cerebrate/src/View/Helper/BootstrapElements/BootstrapProgressTimeline.php

153 lines
4.8 KiB
PHP

<?php
namespace App\View\Helper\BootstrapElements;
use App\View\Helper\BootstrapGeneric;
/**
* Creates a progress timeline similar to a form wizard
*
* # Options:
* - variant: The variant of the active part of the timeline
* - variantInactive: The variant of the inactive part of the timeline
* - selected: 0-indexed step number to be selected. Will make all steps before the selected step active
* - steps: The definition of the step. Options are:
* - text: The text of the step
* - icon: The icon of the step. Default to the text number if empty
* - title: A title to be set for the step
*
* # Usage:
* $this->Bootstrap->progressTimeline([
* 'selected' => 1,
* 'steps' => [
* [
* 'text' => __('Step 1'),
* 'icon' => 'star',
* 'title' => __('Title'),
* ],
* [
* 'text' => __('Step 3'),
* 'icon' => 'exchange-alt',
* ]
* ],
* ]);
*/
class BootstrapProgressTimeline extends BootstrapGeneric
{
private $defaultOptions = [
'steps' => [],
'selected' => 0,
'variant' => 'primary',
'variantInactive' => 'secondary',
];
function __construct($options, $btHelper)
{
$this->allowedOptionValues = [
'variant' => BootstrapGeneric::$variants,
'variantInactive' => BootstrapGeneric::$variants,
];
$this->processOptions($options);
$this->btHelper = $btHelper;
}
private function processOptions($options): void
{
$this->options = array_merge($this->defaultOptions, $options);
$this->checkOptionValidity();
}
public function progressTimeline(): string
{
return $this->genProgressTimeline();
}
private function getStepIcon(array $step, int $i, bool $nodeActive, bool $lineActive): string
{
$icon = $this->node('b', [
'class' => [
!empty($step['icon']) ? h($this->btHelper->FontAwesome->getClass($step['icon'])) : '',
$this->getTextClassForVariant($this->options['variant'])
],
], empty($step['icon']) ? h($i + 1) : '');
$containerDefaultClass = [
'd-flex',
'align-items-center',
'justify-content-center',
'rounded-circle',
];
$containerDefaultClass[] = $nodeActive ? "bg-{$this->options['variant']}" : "bg-{$this->options['variantInactive']}";
$iconContainer = $this->node('span', [
'class' => $containerDefaultClass,
'style' => 'width:50px; height:50px'
], $icon);
$li = $this->node('li', [
'class' => [
'd-flex', 'flex-column',
$nodeActive ? 'progress-active' : 'progress-inactive',
],
], $iconContainer);
$html = $li . $this->getHorizontalLine($i, $nodeActive, $lineActive);
return $html;
}
private function getHorizontalLine(int $i, bool $nodeActive, bool $lineActive): string
{
$stepCount = count($this->options['steps']);
if ($i == $stepCount - 1) {
return '';
}
$progressBar = (new BootstrapProgress([
'label' => false,
'value' => $nodeActive ? ($lineActive ? 100 : 50) : 0,
'height' => '2px',
'variant' => $this->options['variant']
]))->progress();
$line = $this->node('span', [
'class' => [
'progress-line',
'flex-grow-1', 'align-self-center',
$lineActive ? "bg-{$this->options['variant']}" : ''
],
], $progressBar);
return $line;
}
private function getStepText(array $step, bool $isActive): string
{
return $this->node('li', [
'class' => [
'text-center',
'fw-bold',
$isActive ? 'progress-active' : 'progress-inactive',
],
], h($step['text'] ?? ''));
}
private function genProgressTimeline(): string
{
$iconLis = '';
$textLis = '';
foreach ($this->options['steps'] as $i => $step) {
$nodeActive = $i <= $this->options['selected'];
$lineActive = $i < $this->options['selected'];
$iconLis .= $this->getStepIcon($step, $i, $nodeActive, $lineActive);
$textLis .= $this->getStepText($step, $nodeActive);
}
$ulIcons = $this->node('ul', [
'class' => [
'd-flex', 'justify-content-around',
],
], $iconLis);
$ulText = $this->node('ul', [
'class' => [
'd-flex', 'justify-content-between',
],
], $textLis);
$html = $this->node('div', [
'class' => ['progress-timeline', 'mw-75', 'mx-auto']
], $ulIcons . $ulText);
return $html;
}
}