delay: 5000, + delay: 'auto', titleHtml: false, mutedHtml: false, bodyHtml: false, @@ -389,6 +392,12 @@ class Toaster { } return $toast } + + computeDelay() { + return 3000 + + 40*((this.options.title?.length ?? 0) + (this.options.body?.length ?? 0)) + + (['danger', 'warning'].includes(this.options.variant) ? 5000 : 0) + } } /** Class representing a Modal */ @@ -400,15 +409,16 @@ class ModalFactory { constructor(options) { this.options = Object.assign({}, ModalFactory.defaultOptions, options) if (options.POSTSuccessCallback !== undefined) { - if (this.options.rawHtml) { - this.attachSubmitButtonListener = true - } else { + if (!this.options.rawHtml) { UI.toast({ variant: 'danger', bodyHtml: 'POSTSuccessCallback can only be used in conjuction with the rawHtml option. Instead, use the promise instead returned by the API call in APIConfirm.' }) } } + if (this.options.rawHtml) { + this.attachSubmitButtonListener = true + } if (options.type === undefined && options.cancel !== undefined) { this.options.type = 'confirm' } @@ -794,17 +804,25 @@ class ModalFactory { $form = this.$modal.find('form') } if ($submitButton.data('confirmfunction') !== undefined && $submitButton.data('confirmfunction') !== '') { + $submitButton[0].removeAttribute('onclick') const clickHandler = window[$submitButton.data('confirmfunction')] + if (clickHandler === undefined) { + console.error(`Function \`${$submitButton.data('confirmfunction')}\` is not defined`) + } this.options.APIConfirm = (tmpApi) => { let clickResult = clickHandler(this, tmpApi) if (clickResult !== undefined) { return clickResult .then((data) => { - if (data.success) { + if (!data) { this.options.POSTSuccessCallback([data, this]) - } else { // Validation error - this.injectFormValidationFeedback(form, data.errors) - return Promise.reject('Validation error'); + } else { + if (data.success == undefined || data.success) { + this.options.POSTSuccessCallback([data, this]) + } else { // Validation error + this.injectFormValidationFeedback(form, data.errors) + return Promise.reject('Validation error'); + } } }) .catch((errorMessage) => { @@ -814,23 +832,28 @@ class ModalFactory { } } } else { - $submitButton[0].removeAttribute('onclick') - this.options.APIConfirm = (tmpApi) => { - return tmpApi.postForm($form[0]) - .then((data) => { - if (data.success) { - // this.options.POSTSuccessCallback(data) - this.options.POSTSuccessCallback([data, this]) - } else { // Validation error - this.injectFormValidationFeedback(form, data.errors) - return Promise.reject('Validation error'); - } - }) - .catch((errorMessage) => { - this.options.POSTFailCallback([errorMessage, this]) - // this.options.POSTFailCallback(errorMessage) - return Promise.reject(errorMessage); - }) + if ($form[0]) { + // Submit the form via the AJAXApi + $submitButton[0].removeAttribute('onclick') + this.options.APIConfirm = (tmpApi) => { + return tmpApi.postForm($form[0]) + .then((data) => { + if (!data) { + this.options.POSTSuccessCallback([data, this]) + } else { + if (data.success == undefined || data.success) { + this.options.POSTSuccessCallback([data, this]) + } else { // Validation error + this.injectFormValidationFeedback(form, data.errors) + return Promise.reject('Validation error'); + } + } + }) + .catch((errorMessage) => { + this.options.POSTFailCallback([errorMessage, this]) + return Promise.reject(errorMessage); + }) + } } } $submitButton.click(this.getConfirmationHandlerFunction($submitButton)) @@ -877,7 +900,7 @@ class OverlayFactory { spinnerVariant: '', spinnerSmall: false, spinnerType: 'border', - fallbackBoostrapVariant: '', + fallbackBootstrapVariant: '', wrapperCSSDisplay: '', } @@ -976,7 +999,7 @@ class OverlayFactory { let classes = this.$node.attr('class') if (classes !== undefined) { classes = classes.split(' ') - const detectedVariant = OverlayFactory.detectedBootstrapVariant(classes, this.options.fallbackBoostrapVariant) + const detectedVariant = OverlayFactory.detectedBootstrapVariant(classes, this.options.fallbackBootstrapVariant) this.options.spinnerVariant = detectedVariant } } @@ -985,7 +1008,7 @@ class OverlayFactory { * Detect the bootstrap variant from a list of classes * @param {Array} classes - A list of classes containg a bootstrap variant */ - static detectedBootstrapVariant(classes, fallback=OverlayFactory.defaultOptions.fallbackBoostrapVariant) { + static detectedBootstrapVariant(classes, fallback = OverlayFactory.defaultOptions.fallbackBootstrapVariant) { const re = /^[a-zA-Z]+-(?primary|success|danger|warning|info|light|dark|white|transparent)$/; let result for (let i=0; i Date: Mon, 28 Nov 2022 08:37:00 +0100 Subject: [PATCH 02/60] chg: [layout:user_profile] Improved UI --- src/View/Helper/SocialProviderHelper.php | 8 ++++---- templates/element/layouts/header/header-profile.php | 10 +++++----- webroot/css/layout.css | 3 ++- 3 files changed, 11 insertions(+), 10 deletions(-) diff --git a/src/View/Helper/SocialProviderHelper.php b/src/View/Helper/SocialProviderHelper.php index b5125e4..adfd6a8 100644 --- a/src/View/Helper/SocialProviderHelper.php +++ b/src/View/Helper/SocialProviderHelper.php @@ -18,22 +18,22 @@ class SocialProviderHelper extends Helper return !empty($identity['social_profile']); } - public function getIcon($identity) + public function getIcon($identity, array $classes=[]) { if (!empty($identity['social_profile'])) { $provider = $identity['social_profile']['provider']; if (!empty($this->providerImageMapping[$provider])) { - return $this->genImage($this->providerImageMapping[$provider], h($provider)); + return $this->genImage($this->providerImageMapping[$provider], h($provider), $classes); } } return ''; } - private function genImage($url, $alt) + private function genImage($url, $alt, array $classes=[]) { return $this->Bootstrap->node('img', [ 'src' => $url, - 'class' => ['img-fluid'], + 'class' => array_merge(['img-fluid'], $classes), 'width' => '16', 'height' => '16', 'alt' => $alt, diff --git a/templates/element/layouts/header/header-profile.php b/templates/element/layouts/header/header-profile.php index 197eb8e..d0d3bb7 100644 --- a/templates/element/layouts/header/header-profile.php +++ b/templates/element/layouts/header/header-profile.php @@ -20,14 +20,14 @@ use Cake\Routing\Router; - + - + " > SocialProvider->getIcon($this->request->getAttribute('identity')))): ?> - SocialProvider->getIcon($this->request->getAttribute('identity')) ?> + SocialProvider->getIcon($this->request->getAttribute('identity'), ['me-1']) ?> - + - + diff --git a/webroot/css/layout.css b/webroot/css/layout.css index 1afecec..f7f57c2 100644 --- a/webroot/css/layout.css +++ b/webroot/css/layout.css @@ -203,7 +203,8 @@ main.content { margin: auto 0; } -.right-navbar .header-menu .dropdown-menu a.dropdown-item > i { +.right-navbar .header-menu .dropdown-menu a.dropdown-item > i, +.right-navbar .header-menu .dropdown-menu a.dropdown-item > img { min-width: 25px; } From e1115c1f6440eb3a3e621345cf05989f005f98f1 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Mon, 28 Nov 2022 08:43:45 +0100 Subject: [PATCH 03/60] chg: [helper:bootstrapModal] Improved doc --- src/View/Helper/BootstrapElements/BootstrapModal.php | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/src/View/Helper/BootstrapElements/BootstrapModal.php b/src/View/Helper/BootstrapElements/BootstrapModal.php index d04a6fd..fb25b8e 100644 --- a/src/View/Helper/BootstrapElements/BootstrapModal.php +++ b/src/View/Helper/BootstrapElements/BootstrapModal.php @@ -25,7 +25,7 @@ use App\View\Helper\BootstrapGeneric; * - `confirmButton` and `cancelButton`: Can be used to pass a BootstrapElements/BootstrapButton configuration * - The `custom` Display a list of button defined in the $footerButtons parameter * - confirmFunction: The function to be called when clicking the "confirm" button - * - This options only works if the option $show is enabled or if the modal is loaded with the UI ModalFactory function (e.g. `UI.submissionModal()` or `UI.modal()`) + * - This options *only* works if the option $show is enabled or if the modal is loaded with the UI ModalFactory function (e.g. `UI.submissionModal()` or `UI.modal()`) * - cancelOnclick: The function to be called once the "cancel" button trigger the `onclick` event * - footerButtons: A list of configuration to be passed to BootstrapElements/BootstrapButton * - The option `clickFunction` can be used to set the function to be called when clicking the button. Behavior similar to "confirmFunction" From b7a446cd564c44b108135674c06b6a2032db1625 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Mon, 28 Nov 2022 09:06:24 +0100 Subject: [PATCH 04/60] chg: [helper:bootstrap] Added documentation --- .../BootstrapElements/BootstrapListGroup.php | 2 + src/View/Helper/BootstrapHelper.php | 215 +++++++++++++----- 2 files changed, 157 insertions(+), 60 deletions(-) diff --git a/src/View/Helper/BootstrapElements/BootstrapListGroup.php b/src/View/Helper/BootstrapElements/BootstrapListGroup.php index 9c98852..59ae690 100644 --- a/src/View/Helper/BootstrapElements/BootstrapListGroup.php +++ b/src/View/Helper/BootstrapElements/BootstrapListGroup.php @@ -5,6 +5,8 @@ namespace App\View\Helper\BootstrapElements; use App\View\Helper\BootstrapGeneric; /** + * Creates a Bootstrap list group where items can be links or buttons + * * # Options for list container * - class: A list of class * - attrs: A list of additional HTML attributes diff --git a/src/View/Helper/BootstrapHelper.php b/src/View/Helper/BootstrapHelper.php index 8b5a590..6fc78d3 100644 --- a/src/View/Helper/BootstrapHelper.php +++ b/src/View/Helper/BootstrapHelper.php @@ -1,51 +1,15 @@ Bootstrap->Tabs([ - * 'pills' => true, - * 'card' => true, - * 'data' => [ - * 'navs' => [ - * 'tab1', - * ['text' => 'tab2', 'active' => true], - * ['html' => 'tab3', 'disabled' => true], - * ], - * 'content' => [ - * 'body1', - * 'body2', - * '~body3~' - * ] - * ] - * ]); + * $this->Bootstrap->{$componentName}($options); */ namespace App\View\Helper; -use App\View\AppView; use Cake\View\Helper; -use Cake\Utility\Hash; -use Cake\Utility\Inflector; use Cake\Utility\Text; use InvalidArgumentException; @@ -87,120 +51,251 @@ class BootstrapHelper extends Helper { public $helpers = ['FontAwesome']; - public function tabs($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function tabs(array $options): string { $bsTabs = new BootstrapTabs($options); return $bsTabs->tabs(); } - public function alert($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function alert(array $options): string { $bsAlert = new BootstrapAlert($options); return $bsAlert->alert(); } - public function table($options, $data) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @param array $data See BootstrapElements\BootstrapTabs + * @return string + */ + public function table(array $options, array $data = []): string { $bsTable = new BootstrapTable($options, $data, $this); return $bsTable->table(); } - public function listTable($options, $data) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @param array $data See BootstrapElements\BootstrapTabs + * @return string + */ + public function listTable(array $options, array $data = []): string { $bsListTable = new BootstrapListTable($options, $data, $this); return $bsListTable->table(); } - public function button($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function button(array $options): string { $bsButton = new BootstrapButton($options); return $bsButton->button(); } - public function icon($icon, $options = []) + /** + * Creates a Bootstrap tabs from the given options + * + * @param string $icon See BootstrapElements\BootstrapTabs + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function icon(string $icon, array $options = []): string { $bsIcon = new BootstrapIcon($icon, $options); return $bsIcon->icon(); } - public function badge($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function badge(array $options): string { $bsBadge = new BootstrapBadge($options); return $bsBadge->badge(); } - public function modal($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function modal(array $options): string { $bsModal = new BootstrapModal($options); return $bsModal->modal(); } - public function card($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function card(array $options): string { $bsCard = new BootstrapCard($options); return $bsCard->card(); } - public function progress($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function progress(array $options): string { $bsProgress = new BootstrapProgress($options); return $bsProgress->progress(); } - public function collapse($options, $content) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @param string $content See BootstrapElements\BootstrapTabs + * @return string + */ + public function collapse(array $options, string $content): string { $bsCollapse = new BootstrapCollapse($options, $content, $this); return $bsCollapse->collapse(); } - public function accordion($options, $content) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @param string $content See BootstrapElements\BootstrapTabs + * @return string + */ + public function accordion(array $options, string $content): string { $bsAccordion = new BootstrapAccordion($options, $content, $this); return $bsAccordion->accordion(); } - public function progressTimeline($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function progressTimeline(array $options): string { $bsProgressTimeline = new BootstrapProgressTimeline($options, $this); return $bsProgressTimeline->progressTimeline(); } - public function listGroup($options, $data) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $data See BootstrapElements\BootstrapTabs + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function listGroup(array $data, array $options = []): string { - $bsListGroup = new BootstrapListGroup($options, $data, $this); + $bsListGroup = new BootstrapListGroup($data, $options, $this); return $bsListGroup->listGroup(); } - public function switch($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function switch(array $options): string { $bsSwitch = new BootstrapSwitch($options, $this); return $bsSwitch->switch(); } - public function notificationBubble($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function notificationBubble(array $options): string { $bsNotificationBubble = new BootstrapNotificationBubble($options, $this); return $bsNotificationBubble->notificationBubble(); } - public function dropdownMenu($options) + /** + * Creates a Bootstrap tabs from the given options + * + * @param array $options See BootstrapElements\BootstrapTabs + * @return string + */ + public function dropdownMenu(array $options): string { $bsDropdownMenu = new BootstrapDropdownMenu($options, $this); return $bsDropdownMenu->dropdownMenu(); } - public function toast($options) + /** + * Creates a Bootstrap toast from the given options + * + * @param array $options + * @return string + */ + public function toast(array $options): string { $bsToast = new BootstrapToast($options, $this); return $bsToast->toast(); } - public function node($tag, $attrs=[], $content='', $options=[]): string + /** + * Creates a HTML node + * + * @param string $tag The tag of the node. Example: `div`, `span`, ... + * @param array $attrs Optional HTML attributes to be added on the node + * @param string $content Optional innerHTML of the node + * @param array $options Optional options to build the node. See BootstrapGeneric\node + * @return string + */ + public function node(string $tag, array $attrs = [], string $content = '', array $options = []): string { return BootstrapGeneric::node($tag, $attrs, $content, $options); } - public function render($template, $data=[], $options=[]) + /** + * Render the provided template with the given data + * + * @param string $template The template to render. See BootstrapGeneric\render + * @param array $data The data to be used during the template building + * @param array $options Optional options to build the template + * @return string + */ + public function render(string $template, array $data = [], array $options = []): string { return BootstrapGeneric::render($template, $data, $options); } @@ -267,7 +362,7 @@ class BootstrapGeneric /** * Creates an HTML node * - * ### Options + * # Options * * - `escape` Set to false to disable escaping of attribute value. * From abd9e04a0ff9a0b90b668703d983edeaeff23484 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Mon, 28 Nov 2022 10:01:18 +0100 Subject: [PATCH 05/60] chg: [helper:bootstrap] Added more documentation and typing --- .../BootstrapElements/BootstrapAccordion.php | 13 ++++--- .../BootstrapElements/BootstrapAlert.php | 10 ++--- .../BootstrapElements/BootstrapBadge.php | 8 ++-- .../BootstrapElements/BootstrapButton.php | 12 +++--- .../BootstrapElements/BootstrapCard.php | 14 +++---- .../BootstrapElements/BootstrapCollapse.php | 13 ++++--- .../BootstrapDropdownMenu.php | 19 +++++----- .../BootstrapElements/BootstrapIcon.php | 8 ++-- .../BootstrapElements/BootstrapListGroup.php | 8 ++-- .../BootstrapElements/BootstrapListTable.php | 23 ++++++------ .../BootstrapElements/BootstrapModal.php | 22 +++++------ .../BootstrapNotificationBubble.php | 8 ++-- .../BootstrapElements/BootstrapProgress.php | 6 +-- .../BootstrapProgressTimeline.php | 12 +++--- .../BootstrapElements/BootstrapSwitch.php | 8 ++-- .../BootstrapElements/BootstrapTable.php | 37 +++++++++++-------- .../BootstrapElements/BootstrapTabs.php | 20 +++++----- .../BootstrapElements/BootstrapToast.php | 8 ++-- src/View/Helper/BootstrapHelper.php | 4 +- 19 files changed, 131 insertions(+), 122 deletions(-) diff --git a/src/View/Helper/BootstrapElements/BootstrapAccordion.php b/src/View/Helper/BootstrapElements/BootstrapAccordion.php index 9bce200..6f0688c 100644 --- a/src/View/Helper/BootstrapElements/BootstrapAccordion.php +++ b/src/View/Helper/BootstrapElements/BootstrapAccordion.php @@ -3,6 +3,7 @@ namespace App\View\Helper\BootstrapElements; use App\View\Helper\BootstrapGeneric; +use App\View\Helper\BootstrapHelper; /** * Creates an collapsible accordion component @@ -53,7 +54,7 @@ class BootstrapAccordion extends BootstrapGeneric 'class' => [], ]; - function __construct($options, $content, $btHelper) + function __construct(array $options, array $content, BootstrapHelper $btHelper) { $this->allowedOptionValues = []; $this->content = $content; @@ -61,7 +62,7 @@ class BootstrapAccordion extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->checkOptionValidity(); @@ -78,12 +79,12 @@ class BootstrapAccordion extends BootstrapGeneric } } - public function accordion() + public function accordion(): string { return $this->genAccordion(); } - private function genHeader($accordionItem, $i) + private function genHeader(array $accordionItem, int $i): string { $html = $this->nodeOpen('h2', [ 'class' => ['accordion-header'], @@ -110,7 +111,7 @@ class BootstrapAccordion extends BootstrapGeneric return $html; } - private function genBody($accordionItem, $i) + private function genBody(array $accordionItem, int $i): string { $content = $this->node('div', [ 'class' => ['accordion-body'] @@ -134,7 +135,7 @@ class BootstrapAccordion extends BootstrapGeneric return $html; } - private function genAccordion() + private function genAccordion(): string { $html = $this->nodeOpen('div', [ 'class' => array_merge(['accordion'], $this->options['class']), diff --git a/src/View/Helper/BootstrapElements/BootstrapAlert.php b/src/View/Helper/BootstrapElements/BootstrapAlert.php index 49c0240..8bff3c1 100644 --- a/src/View/Helper/BootstrapElements/BootstrapAlert.php +++ b/src/View/Helper/BootstrapElements/BootstrapAlert.php @@ -34,7 +34,7 @@ class BootstrapAlert extends BootstrapGeneric 'class' => [], ]; - function __construct($options) + function __construct(array $options) { $this->allowedOptionValues = [ 'variant' => BootstrapGeneric::$variants, @@ -42,19 +42,19 @@ class BootstrapAlert extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); $this->checkOptionValidity(); } - public function alert() + public function alert(): string { return $this->genAlert(); } - private function genAlert() + private function genAlert(): string { $html = $this->nodeOpen('div', [ 'class' => array_merge([ @@ -72,7 +72,7 @@ class BootstrapAlert extends BootstrapGeneric return $html; } - private function genCloseButton() + private function genCloseButton(): string { $html = ''; if ($this->options['dismissible']) { diff --git a/src/View/Helper/BootstrapElements/BootstrapBadge.php b/src/View/Helper/BootstrapElements/BootstrapBadge.php index d4cf856..3538334 100644 --- a/src/View/Helper/BootstrapElements/BootstrapBadge.php +++ b/src/View/Helper/BootstrapElements/BootstrapBadge.php @@ -34,7 +34,7 @@ class BootstrapBadge extends BootstrapGeneric 'class' => [], ]; - function __construct($options) + function __construct(array $options) { $this->allowedOptionValues = [ 'variant' => BootstrapGeneric::$variants, @@ -42,19 +42,19 @@ class BootstrapBadge extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); $this->checkOptionValidity(); } - public function badge() + public function badge(): string { return $this->genBadge(); } - private function genBadge() + private function genBadge(): string { $html = $this->node('span', [ 'class' => array_merge($this->options['class'], [ diff --git a/src/View/Helper/BootstrapElements/BootstrapButton.php b/src/View/Helper/BootstrapElements/BootstrapButton.php index 7cf2b05..458680c 100644 --- a/src/View/Helper/BootstrapElements/BootstrapButton.php +++ b/src/View/Helper/BootstrapElements/BootstrapButton.php @@ -53,7 +53,7 @@ class BootstrapButton extends BootstrapGeneric private $bsClasses = []; - function __construct($options) + function __construct(array $options) { $this->allowedOptionValues = [ 'variant' => array_merge(BootstrapGeneric::$variants, ['link', 'text']), @@ -63,7 +63,7 @@ class BootstrapButton extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); @@ -91,12 +91,12 @@ class BootstrapButton extends BootstrapGeneric } } - public function button() + public function button(): string { return $this->genButton(); } - private function genButton() + private function genButton(): string { $html = $this->nodeOpen($this->options['nodeType'], array_merge($this->options['attrs'], [ 'class' => array_merge($this->options['class'], $this->bsClasses), @@ -116,7 +116,7 @@ class BootstrapButton extends BootstrapGeneric return $html; } - private function genIcon() + private function genIcon(): string { if (!empty($this->options['icon'])) { $bsIcon = new BootstrapIcon($this->options['icon'], [ @@ -127,7 +127,7 @@ class BootstrapButton extends BootstrapGeneric return ''; } - private function genImage() + private function genImage(): string { if (!empty($this->options['image'])) { return $this->node('img', [ diff --git a/src/View/Helper/BootstrapElements/BootstrapCard.php b/src/View/Helper/BootstrapElements/BootstrapCard.php index 3053660..47ecd68 100644 --- a/src/View/Helper/BootstrapElements/BootstrapCard.php +++ b/src/View/Helper/BootstrapElements/BootstrapCard.php @@ -41,7 +41,7 @@ class BootstrapCard extends BootstrapGeneric 'footerClass' => '', ]; - public function __construct($options) + public function __construct(array $options) { $this->allowedOptionValues = [ 'headerVariant' => array_merge(BootstrapGeneric::$variants, ['']), @@ -51,7 +51,7 @@ class BootstrapCard extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->options['headerClass'] = $this->convertToArrayIfNeeded($this->options['headerClass']); @@ -61,12 +61,12 @@ class BootstrapCard extends BootstrapGeneric $this->options['borderVariant'] = !empty($this->options['headerVariant']) ? "border-{$this->options['headerVariant']}" : ''; } - public function card() + public function card(): string { return $this->genCard(); } - private function genCard() + private function genCard(): string { $card = $this->node('div', [ 'class' => array_merge( @@ -80,7 +80,7 @@ class BootstrapCard extends BootstrapGeneric return $card; } - private function genHeader() + private function genHeader(): string { if (empty($this->options['headerHTML']) && empty($this->options['headerText'])) { return ''; @@ -98,7 +98,7 @@ class BootstrapCard extends BootstrapGeneric return $header; } - private function genBody() + private function genBody(): string { if (empty($this->options['bodyHTML']) && empty($this->options['bodyText'])) { return ''; @@ -116,7 +116,7 @@ class BootstrapCard extends BootstrapGeneric return $body; } - private function genFooter() + private function genFooter(): string { if (empty($this->options['footerHTML']) && empty($this->options['footerText'])) { return ''; diff --git a/src/View/Helper/BootstrapElements/BootstrapCollapse.php b/src/View/Helper/BootstrapElements/BootstrapCollapse.php index 4441d2d..8d90f79 100644 --- a/src/View/Helper/BootstrapElements/BootstrapCollapse.php +++ b/src/View/Helper/BootstrapElements/BootstrapCollapse.php @@ -5,6 +5,7 @@ namespace App\View\Helper\BootstrapElements; use Cake\Utility\Security; use App\View\Helper\BootstrapGeneric; +use App\View\Helper\BootstrapHelper; /** * Creates a Bootstrap collapsible component @@ -45,7 +46,7 @@ class BootstrapCollapse extends BootstrapGeneric 'attrs' => [], ]; - function __construct($options, $content, $btHelper) + function __construct(array $options, string $content, BootstrapHelper $btHelper) { $this->allowedOptionValues = []; $this->processOptions($options); @@ -53,7 +54,7 @@ class BootstrapCollapse extends BootstrapGeneric $this->btHelper = $btHelper; } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); @@ -73,12 +74,12 @@ class BootstrapCollapse extends BootstrapGeneric $this->checkOptionValidity(); } - public function collapse() + public function collapse(): string { return $this->genCollapse(); } - private function genControl() + private function genControl(): string { $attrsConfig = [ 'data-bs-toggle' => 'collapse', @@ -101,7 +102,7 @@ class BootstrapCollapse extends BootstrapGeneric return $html; } - private function genContent() + private function genContent(): string { $cardConfig = $this->options['card']; $cardConfig['bodyHTML'] = $this->content; @@ -113,7 +114,7 @@ class BootstrapCollapse extends BootstrapGeneric return $container; } - private function genCollapse() + private function genCollapse(): string { return $this->genControl() . $this->genContent(); } diff --git a/src/View/Helper/BootstrapElements/BootstrapDropdownMenu.php b/src/View/Helper/BootstrapElements/BootstrapDropdownMenu.php index 2bea216..e3a64c6 100644 --- a/src/View/Helper/BootstrapElements/BootstrapDropdownMenu.php +++ b/src/View/Helper/BootstrapElements/BootstrapDropdownMenu.php @@ -3,6 +3,7 @@ namespace App\View\Helper\BootstrapElements; use App\View\Helper\BootstrapGeneric; +use App\View\Helper\BootstrapHelper; /** * # Options @@ -65,7 +66,7 @@ class BootstrapDropdownMenu extends BootstrapGeneric 'attrs' => [], ]; - function __construct($options, $btHelper) + function __construct(array $options, BootstrapHelper $btHelper) { $this->allowedOptionValues = [ 'direction' => ['start', 'end', 'up', 'down'], @@ -77,24 +78,24 @@ class BootstrapDropdownMenu extends BootstrapGeneric $this->btHelper = $btHelper; } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->options['dropdown-class'] = $this->convertToArrayIfNeeded($this->options['dropdown-class']); $this->checkOptionValidity(); } - public function dropdownMenu() + public function dropdownMenu(): string { return $this->fullDropdown(); } - public function fullDropdown() + public function fullDropdown(): string { return $this->genDropdownWrapper($this->genDropdownToggleButton(), $this->genDropdownMenu($this->menu)); } - public function genDropdownWrapper($toggle = '', $menu = '', $direction = null, $classes = null) + public function genDropdownWrapper(string $toggle = '', string $menu = '', $direction = null, $classes = null): string { $classes = !is_null($classes) ? $classes : $this->options['dropdown-class']; $direction = !is_null($direction) ? $direction : $this->options['direction']; @@ -114,7 +115,7 @@ class BootstrapDropdownMenu extends BootstrapGeneric return $html; } - public function genDropdownToggleButton() + public function genDropdownToggleButton(): string { $defaultOptions = [ 'class' => ['dropdown-toggle'], @@ -127,7 +128,7 @@ class BootstrapDropdownMenu extends BootstrapGeneric return $this->btHelper->button($options); } - private function genDropdownMenu($entries, $alignment = null) + private function genDropdownMenu(array $entries, $alignment = null): string { $alignment = !is_null($alignment) ? $alignment : $this->options['alignment']; $html = $this->node('div', [ @@ -136,7 +137,7 @@ class BootstrapDropdownMenu extends BootstrapGeneric return $html; } - private function genEntries($entries) + private function genEntries(array $entries): string { $html = ''; foreach ($entries as $entry) { @@ -150,7 +151,7 @@ class BootstrapDropdownMenu extends BootstrapGeneric return $html; } - private function genEntry($entry) + private function genEntry(array $entry): string { if (!empty($entry['html'])) { return $entry['html']; diff --git a/src/View/Helper/BootstrapElements/BootstrapIcon.php b/src/View/Helper/BootstrapElements/BootstrapIcon.php index 085d9ae..71c0c8a 100644 --- a/src/View/Helper/BootstrapElements/BootstrapIcon.php +++ b/src/View/Helper/BootstrapElements/BootstrapIcon.php @@ -26,25 +26,25 @@ class BootstrapIcon extends BootstrapGeneric 'attrs' => [], ]; - function __construct($icon, $options = []) + function __construct(string $icon, array $options = []) { $this->icon = $icon; $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->checkOptionValidity(); $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); } - public function icon() + public function icon(): string { return $this->genIcon(); } - private function genIcon() + private function genIcon(): string { $html = $this->node('span', array_merge( [ diff --git a/src/View/Helper/BootstrapElements/BootstrapListGroup.php b/src/View/Helper/BootstrapElements/BootstrapListGroup.php index 59ae690..5804a3f 100644 --- a/src/View/Helper/BootstrapElements/BootstrapListGroup.php +++ b/src/View/Helper/BootstrapElements/BootstrapListGroup.php @@ -60,14 +60,14 @@ class BootstrapListGroup extends BootstrapGeneric private static $defaultClasses = ['list-group',]; private static $defaultItemClasses = ['list-group-item', 'list-group-item-action', 'd-flex', 'align-items-start', 'justify-content-between']; - function __construct($items, $options, $btHelper) + function __construct(array $items, array $options, \App\View\BootstrapHelper $btHelper) { $this->items = $items; $this->processOptions($options); $this->btHelper = $btHelper; } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->options['class'] = $this->convertToArrayIfNeeded($this->options['class']); @@ -90,7 +90,7 @@ class BootstrapListGroup extends BootstrapGeneric return $html; } - private function genItem($item) + private function genItem(array $item): string { $item['class'] = !is_array($item['class']) ? [$item['class']] : $item['class']; $itemOptions = array_merge($this->defaultItemOptions, $item); @@ -109,7 +109,7 @@ class BootstrapListGroup extends BootstrapGeneric return $html; } - private function genBadge($badge) + private function genBadge(array $badge): string { if (empty($badge)) { return ''; diff --git a/src/View/Helper/BootstrapElements/BootstrapListTable.php b/src/View/Helper/BootstrapElements/BootstrapListTable.php index 77aaddb..a2ba806 100644 --- a/src/View/Helper/BootstrapElements/BootstrapListTable.php +++ b/src/View/Helper/BootstrapElements/BootstrapListTable.php @@ -5,6 +5,7 @@ namespace App\View\Helper\BootstrapElements; use Cake\Utility\Hash; use App\View\Helper\BootstrapGeneric; +use App\View\Helper\BootstrapHelper; /** * Creates a list looking like a table from 1-dimensional data $item. @@ -93,7 +94,7 @@ class BootstrapListTable extends BootstrapGeneric 'elementsRootPath' => '/genericElements/SingleViews/Fields/', ]; - function __construct($options, $data, $btHelper) + function __construct(array $options, array $data, BootstrapHelper $btHelper) { $this->allowedOptionValues = [ 'variant' => array_merge(BootstrapGeneric::$variants, ['']) @@ -105,7 +106,7 @@ class BootstrapListTable extends BootstrapGeneric $this->btHelper = $btHelper; } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->options['tableClass'] = $this->convertToArrayIfNeeded($this->options['tableClass']); @@ -113,12 +114,12 @@ class BootstrapListTable extends BootstrapGeneric $this->checkOptionValidity(); } - public function table() + public function table(): string { return $this->genTable(); } - private function genTable() + private function genTable(): string { $html = $this->nodeOpen('table', [ 'class' => [ @@ -142,7 +143,7 @@ class BootstrapListTable extends BootstrapGeneric return $html; } - private function genBody() + private function genBody(): string { $body = $this->nodeOpen('tbody', [ 'class' => $this->options['bodyClass'], @@ -154,7 +155,7 @@ class BootstrapListTable extends BootstrapGeneric return $body; } - private function genRow($field) + private function genRow(array $field): string { $rowValue = $this->genCell($field); $rowKey = $this->node('th', [ @@ -172,7 +173,7 @@ class BootstrapListTable extends BootstrapGeneric return $row; } - private function genCell($field = []) + private function genCell(array $field = []): string { if (isset($field['raw'])) { $cellContent = !empty($field['rawNoEscaping']) ? $field['raw'] : h($field['raw']); @@ -199,14 +200,14 @@ class BootstrapListTable extends BootstrapGeneric ], $cellContent); } - private function getValueFromObject($field) + private function getValueFromObject(array $field): string { $key = is_array($field) ? $field['path'] : $field; $cellValue = Hash::get($this->item, $key); - return $cellValue; + return !is_null($cellValue) ? $cellValue : ''; } - private function getElementPath($type) + private function getElementPath($type): string { return sprintf( '%s%sField', @@ -215,7 +216,7 @@ class BootstrapListTable extends BootstrapGeneric ); } - private function genCaption() + private function genCaption(): string { return !empty($this->caption) ? $this->node('caption', [], h($this->caption)) : ''; } diff --git a/src/View/Helper/BootstrapElements/BootstrapModal.php b/src/View/Helper/BootstrapElements/BootstrapModal.php index fb25b8e..a7b60fb 100644 --- a/src/View/Helper/BootstrapElements/BootstrapModal.php +++ b/src/View/Helper/BootstrapElements/BootstrapModal.php @@ -155,7 +155,7 @@ class BootstrapModal extends BootstrapGeneric 'cancelOnclick' => '' ]; - function __construct($options) + function __construct(array $options) { $this->allowedOptionValues = [ 'size' => ['sm', 'lg', 'xl', ''], @@ -167,7 +167,7 @@ class BootstrapModal extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->checkOptionValidity(); @@ -188,7 +188,7 @@ class BootstrapModal extends BootstrapGeneric } } - public function modal() + public function modal(): string { $modal = $this->genModal(); if ($this->options['show']) { @@ -211,7 +211,7 @@ class BootstrapModal extends BootstrapGeneric )); } - private function genModal() + private function genModal(): string { $dialog = $this->nodeOpen('div', [ 'class' => array_merge( @@ -231,7 +231,7 @@ class BootstrapModal extends BootstrapGeneric return $html; } - private function genHeader() + private function genHeader(): string { $header = $this->nodeOpen('div', ['class' => array_merge(['modal-header'], $this->options['headerClass'])]); $header .= $this->options['titleHtml'] ?? $this->node('h5', ['class' => ['modal-title']], h($this->options['title'])); @@ -242,7 +242,7 @@ class BootstrapModal extends BootstrapGeneric return $header; } - private function genBody() + private function genBody(): string { $body = $this->nodeOpen('div', ['class' => array_merge(['modal-body'], $this->options['bodyClass'])]); $body .= $this->options['bodyHtml'] ?? h($this->options['body']); @@ -250,7 +250,7 @@ class BootstrapModal extends BootstrapGeneric return $body; } - private function genFooter() + private function genFooter(): string { $footer = $this->nodeOpen('div', [ 'class' => array_merge(['modal-footer'], $this->options['footerClass']), @@ -261,7 +261,7 @@ class BootstrapModal extends BootstrapGeneric return $footer; } - private function getFooterBasedOnType() + private function getFooterBasedOnType(): string { if ($this->options['type'] == 'ok-only') { return $this->getFooterOkOnly(); @@ -274,7 +274,7 @@ class BootstrapModal extends BootstrapGeneric } } - private function getFooterOkOnly() + private function getFooterOkOnly(): string { return (new BootstrapButton([ 'variant' => 'primary', @@ -286,7 +286,7 @@ class BootstrapModal extends BootstrapGeneric ]))->button(); } - private function getFooterConfirm() + private function getFooterConfirm(): string { $buttonCancelConfig = array_merge( [ @@ -318,7 +318,7 @@ class BootstrapModal extends BootstrapGeneric return $buttonCancel . $buttonConfirm; } - private function getFooterCustom() + private function getFooterCustom(): string { $buttons = []; foreach ($this->options['footerButtons'] as $buttonConfig) { diff --git a/src/View/Helper/BootstrapElements/BootstrapNotificationBubble.php b/src/View/Helper/BootstrapElements/BootstrapNotificationBubble.php index d9744d2..e0788ab 100644 --- a/src/View/Helper/BootstrapElements/BootstrapNotificationBubble.php +++ b/src/View/Helper/BootstrapElements/BootstrapNotificationBubble.php @@ -33,7 +33,7 @@ class BootstrapNotificationBubble extends BootstrapGeneric 'attrs' => [], ]; - function __construct($options) + function __construct(array $options) { $this->allowedOptionValues = [ 'variant' => BootstrapGeneric::$variants, @@ -43,7 +43,7 @@ class BootstrapNotificationBubble extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->checkOptionValidity(); @@ -57,12 +57,12 @@ class BootstrapNotificationBubble extends BootstrapGeneric } } - public function notificationBubble() + public function notificationBubble(): string { return $this->genNotificationBubble(); } - private function genNotificationBubble() + private function genNotificationBubble(): string { $tmpId = 'tmp-' . mt_rand(); $defaultClasses = [ diff --git a/src/View/Helper/BootstrapElements/BootstrapProgress.php b/src/View/Helper/BootstrapElements/BootstrapProgress.php index 7bb861e..27117b5 100644 --- a/src/View/Helper/BootstrapElements/BootstrapProgress.php +++ b/src/View/Helper/BootstrapElements/BootstrapProgress.php @@ -47,18 +47,18 @@ class BootstrapProgress extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions($options): void { $this->options = array_merge($this->defaultOptions, $options); $this->checkOptionValidity(); } - public function progress() + public function progress(): string { return $this->genProgress(); } - private function genProgress() + private function genProgress(): string { $percentage = round(100 * $this->options['value'] / $this->options['total']); $heightStyle = !empty($this->options['height']) ? sprintf('height: %s;', h($this->options['height'])) : ''; diff --git a/src/View/Helper/BootstrapElements/BootstrapProgressTimeline.php b/src/View/Helper/BootstrapElements/BootstrapProgressTimeline.php index 6243a5e..89c20d0 100644 --- a/src/View/Helper/BootstrapElements/BootstrapProgressTimeline.php +++ b/src/View/Helper/BootstrapElements/BootstrapProgressTimeline.php @@ -51,18 +51,18 @@ class BootstrapProgressTimeline extends BootstrapGeneric $this->btHelper = $btHelper; } - private function processOptions($options) + private function processOptions($options): void { $this->options = array_merge($this->defaultOptions, $options); $this->checkOptionValidity(); } - public function progressTimeline() + public function progressTimeline(): string { return $this->genProgressTimeline(); } - private function getStepIcon($step, $i, $nodeActive, $lineActive) + private function getStepIcon(array $step, int $i, bool $nodeActive, bool $lineActive): string { $icon = $this->node('b', [ 'class' => [ @@ -92,7 +92,7 @@ class BootstrapProgressTimeline extends BootstrapGeneric return $html; } - private function getHorizontalLine($i, $nodeActive, $lineActive) + private function getHorizontalLine(int $i, bool $nodeActive, bool $lineActive): string { $stepCount = count($this->options['steps']); if ($i == $stepCount - 1) { @@ -114,7 +114,7 @@ class BootstrapProgressTimeline extends BootstrapGeneric return $line; } - private function getStepText($step, $isActive) + private function getStepText(array $step, bool $isActive): string { return $this->node('li', [ 'class' => [ @@ -125,7 +125,7 @@ class BootstrapProgressTimeline extends BootstrapGeneric ], h($step['text'] ?? '')); } - private function genProgressTimeline() + private function genProgressTimeline(): string { $iconLis = ''; $textLis = ''; diff --git a/src/View/Helper/BootstrapElements/BootstrapSwitch.php b/src/View/Helper/BootstrapElements/BootstrapSwitch.php index 984964c..b70ab6f 100644 --- a/src/View/Helper/BootstrapElements/BootstrapSwitch.php +++ b/src/View/Helper/BootstrapElements/BootstrapSwitch.php @@ -34,7 +34,7 @@ class BootstrapSwitch extends BootstrapGeneric 'attrs' => [], ]; - public function __construct($options) + public function __construct(array $options) { $this->allowedOptionValues = [ 'variant' => BootstrapGeneric::$variants, @@ -42,18 +42,18 @@ class BootstrapSwitch extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->checkOptionValidity(); } - public function switch() + public function switch(): string { return $this->genSwitch(); } - public function genSwitch() + public function genSwitch(): string { $tmpId = 'tmp-' . mt_rand(); $input = self::node('input', array_merge( diff --git a/src/View/Helper/BootstrapElements/BootstrapTable.php b/src/View/Helper/BootstrapElements/BootstrapTable.php index c69dc76..21a627f 100644 --- a/src/View/Helper/BootstrapElements/BootstrapTable.php +++ b/src/View/Helper/BootstrapElements/BootstrapTable.php @@ -6,6 +6,7 @@ use Cake\Utility\Hash; use Cake\Utility\Inflector; use App\View\Helper\BootstrapGeneric; +use App\View\Helper\BootstrapHelper; /** * Creates a table from 2-dimensional data $items. @@ -23,6 +24,7 @@ use App\View\Helper\BootstrapGeneric; * # Options for fields * - label: The name of the field to be displayed as a label * - labelHtml: The HTML of the field to be displayed as a label + * - class: Additional classes to add for that row * - path: The path to be fed to Hash::get() in order to get the value from the $item * - element: The type of element to use combined with $elementsRootPath from the table's option * - formatter: A callback function to format the value @@ -87,7 +89,7 @@ class BootstrapTable extends BootstrapGeneric 'elementsRootPath' => '/genericElements/SingleViews/Fields/', ]; - function __construct($options, $data, $btHelper) + function __construct(array $options, array $data, BootstrapHelper $btHelper) { $this->allowedOptionValues = [ 'variant' => array_merge(BootstrapGeneric::$variants, ['']) @@ -99,7 +101,7 @@ class BootstrapTable extends BootstrapGeneric $this->btHelper = $btHelper; } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->checkOptionValidity(); @@ -108,12 +110,12 @@ class BootstrapTable extends BootstrapGeneric $this->options['headerClass'] = $this->convertToArrayIfNeeded($this->options['headerClass']); } - public function table() + public function table(): string { return $this->genTable(); } - private function genTable() + private function genTable(): string { $html = $this->nodeOpen('table', [ 'class' => [ @@ -138,7 +140,7 @@ class BootstrapTable extends BootstrapGeneric return $html; } - private function genHeader() + private function genHeader(): string { $head = $this->nodeOpen('thead', [ 'class' => $this->options['headerClass'], @@ -163,7 +165,7 @@ class BootstrapTable extends BootstrapGeneric return $head; } - private function genBody() + private function genBody(): string { $body = $this->nodeOpen('tbody', [ 'class' => $this->options['bodyClass'], @@ -175,7 +177,7 @@ class BootstrapTable extends BootstrapGeneric return $body; } - private function genRow($row, $rowIndex) + private function genRow(array $row, int $rowIndex): string { $html = $this->nodeOpen('tr', [ 'class' => [ @@ -189,14 +191,14 @@ class BootstrapTable extends BootstrapGeneric } } else { // indexed array foreach ($row as $i => $cellValue) { - $html .= $this->genCell($cellValue, 'index', $row, $rowIndex); + $html .= $this->genCell($cellValue, [], $row, $rowIndex); } } $html .= $this->nodeClose('tr'); return $html; } - private function genCell($value, $field = [], $row = [], $rowIndex = 0) + private function genCell(string $value, array $field = [], array $row = [], int $rowIndex = 0): string { if (isset($field['formatter'])) { $cellContent = $field['formatter']($value, $row, $rowIndex); @@ -209,20 +211,23 @@ class BootstrapTable extends BootstrapGeneric $cellContent = h($value); } return $this->node('td', [ - 'class' => [ - !empty($field['columnVariant']) ? "table-{$field['columnVariant']}" : '' - ] + 'class' => array_merge( + [ + !empty($field['columnVariant']) ? "table-{$field['columnVariant']}" : '' + ], + $field['class'] ?? [] + ), ], $cellContent); } - private function getValueFromObject($row, $field) + private function getValueFromObject(array $row, $field): string { $path = is_array($field) ? $field['path'] : $field; $cellValue = Hash::get($row, $path); - return $cellValue; + return !is_null($cellValue) ? $cellValue : ''; } - private function getElementPath($type) + private function getElementPath(string $type): string { return sprintf( '%s%sField', @@ -231,7 +236,7 @@ class BootstrapTable extends BootstrapGeneric ); } - private function genCaption() + private function genCaption(): string { return !empty($this->caption) ? $this->node('caption', [], h($this->caption)) : ''; } diff --git a/src/View/Helper/BootstrapElements/BootstrapTabs.php b/src/View/Helper/BootstrapElements/BootstrapTabs.php index a0a7e59..e0ac5af 100644 --- a/src/View/Helper/BootstrapElements/BootstrapTabs.php +++ b/src/View/Helper/BootstrapElements/BootstrapTabs.php @@ -92,7 +92,7 @@ class BootstrapTabs extends BootstrapGeneric ]; private $bsClasses = null; - function __construct($options) + function __construct(array $options) { $this->allowedOptionValues = [ 'justify-header' => [false, 'center', 'end', 'start'], @@ -104,12 +104,12 @@ class BootstrapTabs extends BootstrapGeneric $this->processOptions($options); } - public function tabs() + public function tabs(): string { return $this->genTabs(); } - private function processOptions($options) + private function processOptions(array $options): void { $this->options = array_merge($this->defaultOptions, $options); $this->data = $this->options['data']; @@ -179,12 +179,12 @@ class BootstrapTabs extends BootstrapGeneric } } - private function genTabs() + private function genTabs(): string { return $this->options['vertical'] ? $this->genVerticalTabs() : $this->genHorizontalTabs(); } - private function genHorizontalTabs() + private function genHorizontalTabs(): string { if ($this->options['card']) { $cardOptions = [ @@ -206,7 +206,7 @@ class BootstrapTabs extends BootstrapGeneric } } - private function genVerticalTabs() + private function genVerticalTabs(): string { $header = $this->node('div', ['class' => array_merge( [ @@ -244,7 +244,7 @@ class BootstrapTabs extends BootstrapGeneric return $container; } - private function genNav() + private function genNav(): string { $html = $this->nodeOpen('ul', [ 'class' => array_merge(['nav'], $this->bsClasses['nav'], $this->options['nav-class']), @@ -257,7 +257,7 @@ class BootstrapTabs extends BootstrapGeneric return $html; } - private function genNavItem($navItem) + private function genNavItem(array $navItem): string { $html = $this->nodeOpen('li', [ 'class' => array_merge(['nav-item'], $this->bsClasses['nav-item'], $this->options['nav-item-class']), @@ -282,7 +282,7 @@ class BootstrapTabs extends BootstrapGeneric return $html; } - private function genContent() + private function genContent(): string { $html = $this->nodeOpen('div', [ 'class' => array_merge(['tab-content'], $this->options['content-class']), @@ -295,7 +295,7 @@ class BootstrapTabs extends BootstrapGeneric return $html; } - private function genContentItem($navItem, $content) + private function genContentItem(array $navItem, string $content): string { return $this->node('div', [ 'class' => array_merge(['tab-pane', 'fade'], [!empty($navItem['active']) ? 'show active' : '']), diff --git a/src/View/Helper/BootstrapElements/BootstrapToast.php b/src/View/Helper/BootstrapElements/BootstrapToast.php index fc3e264..9df3b8d 100644 --- a/src/View/Helper/BootstrapElements/BootstrapToast.php +++ b/src/View/Helper/BootstrapElements/BootstrapToast.php @@ -40,7 +40,7 @@ class BootstrapToast extends BootstrapGeneric 'closeButton' => true, ]; - function __construct($options) + function __construct(array $options) { $this->allowedOptionValues = [ 'variant' => array_merge(BootstrapGeneric::$variants, ['default']), @@ -48,7 +48,7 @@ class BootstrapToast extends BootstrapGeneric $this->processOptions($options); } - private function processOptions($options) + private function processOptions(array $options): void { $validOptions = array_filter($options, function($optionName) { return isset($this->defaultOptions[$optionName]); @@ -57,12 +57,12 @@ class BootstrapToast extends BootstrapGeneric $this->checkOptionValidity(); } - public function toast() + public function toast(): string { return $this->genToast(); } - private function genToast() + private function genToast(): string { return $this->node('script', [], sprintf( "$(document).ready(function() { diff --git a/src/View/Helper/BootstrapHelper.php b/src/View/Helper/BootstrapHelper.php index 6fc78d3..f814116 100644 --- a/src/View/Helper/BootstrapHelper.php +++ b/src/View/Helper/BootstrapHelper.php @@ -191,10 +191,10 @@ class BootstrapHelper extends Helper * Creates a Bootstrap tabs from the given options * * @param array $options See BootstrapElements\BootstrapTabs - * @param string $content See BootstrapElements\BootstrapTabs + * @param array $content See BootstrapElements\BootstrapTabs * @return string */ - public function accordion(array $options, string $content): string + public function accordion(array $options, array $content): string { $bsAccordion = new BootstrapAccordion($options, $content, $this); return $bsAccordion->accordion(); From 251331b12150690cb2525a6374c2db1ab12960ec Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Mon, 28 Nov 2022 10:01:49 +0100 Subject: [PATCH 06/60] fix: [layout:formLayouts] Use correct parameter for accordion header --- .../element/genericElements/Form/formLayouts/formDefault.php | 2 +- templates/element/genericElements/Form/formLayouts/formRaw.php | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/templates/element/genericElements/Form/formLayouts/formDefault.php b/templates/element/genericElements/Form/formLayouts/formDefault.php index 25f7699..29a3930 100644 --- a/templates/element/genericElements/Form/formLayouts/formDefault.php +++ b/templates/element/genericElements/Form/formLayouts/formDefault.php @@ -24,7 +24,7 @@ [ 'open' => true, 'header' => [ - 'title' => __('Meta fields') + 'text' => __('Meta fields') ], 'body' => $metaTemplateString, ], diff --git a/templates/element/genericElements/Form/formLayouts/formRaw.php b/templates/element/genericElements/Form/formLayouts/formRaw.php index 2817bd6..b86eacf 100644 --- a/templates/element/genericElements/Form/formLayouts/formRaw.php +++ b/templates/element/genericElements/Form/formLayouts/formRaw.php @@ -17,7 +17,7 @@ [ 'open' => true, 'header' => [ - 'title' => __('Meta fields') + 'text' => __('Meta fields') ], 'body' => $metaTemplateString, ], From 796574994c7d72cb91eaac7cf22bb67a2d52a268 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Mon, 28 Nov 2022 10:02:11 +0100 Subject: [PATCH 07/60] fix: [elements:setting-search] Fixed typo --- templates/element/Settings/search.php | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/templates/element/Settings/search.php b/templates/element/Settings/search.php index ceca462..4fc97da 100644 --- a/templates/element/Settings/search.php +++ b/templates/element/Settings/search.php @@ -17,7 +17,7 @@ $(document).ready(function() { $("#search-settings").select2({ data: selectData, - placeholder: '', + placeholder: '', templateResult: formatSettingSearchResult, templateSelection: formatSettingSearchSelection, matcher: settingMatcher, From 6d2f3f2ef973b775ab5ecd721016719429f94593 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Mon, 28 Nov 2022 10:02:36 +0100 Subject: [PATCH 08/60] chg: [elements:settings-notice] Improved UI --- templates/element/Settings/notice.php | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/templates/element/Settings/notice.php b/templates/element/Settings/notice.php index c7baeb5..38c1f64 100644 --- a/templates/element/Settings/notice.php +++ b/templates/element/Settings/notice.php @@ -52,7 +52,7 @@ foreach (array_keys($mainNoticeHeading) as $level) { 'fields' => [ ['path' => 'name', 'label' => __('Name'), 'formatter' => function($name, $row) { $settingID = preg_replace('/(\.|\W)/', '_', h($row['true-name'])); - return sprintf('%s', $settingID, $settingID, h($name)); + return sprintf('%s', $settingID, $settingID, h($name)); }], ['path' => 'setting-path', 'label' => __('Category'), 'formatter' => function($path, $row) { return '' . h(str_replace('.', ' â–¸ ', $path)) . ''; From 3dddd96eeb0cc130f70c1ef6d2452353ac16b157 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Mon, 28 Nov 2022 12:12:01 +0100 Subject: [PATCH 09/60] chg: [element:metafield_panel] Metafield now relying on their index type when being displayed on singleViews --- src/Model/Table/PermissionLimitationsTable.php | 4 ---- .../genericElements/SingleViews/metafields_panel.php | 12 +++++++++++- 2 files changed, 11 insertions(+), 5 deletions(-) diff --git a/src/Model/Table/PermissionLimitationsTable.php b/src/Model/Table/PermissionLimitationsTable.php index 1b5f193..1763d3c 100644 --- a/src/Model/Table/PermissionLimitationsTable.php +++ b/src/Model/Table/PermissionLimitationsTable.php @@ -79,10 +79,6 @@ class PermissionLimitationsTable extends AppTable foreach ($metaTemplate['meta_template_fields'] as &$meta_template_field) { $boolean = $meta_template_field['type'] === 'boolean'; foreach ($meta_template_field['metaFields'] as &$metaField) { - if ($boolean) { - $metaField['value'] = ''; - $metaField['no_escaping'] = true; - } if (isset($permissionLimitations[$metaField['field']])) { foreach ($permissionLimitations[$metaField['field']] as $scope => $value) { $messageType = 'warning'; diff --git a/templates/element/genericElements/SingleViews/metafields_panel.php b/templates/element/genericElements/SingleViews/metafields_panel.php index 2c1df06..82b24be 100644 --- a/templates/element/genericElements/SingleViews/metafields_panel.php +++ b/templates/element/genericElements/SingleViews/metafields_panel.php @@ -1,10 +1,12 @@ [], 'content' => [] ]; +$viewElementCandidatePath = '/genericElements/SingleViews/Fields/'; foreach($data['MetaTemplates'] as $metaTemplate) { if (!empty($metaTemplate->meta_template_fields)) { $tabData['navs'][] = [ @@ -15,9 +17,17 @@ foreach($data['MetaTemplates'] as $metaTemplate) { $labelPrintedOnce = false; if (!empty($metaTemplateField->metaFields)) { foreach ($metaTemplateField->metaFields as $metaField) { + $viewElementCandidate = $metaTemplateField->index_type == 'text' ? 'generic' : $metaTemplateField->index_type; // Currently, single-view generic fields are not using index-view fields $fields[] = [ 'key' => !$labelPrintedOnce ? $metaField->field : '', - 'raw' => $metaField->value, + // Not relying on the `type` option as this table is a special case where not all values have a label + 'raw' => $this->element(sprintf('%s%sField', $viewElementCandidatePath, $viewElementCandidate), [ + 'data' => $metaField, + 'field' => [ + 'path' => 'value', + ] + ]), + 'rawNoEscaping' => true, 'warning' => $metaField->warning ?? null, 'info' => $metaField->info ?? null, 'danger' => $metaField->danger ?? null From 346e6db5120c1462ad945a98bc216d893bd754d3 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Mon, 28 Nov 2022 15:33:56 +0100 Subject: [PATCH 10/60] chg: [install:nginx] Cerebrate now expect php8+ --- INSTALL/cerebrate_nginx.conf | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/INSTALL/cerebrate_nginx.conf b/INSTALL/cerebrate_nginx.conf index 59ad861..b8936f5 100644 --- a/INSTALL/cerebrate_nginx.conf +++ b/INSTALL/cerebrate_nginx.conf @@ -28,7 +28,7 @@ server { location ~ \.php$ { try_files $uri =404; fastcgi_split_path_info ^(.+\.php)(/.+)$; - fastcgi_pass unix:/var/run/php/php7.4-fpm.sock; + fastcgi_pass unix:/var/run/php/php8.1-fpm.sock; fastcgi_index index.php; include fastcgi_params; fastcgi_param SCRIPT_FILENAME $document_root$fastcgi_script_name; From 9ad328d962336cbc8053281bc9dbd2ff64168966 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Mon, 28 Nov 2022 15:51:29 +0100 Subject: [PATCH 11/60] fix: [genericTemplate:delete] Fixed usage of BootstrapElement\BootstrapModal --- templates/genericTemplates/delete.php | 7 +++++-- 1 file changed, 5 insertions(+), 2 deletions(-) diff --git a/templates/genericTemplates/delete.php b/templates/genericTemplates/delete.php index de45ab6..763750a 100644 --- a/templates/genericTemplates/delete.php +++ b/templates/genericTemplates/delete.php @@ -28,8 +28,11 @@ $bodyHTML = sprintf('%s%s', $formHTML, $bodyMessage); echo $this->Bootstrap->modal([ 'size' => 'lg', 'title' => !empty($deletionTitle) ? $deletionTitle : __('Delete {0}', h(Cake\Utility\Inflector::singularize(Cake\Utility\Inflector::humanize($this->request->getParam('controller'))))), - 'type' => 'confirm-danger', - 'confirmText' => !empty($deletionConfirm) ? $deletionConfirm : __('Delete'), + 'type' => 'confirm', + 'confirmButton' => [ + 'text' => !empty($deletionConfirm) ? $deletionConfirm : __('Delete'), + 'variant' => 'danger', + ], 'bodyHtml' => $bodyHTML, ]); ?> From e5080e6fda57adf0107cce73898f48d9e76de675 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Tue, 29 Nov 2022 11:51:03 +0100 Subject: [PATCH 12/60] fix: [brood:preview] Restored searching capability on browsing --- src/Controller/BroodsController.php | 23 ++++++++++++++++-- src/Controller/Component/CRUDComponent.php | 27 ++++++++++++++-------- 2 files changed, 38 insertions(+), 12 deletions(-) diff --git a/src/Controller/BroodsController.php b/src/Controller/BroodsController.php index a857d43..b120f8c 100644 --- a/src/Controller/BroodsController.php +++ b/src/Controller/BroodsController.php @@ -14,6 +14,18 @@ class BroodsController extends AppController public $quickFilterFields = [['Broods.name' => true], 'Broods.uuid', ['Broods.description' => true]]; public $containFields = ['Organisations']; + protected $previewScopes = [ + 'organisations' => [ + 'quickFilterFields' => ['uuid', ['name' => true], ], + ], + 'individuals' => [ + 'quickFilterFields' => ['uuid', ['email' => true], ['first_name' => true], ['last_name' => true], ], + ], + 'sharingGroups' => [ + 'quickFilterFields' => ['uuid', ['name' => true], ], + ], + ]; + public function index() { $this->CRUD->index([ @@ -96,8 +108,9 @@ class BroodsController extends AppController public function previewIndex($id, $scope) { - if (!in_array($scope, ['organisations', 'individuals', 'sharingGroups'])) { - throw new MethodNotAllowedException(__('Invalid scope. Valid options are: organisations, individuals, sharing_groups')); + $validScopes = array_keys($this->previewScopes); + if (!in_array($scope, $validScopes)) { + throw new MethodNotAllowedException(__('Invalid scope. Valid options are: {0}', implode(', ', $validScopes))); } $filter = $this->request->getQuery('quickFilter'); $data = $this->Broods->queryIndex($id, $scope, $filter); @@ -108,6 +121,12 @@ class BroodsController extends AppController return $this->RestResponse->viewData($data, 'json'); } else { $data = $this->CustomPagination->paginate($data); + $optionFilters = ['quickFilter']; + $CRUDParams = $this->ParamHandler->harvestParams($optionFilters); + $CRUDOptions = [ + 'quickFilters' => $this->previewScopes[$scope]['quickFilterFields'], + ]; + $this->CRUD->setQuickFilterForView($CRUDParams, $CRUDOptions); $this->set('data', $data); $this->set('brood_id', $id); if ($this->request->is('ajax')) { diff --git a/src/Controller/Component/CRUDComponent.php b/src/Controller/Component/CRUDComponent.php index f932e5a..b2a7ab5 100644 --- a/src/Controller/Component/CRUDComponent.php +++ b/src/Controller/Component/CRUDComponent.php @@ -1119,17 +1119,9 @@ class CRUDComponent extends Component public function setQuickFilters(array $params, \Cake\ORM\Query $query, array $options): \Cake\ORM\Query { + $this->setQuickFilterForView($params, $options); $quickFilterFields = $options['quickFilters']; - $queryConditions = []; - $this->Controller->set('quickFilter', empty($quickFilterFields) ? [] : $quickFilterFields); - if ($this->metaFieldsSupported() && !empty($options['quickFilterForMetaField']['enabled'])) { - $this->Controller->set('quickFilterForMetaField', [ - 'enabled' => $options['quickFilterForMetaField']['enabled'] ?? false, - 'wildcard_search' => $options['quickFilterForMetaField']['enabled'] ?? false, - ]); - } if (!empty($params['quickFilter']) && !empty($quickFilterFields)) { - $this->Controller->set('quickFilterValue', $params['quickFilter']); $queryConditions = $this->genQuickFilterConditions($params, $quickFilterFields); if ($this->metaFieldsSupported() && !empty($options['quickFilterForMetaField']['enabled'])) { @@ -1139,10 +1131,25 @@ class CRUDComponent extends Component } $query->where(['OR' => $queryConditions]); + } + return $query; + } + + public function setQuickFilterForView(array $params, array $options): void + { + $quickFilterFields = $options['quickFilters']; + $this->Controller->set('quickFilter', empty($quickFilterFields) ? [] : $quickFilterFields); + if ($this->metaFieldsSupported() && !empty($options['quickFilterForMetaField']['enabled'])) { + $this->Controller->set('quickFilterForMetaField', [ + 'enabled' => $options['quickFilterForMetaField']['enabled'] ?? false, + 'wildcard_search' => $options['quickFilterForMetaField']['enabled'] ?? false, + ]); + } + if (!empty($params['quickFilter']) && !empty($quickFilterFields)) { + $this->Controller->set('quickFilterValue', $params['quickFilter']); } else { $this->Controller->set('quickFilterValue', ''); } - return $query; } public function genQuickFilterConditions(array $params, array $quickFilterFields): array From 7ce6507e941ca328846dc7dee8cd2f9f4192a849 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Wed, 30 Nov 2022 10:28:47 +0100 Subject: [PATCH 13/60] fix: [user:login] Added support of `redirect` after login --- src/Application.php | 5 +++-- templates/Users/login.php | 2 +- 2 files changed, 4 insertions(+), 3 deletions(-) diff --git a/src/Application.php b/src/Application.php index 0bf89c9..aad0322 100644 --- a/src/Application.php +++ b/src/Application.php @@ -120,8 +120,9 @@ class Application extends BaseApplication implements AuthenticationServiceProvid ])); \SocialConnect\JWX\JWT::$screw = Configure::check('keycloak.screw') ? Configure::read('keycloak.screw') : 0; } - $middlewareQueue->add(new AuthenticationMiddleware($this)) - ->add(new BodyParserMiddleware()); + $middlewareQueue + ->add(new BodyParserMiddleware()) + ->add(new AuthenticationMiddleware($this)); return $middlewareQueue; } diff --git a/templates/Users/login.php b/templates/Users/login.php index 60d6054..f9de87f 100644 --- a/templates/Users/login.php +++ b/templates/Users/login.php @@ -20,7 +20,7 @@ use Cake\Core\Configure; $this->Form->setTemplates($template); if (!Configure::check('password_auth.enabled') || Configure::read('password_auth.enabled')) { echo sprintf('

    %s

    ', __('Sign In')); - echo $this->Form->create(null, ['url' => ['controller' => 'users', 'action' => 'login']]); + echo $this->Form->create(null, ['url' => ['controller' => 'users', 'action' => 'login', '?' => ['redirect' => $this->request->getQuery('redirect')],]]); echo $this->Form->control('username', ['label' => 'Username', 'class' => 'form-control mb-2', 'placeholder' => __('Username')]); echo $this->Form->control('password', ['type' => 'password', 'label' => 'Password', 'class' => 'form-control mb-3', 'placeholder' => __('Password')]); echo $this->Form->control(__('Login'), ['type' => 'submit', 'class' => 'btn btn-primary']); From 97716e3f6aae4e946814036447952f8f048c7811 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Fri, 2 Dec 2022 09:45:26 +0100 Subject: [PATCH 14/60] new: [css:bootstrap-additional] Added table-xs class --- webroot/css/themes/additional/bootstrap-additional.css | 4 ++++ webroot/css/themes/theme-darkly.css | 4 ++++ webroot/css/themes/theme-default.css | 4 ++++ webroot/css/themes/theme-flatly.css | 4 ++++ webroot/css/themes/theme-minty.css | 4 ++++ webroot/css/themes/theme-quartz.css | 4 ++++ webroot/css/themes/theme-slate.css | 4 ++++ webroot/css/themes/theme-vapor.css | 4 ++++ webroot/theme/scss/additional/bootstrap-additional.scss | 4 ++++ 9 files changed, 36 insertions(+) diff --git a/webroot/css/themes/additional/bootstrap-additional.css b/webroot/css/themes/additional/bootstrap-additional.css index 2654c1e..af9a36c 100644 --- a/webroot/css/themes/additional/bootstrap-additional.css +++ b/webroot/css/themes/additional/bootstrap-additional.css @@ -344,6 +344,10 @@ box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.25); } +.table-xs > :not(caption) > * > * { + padding: 0.05rem 0.05rem; +} + /* Utilities */ .mw-75 { max-width: 75% !important; diff --git a/webroot/css/themes/theme-darkly.css b/webroot/css/themes/theme-darkly.css index f0ab02c..34e902b 100644 --- a/webroot/css/themes/theme-darkly.css +++ b/webroot/css/themes/theme-darkly.css @@ -344,6 +344,10 @@ box-shadow: 0 0 0 0.2rem rgba(243, 156, 18, 0.25); } +.table-xs > :not(caption) > * > * { + padding: 0.05rem 0.05rem; +} + /* Utilities */ .mw-75 { max-width: 75% !important; diff --git a/webroot/css/themes/theme-default.css b/webroot/css/themes/theme-default.css index 632df9b..56e4cd5 100644 --- a/webroot/css/themes/theme-default.css +++ b/webroot/css/themes/theme-default.css @@ -344,6 +344,10 @@ box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.25); } +.table-xs > :not(caption) > * > * { + padding: 0.05rem 0.05rem; +} + /* Utilities */ .mw-75 { max-width: 75% !important; diff --git a/webroot/css/themes/theme-flatly.css b/webroot/css/themes/theme-flatly.css index a136080..b0dbfc1 100644 --- a/webroot/css/themes/theme-flatly.css +++ b/webroot/css/themes/theme-flatly.css @@ -344,6 +344,10 @@ box-shadow: 0 0 0 0.2rem rgba(243, 156, 18, 0.25); } +.table-xs > :not(caption) > * > * { + padding: 0.05rem 0.05rem; +} + /* Utilities */ .mw-75 { max-width: 75% !important; diff --git a/webroot/css/themes/theme-minty.css b/webroot/css/themes/theme-minty.css index f118a7d..421f575 100644 --- a/webroot/css/themes/theme-minty.css +++ b/webroot/css/themes/theme-minty.css @@ -344,6 +344,10 @@ box-shadow: 0 0 0 0.2rem rgba(243, 156, 18, 0.25); } +.table-xs > :not(caption) > * > * { + padding: 0.05rem 0.05rem; +} + /* Utilities */ .mw-75 { max-width: 75% !important; diff --git a/webroot/css/themes/theme-quartz.css b/webroot/css/themes/theme-quartz.css index 8853db3..45e7268 100644 --- a/webroot/css/themes/theme-quartz.css +++ b/webroot/css/themes/theme-quartz.css @@ -344,6 +344,10 @@ box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.25); } +.table-xs > :not(caption) > * > * { + padding: 0.05rem 0.05rem; +} + /* Utilities */ .mw-75 { max-width: 75% !important; diff --git a/webroot/css/themes/theme-slate.css b/webroot/css/themes/theme-slate.css index be86d33..cb59b58 100644 --- a/webroot/css/themes/theme-slate.css +++ b/webroot/css/themes/theme-slate.css @@ -344,6 +344,10 @@ box-shadow: 0 0 0 0.2rem rgba(248, 148, 6, 0.25); } +.table-xs > :not(caption) > * > * { + padding: 0.05rem 0.05rem; +} + /* Utilities */ .mw-75 { max-width: 75% !important; diff --git a/webroot/css/themes/theme-vapor.css b/webroot/css/themes/theme-vapor.css index be21737..d44b6ca 100644 --- a/webroot/css/themes/theme-vapor.css +++ b/webroot/css/themes/theme-vapor.css @@ -344,6 +344,10 @@ box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.25); } +.table-xs > :not(caption) > * > * { + padding: 0.05rem 0.05rem; +} + /* Utilities */ .mw-75 { max-width: 75% !important; diff --git a/webroot/theme/scss/additional/bootstrap-additional.scss b/webroot/theme/scss/additional/bootstrap-additional.scss index 6c0675d..339b9fa 100644 --- a/webroot/theme/scss/additional/bootstrap-additional.scss +++ b/webroot/theme/scss/additional/bootstrap-additional.scss @@ -122,6 +122,10 @@ $toast-color-level: 70% !default; } } +.table-xs > :not(caption) > * > * { + padding: 0.05rem 0.05rem; +} + /* Utilities */ // Use bootstrap's utilities API with something like this // $utilities: map-merge( From 48a3c242aaabbfe264004d61998737776785c4c6 Mon Sep 17 00:00:00 2001 From: Sami Mokaddem Date: Fri, 2 Dec 2022 09:46:05 +0100 Subject: [PATCH 15/60] chg: [js:bootstrap-helper] Added support of modal size --- webroot/js/bootstrap-helper.js | 3 +++ 1 file changed, 3 insertions(+) diff --git a/webroot/js/bootstrap-helper.js b/webroot/js/bootstrap-helper.js index 18283cd..c70c7b0 100644 --- a/webroot/js/bootstrap-helper.js +++ b/webroot/js/bootstrap-helper.js @@ -629,6 +629,9 @@ class ModalFactory { } } else { $modalDialog = $('